Aminotoluenes
eMolecules 22383-85-3 | Ambeed | 234-Trimethoxy-6-methylbenzaldehyde | 1g | 600838884 | A374403 | MFCD00016598 | 210.229 | C11H14O4
Pharmablock | 4-bromo-26-dimethyl-pyridine | 25mg | 694125587 | PBT4299 | 5093-70-9 | MFCD00671475 | 186.052 | C7H8BrN
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1094601-66-7 | ChemScene | 3-Methyl-1-(4-methylbenzyl)piperazin-2-one | 100mg | 768992196 | CS-0440818 | MFCD06804003 | 218.3 | C13H18N2O
Medchem Express | FW1256 | 5mg | 518571028 | HY-121955 | 117089-08-4 | 247.250 | C12H10NOPS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 32890-88-3 | 2,6-Difluoro-3-methylbenzoic acid | Apollo Scientific | MFCD01631332 | 172.131 | C8H6F2O2 | 97.000 | Cc1ccc(F)c(C(O)=O)c1F | 25g | 562450395
2,6-Difluoro-3-methylbenzoic acid | Apollo Scientific | 32890-88-3 | MFCD01631332 | 172.131 | C8H6F2O2 | 97.000 | Cc1ccc(F)c(C(O)=O)c1F | 25g | 562450395
eMolecules 57414-85-4 | Ethyl 3-amino-2-methylbenzoate | Apollo Scientific | MFCD00957246 | 179.219 | C10H13NO2 | 95.000 | CCOC(=O)c1cccc(N)c1C | 1g | 562443856
Ethyl 3-amino-2-methylbenzoate | Apollo Scientific | 57414-85-4 | MFCD00957246 | 179.219 | C10H13NO2 | 95.000 | CCOC(=O)c1cccc(N)c1C | 1g | 562443856
Chemscene ChemScene | 2-Amino-4-methylbenzonitrile | 25G | CS-W008109 | 0.98 | 26830-96-6| MFCD00173706 | 132.17
ChemScene | 2-Amino-4-methylbenzonitrile | 25G | CS-W008109 | 0.98 | 26830-96-6| MFCD00173706 | 132.17
![eMolecules 76152-15-3 | Potassium iodo(4-methylbenzensulfonyl)azanide | Synthonix | MFCD30833905 | 335.200 | C7H7IKNO2S | 0.000 | [K+].Cc1ccc(cc1)S(=O)(=O)[N-]I | 1g | 701022484](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502455605.PNG-250.jpg)
eMolecules 76152-15-3 | Potassium iodo(4-methylbenzensulfonyl)azanide | Synthonix | MFCD30833905 | 335.200 | C7H7IKNO2S | 0.000 | [K+].Cc1ccc(cc1)S(=O)(=O)[N-]I | 1g | 701022484
Potassium iodo(4-methylbenzensulfonyl)azanide | Synthonix | 76152-15-3 | MFCD30833905 | 335.200 | C7H7IKNO2S | 0.000 | [K+].Cc1ccc(cc1)S(=O)(=O)[N-]I | 1g | 701022484