Oxazoles
Medchemexpress LLC Flag Tag Antibody Y 50uL | 50uL
Flag Tag Antibody (YA6859) is a non-conjugated and Rabbit origined IgG monoclonal antibody targeting to Flag Tag
![eMolecules 458546-95-7 | N-Fmoc-(4S)-4-(acetylamino)-L-proline | Advanced ChemBlocks394.427 | C22H22N2O5 | 95.000 | CC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 250mg | 825299144](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000190593.jpg-250.jpg)
eMolecules 458546-95-7 | N-Fmoc-(4S)-4-(acetylamino)-L-proline | Advanced ChemBlocks394.427 | C22H22N2O5 | 95.000 | CC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 250mg | 825299144
N-Fmoc-(4S)-4-(acetylamino)-L-proline | Advanced ChemBlocks | 458546-95-7394.427 | C22H22N2O5 | 95.000 | CC(=O)N[C@H]1C[C@H](N(C1)C(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O | 250mg | 825299144
Research Products International Corp Nalidixic Acid Sodium Salt, 25 Grams
Nalidixic Acid Sodium Salt is a compound of notable importance in microbiology and pharmaceutical research. This sodium salt formulation of nalidixic acid is a valuable tool for investigating bacterial resistance mechanisms and antibiotic development.
In microbiology, Nalidixic Acid Sodium Salt is widely employed to study bacterial susceptibility and resistance patterns. It serves as a selective agent in microbiological culture media, inhibiting the growth of susceptible bacteria. Researchers use it to assess the effectiveness of antibiotics and to understand the molecular mechanisms behind bacterial resistance, contributing to our understanding of microbial biology and antibiotic resistance.
eMolecules 118994-84-6 | Oxazole-4-carboxaldehyde | Combi-Blocks | MFCD02179512 | 97.073 | C4H3NO2 | 98.000 | O=Cc1cocn1 | 1g | 117533657
Oxazole-4-carboxaldehyde | Combi-Blocks | 118994-84-6 | MFCD02179512 | 97.073 | C4H3NO2 | 98.000 | O=Cc1cocn1 | 1g | 117533657