Thiadiazoles
Apexbio Technology LLC 4-PH 5-ME THIADIAZOLE-5000mg
4-phenyl-5-methyl-1 2 3-Thiadiazole (CAS No 64273-28-5) is a compound prevalent in biomedical research particularly within the realm of pharmacological studies investigating novel therapeutic agents Originating from synthetic chemistry this compound often targets molecular pathways related to oxidative stress and inflammatory responses In vitro it typically exhibits activity in the nanomolar to low micromolar range making it a potent candidate for biochemical assays Common applications of 4-phenyl-5-methyl-1 2 3-thiadiazole include its use in various cell model systems and animal studies aimed at understanding drug metabolism and efficacy as well as in high-throughput drug screening processes to identify potential drug candidates Experimental concentrations typically depend on the specific research design allowing for flexibility in its application across different study paradigms
Apexbio Technology LLC 4-PH 5-ME THIADIAZOLE-1000mg
4-phenyl-5-methyl-1 2 3-Thiadiazole (CAS No 64273-28-5) is a compound prevalent in biomedical research particularly within the realm of pharmacological studies investigating novel therapeutic agents Originating from synthetic chemistry this compound often targets molecular pathways related to oxidative stress and inflammatory responses In vitro it typically exhibits activity in the nanomolar to low micromolar range making it a potent candidate for biochemical assays Common applications of 4-phenyl-5-methyl-1 2 3-thiadiazole include its use in various cell model systems and animal studies aimed at understanding drug metabolism and efficacy as well as in high-throughput drug screening processes to identify potential drug candidates Experimental concentrations typically depend on the specific research design allowing for flexibility in its application across different study paradigms
Chemscene ChemScene | 5-Methyl-1,3,4-thiadiazole-2-carbaldehyde | 100MG | CS-0197746 | 0.97 | 61018-49-3| MFCD10700256 | 128.16
ChemScene | 5-Methyl-1,3,4-thiadiazole-2-carbaldehyde | 100MG | CS-0197746 | 0.97 | 61018-49-3| MFCD10700256 | 128.16
eMolecules 85003-78-7 | 2-(5-AMINO-1,3,4-THIADIAZOL-2-YL)-PHENOL | AstaTech | MFCD01049035 | 193.220 | C8H7N3OS | 94.000 | Nc1nnc(s1)-c1ccccc1O | 1g | 536770661
2-(5-AMINO-1,3,4-THIADIAZOL-2-YL)-PHENOL | AstaTech | 85003-78-7 | MFCD01049035 | 193.220 | C8H7N3OS | 94.000 | Nc1nnc(s1)-c1ccccc1O | 1g | 536770661
Aobchem 4-Phenyl-1 2 3-thiadiazole | ≥95% | CAS 25445-77-6 | C8H6N2S | 250mg
4-Phenyl-1 2 3-thiadiazole | ≥95% | CAS 25445-77-6 | C8H6N2S | 250mg
eMolecules 2254-88-8 | DICHLORO-1,2,4-THIADIAZOLE | AstaTech | MFCD00799286 | 155.000 | C2Cl2N2S | 95.000 | Clc1nsc(Cl)n1 | 0.25g | 718060225
DICHLORO-1,2,4-THIADIAZOLE | AstaTech | 2254-88-8 | MFCD00799286 | 155.000 | C2Cl2N2S | 95.000 | Clc1nsc(Cl)n1 | 0.25g | 718060225
Aobchem 4-Phenyl-1 2 3-thiadiazole | ≥95% | CAS 25445-77-6 | C8H6N2S | 1g
4-Phenyl-1 2 3-thiadiazole | ≥95% | CAS 25445-77-6 | C8H6N2S | 1g
eMolecules 120208-98-2 | 5-Amino-1,3,4-thiadiazole-2-sulfonamide Hydrochloride Salt | Toronto Research Chemicals | MFCD18071652 | 216.660 | C2H5ClN4O2S2Cl.Nc1nnc(s1)S(N)(=O)=O | 100mg | 483379929
5-Amino-1,3,4-thiadiazole-2-sulfonamide Hydrochloride Salt | Toronto Research Chemicals | 120208-98-2 | MFCD18071652 | 216.660 | C2H5ClN4O2S2Cl.Nc1nnc(s1)S(N)(=O)=O | 100mg | 483379929
eMolecules 27643-15-8 | 1,2,3-Thiadiazole-4-carbaldehyde | ChemScene | MFCD02180762 | 114.120 | C3H2N2OS | 97.000 | O=Cc1csnn1 | 100mg | 654769353
1,2,3-Thiadiazole-4-carbaldehyde | ChemScene | 27643-15-8 | MFCD02180762 | 114.120 | C3H2N2OS | 97.000 | O=Cc1csnn1 | 100mg | 654769353
eMolecules 5097-44-9 | 4-Chloro-1,2,5-thiadiazole-3-carboxylic acid | Synthonix - Stock | MFCD28127723 | 164.560 | C3HClN2O2S | 95.000 | OC(=O)c1nsnc1Cl | 1g | 499992637
4-Chloro-1,2,5-thiadiazole-3-carboxylic acid | Synthonix - Stock | 5097-44-9 | MFCD28127723 | 164.560 | C3HClN2O2S | 95.000 | OC(=O)c1nsnc1Cl | 1g | 499992637
Chemscene ChemScene | 4-Methyl-1,2,3-thiadiazole-5-carbaldehyde | 250MG | CS-0103587 | 0.98 | 127108-66-1| MFCD06245124 | 128.16
ChemScene | 4-Methyl-1,2,3-thiadiazole-5-carbaldehyde | 250MG | CS-0103587 | 0.98 | 127108-66-1| MFCD06245124 | 128.16
eMolecules 2254-88-8 | DICHLORO-1,2,4-THIADIAZOLE | AstaTech | MFCD00799286 | 155.000 | C2Cl2N2S | 95.000 | Clc1nsc(Cl)n1 | 1g | 449786447
DICHLORO-1,2,4-THIADIAZOLE | AstaTech | 2254-88-8 | MFCD00799286 | 155.000 | C2Cl2N2S | 95.000 | Clc1nsc(Cl)n1 | 1g | 449786447
Chem-Impex International, Inc. 2-Mercapto-1,3,4-thiadiazole | MFCD00040404 | 5G
2-Mercapto-1,3,4-thiadiazole, MFCD00040404, 5G
eMolecules 499769-94-7 | Benzo-2,1,3-thiadiazole-4-boronic acid | Combi-Blocks | MFCD05664667 | 179.990 | C6H5BN2O2S | 95.000 | OB(O)c1cccc2nsnc12 | 1g | 117524100
Benzo-2,1,3-thiadiazole-4-boronic acid | Combi-Blocks | 499769-94-7 | MFCD05664667 | 179.990 | C6H5BN2O2S | 95.000 | OB(O)c1cccc2nsnc12 | 1g | 117524100