Nitrotoluenes
![eMolecules 349-04-2 | 4-Chloro-3-nitrobenzenesulfonyl fluoride | Combi-Blocks | MFCD00024857 | 239.600 | C6H3ClFNO4S | 98.000 | [O-][N+](=O)c1cc(ccc1Cl)S(F)(=O)=O | 5g | 232309048](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00128114-232309048.PNG-250.jpg)
eMolecules 349-04-2 | 4-Chloro-3-nitrobenzenesulfonyl fluoride | Combi-Blocks | MFCD00024857 | 239.600 | C6H3ClFNO4S | 98.000 | [O-][N+](=O)c1cc(ccc1Cl)S(F)(=O)=O | 5g | 232309048
4-Chloro-3-nitrobenzenesulfonyl fluoride | Combi-Blocks | 349-04-2 | MFCD00024857 | 239.600 | C6H3ClFNO4S | 98.000 | [O-][N+](=O)c1cc(ccc1Cl)S(F)(=O)=O | 5g | 232309048
![eMolecules 349-04-2 | 4-Chloro-3-nitrobenzenesulfonyl fluoride | Combi-Blocks | MFCD00024857 | 239.600 | C6H3ClFNO4S | 98.000 | [O-][N+](=O)c1cc(ccc1Cl)S(F)(=O)=O | 1g | 232309046](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00128114-232309046.PNG-250.jpg)
eMolecules 349-04-2 | 4-Chloro-3-nitrobenzenesulfonyl fluoride | Combi-Blocks | MFCD00024857 | 239.600 | C6H3ClFNO4S | 98.000 | [O-][N+](=O)c1cc(ccc1Cl)S(F)(=O)=O | 1g | 232309046
4-Chloro-3-nitrobenzenesulfonyl fluoride | Combi-Blocks | 349-04-2 | MFCD00024857 | 239.600 | C6H3ClFNO4S | 98.000 | [O-][N+](=O)c1cc(ccc1Cl)S(F)(=O)=O | 1g | 232309046
Accela Chembio Inc 2-bromo-3-nitrotoluene | 5g | 41085-43-2 | MFCD00134555 | 95+% | D: 0.803 | Shelf Life: 1080 Days | Light Sensitive/+4
2-bromo-3-nitrotoluene | 5g | 41085-43-2 | MFCD00134555 | 95+% | D: 0.803 | Shelf Life: 1080 Days | Light Sensitive/+4
Accela Chembio Inc 2-bromo-6-nitrotoluene | 25g | 55289-35-5 | MFCD00009792 | 98% | Shelf Life: 1260 Days | Light Sensitive
2-bromo-6-nitrotoluene | 25g | 55289-35-5 | MFCD00009792 | 98% | Shelf Life: 1260 Days | Light Sensitive
eMolecules 63365-23-1 | 2-AMINO-6-NITROBENZONITRILE | MFCD08236739 | 1g
AstaTech | 2-AMINO-6-NITROBENZONITRILE | 1g | 349265900 | 95625 | 95.000 | 63365-23-1 | MFCD08236739 | 163.136 | C7H5N3O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
=O | 1g | 537688460](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502142217.JPG-250.jpg)
eMolecules 78831-78-4 | 3,5-Dibromo-4-nitrotoluene | Oakwood Chemical | MFCD11846027 | 294.930 | C7H5Br2NO2 | 0.000 | Cc1cc(Br)c(c(Br)c1)[N+]([O-])=O | 1g | 537688460
3,5-Dibromo-4-nitrotoluene | Oakwood Chemical | 78831-78-4 | MFCD11846027 | 294.930 | C7H5Br2NO2 | 0.000 | Cc1cc(Br)c(c(Br)c1)[N+]([O-])=O | 1g | 537688460
=O | 25g | 386901189](https://assets.fishersci.com/TFS-Assets/CCG/product-images/501717454.jpg-250.jpg)
eMolecules 99-52-5 | 2-Methyl-4-nitroaniline | Chem-Impex | MFCD00007734 | 152.153 | C7H8N2O2 | 99.000 | Cc1cc(ccc1N)[N+]([O-])=O | 25g | 386901189
2-Methyl-4-nitroaniline | Chem-Impex | 99-52-5 | MFCD00007734 | 152.153 | C7H8N2O2 | 99.000 | Cc1cc(ccc1N)[N+]([O-])=O | 25g | 386901189
Accela Chembio Inc 2-fluoro-3-nitrotoluene | 25g | 437-86-5 | MFCD03412242 | 98% | D: 1.28 | Shelf Life: 2340 Days | Regular
2-fluoro-3-nitrotoluene | 25g | 437-86-5 | MFCD03412242 | 98% | D: 1.28 | Shelf Life: 2340 Days | Regular
Accela Chembio Inc 2-fluoro-3-nitrotoluene | 100g | 437-86-5 | MFCD03412242 | 98% | D: 1.28 | Shelf Life: 2340 Days | Regular
2-fluoro-3-nitrotoluene | 100g | 437-86-5 | MFCD03412242 | 98% | D: 1.28 | Shelf Life: 2340 Days | Regular
Accela Chembio Inc 2 | 5-difluoro-4-nitrotoluene | 25g | 141412-60-4 | MFCD06200905 | 97+% | Shelf Life: 1260 Days | Light Sensitive
2 | 5-difluoro-4-nitrotoluene | 25g | 141412-60-4 | MFCD06200905 | 97+% | Shelf Life: 1260 Days | Light Sensitive
Accela Chembio Inc 2-chloro-4-fluoro-5-nitrotoluene | 5g | 112108-73-3 | MFCD11110549 | 97+% | Shelf Life: 1260 Days | Light Sensitive/+4
2-chloro-4-fluoro-5-nitrotoluene | 5g | 112108-73-3 | MFCD11110549 | 97+% | Shelf Life: 1260 Days | Light Sensitive/+4
=O | 1g | 381448031](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502486405.JPG-250.jpg)
eMolecules 1093758-82-7 | 2,5-DIFLUORO-3-NITROTOLUENE | AstaTech | MFCD11519028 | 173.119 | C7H5F2NO2 | 97.000 | Cc1cc(F)cc(c1F)[N+]([O-])=O | 1g | 381448031
2,5-DIFLUORO-3-NITROTOLUENE | AstaTech | 1093758-82-7 | MFCD11519028 | 173.119 | C7H5F2NO2 | 97.000 | Cc1cc(F)cc(c1F)[N+]([O-])=O | 1g | 381448031