Aminotoluenes
Medchemexpress LLC Pyridine, 3-chloro-2-(2-methylpropoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | 1387634-81-2 | 311.62 | 5 G
Pyridine, 3-chloro-2-(2-methylpropoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- is a chemical compound primarily utilized as a drug intermediate in the synthesis of various active compounds. This product, identified by its CAS number 1387634-81-2 and molecular weight of 311.62, demonstrates a purity of 95.0% by NMR. It requires specific storage conditions to maintain its integrity.
- Used as a versatile drug intermediate
- Essential for the synthesis of active pharmaceutical compounds
- High purity of 95.0% (NMR)
- Requires sealed storage at -20°C, protected from moisture and light
- Stable for 6 months at -80°C or 1 month at -20°C when in solvent, under sealed, dry, and dark conditions
eMolecules 133-78-8 | m-Toluidine-4-sulfonic acid | Combi-Blocks | MFCD00035774 | 187.210 | C7H9NO3S | 95.000 | Cc1cc(N)ccc1S(O)(=O)=O | 1g | 528673198
m-Toluidine-4-sulfonic acid | Combi-Blocks | 133-78-8 | MFCD00035774 | 187.210 | C7H9NO3S | 95.000 | Cc1cc(N)ccc1S(O)(=O)=O | 1g | 528673198
eMolecules 55011-44-4 | O-Tolidine sulfone | Combi-Blocks | MFCD00039157 | 274.340 | C14H14N2O2S | 70.000 | Cc1cc2-c3cc(C)c(N)cc3S(=O)(=O)c2cc1N | 1g | 537623743
O-Tolidine sulfone | Combi-Blocks | 55011-44-4 | MFCD00039157 | 274.340 | C14H14N2O2S | 70.000 | Cc1cc2-c3cc(C)c(N)cc3S(=O)(=O)c2cc1N | 1g | 537623743
eMolecules 312619-56-0 | 3-Methylbenzenesulfonic acid hydrate | ChemScene | MFCD00167130 | 190.210 | C7H10O4S | 98.000 | O.Cc1cccc(c1)S(O)(=O)=O | 250mg | 632290268
3-Methylbenzenesulfonic acid hydrate | ChemScene | 312619-56-0 | MFCD00167130 | 190.210 | C7H10O4S | 98.000 | O.Cc1cccc(c1)S(O)(=O)=O | 250mg | 632290268
eMolecules Methylaniline-PEG-alcohol, MW 5,000 | Broadpharm |280.368 | C15H24N2O3 | 95.000 | CN(CCCC(=O)NCCOCCO)c1ccccc1 | 25mg | 672542431
Methylaniline-PEG-alcohol, MW 5,000 | Broadpharm |280.368 | C15H24N2O3 | 95.000 | CN(CCCC(=O)NCCOCCO)c1ccccc1 | 25mg | 672542431
Aobchem 2-Amino-4-bromotoluene, AOBCHEM USA 10629-100G. 39478-78-9. MFCD00800678
2-Amino-4-bromotoluene, AOBCHEM USA 10629-100G. 39478-78-9. MFCD00800678
Accela Chembio Inc 5-amino-2-methylbenzonitrile | 100g | 50670-64-9 | MFCD00017608 | 97+% | Shelf Life: 1620 Days | Light Sensitive/air Sensitive
5-amino-2-methylbenzonitrile | 100g | 50670-64-9 | MFCD00017608 | 97+% | Shelf Life: 1620 Days | Light Sensitive/air Sensitive
eMolecules 160313-69-9 | Ethyl 4-bromo-3-methylbenzoate | MFCD00673007 | 1g
Ambeed | 22-Dimethyl-5-(propan-2-ylidene)-13-dioxane-46-dione | 1g | 600843515 | A580069 | 2231-66-5 | MFCD16038481 | 184.191 | C9H12O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 29289-13-2 | Ambeed | 2-Iodo-4-methylaniline | 1g | 552550863 | A122989 | MFCD03407391 | 233.052 | C7H8IN
Ambeed | Phenyl(3-(trifluoromethyl)phenyl)methanol | 1g | 527436573 | A523067 | 728-80-3 | MFCD00014397 | 252.236 | C14H11F3O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 613-97-8 | N-Ethyl-N-methylaniline | ChemScene | MFCD00009038 | 135.210 | C9H13N | 97.000 | CCN(C)c1ccccc1 | 1g | 632287818
N-Ethyl-N-methylaniline | ChemScene | 613-97-8 | MFCD00009038 | 135.210 | C9H13N | 97.000 | CCN(C)c1ccccc1 | 1g | 632287818
eMolecules 623-08-5 | N-Methyl-p-toluidine | Combi-Blocks | MFCD00025628 | 121.183 | C8H11N | 98.000 | CNc1ccc(C)cc1 | 500g | 335344496
N-Methyl-p-toluidine | Combi-Blocks | 623-08-5 | MFCD00025628 | 121.183 | C8H11N | 98.000 | CNc1ccc(C)cc1 | 500g | 335344496
eMolecules 80948-78-3 | 2,4-Dibromo-3-methylaniline | Oakwood Chemical | MFCD12547774 | 264.948 | C7H7Br2N | 98.000 | Cc1c(Br)ccc(N)c1Br | 1g | 537689667
2,4-Dibromo-3-methylaniline | Oakwood Chemical | 80948-78-3 | MFCD12547774 | 264.948 | C7H7Br2N | 98.000 | Cc1c(Br)ccc(N)c1Br | 1g | 537689667
eMolecules 53982-02-8 | 2-Ethoxy-6-methylaniline | MFCD12170060 | 250mg
Ambeed | 2-Ethoxy-6-methylaniline | 250mg | 600842304 | A521907 | 53982-02-8 | MFCD12170060 | 151.209 | C9H13NO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 304671-77-0 | o-Tolidine dihydrochloride hydrate | Oakwood Chemicals | MFCD00150103 | 303.230 | C14H20Cl2N2O | 96.000 | O.Cl.Cl.Cc1cc(ccc1N)-c1ccc(N)c(C)c1 | 1g | 480150812
o-Tolidine dihydrochloride hydrate | Oakwood Chemicals | 304671-77-0 | MFCD00150103 | 303.230 | C14H20Cl2N2O | 96.000 | O.Cl.Cl.Cc1cc(ccc1N)-c1ccc(N)c(C)c1 | 1g | 480150812