Carboxylic acid imides
Chem-Impex International, Inc. (R)-4-Benzyl-3-propionyl-2-oxazolidinone | 131685-53-5 | MFCD00269687 | 25G
(R)-4-Benzyl-3-propionyl-2-oxazolidinone, 131685-53-5, MFCD00269687, 25G
Chem-Impex International, Inc. 2,4-Thiazolidinedione | MFCD00005478 | 100G
2,4-Thiazolidinedione, MFCD00005478, 100G
Chem-Impex International, Inc. 1,3-Dibromo-5,5-dimethylhydantoin | MFCD00003189 | 100G
1,3-Dibromo-5,5-dimethylhydantoin, MFCD00003189, 100G
Sigma Aldrich Fine Chemicals Biosciences N-Methylsuccinimide | 99% Purity | CAS No.: 1121-07-9 | MDL No.: MFCD00005517 | 25g
N-Methylsuccinimide | Purity: 99% | M. W.: 113.11 | CAS No.: 1121-07-9 | MDL No.: MFCD00005517 | 25g
eMolecules 1333493-13-2 | ChemScene | (R)-4-((7-Ethyl-8-isopropyl-5-methyl-6-oxo-5678-tetrahydropteridin-2-yl)amino)-3-methoxybenzoic acid | 100mg | 642097960 | CS-0028467 | MFCD22565663 | 399.451 | C20H25N5O4
Medchem Express | THZ1 | 5mg | 446271624 | HY-80013 | 1604810-83-4 | MFCD28167785 | 566.060 | C31H28ClN7O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 692764-09-3 | ethyl 1,4-dihydro-6-isopropoxy-4-oxoquinoline-3-carboxylate | Broadpharm | MFCD05744800 | 275.304 | C15H17NO4 | 97.000 | CCOC(=O)c1c[nH]c2ccc(OC(C)C)cc2c1=O | 1g | 112541819](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502202697.JPG-250.jpg)
eMolecules 692764-09-3 | ethyl 1,4-dihydro-6-isopropoxy-4-oxoquinoline-3-carboxylate | Broadpharm | MFCD05744800 | 275.304 | C15H17NO4 | 97.000 | CCOC(=O)c1c[nH]c2ccc(OC(C)C)cc2c1=O | 1g | 112541819
ethyl 1,4-dihydro-6-isopropoxy-4-oxoquinoline-3-carboxylate | Broadpharm | 692764-09-3 | MFCD05744800 | 275.304 | C15H17NO4 | 97.000 | CCOC(=O)c1c[nH]c2ccc(OC(C)C)cc2c1=O | 1g | 112541819
eMolecules 2096331-77-8 | 3-Chloro-4-fluoro-5-isopropoxyphenylboronic acid | Combi-Blocks | MFCD20441835 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1cc(cc(Cl)c1F)B(O)O | 1g | 117525068
3-Chloro-4-fluoro-5-isopropoxyphenylboronic acid | Combi-Blocks | 2096331-77-8 | MFCD20441835 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1cc(cc(Cl)c1F)B(O)O | 1g | 117525068
eMolecules 85-41-6 | Phthalimide | Chem-Impex | MFCD00005881 | 147.133 | C8H5NO2 | 99.000 | O=C1NC(=O)c2ccccc12 | 50kg | 342449853
Phthalimide | Chem-Impex | 85-41-6 | MFCD00005881 | 147.133 | C8H5NO2 | 99.000 | O=C1NC(=O)c2ccccc12 | 50kg | 342449853
Sigma Aldrich Fine Chemicals Biosciences Locostatin 50MG
Locostatin | ≥98% | 245.27 | 90719-30-5 | MFCD00278769 | 50MG
eMolecules 1256346-21-0 | 4-Chloro-2-fluoro-3-isopropoxyphenylboronic acid | Combi-Blocks | MFCD17015738 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1c(Cl)ccc(B(O)O)c1F | 1g | 117524632
4-Chloro-2-fluoro-3-isopropoxyphenylboronic acid | Combi-Blocks | 1256346-21-0 | MFCD17015738 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1c(Cl)ccc(B(O)O)c1F | 1g | 117524632
eMolecules 5839-88-3 | 4,4-DIMETHYLOXAZOLIDINE-2,5-DIONE | AstaTech | MFCD20926118 | 129.115 | C5H7NO3 | 95.000 | CC1(C)NC(=O)OC1=O | 0.25g | 458246438
4,4-DIMETHYLOXAZOLIDINE-2,5-DIONE | AstaTech | 5839-88-3 | MFCD20926118 | 129.115 | C5H7NO3 | 95.000 | CC1(C)NC(=O)OC1=O | 0.25g | 458246438
eMolecules 77-48-5 | 1,3-Dibromo-5,5-dimethylhydantoin | Chem-Impex | MFCD00003189 | 285.923 | C5H6Br2N2O2 | 98.000 | CC1(C)N(Br)C(=O)N(Br)C1=O | 100g | 112760363
1,3-Dibromo-5,5-dimethylhydantoin | Chem-Impex | 77-48-5 | MFCD00003189 | 285.923 | C5H6Br2N2O2 | 98.000 | CC1(C)N(Br)C(=O)N(Br)C1=O | 100g | 112760363
eMolecules 2096335-18-9 | 3-Chloro-5-fluoro-4-isopropoxyphenylboronic acid | Combi-Blocks | MFCD20441800 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1c(F)cc(cc1Cl)B(O)O | 1g | 117523435
3-Chloro-5-fluoro-4-isopropoxyphenylboronic acid | Combi-Blocks | 2096335-18-9 | MFCD20441800 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1c(F)cc(cc1Cl)B(O)O | 1g | 117523435
eMolecules 133812-16-5 | Medchem Express | (E/Z)-Locostatin | 5mg | 788478648 | HY-W013411 | MFCD00278769 | 245.278 | C14H15NO3
Medchem Express | SAHA chloroalkane T1 | 5mg | 455326012 | HY-111595 | 1613617-05-2 | 719.270 | C33H55ClN4O11
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 15888-38-7 | 5'-O-Acetyl-2',3'-O-isopropylideneadenosine | MFCD00005755 | 1g
Medchem Express | (R)-Equol | 5mg | 446259333 | HY-108414 | 221054-79-1 | MFCD09025608 | 242.274 | C15H14O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>