Triazoles
eMolecules 1429903-76-3 | 3-Ethoxy-5-(trifluoromethyl)aniline | MFCD24038541 | 250mg
Ambeed | 9-(p-Tolyl)-9H-carbazole | 250mg | 628567600 | A447114 | 19264-73-4 | MFCD14708175 | 257.336 | C19H15N
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 61-82-5 | 1H-1,2,4-Triazole-3-amine | Matrix Scientific | MFCD00005230 | 84.082 | C2H4N4 | 97.000 | Nc1nc[nH]n1 | 1g | 389724640](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00128114-389724640.PNG-250.jpg)
eMolecules 61-82-5 | 1H-1,2,4-Triazole-3-amine | Matrix Scientific | MFCD00005230 | 84.082 | C2H4N4 | 97.000 | Nc1nc[nH]n1 | 1g | 389724640
1H-1,2,4-Triazole-3-amine | Matrix Scientific | 61-82-5 | MFCD00005230 | 84.082 | C2H4N4 | 97.000 | Nc1nc[nH]n1 | 1g | 389724640
![eMolecules 7169-93-9 | 2-Methyl[1,2,4]triazolo[1,5-a]pyridin-8-amine | Combi-Blocks, Inc. | MFCD16547421 | 148.169 | C7H8N4 | 95.000 | Cc1nc2c(N)cccn2n1 | 1g | 603148883](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502191112.JPG-250.jpg)
eMolecules 7169-93-9 | 2-Methyl[1,2,4]triazolo[1,5-a]pyridin-8-amine | Combi-Blocks, Inc. | MFCD16547421 | 148.169 | C7H8N4 | 95.000 | Cc1nc2c(N)cccn2n1 | 1g | 603148883
2-Methyl[1,2,4]triazolo[1,5-a]pyridin-8-amine | Combi-Blocks, Inc. | 7169-93-9 | MFCD16547421 | 148.169 | C7H8N4 | 95.000 | Cc1nc2c(N)cccn2n1 | 1g | 603148883
![eMolecules 1214901-64-0 | 2,5-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE | MFCD20527883 | 1g](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502144446.JPG-250.jpg)
eMolecules 1214901-64-0 | 2,5-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE | MFCD20527883 | 1g
Medchem Express | AM-92016 (hydrochloride) | 5mg | 482203787 | HY-101253 | 133229-11-5 | MFCD00673947 | 483.830 | C19H25Cl3N2O4S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 16778-70-4 | 1-Ethyl-1,2,4-triazole | Ambeed | MFCD07367971 | 97.121 | C4H7N3 | 97.000 | CCn1cncn1 | 250mg | 524985067
1-Ethyl-1,2,4-triazole | Ambeed | 16778-70-4 | MFCD07367971 | 97.121 | C4H7N3 | 97.000 | CCn1cncn1 | 250mg | 524985067
![eMolecules 39030-53-0 | 6-Methyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one | Combi-Blocks | MFCD00197444 | 150.141 | C6H6N4O | 96.000 | Cc1ccc2n[nH]c(=O)n2n1 | 1g | 457921620](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502187540.JPG-250.jpg)
eMolecules 39030-53-0 | 6-Methyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one | Combi-Blocks | MFCD00197444 | 150.141 | C6H6N4O | 96.000 | Cc1ccc2n[nH]c(=O)n2n1 | 1g | 457921620
6-Methyl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one | Combi-Blocks | 39030-53-0 | MFCD00197444 | 150.141 | C6H6N4O | 96.000 | Cc1ccc2n[nH]c(=O)n2n1 | 1g | 457921620
