Terphenyls
=O | 100mg | 712840728](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502462751.JPG-250.jpg)
eMolecules 1887-73-6 | 1,2,4,5-Tetrafluoro-3-methoxy-6-nitrobenzene | ChemScene | MFCD00986393 | 225.099 | C7H3F4NO3 | 98.000 | COc1c(F)c(F)c(c(F)c1F)[N+]([O-])=O | 100mg | 712840728
1,2,4,5-Tetrafluoro-3-methoxy-6-nitrobenzene | ChemScene | 1887-73-6 | MFCD00986393 | 225.099 | C7H3F4NO3 | 98.000 | COc1c(F)c(F)c(c(F)c1F)[N+]([O-])=O | 100mg | 712840728
eMolecules 1417567-95-3 | 2,4-DIBROMO-1-(DIFLUOROMETHOXY)BENZENE | MFCD22581011 | 1g
Pharmablock | 1-tert-butylazetidin-3-amine | 25mg | 551212906 | PB06803 | 18713-70-7 | MFCD10565786 | 128.219 | C7H16N2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 594-81-0 | 2,3-Dibromo-2,3-dimethylbutane | Combi-Blocks, Inc. | MFCD00053168 | 243.970 | C6H12Br2 | 98.000 | CC(C)(Br)C(C)(C)Br | 1g | 569295348
2,3-Dibromo-2,3-dimethylbutane | Combi-Blocks, Inc. | 594-81-0 | MFCD00053168 | 243.970 | C6H12Br2 | 98.000 | CC(C)(Br)C(C)(C)Br | 1g | 569295348
Medchemexpress LLC 1,1':2',1''-Terphenyl-d14 | 5142-67-6 | 99% | 244.39 | 25 MG
1,1':2',1''-Terphenyl-d14 is a deuterium-labeled compound, specifically a stable isotope of 1,1':2',1''-Terphenyl. It is intended for research use only and not for medical applications. This compound is valuable as a tracer and an internal standard in various quantitative analyses, including NMR, GC-MS, and LC-MS. The incorporation of stable heavy isotopes like deuterium into molecules can influence their pharmacokinetic and metabolic profiles.
- Can be used as a tracer.
- Acts as an internal standard for quantitative analysis by NMR, GC-MS, or LC-MS.
- Deuterium labeling can impact pharmacokinetic and metabolic properties.
- For research use only.