Diphenylethers
Sigma Aldrich Fine Chemicals Biosciences Diphenyl ether >=99%, FG | 101-84-8 | MFCD00003034 | 25KG
Diphenyl ether >=99%, FG | Purity: >=99% | Mol Wt: 170.21 | 101-84-8 | MFCD00003034 | 25KG
eMolecules 79124-75-7 | 3-(4-Methylphenoxy)-benzaldehyde | Oakwood Chemical | MFCD00003360 | 212.248 | C14H12O2 | 97.000 | Cc1ccc(Oc2cccc(C=O)c2)cc1 | 1g | 537709807
3-(4-Methylphenoxy)-benzaldehyde | Oakwood Chemical | 79124-75-7 | MFCD00003360 | 212.248 | C14H12O2 | 97.000 | Cc1ccc(Oc2cccc(C=O)c2)cc1 | 1g | 537709807
eMolecules 330792-70-6 | Ambeed | 3-Amino-5-(4-phenoxyphenyl)pyrazole-4-carbonitrile | 5g | 570996070 | A464244 | MFCD20270361 | 276.299 | C16H12N4O
Ambeed | Methyl 4-methylbenzenesulfonate | 500g | 525099967 | A182547 | 80-48-8 | MFCD00008417 | 186.230 | C8H10O3S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Matrix Scientific 2-PHENOXYBENZENECARBALDEHYD-1G
2-Phenoxybenzenecarbaldehyde, 1g,C13H10O2, MFCD00800666, mw 198.22, [19434-34-5]
Medchemexpress LLC Cresyl diphenyl phosphate | 26444-49-5 | MFCD00014920 | 97.0% | 340.31 g/mol | C19H17O4P | 50 G
Cresyl diphenyl phosphate is an organophosphate research reagent used in biochemical assays and studies of lipid metabolism. It is supplied as a high-purity solid suitable for laboratory use, with reported molecular formula C19H17O4P and molecular weight 340.31 g/mol. The compound is commonly employed in in vitro and in vivo studies examining lipid homeostasis and related pathways.
- High purity: 97.0%.
- Molecular formula: C19H17O4P.
- Molecular weight: 340.31 g/mol.
- Used in biochemical assays and lipid metabolism research.
- Available in laboratory-scale pack sizes for research use.
eMolecules 1170147-57-5 | 4-(2-CHLOROPHENOXY)BENZYLAMINE HCL | AstaTech | MFCD03840156 | 270.150 | C13H13Cl2NO | 95.000 | Cl.NCc1ccc(Oc2ccccc2Cl)cc1 | 1g | 112531284
4-(2-CHLOROPHENOXY)BENZYLAMINE HCL | AstaTech | 1170147-57-5 | MFCD03840156 | 270.150 | C13H13Cl2NO | 95.000 | Cl.NCc1ccc(Oc2ccccc2Cl)cc1 | 1g | 112531284
eMolecules 66000-40-6 | Medchem Express | BW 755C | 5mg | 791206330 | HY-119671 | MFCD01038078 | 229.206 | C10H10F3N3
Medchem Express | BW 755C | 5mg | 791206330 | HY-119671 | 66000-40-6 | MFCD01038078 | 229.206 | C10H10F3N3
Chem-Impex International, Inc. 4-Phenoxybenzaldehyde | MFCD00003383 | 1G
4-Phenoxybenzaldehyde, MFCD00003383, 1G
Chem-Impex International, Inc. 4-Phenoxybenzoic acid | 2215-77-2 | MFCD00002539 | 25G
4-Phenoxybenzoic acid, 2215-77-2, MFCD00002539, 25G
Chem-Impex International, Inc. 4-Phenoxybenzoic acid | 2215-77-2 | MFCD00002539 | 5G
4-Phenoxybenzoic acid, 2215-77-2, MFCD00002539, 5G
=O | 1g | 117533505](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502190452.JPG-250.jpg)
eMolecules 1038700-63-8 | N-Methyl-2-(2-nitrophenoxy)ethanamine | Combi-Blocks | MFCD11053870 | 196.206 | C9H12N2O3 | 98.000 | CNCCOc1ccccc1[N+]([O-])=O | 1g | 117533505
N-Methyl-2-(2-nitrophenoxy)ethanamine | Combi-Blocks | 1038700-63-8 | MFCD11053870 | 196.206 | C9H12N2O3 | 98.000 | CNCCOc1ccccc1[N+]([O-])=O | 1g | 117533505
eMolecules 70958-20-2 | 2-(5-Chloro-2-phenoxyphenyl)acetic acid | Combi-Blocks | MFCD07368830 | 262.690 | C14H11ClO3 | 98.000 | OC(=O)Cc1cc(Cl)ccc1Oc1ccccc1 | 25g | 335357203
2-(5-Chloro-2-phenoxyphenyl)acetic acid | Combi-Blocks | 70958-20-2 | MFCD07368830 | 262.690 | C14H11ClO3 | 98.000 | OC(=O)Cc1cc(Cl)ccc1Oc1ccccc1 | 25g | 335357203
eMolecules 110231-30-6 | Diphenyl-1-pyrenylphosphine | Ambeed | MFCD00278755 | 386.434 | C28H19P | 95.000 | c1ccc(cc1)P(c1ccccc1)c1ccc2ccc3cccc4ccc1c2c34 | 5g | 517261637
Diphenyl-1-pyrenylphosphine | Ambeed | 110231-30-6 | MFCD00278755 | 386.434 | C28H19P | 95.000 | c1ccc(cc1)P(c1ccccc1)c1ccc2ccc3cccc4ccc1c2c34 | 5g | 517261637