eMolecules 461641-74-7 | (1H-1,2,3-Benzotriazol-1-ylmethyl)dimethylamine; with ethanol 1:1 | Oakwood Chemical222.292 | C11H18N4O | 96.000 | CCO.CN(C)Cn1nnc2ccccc12 | 1g | 537712676
(1H-1,2,3-Benzotriazol-1-ylmethyl)dimethylamine; with ethanol 1:1 | Oakwood Chemical | 461641-74-7222.292 | C11H18N4O | 96.000 | CCO.CN(C)Cn1nnc2ccccc12 | 1g | 537712676
eMolecules 305851-15-4 | 4-(1H-1,2,3-Benzotriazol-1-ylmethyl)-N-(4-chlorophenyl)-1,3-thiazol-2-amine | Oakwood Chemicals | MFCD01823146 | 341.820 | C16H12ClN5S | 98.000 | Clc1ccc(Nc2nc(Cn3nnc4ccccc34)cs2)cc1 | 1mg | 480158225
4-(1H-1,2,3-Benzotriazol-1-ylmethyl)-N-(4-chlorophenyl)-1,3-thiazol-2-amine | Oakwood Chemicals | 305851-15-4 | MFCD01823146 | 341.820 | C16H12ClN5S | 98.000 | Clc1ccc(Nc2nc(Cn3nnc4ccccc34)cs2)cc1 | 1mg | 480158225
Chem-Impex International, Inc. 1H-1,2,4-Triazole-3-carboxylic acid | 4928-87-4 | MFCD00078268 | 25G
1H-1,2,4-Triazole-3-carboxylic acid, 4928-87-4, MFCD00078268, 25G
Sigma Aldrich Fine Chemicals Biosciences ZM 241385 >=98% (HPLC) | 139180-30-6 | MFCD00908394 | 25MG
ZM 241385 >=98% (HPLC) | Purity: >=98% (HPLC) | Mol Wt: 337.34 | 139180-30-6 | MFCD00908394 | 25MG
![eMolecules 27187-13-9 | 5-chloro-[1,2,4]triazolo[4,3-a]pyridine | Combi-Blocks, Inc. | MFCD11109431 | 153.570 | C6H4ClN3 | 96.000 | Clc1cccc2nncn12 | 5g | 603142205](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502188043.JPG-250.jpg)
eMolecules 27187-13-9 | 5-chloro-[1,2,4]triazolo[4,3-a]pyridine | Combi-Blocks, Inc. | MFCD11109431 | 153.570 | C6H4ClN3 | 96.000 | Clc1cccc2nncn12 | 5g | 603142205
5-chloro-[1,2,4]triazolo[4,3-a]pyridine | Combi-Blocks, Inc. | 27187-13-9 | MFCD11109431 | 153.570 | C6H4ClN3 | 96.000 | Clc1cccc2nncn12 | 5g | 603142205
Accela Chembio Inc Sodium 1 | 2 | 4-triazolide | 25g | 41253-21-8 | MFCD00044437 | Tech. 90% | Shelf Life: 1800 Days | Moisture Senstive
Sodium 1 | 2 | 4-triazolide | 25g | 41253-21-8 | MFCD00044437 | Tech. 90% | Shelf Life: 1800 Days | Moisture Senstive
Accela Chembio Inc 1 | 2 | 3-triazole | 25g | 288-36-8 | MFCD00014490 | 97+% | D: 1.192 | Shelf Life: 1440 Days | Light Sensitive/moisture Sensitive
1 | 2 | 3-triazole | 25g | 288-36-8 | MFCD00014490 | 97+% | D: 1.192 | Shelf Life: 1440 Days | Light Sensitive/moisture Sensitive
Medchemexpress LLC 1,2,4-triazole | 288-88-0 | MFCD00005228 | 100.0% | 69.07 | C2H3N3 | 100mg
1 2 4-Triazole (Standard) is the analytical standard of 1 2 4-Triazole This product is intended for research and analytical applications 1 2 4-Triazole is a biochemical reagent that can be used as a biological material or organic compound for life science related research
Chem-Impex International, Inc. 3-Amino-1,2,4-triazole | MFCD00005230 | 25G
3-Amino-1,2,4-triazole, MFCD00005230, 25G