Aminotoluenes
eMolecules 29027-20-1 | 3-Chloro-5-methylaniline | MFCD15527197 | 1g
Medchem Express | Elacestrant | 1mg | 415688290 | HY-19822 | 722533-56-4 | MFCD30532693 | 458.646 | C30H38N2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 32890-88-3 | 2,6-Difluoro-3-methylbenzoic acid | Apollo Scientific | MFCD01631332 | 172.131 | C8H6F2O2 | 97.000 | Cc1ccc(F)c(C(O)=O)c1F | 25g | 562450395
2,6-Difluoro-3-methylbenzoic acid | Apollo Scientific | 32890-88-3 | MFCD01631332 | 172.131 | C8H6F2O2 | 97.000 | Cc1ccc(F)c(C(O)=O)c1F | 25g | 562450395
Aobchem 3-Amino-4-methylphenylboronic acid, AOBCHEM USA 10617-5G. 22237-12-3. MFCD01074640
3-Amino-4-methylphenylboronic acid, AOBCHEM USA 10617-5G. 22237-12-3. MFCD01074640
![eMolecules 1818847-41-4 | 7-BROMO-5-(4-METHYLBENZENESULFONYL)-5H-PYRROLO[2,3-B]PYRAZINE | AstaTech | MFCD29060194 | 352.210 | C13H10BrN3O2S | 95.000 | Cc1ccc(cc1)S(=O)(=O)n1cc(Br)c2nccnc12 | 0.25g | 302810612](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502182967.JPG-250.jpg)
eMolecules 1818847-41-4 | 7-BROMO-5-(4-METHYLBENZENESULFONYL)-5H-PYRROLO[2,3-B]PYRAZINE | AstaTech | MFCD29060194 | 352.210 | C13H10BrN3O2S | 95.000 | Cc1ccc(cc1)S(=O)(=O)n1cc(Br)c2nccnc12 | 0.25g | 302810612
7-BROMO-5-(4-METHYLBENZENESULFONYL)-5H-PYRROLO[2,3-B]PYRAZINE | AstaTech | 1818847-41-4 | MFCD29060194 | 352.210 | C13H10BrN3O2S | 95.000 | Cc1ccc(cc1)S(=O)(=O)n1cc(Br)c2nccnc12 | 0.25g | 302810612
eMolecules 39828-37-0 | 2,4-Dihydroxy-5-methylbenzaldehyde | MFCD24673936 | 1g
AstaTech | (R)-4-HYDROXY-NN-DIPHENYLPENT-2-YNAMIDE | 0.25g | 718059654 | F17856 | 95.000 | 899809-61-1 | MFCD28972389 | 265.312 | C17H15NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 124289-21-0 | 3-Bromo-5-methylbenzonitrile | ChemScene | MFCD08061970 | 196.047 | C8H6BrN | 98.000 | Cc1cc(Br)cc(c1)C#N | 5g | 536844996
3-Bromo-5-methylbenzonitrile | ChemScene | 124289-21-0 | MFCD08061970 | 196.047 | C8H6BrN | 98.000 | Cc1cc(Br)cc(c1)C#N | 5g | 536844996
eMolecules 452-84-6 | 2-Fluoro-5-methylaniline | Oakwood Chemical | MFCD00007654 | 125.146 | C7H8FN | 98.000 | Cc1ccc(F)c(N)c1 | 1g | 537679631
2-Fluoro-5-methylaniline | Oakwood Chemical | 452-84-6 | MFCD00007654 | 125.146 | C7H8FN | 98.000 | Cc1ccc(F)c(N)c1 | 1g | 537679631
Ethos Biosciences Toluidine Blue 1%, 4oz, Ethos
Toluidine Blue 1% is a ready-to-use staining solution suitable for histology, cytology, microbiology, and general laboratory applications. Commonly used as a basic dye, it provides strong nuclear and metachromatic staining, allowing clear visualization of cellular and tissue components during microscopic evaluation. The formulation delivers consistent color intensity for reliable slide preparation and reproducible results. Ideal for routine and specialized staining protocols, Toluidine Blue 1% supports accurate cell and tissue morphology assessment.