Benzophenones
Medchemexpress LLC Benzophenone | 119-61-9 | MFCD00003076 | 100.0% | 182.22 g/mol | C13H10O | 1mL
Benzophenone is an endogenous metabolite Benzophenone is a photosensitizer that absorbs UV light transfers its energy to DNA and triggers DNA damage Benzophenone can be used as the fragrance enhancer ultraviolet curing agent additive in plastics or the flavor ingredient Benzophenone can also be used in the manufacturing of insecticides agricultural chemicals hypnotics antihistamines and other pharmaceuticals Benzophenone exhibits certain carcinogenicity in mouse/rat models under long term exposure Benzophenone exhibits estrogenic activity[1][2]
eMolecules 887584-91-0 | 3,4-Difluoro-5-hydroxybenzaldehyde | MFCD04972451 | 1g
Ambeed | 3,4-Difluoro-5-hydroxybenzaldehyde | 1g | 490508486 | A138402 | 887584-91-0 | MFCD04972451 | 158.104 | C7H4F2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1013-88-3 | Benzophenone imine | Chem-Impex | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 5g | 112766095
Benzophenone imine | Chem-Impex | 1013-88-3 | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 5g | 112766095
Medchemexpress LLC HY-10418 5mg Medchemexpress, AH 6809 CAS:33458-93-4 Purity:>98%
Medchemexpress, HY-10418 5mg AH 6809 CAS:33458-93-4 Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
Matrix Scientific 4-FLUOROBENZOPHENONE MF C13H9FO MW 200.21 CAS 345-83-5 MDL MFCD00000352 QTY 100 UOM G
4-FLUOROBENZOPHENONE MF C13H9FO MW 200.21 CAS 345-83-5 MDL MFCD00000352 QTY 100 UOM G
eMolecules 1013-88-3 | Benzophenone imine | Chem-Impex | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 100g | 112766097
Benzophenone imine | Chem-Impex | 1013-88-3 | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 100g | 112766097
eMolecules 1013-88-3 | Benzophenone imine | Chem-Impex | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 25g | 112766096
Benzophenone imine | Chem-Impex | 1013-88-3 | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 25g | 112766096
![eMolecules 861533-46-2 | Ambeed | 33-Dihydroxy-[11-biphenyl]-44-dicarboxylic acid | 100mg | 570579679 | A684329 | MFCD24387008 | 274.228 | C14H10O6](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502484928.JPG-250.jpg)
eMolecules 861533-46-2 | Ambeed | 33-Dihydroxy-[11-biphenyl]-44-dicarboxylic acid | 100mg | 570579679 | A684329 | MFCD24387008 | 274.228 | C14H10O6
Ambeed | 33-Dihydroxy-[11-biphenyl]-44-dicarboxylic acid | 100mg | 570579679 | A684329 | 861533-46-2 | MFCD24387008 | 274.228 | C14H10O6
eMolecules 2092-49-1 | 6,6'-dihydroxy-5,5'-dimethoxybiphenyl-3,3'-dicarbaldehyde | MFCD00156888 | 100mg
Pharmablock | ethyl 4-hydroxy-2-oxo-12-dihydroquinoline-3-carboxylate | 50mg | 551058348 | PB00665 | 40059-53-8 | MFCD00218345 | 233.223 | C12H11NO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 301818-69-9 | 5,6-Dihydroxy-2-phenyl-1-benzothiophen-3(2H)-one 1,1-dioxide | Oakwood Chemical | MFCD00966891 | 290.290 | C14H10O5S | 97.000 | Oc1cc2C(=O)C(c3ccccc3)S(=O)(=O)c2cc1O | 100mg | 537713228
5,6-Dihydroxy-2-phenyl-1-benzothiophen-3(2H)-one 1,1-dioxide | Oakwood Chemical | 301818-69-9 | MFCD00966891 | 290.290 | C14H10O5S | 97.000 | Oc1cc2C(=O)C(c3ccccc3)S(=O)(=O)c2cc1O | 100mg | 537713228
Accela Chembio Inc 2-amino-5-chloro-2'-fluorobenzophenone | 25g | 784-38-3 | MFCD00038381 | 97+% | Shelf Life: 1260 Days | Light Sensitive/+4
2-amino-5-chloro-2'-fluorobenzophenone | 25g | 784-38-3 | MFCD00038381 | 97+% | Shelf Life: 1260 Days | Light Sensitive/+4