Terphenyls
eMolecules 1762-84-1 | 4-Bromo-p-terphenyl | MFCD02685117 | 1g
Ambeed | (2R3R4S5R6R)-2-(Allyloxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-345-triol | 100mg | 660581246 | A208013 | 2595-07-5 | MFCD08274511 | 220.221 | C9H16O6
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1762-84-1 | 4-BROMO-P-TERPHENYL | AA Blocks LLC | MFCD02685117 | 309.206 | C18H13Br | 0.000 | Brc1ccc(cc1)-c1ccc(cc1)-c1ccccc1 | 25g | 410156856
4-BROMO-P-TERPHENYL | AA Blocks LLC | 1762-84-1 | MFCD02685117 | 309.206 | C18H13Br | 0.000 | Brc1ccc(cc1)-c1ccc(cc1)-c1ccccc1 | 25g | 410156856
eMolecules 172100-44-6 | 5,5'-Dibromo-4,4'-dinonyl-2,2'-bithiazole | Ambeed | MFCD27923056 | 578.510 | C24H38Br2N2S2 | 97.000 | CCCCCCCCCc1nc(sc1Br)-c1nc(CCCCCCCCC)c(Br)s1 | 50mg | 632809845
5,5'-Dibromo-4,4'-dinonyl-2,2'-bithiazole | Ambeed | 172100-44-6 | MFCD27923056 | 578.510 | C24H38Br2N2S2 | 97.000 | CCCCCCCCCc1nc(sc1Br)-c1nc(CCCCCCCCC)c(Br)s1 | 50mg | 632809845
![eMolecules 1542274-12-3 | Ambeed | [1141-Terphenyl]-233555-hexacarboxylic acid | 250mg | 586456744 | A662475 | 494.364 | C24H14O12](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502484411.JPG-250.jpg)
eMolecules 1542274-12-3 | Ambeed | [1141-Terphenyl]-233555-hexacarboxylic acid | 250mg | 586456744 | A662475 | 494.364 | C24H14O12
Ambeed | 2-(4-Fluorophenyl)-4455-tetramethyl-132-dioxaborolane | 5g | 525081770 | A165629 | 214360-58-4 | MFCD03453665 | 222.070 | C12H16BFO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 51751-44-1 | 3,3'-Dibromo-2,2'-bithiophene | Ambeed | MFCD00114806 | 324.050 | C8H4Br2S2 | 98.000 | Brc1ccsc1-c1sccc1Br | 100mg | 521433642
3,3'-Dibromo-2,2'-bithiophene | Ambeed | 51751-44-1 | MFCD00114806 | 324.050 | C8H4Br2S2 | 98.000 | Brc1ccsc1-c1sccc1Br | 100mg | 521433642
eMolecules 202982-77-2 | 4,5-DIBROMO-2-FLUOROTOLUENE | MFCD00143234 | 25g
Ambeed | 24-Difluoro-6-nitrophenol | 250mg | 552612350 | A170407 | 364-31-8 | MFCD03094186 | 175.091 | C6H3F2NO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 79538-03-7 | 2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol | Oakwood Chemical | MFCD03093260 | 194.129 | C8H6F4O | 95.000 | Cc1c(F)c(F)c(CO)c(F)c1F | 1g | 537695080
2,3,5,6-Tetrafluoro-4-methylbenzyl alcohol | Oakwood Chemical | 79538-03-7 | MFCD03093260 | 194.129 | C8H6F4O | 95.000 | Cc1c(F)c(F)c(CO)c(F)c1F | 1g | 537695080
eMolecules 1762-84-1 | 4-Bromo-p-terphenyl | Ambeed | MFCD02685117 | 309.206 | C18H13Br | 98.000 | Brc1ccc(cc1)-c1ccc(cc1)-c1ccccc1 | 5g | 490550911
4-Bromo-p-terphenyl | Ambeed | 1762-84-1 | MFCD02685117 | 309.206 | C18H13Br | 98.000 | Brc1ccc(cc1)-c1ccc(cc1)-c1ccccc1 | 5g | 490550911
![eMolecules 1372778-68-1 | ChemScene | N-([1131-terphenyl]-5-yl)-99-dimethyl-9H-fluoren-2-amine | 100mg | 632308153 | CS-0162945 | 437.586 | C33H27N](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502444950.PNG-250.jpg)
eMolecules 1372778-68-1 | ChemScene | N-([1131-terphenyl]-5-yl)-99-dimethyl-9H-fluoren-2-amine | 100mg | 632308153 | CS-0162945 | 437.586 | C33H27N
Pharmablock | 5-bromo-2-(bromomethyl)pyridinehydrobromide | 25mg | 779716477 | PBYS1747-1 | 173999-22-9 | MFCD20921831 | 331.833 | C6H6Br3N
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool