1-hydroxy-2-unsubstituted benzenoids
eMolecules 1181566-40-4 | 5-(4-Hydroxyphenyl)nicotinic acid | Combi-Blocks | MFCD11933378 | 215.208 | C12H9NO3 | 97.000 | OC(=O)c1cncc(c1)-c1ccc(O)cc1 | 1g | 117585960
5-(4-Hydroxyphenyl)nicotinic acid | Combi-Blocks | 1181566-40-4 | MFCD11933378 | 215.208 | C12H9NO3 | 97.000 | OC(=O)c1cncc(c1)-c1ccc(O)cc1 | 1g | 117585960
Medchemexpress LLC 4-hydroxybenzoic acid | 99-96-7 | MFCD00002547 | 100.0% | 138.12 g/mol | C7H6O3 | 25g
4-Hydroxybenzoic acid a phenolic derivative of benzoic acid could inhibit most gram-positive and some gram-negative bacteria with an IC50 of 160 g/mL
Aobchem 3-Bromo-5-hydroxyphenylboronic acid pinacol ester | ≥97% | CAS 1218789-50-4 | C12H16BBrO3 | 250mg
3-Bromo-5-hydroxyphenylboronic acid pinacol ester | ≥97% | CAS 1218789-50-4 | C12H16BBrO3 | 250mg
Aobchem 3-Bromo-2-hydroxyphenyl boronic acid | ≥95% | CAS 89488-24-4 | C6H6BBrO3 | 5g
3-Bromo-2-hydroxyphenyl boronic acid | ≥95% | CAS 89488-24-4 | C6H6BBrO3 | 5g
Aobchem 1-(3-Bromo-4-hydroxyphenyl)-1-propanone | ≥95% | CAS 18430-72-3 | C9H9BrO2 | 250mg
1-(3-Bromo-4-hydroxyphenyl)-1-propanone | ≥95% | CAS 18430-72-3 | C9H9BrO2 | 250mg
Aobchem 3-Bromo-5-hydroxyphenylboronic acid pinacol ester | ≥97% | CAS 1218789-50-4 | C12H16BBrO3 | 500mg
3-Bromo-5-hydroxyphenylboronic acid pinacol ester | ≥97% | CAS 1218789-50-4 | C12H16BBrO3 | 500mg
Aobchem 1-(3-Bromo-2-hydroxyphenyl)-1-propanone | 95% | CAS 17764-91-9 | C9H9BrO2 | 1g
1-(3-Bromo-2-hydroxyphenyl)-1-propanone | 95% | CAS 17764-91-9 | C9H9BrO2 | 1g
Medchemexpress LLC 3-(3-Hydroxyphenyl)propionic acid | 621-54-5 | 166.18 | 5 G
3-(3-Hydroxyphenyl)propionic acid (3HPPA) promotes endothelium-dependent nitric oxide (NO) release and activates endothelial nitric oxide synthase (eNOS). It mediates vascular smooth muscle relaxation, enhances endothelial cell NO synthesis, and induces vasodilation, reducing peripheral vascular resistance. It can dose-dependently reduce blood pressure in spontaneously hypertensive rats (SHR) without affecting cardiac contractility or heart rate. It offers antihypertensive and vascular protective effects, useful in preventing and treating cardiovascular diseases.
- Endothelium-dependent nitric oxide (NO) release promoter
- Endothelial nitric oxide synthase (eNOS) activator
- Mediates vascular smooth muscle relaxation
- Enhances endothelial cell NO synthesis
- Induces vasodilation
- Reduces peripheral vascular resistance
- Antihypertensive and vascular protective effects
Aobchem 1-(4-Bromo-2-hydroxyphenyl)-1-propanone | ≥95% | CAS 17764-92-0 | C9H9BrO2 | 1g
1-(4-Bromo-2-hydroxyphenyl)-1-propanone | ≥95% | CAS 17764-92-0 | C9H9BrO2 | 1g
eMolecules 17696-61-6 | 4-Hydroxybenzoic acid sec-butyl ester | Combi-Blocks | MFCD00059626 | 194.230 | C11H14O3 | 98.000 | CCC(C)OC(=O)c1ccc(O)cc1 | 1g | 296394736
4-Hydroxybenzoic acid sec-butyl ester | Combi-Blocks | 17696-61-6 | MFCD00059626 | 194.230 | C11H14O3 | 98.000 | CCC(C)OC(=O)c1ccc(O)cc1 | 1g | 296394736