Nitrobenzoic acids and derivatives
=O | 500g | 575774587](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000490677.jpg-250.jpg)
eMolecules 453-71-4 | 4-Fluoro-3-nitrobenzoic acid | Ambeed | MFCD00007058 | 185.110 | C7H4FNO4 | 98.000 | OC(=O)c1ccc(F)c(c1)[N+]([O-])=O | 500g | 575774587
4-Fluoro-3-nitrobenzoic acid | Ambeed | 453-71-4 | MFCD00007058 | 185.110 | C7H4FNO4 | 98.000 | OC(=O)c1ccc(F)c(c1)[N+]([O-])=O | 500g | 575774587
Medchemexpress LLC Benzoic acid, 2-amino-5-nitro- | 616-79-5 | MFCD00017039 | 25g
2-Amino-5-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research
Medchemexpress LLC 2-nitrobenzoic acid | 552-16-9 | MFCD00007137 | 100.0% | 167.12 g·mol⁻¹ | C7H5NO4 | 250g
2-Nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research
eMolecules 1-(Methoxymethyl)-3-nitrobenzene | 1515-84-0 | MFCD18070994 | 1g
Oakwood Chemical | 1-(Methoxymethyl)-3-nitrobenzene | 1g | 537708751 | 102051 | | 1515-84-0 | MFCD18070994 | 167.164 | C8H9NO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Sigma Aldrich Fine Chemicals Biosciences Phosphatase Acid from pota
Acid phosphatase from potato is a phosphomonoesterase which can appear in multiple molecular forms of similar molecular mass but with different isoelectric points.
Chemscene ChemScene | 4-Iodo-3-nitrobenzoic acid | 10G | CS-W002638 | 0.98 | 35674-27-2| MFCD00502399 | 293.016
ChemScene | 4-Iodo-3-nitrobenzoic acid | 10G | CS-W002638 | 0.98 | 35674-27-2| MFCD00502399 | 293.016
Medchemexpress LLC 2-amino-3-nitrobenzoic acid | 606-18-8 | MFCD00024261 | 5g
2-Amino-3-nitrobenzoic acid is a peroxide with antiviral activity