Filtered Search Results
Palladium(II) nitrate hydrate, 99.8% (metals basis), Pd 39% min
CAS: 207596-32-5 Molecular Formula: N2O6Pd Molecular Weight (g/mol): 230.43 MDL Number: MFCD00011169 InChI Key: GPNDARIEYHPYAY-UHFFFAOYSA-N Synonym: palladium nitrate,palladium ii nitrate,palladous nitrate,palladium dinitrate,unii-5g27lbz05u,nitric acid, palladium 2+ salt,hydrogen tetranitropalladate ii,palladium 2+ dinitrate,palladiumdinitrate PubChem CID: 24932 IUPAC Name: palladium(2+);dinitrate SMILES: [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24932 |
|---|---|
| CAS | 207596-32-5 |
| Molecular Weight (g/mol) | 230.43 |
| MDL Number | MFCD00011169 |
| SMILES | [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | palladium nitrate,palladium ii nitrate,palladous nitrate,palladium dinitrate,unii-5g27lbz05u,nitric acid, palladium 2+ salt,hydrogen tetranitropalladate ii,palladium 2+ dinitrate,palladiumdinitrate |
| IUPAC Name | palladium(2+);dinitrate |
| InChI Key | GPNDARIEYHPYAY-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pd |
Palladium on activated carbon, 10% Pd, unreduced, dry
CAS: 7440-05-3 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 7440-05-3 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Tetrakis(triphenylphosphine)palladium(0), 99%
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Palladium(II) acetate, 47.5% Pd
CAS: 3375-31-3 Molecular Formula: C4H6O4Pd Molecular Weight (g/mol): 224.51 MDL Number: MFCD00012453 InChI Key: YJVFFLUZDVXJQI-UHFFFAOYSA-L Synonym: palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate PubChem CID: 167845 SMILES: [Pd++].CC([O-])=O.CC([O-])=O
| PubChem CID | 167845 |
|---|---|
| CAS | 3375-31-3 |
| Molecular Weight (g/mol) | 224.51 |
| MDL Number | MFCD00012453 |
| SMILES | [Pd++].CC([O-])=O.CC([O-])=O |
| Synonym | palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate |
| InChI Key | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| Molecular Formula | C4H6O4Pd |
Palladium(II) chloride, 99.9% (metals basis), Pd 59.0% min
CAS: 7647-10-1 Molecular Formula: Cl2Pd Molecular Weight (g/mol): 177.32 MDL Number: MFCD00003558 InChI Key: PIBWKRNGBLPSSY-UHFFFAOYSA-L PubChem CID: 24290 ChEBI: CHEBI:53434 SMILES: [Cl-].[Cl-].[Pd++]
| PubChem CID | 24290 |
|---|---|
| CAS | 7647-10-1 |
| Molecular Weight (g/mol) | 177.32 |
| ChEBI | CHEBI:53434 |
| MDL Number | MFCD00003558 |
| SMILES | [Cl-].[Cl-].[Pd++] |
| InChI Key | PIBWKRNGBLPSSY-UHFFFAOYSA-L |
| Molecular Formula | Cl2Pd |
Thermo Scientific Chemicals Palladium on 2-4 mm alumina pellets, 0.5% Pd
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Palladium(II) 2,4-pentanedionate, Pd 34.7%
CAS: 14024-61-4 Molecular Formula: C10H14O4Pd Molecular Weight (g/mol): 304.64 MDL Number: MFCD00000025 MFCD00000025 InChI Key: JKDRQYIYVJVOPF-FDGPNNRMSA-L Synonym: palladium diacetonate,acetylacetone palladium ii salt,bis 2,4-pentanedionato palladium ii PubChem CID: 53384484 IUPAC Name: (E)-4-oxopent-2-en-2-olate;palladium(2+) SMILES: [Pd++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 53384484 |
|---|---|
| CAS | 14024-61-4 |
| Molecular Weight (g/mol) | 304.64 |
| MDL Number | MFCD00000025 MFCD00000025 |
| SMILES | [Pd++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | palladium diacetonate,acetylacetone palladium ii salt,bis 2,4-pentanedionato palladium ii |
| IUPAC Name | (E)-4-oxopent-2-en-2-olate;palladium(2+) |
| InChI Key | JKDRQYIYVJVOPF-FDGPNNRMSA-L |
| Molecular Formula | C10H14O4Pd |
Palladium(II) acetate, Pd 45.9-48.4%
CAS: 3375-31-3 Molecular Formula: C4H6O4Pd Molecular Weight (g/mol): 224.51 MDL Number: MFCD00012453 InChI Key: YJVFFLUZDVXJQI-UHFFFAOYSA-L Synonym: palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate PubChem CID: 167845 IUPAC Name: palladium(2+);diacetate SMILES: [Pd++].CC([O-])=O.CC([O-])=O
| PubChem CID | 167845 |
|---|---|
| CAS | 3375-31-3 |
| Molecular Weight (g/mol) | 224.51 |
| MDL Number | MFCD00012453 |
| SMILES | [Pd++].CC([O-])=O.CC([O-])=O |
| Synonym | palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate |
| IUPAC Name | palladium(2+);diacetate |
| InChI Key | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| Molecular Formula | C4H6O4Pd |
Palladium(II) iodide, 99.9% (metals basis), Pd 28% min
CAS: 7790-38-7 Molecular Formula: I2Pd Molecular Weight (g/mol): 360.23 MDL Number: MFCD00011171 InChI Key: HNNUTDROYPGBMR-UHFFFAOYSA-L IUPAC Name: palladium(2+) diiodide SMILES: [Pd++].[I-].[I-]
