Benzophenones
Aobchem 2 2 -Dimethoxybenzophenone | ≥95% | CAS 13102-33-5 | C15H14O3 | 1g
2 2 -Dimethoxybenzophenone | ≥95% | CAS 13102-33-5 | C15H14O3 | 1g
Aobchem 2-Bromobenzophenone | ≥95% | CAS 13047-06-8 | C13H9BrO | 25g
2-Bromobenzophenone | ≥95% | CAS 13047-06-8 | C13H9BrO | 25g
Aobchem 2-Methoxybenzophenone | ≥95% | CAS 2553-04-0 | C14H12O2 | 1g
2-Methoxybenzophenone | ≥95% | CAS 2553-04-0 | C14H12O2 | 1g
Aobchem 2 5-Difluorobenzophenone | ≥97% | CAS 85068-35-5 | C13H8F2O | 10g
2 5-Difluorobenzophenone | ≥97% | CAS 85068-35-5 | C13H8F2O | 10g
Aobchem 2-Methoxybenzophenone | ≥95% | CAS 2553-04-0 | C14H12O2 | 5g
2-Methoxybenzophenone | ≥95% | CAS 2553-04-0 | C14H12O2 | 5g
Aobchem 3 3 -Dimethylbenzophenone | ≥97% | CAS 2852-68-8 | C15H14O | 1g
3 3 -Dimethylbenzophenone | ≥97% | CAS 2852-68-8 | C15H14O | 1g
eMolecules 54118-76-2 | 3-Bromo-4'-methoxybenzophenone | Apollo Scientific | MFCD01311588 | 291.144 | C14H11BrO2 | 95.000 | COc1ccc(cc1)C(=O)c1cccc(Br)c1 | 1g | 562442157
3-Bromo-4'-methoxybenzophenone | Apollo Scientific | 54118-76-2 | MFCD01311588 | 291.144 | C14H11BrO2 | 95.000 | COc1ccc(cc1)C(=O)c1cccc(Br)c1 | 1g | 562442157
eMolecules 1221485-83-1 | Medchem Express | Skepinone-L | 5mg | 446265396 | HY-15300 | MFCD22572738 | 425.432 | C24H21F2NO4
ChemScene | 1-Ethyl-5-(4455-tetramethyl-132-dioxaborolan-2-yl)pyridin-2(1H)-one | 100mg | 632281151 | CS-0135354 | 1349734-00-4 | MFCD27959317 | 249.120 | C13H20BNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Medchemexpress LLC HY-10418 5mg Medchemexpress, AH 6809 CAS:33458-93-4 Purity:>98%
Medchemexpress, HY-10418 5mg AH 6809 CAS:33458-93-4 Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
eMolecules 196808-24-9 | Medchem Express | GW1929 | 5mg | 446266260 | HY-15655 | MFCD04040003 | 495.579 | C30H29N3O4
Medchem Express | Cirsiliol | 5mg | 719835628 | HY-110399 | 34334-69-5 | MFCD00210577 | 330.292 | C17H14O7
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Matrix Scientific 4-FLUOROBENZOPHENONE MF C13H9FO MW 200.21 CAS 345-83-5 MDL MFCD00000352 QTY 100 UOM G
4-FLUOROBENZOPHENONE MF C13H9FO MW 200.21 CAS 345-83-5 MDL MFCD00000352 QTY 100 UOM G
eMolecules 1013-88-3 | Benzophenone imine | Chem-Impex | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 100g | 112766097
Benzophenone imine | Chem-Impex | 1013-88-3 | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 100g | 112766097
eMolecules 1013-88-3 | Benzophenone imine | Chem-Impex | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 25g | 112766096
Benzophenone imine | Chem-Impex | 1013-88-3 | MFCD00001760 | 181.238 | C13H11N | 99.000 | N=C(c1ccccc1)c1ccccc1 | 25g | 112766096
eMolecules 22679-54-5 | 4-tert-Butylbenzophenone | MFCD00017255 | 5g
Medchem Express | Prinaberel | 10mg | 446264801 | HY-14933 | 524684-52-4 | MFCD09954141 | 271.247 | C15H10FNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 334998-36-6 | Medchem Express | CUR61414 | 5mg | 752822700 | HY-113965 | MFCD20275055 | 550.7 | C31H42N4O5
Medchem Express | M1002 | 5mg | 721611237 | HY-139287 | 823830-85-9 | MFCD05999002 | 394.290 | C15H8F6N2O2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool