Aminobenzoic acids and derivatives
eMolecules 120278-07-1 | 4-Amino-1-carbobenzoxypiperidine | Chem-Impex | MFCD05863884 | 234.299 | C13H18N2O2 | 97.000 | NC1CCN(CC1)C(=O)OCc1ccccc1 | 1g | 650582971
4-Amino-1-carbobenzoxypiperidine | Chem-Impex | 120278-07-1 | MFCD05863884 | 234.299 | C13H18N2O2 | 97.000 | NC1CCN(CC1)C(=O)OCc1ccccc1 | 1g | 650582971
Chemscene Methyl 2-cyclopentanonecarboxylate | 100g | CS-0007582 | 97% | 10472-24-9 | MFCD00001411 | 142 15 | C7H10O3
Chemscene | Methyl 2-cyclopentanonecarboxylate | 100g | CS-0007582 | 97% | 10472-24-9 | MFCD00001411 | 142 15 | C7H10O3
eMolecules 1640-39-7 | 2,3,3-Trimethylindolenine | Chemodex Ltd. | MFCD00005724 | 159.232 | C11H13N | 98.000 | CC1=Nc2ccccc2C1(C)C | 50g | 482922943
2,3,3-Trimethylindolenine | Chemodex Ltd. | 1640-39-7 | MFCD00005724 | 159.232 | C11H13N | 98.000 | CC1=Nc2ccccc2C1(C)C | 50g | 482922943
eMolecules 1143516-05-5 | 8-Amino-3,6-dioxaoctanoic acid dimer | Combi-Blocks, Inc. | MFCD13184942 | 308.331 | C12H24N2O7 | 98.000 | NCCOCCOCC(=O)NCCOCCOCC(O)=O | 100g | 882684340
8-Amino-3,6-dioxaoctanoic acid dimer | Combi-Blocks, Inc. | 1143516-05-5 | MFCD13184942 | 308.331 | C12H24N2O7 | 98.000 | NCCOCCOCC(=O)NCCOCCOCC(O)=O | 100g | 882684340
eMolecules 82417-45-6 | 2,3-Dichlorobenzenesulfonyl chloride | Combi-Blocks | MFCD00051844 | 245.500 | C6H3Cl3O2S | 98.000 | Clc1cccc(c1Cl)S(Cl)(=O)=O | 25g | 205390099
2,3-Dichlorobenzenesulfonyl chloride | Combi-Blocks | 82417-45-6 | MFCD00051844 | 245.500 | C6H3Cl3O2S | 98.000 | Clc1cccc(c1Cl)S(Cl)(=O)=O | 25g | 205390099
eMolecules 351422-73-6 | (3-Carbamoylphenyl)boronic acid | Ambeed | MFCD03411948 | 164.960 | C7H8BNO3 | 97.000 | NC(=O)c1cccc(c1)B(O)O | 100g | 552663102
(3-Carbamoylphenyl)boronic acid | Ambeed | 351422-73-6 | MFCD03411948 | 164.960 | C7H8BNO3 | 97.000 | NC(=O)c1cccc(c1)B(O)O | 100g | 552663102
eMolecules 27492-84-8 | Methyl 4-amino-2-methoxybenzoate | Combi-Blocks | MFCD00017202 | 181.191 | C9H11NO3 | 98.000 | COC(=O)c1ccc(N)cc1OC | 500g | 528668286
Methyl 4-amino-2-methoxybenzoate | Combi-Blocks | 27492-84-8 | MFCD00017202 | 181.191 | C9H11NO3 | 98.000 | COC(=O)c1ccc(N)cc1OC | 500g | 528668286
eMolecules 2646-97-1 | 3-(Trifluoromethyl)aniline hydrochloride | Combi-Blocks, Inc. | MFCD00035492 | 197.590 | C7H7ClF3N | 98.000 | Cl.Nc1cccc(c1)C(F)(F)F | 100g | 703122102
3-(Trifluoromethyl)aniline hydrochloride | Combi-Blocks, Inc. | 2646-97-1 | MFCD00035492 | 197.590 | C7H7ClF3N | 98.000 | Cl.Nc1cccc(c1)C(F)(F)F | 100g | 703122102
NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 487554402](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000224449.jpg-250.jpg)
eMolecules 270596-49-1 | (S)-b-(Fmoc-amino)-2-fluorobenzenebutanoic acid | Acrotein ChemBio Inc. | MFCD01861009 | 419.452 | C25H22FNO4 | 97.000 | OC(=O)C[C@H](Cc1ccccc1F)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 487554402
(S)-b-(Fmoc-amino)-2-fluorobenzenebutanoic acid | Acrotein ChemBio Inc. | 270596-49-1 | MFCD01861009 | 419.452 | C25H22FNO4 | 97.000 | OC(=O)C[C@H](Cc1ccccc1F)NC(=O)OCC1c2ccccc2-c2ccccc12 | 1g | 487554402
eMolecules 93071-75-1 | 3-(Trifluoromethoxy)benzylamine | Combi-Blocks | MFCD00061267 | 191.153 | C8H8F3NO | 97.000 | NCc1cccc(OC(F)(F)F)c1 | 100g | 290687312
3-(Trifluoromethoxy)benzylamine | Combi-Blocks | 93071-75-1 | MFCD00061267 | 191.153 | C8H8F3NO | 97.000 | NCc1cccc(OC(F)(F)F)c1 | 100g | 290687312
eMolecules 7377-03-9 | Octanohydroxamic acid | Chem-Impex | MFCD00143918 | 159.229 | C8H17NO2 | 99.000 | CCCCCCCC(=O)NO | 100g | 490843468
Octanohydroxamic acid | Chem-Impex | 7377-03-9 | MFCD00143918 | 159.229 | C8H17NO2 | 99.000 | CCCCCCCC(=O)NO | 100g | 490843468
eMolecules 328086-60-8 | Paxlovid Intermediate 3 | Ambeed | MFCD28138267 | 286.328 | C13H22N2O5 | 97.000 | COC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)OC(C)(C)C | 25g | 600851863
Paxlovid Intermediate 3 | Ambeed | 328086-60-8 | MFCD28138267 | 286.328 | C13H22N2O5 | 97.000 | COC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)OC(C)(C)C | 25g | 600851863
Cayman Chemical 16 16dimethyl Prostaglandin A
16,16-dimethyl PGA2 is a metabolism resistant analog of PGA2 with a prolonged in vivo half-life. It inhibits the proliferation of Sendai virus in cultured African green monkey kidney cells by >90% at a concentration of 4 UG/ml.{2680} Daily infusion of 10 UG of 16,16-dimethyl PGA2 methyl ester into mice infected with influenza A virus increased survival by 40%.{1136} Similar treatment of mice inoculated with erythroleukemia cells delayed tumor growth and increased survival time.{1184}