1,2-dihalobenzenes

Alfa Aesar™ 1,2-Dibromo-3,4,5,6-tetramethylbenzene, 98%

CAS: 36321-73-0 Molecular Formula: C10H12Br2 Molecular Weight (g/mol): 292.014 MDL Number: MFCD00154987 InChI Key: VEZJOZSIGSNYEB-UHFFFAOYSA-N Synonym: 1,2-bis bromanyl-3,4,5,6-tetramethyl-benzene PubChem CID: 2752606 IUPAC Name: 1,2-dibromo-3,4,5,6-tetramethylbenzene SMILES: CC1=C(C(=C(C(=C1C)Br)Br)C)C

  spinner