Nitrobenzoic acids and derivatives
Accela Chembio Inc 5-methoxy-2-nitrobenzoic Acid | 100g | 1882-69-5 | MFCD00151836 | 97+% | Shelf Life: 1080 Days | Regular
5-methoxy-2-nitrobenzoic Acid | 100g | 1882-69-5 | MFCD00151836 | 97+% | Shelf Life: 1080 Days | Regular
Medchemexpress LLC 1-isopropyl-4-nitrobenzene-d4 | 1219803-36-7 | 98.2% | 169.21 | C9H7D4NO2 | 10 MG
1-Isopropyl-4-nitrobenzene-d4 is the deuterium-labeled analog of 1-isopropyl-4-nitrobenzene supplied as an isotope-labeled standard for research and analytical applications. It is intended for use as a tracer or internal standard in quantitative studies, method development, and pharmacokinetic investigations. The compound has formula C9H7D4NO2, molecular weight 169.21, and is provided at high purity.
Accela Chembio Inc 2-fluoro-5-nitrobenzoic Acid | 100g | 7304-32-7 | MFCD00134238 | 97+% | Shelf Life: 1260 Days | Regular
2-fluoro-5-nitrobenzoic Acid | 100g | 7304-32-7 | MFCD00134238 | 97+% | Shelf Life: 1260 Days | Regular
![eMolecules 4-Nitrophthalic anhydride | Combi-Blocks | 5466-84-2 | MFCD00005922 | 193.114 | C8H3NO5 | 98.000 | [O-][N+](=O)c1ccc2C(=O)OC(=O)c2c1 | 25g | 205401616](https://assets.fishersci.com/TFS-Assets/CCG/product-images/NC1845698.jpg-250.jpg)
eMolecules 4-Nitrophthalic anhydride | Combi-Blocks | 5466-84-2 | MFCD00005922 | 193.114 | C8H3NO5 | 98.000 | [O-][N+](=O)c1ccc2C(=O)OC(=O)c2c1 | 25g | 205401616
4-Nitrophthalic anhydride | Combi-Blocks | 5466-84-2 | MFCD00005922 | 193.114 | C8H3NO5 | 98.000 | [O-][N+](=O)c1ccc2C(=O)OC(=O)c2c1 | 25g | 205401616
eMolecules dimethyl 4-amino-3-nitrobenzene-1,2-dioate | | MFCD14585237 | 1g
Broadpharm | dimethyl 4-amino-3-nitrobenzene-1,2-dioate | 1g | 112545200 | BP-11552 | | | MFCD14585237 | 254.198 | C10H10N2O6
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Medchemexpress LLC 3-nitrobenzoic acid | 121-92-6 | MFCD00007251 | 99.2% | 167.12 g/mol | C7H5NO4 | 500g
3-Nitrobenzoic acid (m-Carboxynitrobenzene m-Nitrobenzenecarboxylic acid m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols[1][2]
Medchemexpress LLC 3-nitrobenzoic acid | 121-92-6 | MFCD00007251 | 99.2% | 167.12 g/mol | C7H5NO4 | 250g
3-Nitrobenzoic acid (m-Carboxynitrobenzene m-Nitrobenzenecarboxylic acid m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols[1][2]
Medchemexpress LLC 3-nitrophthalic acid | 603-11-2 | MFCD00007138 | 100.0% | 211.13 | C8H5NO6 | 1kg
3-Nitrophthalic acid (m-Nitrophthalic acid o-Nitrophthalic acid) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1]
Medchemexpress LLC 4-Chloro-3-nitrobenzoic acid | 96-99-1 | 99.4% | 201.56 | 100 G
4-Chloro-3-nitrobenzoic acid is a chemical compound with oral activity. Oral administration of this compound can influence the synthesis of liver proteins and the activities of specific enzymes like urokinase and histidine kinase. It is intended for research purposes only.
- Has oral activity
- Affects synthesis of liver proteins
- Influences urokinase activity
- Impacts histidine kinase activity
- For research use only
Medchemexpress LLC 3-nitrophthalic acid | 603-11-2 | MFCD00007138 | 100.0% | 211.13 | C8H5NO6 | 500g
3-Nitrophthalic acid (m-Nitrophthalic acid o-Nitrophthalic acid) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1]