| CAS | 7790-38-7 |
|---|---|
| Molecular Weight (g/mol) | 360.23 |
| MDL Number | MFCD00011171 |
| SMILES | [Pd++].[I-].[I-] |
| IUPAC Name | palladium(2+) diiodide |
| InChI Key | HNNUTDROYPGBMR-UHFFFAOYSA-L |
| Molecular Formula | I2Pd |
Palladium foil, 0.025mm (0.001in) thick, 99.9% (metals basis)
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Tris(dibenzylideneacetone)dipalladium(0), 97%
CAS: 51364-51-3 Molecular Formula: C51H42O3Pd2 Molecular Weight (g/mol): 915.73 MDL Number: MFCD00013310 InChI Key: CYPYTURSJDMMMP-UHFFFAOYSA-N Synonym: tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium PubChem CID: 9811564 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1
| PubChem CID | 9811564 |
|---|---|
| CAS | 51364-51-3 |
| Molecular Weight (g/mol) | 915.73 |
| MDL Number | MFCD00013310 |
| SMILES | [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1 |
| Synonym | tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | CYPYTURSJDMMMP-UHFFFAOYSA-N |
| Molecular Formula | C51H42O3Pd2 |
Palladium standard solution, for AAS, 1 mg/ml Pd in 10 to 20% HCl
CAS: 7440-05-3 | Pd | 106.42 g/mol
| Boiling Point | 107.0°C |
|---|---|
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| Solubility | Soluble in water |
| Color | Brown/Red |
| Physical Form | Solution |
| Chemical Name or Material | Palladium standard solution |
| Grade | AAS |
| SMILES | [Pd] |
| Concentration | 997 to 1003 μg/mL of Pd (2+) in 10% HCl (20°C) |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Density | 1.0500g/mL |
| PubChem CID | 23938 |
| Name Note | 1 mg/ml Pd in 10% HCl |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement: Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. IF ON SKIN: Wash with plenty of soap and water. Avoid breathing dust/fume/gas/mist/vapors/spray. Keep only in original container. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| Health Hazard 2 | GHS H Statement: Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. May be corrosive to metals. |
| Health Hazard 1 | GHS Signal Word: Warning |
| Packaging | Plastic bottle |
| IUPAC Name | palladium |
| Molecular Formula | Pd |
| Melting Point | -25.0°C |
| Specific Gravity | 1.05 |
Palladium(II) oxide, 99.995%, (trace metal basis)
CAS: 1314-08-5 Molecular Formula: OPd Molecular Weight (g/mol): 122.42 MDL Number: MFCD00011172 InChI Key: JQPTYAILLJKUCY-UHFFFAOYSA-N Synonym: palladium ii oxide,palladium oxide pdo,acmc-1bqvh,palladium oxide, pdo,palladium ii oxide, anhydrous,palladium ii oxide-pd,11113-77-2 cpd with unspecified mf,palladium oxide ? inverted exclamation mark-?,palladium ii oxide trace metals basis PubChem CID: 5083724 IUPAC Name: palladium(2+) oxidandiide SMILES: [O--].[Pd++]
| PubChem CID | 5083724 |
|---|---|
| CAS | 1314-08-5 |
| Molecular Weight (g/mol) | 122.42 |
| MDL Number | MFCD00011172 |
| SMILES | [O--].[Pd++] |
| Synonym | palladium ii oxide,palladium oxide pdo,acmc-1bqvh,palladium oxide, pdo,palladium ii oxide, anhydrous,palladium ii oxide-pd,11113-77-2 cpd with unspecified mf,palladium oxide ? inverted exclamation mark-?,palladium ii oxide trace metals basis |
| IUPAC Name | palladium(2+) oxidandiide |
| InChI Key | JQPTYAILLJKUCY-UHFFFAOYSA-N |
| Molecular Formula | OPd |
Palladium on activated carbon, unreduced, 5% Pd
CAS: 7440-05-3 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 7440-05-3 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |
Palladium, 5% on gamma alumina powder, reduced
CAS: 5-3-7440 Molecular Formula: Pd Molecular Weight (g/mol): 106.42 MDL Number: MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 InChI Key: KDLHZDBZIXYQEI-UHFFFAOYSA-N Synonym: black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon PubChem CID: 23938 ChEBI: CHEBI:33363 IUPAC Name: palladium SMILES: [Pd]
| PubChem CID | 23938 |
|---|---|
| CAS | 5-3-7440 |
| Molecular Weight (g/mol) | 106.42 |
| ChEBI | CHEBI:33363 |
| MDL Number | MFCD00011167 MFCD03457879 MFCD03427452 MFCD03613602 MFCD03613603 MFCD03613604 MFCD03613605 MFCD06798745 |
| SMILES | [Pd] |
| Synonym | black,on carbon,paladio,palladium/carbon,element,charcoal,palladium, element,palladex 600,on charcoal,palladium-activated carbon |
| IUPAC Name | palladium |
| InChI Key | KDLHZDBZIXYQEI-UHFFFAOYSA-N |
| Molecular Formula | Pd |