Diphenylethers
eMolecules 1002557-25-6 | 2-(4-FLUOROPHENOXY)BENZYLAMINE HCL | AstaTech | MFCD03840020 | 253.700 | C13H13ClFNO | 95.000 | Cl.NCc1ccccc1Oc1ccc(F)cc1 | 1g | 112530811
2-(4-FLUOROPHENOXY)BENZYLAMINE HCL | AstaTech | 1002557-25-6 | MFCD03840020 | 253.700 | C13H13ClFNO | 95.000 | Cl.NCc1ccccc1Oc1ccc(F)cc1 | 1g | 112530811
eMolecules 1464091-46-0 | TERT-BUTYL 3-(3-NITROPHENOXY)PIPERIDINE-1-CARBOXYLATE | MFCD09953095 | 1g
Ambeed | 2-Bromo-6-nitrobenzaldehyde | 100mg | 521438257 | A354082 | 20357-21-5 | MFCD09040530 | 230.017 | C7H4BrNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Cambridge Isotope Laboratories Bromkal 70-5 diphenyl ether (unlabeled) 50 ug/mL in methanol 1 2 mL
Bromkal 70-5 diphenyl ether (unlabeled) 50 ug/mL in methanol 1 2 mL
![eMolecules 50508-33-3 | 4-[(4-Nitrophenoxy)acetyl]morpholine | MFCD01207102 | 25g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502186415.JPG-250.jpg)
eMolecules 50508-33-3 | 4-[(4-Nitrophenoxy)acetyl]morpholine | MFCD01207102 | 25g
Combi-Blocks | 4-[(4-Nitrophenoxy)acetyl]morpholine | 25g | 457918736 | QZ-2092 | 98.000 | 50508-33-3 | MFCD01207102 | 266.253 | C12H14N2O5
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1185096-94-9 | 3-(4-FLUOROPHENOXY)BENZYLAMINE HCL | AstaTech | MFCD03840099 | 253.700 | C13H13ClFNO | 95.000 | Cl.NCc1cccc(Oc2ccc(F)cc2)c1 | 1g | 112531068
3-(4-FLUOROPHENOXY)BENZYLAMINE HCL | AstaTech | 1185096-94-9 | MFCD03840099 | 253.700 | C13H13ClFNO | 95.000 | Cl.NCc1cccc(Oc2ccc(F)cc2)c1 | 1g | 112531068
eMolecules 1170147-57-5 | 4-(2-CHLOROPHENOXY)BENZYLAMINE HCL | AstaTech | MFCD03840156 | 270.150 | C13H13Cl2NO | 95.000 | Cl.NCc1ccc(Oc2ccccc2Cl)cc1 | 1g | 112531284
4-(2-CHLOROPHENOXY)BENZYLAMINE HCL | AstaTech | 1170147-57-5 | MFCD03840156 | 270.150 | C13H13Cl2NO | 95.000 | Cl.NCc1ccc(Oc2ccccc2Cl)cc1 | 1g | 112531284
Cambridge Isotope Laboratories Polybrominated Diphenyl Ether Surrogate Spiking Stock (10X) Solution (13C12 99%) 0 5 mL
Polybrominated Diphenyl Ether Surrogate Spiking Stock (10X) Solution (13C12 99%) 0 5 mL
eMolecules 51632-16-7 | Ambeed | 1-(Bromomethyl)-3-phenoxybenzene | 250mg | 525015131 | A118387 | MFCD01761658 | 263.134 | C13H11BrO
Ambeed | 1-(Bromomethyl)-3-phenoxybenzene | 250mg | 525015131 | A118387 | 51632-16-7 | MFCD01761658 | 263.134 | C13H11BrO
![eMolecules 318239-67-7 | [5-(4-Chlorophenoxy)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanol | Oakwood Chemicals | MFCD00172650 | 306.670 | C12H10ClF3N2O2 | 0.000 | Cn1nc(c(CO)c1Oc1ccc(Cl)cc1)C(F)(F)F | 100mg | 480109460](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502179411.JPG-250.jpg)
eMolecules 318239-67-7 | [5-(4-Chlorophenoxy)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanol | Oakwood Chemicals | MFCD00172650 | 306.670 | C12H10ClF3N2O2 | 0.000 | Cn1nc(c(CO)c1Oc1ccc(Cl)cc1)C(F)(F)F | 100mg | 480109460
[5-(4-Chlorophenoxy)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanol | Oakwood Chemicals | 318239-67-7 | MFCD00172650 | 306.670 | C12H10ClF3N2O2 | 0.000 | Cn1nc(c(CO)c1Oc1ccc(Cl)cc1)C(F)(F)F | 100mg | 480109460
Cambridge Isotope Laboratories Polybrominated Diphenyl Ether PAR Solution (unlabeled) (7 5X solution Of EO-5113-0) 0 5 mL
Polybrominated Diphenyl Ether PAR Solution (unlabeled) (7 5X solution Of EO-5113-0) 0 5 mL
Accela Chembio Inc 4-phenoxybenzaldehyde | 25g | 67-36-7 | MFCD00003383 | 97+% | D: 1.132 | Shelf Life: 900 Days | Light Sensitive/air Sensitive
4-phenoxybenzaldehyde | 25g | 67-36-7 | MFCD00003383 | 97+% | D: 1.132 | Shelf Life: 900 Days | Light Sensitive/air Sensitive
eMolecules 1019366-58-5 | 4-(2-AMINOPHENOXY)BENZAMIDE | AstaTech | MFCD11133123 | 228.251 | C13H12N2O2 | 95.000 | NC(=O)c1ccc(Oc2ccccc2N)cc1 | 1g | 436052181
4-(2-AMINOPHENOXY)BENZAMIDE | AstaTech | 1019366-58-5 | MFCD11133123 | 228.251 | C13H12N2O2 | 95.000 | NC(=O)c1ccc(Oc2ccccc2N)cc1 | 1g | 436052181