Karl Fischer Buffers and Reagents
Buffers and reagents intended for use with Karl Fischer (KF) titration techniques. KF titration is a classic titration method that uses coulometric or volumetric titration to determine the moisture content of a sample.
Karl Fischer (KF) reagents are used in the analytical technique developed by chemist Karl Fischer to accurately measure the water content of gases, liquids, and solids.
Key applications include:
- Analyzing water content in raw materials and finished products
- Estimating moisture in food, pharmaceuticals, chemicals, and petroleum products
- Determining the water content of laboratory samples.
Karl Fischer reagents contain a variety of chemicals in proprietary formulations. Consult the SDS for individual products for appropriate handling instructions and precautions.
![eMolecules 1390-65-4 | CARMINE (ALUM LAKE) | AstaTech | MFCD00167028 | 492.389 | C22H20O13 | 40.000 | Cc1c(C(O)=O)c(O)cc2C(=O)c3c(O)c(O)c([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(O)c3C(=O)c12 | 1g | 718063478](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502441721.PNG-250.jpg)
eMolecules 1390-65-4 | CARMINE (ALUM LAKE) | AstaTech | MFCD00167028 | 492.389 | C22H20O13 | 40.000 | Cc1c(C(O)=O)c(O)cc2C(=O)c3c(O)c(O)c([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(O)c3C(=O)c12 | 1g | 718063478
CARMINE (ALUM LAKE) | AstaTech | 1390-65-4 | MFCD00167028 | 492.389 | C22H20O13 | 40.000 | Cc1c(C(O)=O)c(O)cc2C(=O)c3c(O)c(O)c([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(O)c3C(=O)c12 | 1g | 718063478
eMolecules 942070-32-8 | 1-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)ethanone | Ambeed | MFCD08063138 | 252.140 | C12H17BO3S | 98.000 | CC(=O)c1ccc(s1)B1OC(C)(C)C(C)(C)O1 | 100mg | 650569906
1-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)ethanone | Ambeed | 942070-32-8 | MFCD08063138 | 252.140 | C12H17BO3S | 98.000 | CC(=O)c1ccc(s1)B1OC(C)(C)C(C)(C)O1 | 100mg | 650569906
eMolecules 90953-94-9 | 4-OXOOCT-7-YNOIC ACID | AstaTech154.165 | C8H10O3 | 95.000 | OC(=O)CCC(=O)CCC#C | 0.1g | 736391971
4-OXOOCT-7-YNOIC ACID | AstaTech | 90953-94-9154.165 | C8H10O3 | 95.000 | OC(=O)CCC(=O)CCC#C | 0.1g | 736391971
eMolecules 72653-14-6 | 4-Acetyl-4-(ethoxycarbonyl)heptanedioic acid | Ambeed | MFCD00052373 | 274.269 | C12H18O7 | 98.000 | CCOC(=O)C(CCC(O)=O)(CCC(O)=O)C(C)=O | 100mg | 682930417
4-Acetyl-4-(ethoxycarbonyl)heptanedioic acid | Ambeed | 72653-14-6 | MFCD00052373 | 274.269 | C12H18O7 | 98.000 | CCOC(=O)C(CCC(O)=O)(CCC(O)=O)C(C)=O | 100mg | 682930417
![eMolecules 81-27-6 | Ambeed | (9R9R)-44-Dihydroxy-1010-dioxo-55-bis(((2S3R4S5S6R)-345-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-991010-tetrahydro-[99-bianthracene]-22-dicarboxylic acid | 1mg | 761012707 | A559275 | MFCD00151527 | 862.746 | C42H38O20](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502432801.PNG-250.jpg)
eMolecules 81-27-6 | Ambeed | (9R9R)-44-Dihydroxy-1010-dioxo-55-bis(((2S3R4S5S6R)-345-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-991010-tetrahydro-[99-bianthracene]-22-dicarboxylic acid | 1mg | 761012707 | A559275 | MFCD00151527 | 862.746 | C42H38O20
Ambeed | (9R9R)-44-Dihydroxy-1010-dioxo-55-bis(((2S3R4S5S6R)-345-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-991010-tetrahydro-[99-bianthracene]-22-dicarboxylic acid | 1mg | 761012707 | A559275 | 81-27-6 | MFCD00151527 | 862.746 | C42H38O20
eMolecules 2229535-38-8 | 1-(Methoxymethyl)-4-oxocyclohexanecarboxylic acid | ChemScene186.207 | C9H14O4 | 95.000 | COCC1(CCC(=O)CC1)C(O)=O | 100mg | 714102860
1-(Methoxymethyl)-4-oxocyclohexanecarboxylic acid | ChemScene | 2229535-38-8186.207 | C9H14O4 | 95.000 | COCC1(CCC(=O)CC1)C(O)=O | 100mg | 714102860
eMolecules 27328-86-5 | ChemScene | 3-Oxo-3-(3-(trifluoromethyl)phenyl)propanenitrile | 1g | 572180866 | CS-0059264 | MFCD00052315 | 213.159 | C10H6F3NO
Medchem Express | Arterolane | 5mg | 455325950 | HY-10852 | 664338-39-0 | 392.540 | C22H36N2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 110351-94-5 | Medchem Express | Exatecan Intermediate 1 | 100mg | 788478595 | HY-42487 | MFCD09833229 | 263.249 | C13H13NO5
ChemScene | tert-Butyl 4-((6-aminopyridin-3-yl)methyl)piperazine-1-carboxylate | 100mg | 721766394 | CS-0108482 | 1178566-52-3 | MFCD28130029 | 292.383 | C15H24N4O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 79416-27-6 | Methyl aminolevulinate HCl | Ambeed | MFCD00012868 | 181.620 | C6H12ClNO3 | 98.000 | Cl.COC(=O)CCC(=O)CN | 25mg | 598442263
Methyl aminolevulinate HCl | Ambeed | 79416-27-6 | MFCD00012868 | 181.620 | C6H12ClNO3 | 98.000 | Cl.COC(=O)CCC(=O)CN | 25mg | 598442263
eMolecules 291778-77-3 | Medchem Express | AE-3763 | 5mg | 559839843 | HY-19406 | 549.548 | C23H34F3N5O7
Pharmablock | 3-benzyl-7-oxa-3-azabicyclo[4.1.0]heptane | 500mg | 551332285 | PBT0088 | 725715-12-8 | MFCD18785747 | 189.258 | C12H15NO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 939-70-8 | Ambeed | 1-(1H-Benzo[d]imidazol-2-yl)ethanone | 1g | 552701489 | A307673 | MFCD00159994 | 160.176 | C9H8N2O](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502441201.PNG-250.jpg)
eMolecules 939-70-8 | Ambeed | 1-(1H-Benzo[d]imidazol-2-yl)ethanone | 1g | 552701489 | A307673 | MFCD00159994 | 160.176 | C9H8N2O
Ambeed | 1-(1H-Benzo[d]imidazol-2-yl)ethanone | 1g | 552701489 | A307673 | 939-70-8 | MFCD00159994 | 160.176 | C9H8N2O
Phenomenex Inc 50000 g/mL in Methylene Chloride, 1 mL in 2 mL Ampoule
Motor Oil Composite AL0-101559
eMolecules 1639422-97-1 | Medchem Express | JH-VIII-157-02 | 5mg | 446260174 | HY-112140 | 465.557 | C28H27N5O2
Medchem Express | 10-Gingerol | 5mg | 495800807 | HY-N0448 | 23513-15-7 | MFCD01682694 | 350.499 | C21H34O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool