Chemicals
Filtered Search Results
Silver sulfate, ACS reagent
CAS: 10294-26-5 Molecular Formula: Ag2H2O4S Molecular Weight (g/mol): 313.81 InChI Key: YPNVIBVEFVRZPJ-UHFFFAOYSA-N Synonym: silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt PubChem CID: 159865 IUPAC Name: disilver(1+) sulfuric acid SMILES: [Ag+].[Ag+].OS(O)(=O)=O
| PubChem CID | 159865 |
|---|---|
| CAS | 10294-26-5 |
| Molecular Weight (g/mol) | 313.81 |
| SMILES | [Ag+].[Ag+].OS(O)(=O)=O |
| Synonym | silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt |
| IUPAC Name | disilver(1+) sulfuric acid |
| InChI Key | YPNVIBVEFVRZPJ-UHFFFAOYSA-N |
| Molecular Formula | Ag2H2O4S |
Thermo Scientific Chemicals Tris(2-carboxyethyl)phosphine hydrochloride, 98%, Molecular Biology Grade
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
Triphenylphosphine oxide, 99%
CAS: 791-28-6 Molecular Formula: C18H15OP Molecular Weight (g/mol): 278.29 MDL Number: MFCD00002080 MFCD03458802 InChI Key: FIQMHBFVRAXMOP-UHFFFAOYSA-N Synonym: triphenylphosphine oxide,phosphine oxide, triphenyl,triphenyl phosphorus oxide,triphenyl phosphine oxide,triphenylphosphane oxide,tppo,triphenylphosphineoxide,ph3po,diphenylphosphoroso benzene,triphenylphosphanoxid PubChem CID: 13097 ChEBI: CHEBI:36601 IUPAC Name: diphenylphosphorylbenzene SMILES: O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 13097 |
|---|---|
| CAS | 791-28-6 |
| Molecular Weight (g/mol) | 278.29 |
| ChEBI | CHEBI:36601 |
| MDL Number | MFCD00002080 MFCD03458802 |
| SMILES | O=P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine oxide,phosphine oxide, triphenyl,triphenyl phosphorus oxide,triphenyl phosphine oxide,triphenylphosphane oxide,tppo,triphenylphosphineoxide,ph3po,diphenylphosphoroso benzene,triphenylphosphanoxid |
| IUPAC Name | diphenylphosphorylbenzene |
| InChI Key | FIQMHBFVRAXMOP-UHFFFAOYSA-N |
| Molecular Formula | C18H15OP |
Acrylic acid, low water content, 99.5%, stab. with ca 200ppm 4-methoxyphenol
CAS: 79-10-7 Molecular Formula: C3H4O2 Molecular Weight (g/mol): 72.063 MDL Number: MFCD00004367 InChI Key: NIXOWILDQLNWCW-UHFFFAOYSA-N Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 IUPAC Name: prop-2-enoic acid SMILES: C=CC(=O)O
| PubChem CID | 6581 |
|---|---|
| CAS | 79-10-7 |
| Molecular Weight (g/mol) | 72.063 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00004367 |
| SMILES | C=CC(=O)O |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| IUPAC Name | prop-2-enoic acid |
| InChI Key | NIXOWILDQLNWCW-UHFFFAOYSA-N |
| Molecular Formula | C3H4O2 |
Triethanolamine, 97%, Thermo Scientific Chemicals
CAS: 102-71-6 Molecular Weight (g/mol): 149.19 MDL Number: MFCD00002855 InChI Key: GSEJCLTVZPLZKY-UHFFFAOYSA-N Synonym: triethanolamine,trolamine,2,2',2-nitrilotriethanol,sterolamide,daltogen,tris 2-hydroxyethyl amine,triethylolamine,nitrilotriethanol,trihydroxytriethylamine,thiofaco t-35 PubChem CID: 7618 ChEBI: CHEBI:28621
| PubChem CID | 7618 |
|---|---|
| CAS | 102-71-6 |
| Molecular Weight (g/mol) | 149.19 |
| ChEBI | CHEBI:28621 |
| MDL Number | MFCD00002855 |
| Synonym | triethanolamine,trolamine,2,2',2-nitrilotriethanol,sterolamide,daltogen,tris 2-hydroxyethyl amine,triethylolamine,nitrilotriethanol,trihydroxytriethylamine,thiofaco t-35 |
| InChI Key | GSEJCLTVZPLZKY-UHFFFAOYSA-N |
Calcium chloride dihydrate, 99+%, ACS reagent
CAS: 10035-04-8 Molecular Formula: CaCl2·2H2O Molecular Weight (g/mol): 147.02 MDL Number: MFCD00149613
| CAS | 10035-04-8 |
|---|---|
| Molecular Weight (g/mol) | 147.02 |
| MDL Number | MFCD00149613 |
| Molecular Formula | CaCl2·2H2O |
Thermo Scientific Chemicals Uracil, 99+%
CAS: 66-22-8 Molecular Formula: C4H4N2O2 Molecular Weight (g/mol): 112.09 MDL Number: MFCD00006016 InChI Key: ISAKRJDGNUQOIC-UHFFFAOYSA-N Synonym: uracil,2,4-dihydroxypyrimidine,2,4 1h,3h-pyrimidinedione,2,4-pyrimidinediol,2,4-dioxopyrimidine,pyrimidine-2,4 1h,3h-dione,pirod,2,4-pyrimidinedione,pyrod,hybar x PubChem CID: 1174 ChEBI: CHEBI:17568 IUPAC Name: 1H-pyrimidine-2,4-dione SMILES: O=C1NC=CC(=O)N1
| PubChem CID | 1174 |
|---|---|
| CAS | 66-22-8 |
| Molecular Weight (g/mol) | 112.09 |
| ChEBI | CHEBI:17568 |
| MDL Number | MFCD00006016 |
| SMILES | O=C1NC=CC(=O)N1 |
| Synonym | uracil,2,4-dihydroxypyrimidine,2,4 1h,3h-pyrimidinedione,2,4-pyrimidinediol,2,4-dioxopyrimidine,pyrimidine-2,4 1h,3h-dione,pirod,2,4-pyrimidinedione,pyrod,hybar x |
| IUPAC Name | 1H-pyrimidine-2,4-dione |
| InChI Key | ISAKRJDGNUQOIC-UHFFFAOYSA-N |
| Molecular Formula | C4H4N2O2 |
Benzyl chloride, 99%, stab.
CAS: 100-44-7 Molecular Formula: C7H7Cl Molecular Weight (g/mol): 126.583 MDL Number: MFCD00000889 InChI Key: KCXMKQUNVWSEMD-UHFFFAOYSA-N Synonym: benzyl chloride,chloromethyl benzene,benzylchloride,alpha-chlorotoluene,benzylchlorid,chlorophenylmethane,benzene, chloromethyl,chlorure de benzyle,tolyl chloride,alpha-chlortoluol PubChem CID: 7503 ChEBI: CHEBI:615597 IUPAC Name: chloromethylbenzene SMILES: C1=CC=C(C=C1)CCl
| PubChem CID | 7503 |
|---|---|
| CAS | 100-44-7 |
| Molecular Weight (g/mol) | 126.583 |
| ChEBI | CHEBI:615597 |
| MDL Number | MFCD00000889 |
| SMILES | C1=CC=C(C=C1)CCl |
| Synonym | benzyl chloride,chloromethyl benzene,benzylchloride,alpha-chlorotoluene,benzylchlorid,chlorophenylmethane,benzene, chloromethyl,chlorure de benzyle,tolyl chloride,alpha-chlortoluol |
| IUPAC Name | chloromethylbenzene |
| InChI Key | KCXMKQUNVWSEMD-UHFFFAOYSA-N |
| Molecular Formula | C7H7Cl |
Indole-3-butyric acid, 98%
CAS: 133-32-4 Molecular Formula: C12H13NO2 Molecular Weight (g/mol): 203.241 MDL Number: MFCD00005664 InChI Key: JTEDVYBZBROSJT-UHFFFAOYSA-N Synonym: indole-3-butyric acid,3-indolebutyric acid,4-1h-indol-3-yl butanoic acid,indolebutyric acid,hormodin,1h-indole-3-butanoic acid,seradix,indole-3-butanoic acid,jiffy grow,4-indol-3-yl butyric acid PubChem CID: 8617 ChEBI: CHEBI:33070 IUPAC Name: 4-(1H-indol-3-yl)butanoic acid SMILES: C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O
| PubChem CID | 8617 |
|---|---|
| CAS | 133-32-4 |
| Molecular Weight (g/mol) | 203.241 |
| ChEBI | CHEBI:33070 |
| MDL Number | MFCD00005664 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O |
| Synonym | indole-3-butyric acid,3-indolebutyric acid,4-1h-indol-3-yl butanoic acid,indolebutyric acid,hormodin,1h-indole-3-butanoic acid,seradix,indole-3-butanoic acid,jiffy grow,4-indol-3-yl butyric acid |
| IUPAC Name | 4-(1H-indol-3-yl)butanoic acid |
| InChI Key | JTEDVYBZBROSJT-UHFFFAOYSA-N |
| Molecular Formula | C12H13NO2 |
SLMP Llc Dba Statlab Medical Methanol (ACS Grade), 99%, StatLab™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 67-56-1 Molecular Formula: CH4O Molecular Weight (g/mol): 32.04 InChI Key: OKKJLVBELUTLKV-UHFFFAOYSA-N IUPAC Name: methanol SMILES: CO
| CAS | 67-56-1 |
|---|---|
| Molecular Weight (g/mol) | 32.04 |
| SMILES | CO |
| IUPAC Name | methanol |
| InChI Key | OKKJLVBELUTLKV-UHFFFAOYSA-N |
| Molecular Formula | CH4O |
2-Chloroethanol, 99%, Thermo Scientific Chemicals
CAS: 107-07-3 Molecular Formula: C2H5ClO Molecular Weight (g/mol): 80.511 MDL Number: MFCD00002829 InChI Key: SZIFAVKTNFCBPC-UHFFFAOYSA-N Synonym: ethylene chlorohydrin,ethanol, 2-chloro,glycol chlorohydrin,2-chloroethyl alcohol,chloroethanol,glycol monochlorohydrin,2-monochloroethanol,ethylchlorohydrin,2-chlorethanol,2-chloro-1-ethanol PubChem CID: 34 ChEBI: CHEBI:28200 IUPAC Name: 2-chloroethanol SMILES: C(CCl)O
| PubChem CID | 34 |
|---|---|
| CAS | 107-07-3 |
| Molecular Weight (g/mol) | 80.511 |
| ChEBI | CHEBI:28200 |
| MDL Number | MFCD00002829 |
| SMILES | C(CCl)O |
| Synonym | ethylene chlorohydrin,ethanol, 2-chloro,glycol chlorohydrin,2-chloroethyl alcohol,chloroethanol,glycol monochlorohydrin,2-monochloroethanol,ethylchlorohydrin,2-chlorethanol,2-chloro-1-ethanol |
| IUPAC Name | 2-chloroethanol |
| InChI Key | SZIFAVKTNFCBPC-UHFFFAOYSA-N |
| Molecular Formula | C2H5ClO |
Calcium nitrate tetrahydrate, 98%, extra pure
CAS: 13477-34-4 Molecular Formula: CaH8N2O10 Molecular Weight (g/mol): 236.15 InChI Key: MWGCGFYACDTFSB-UHFFFAOYSA-N Synonym: calcium nitrate tetrahydrate,calcium nitrate hydrate, puratronic,acmc-1aekc,calcium nitrate tetra hydrate,ca.2no3.4h2o,ca no3 2.4h2o,calcium tetrahydrate dinitronate,calcium nitrate-water 1/4,calcium tetrahydrate dinitrate,calcium 2+ tetrahydrate dinitronate PubChem CID: 16211656 ChEBI: CHEBI:86159 IUPAC Name: calcium bis(nitric acid) tetrahydrate SMILES: O.[Ca++].[O-][N+]([O-])=O
| PubChem CID | 16211656 |
|---|---|
| CAS | 13477-34-4 |
| Molecular Weight (g/mol) | 236.15 |
| ChEBI | CHEBI:86159 |
| SMILES | O.[Ca++].[O-][N+]([O-])=O |
| Synonym | calcium nitrate tetrahydrate,calcium nitrate hydrate, puratronic,acmc-1aekc,calcium nitrate tetra hydrate,ca.2no3.4h2o,ca no3 2.4h2o,calcium tetrahydrate dinitronate,calcium nitrate-water 1/4,calcium tetrahydrate dinitrate,calcium 2+ tetrahydrate dinitronate |
| IUPAC Name | calcium bis(nitric acid) tetrahydrate |
| InChI Key | MWGCGFYACDTFSB-UHFFFAOYSA-N |
| Molecular Formula | CaH8N2O10 |
Calcium carbonate, 99%, extra pure
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Acetonitrile, anhydrous, 99.8+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 75-05-8 Molecular Formula: C2H3N Molecular Weight (g/mol): 41.053 MDL Number: MFCD00001878 InChI Key: WEVYAHXRMPXWCK-UHFFFAOYSA-N Synonym: methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn PubChem CID: 6342 ChEBI: CHEBI:38472 IUPAC Name: acetonitrile SMILES: CC#N
| PubChem CID | 6342 |
|---|---|
| CAS | 75-05-8 |
| Molecular Weight (g/mol) | 41.053 |
| ChEBI | CHEBI:38472 |
| MDL Number | MFCD00001878 |
| SMILES | CC#N |
| Synonym | methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn |
| IUPAC Name | acetonitrile |
| InChI Key | WEVYAHXRMPXWCK-UHFFFAOYSA-N |
| Molecular Formula | C2H3N |
18-Crown-6, 99%
CAS: 17455-13-9 Molecular Formula: C12H24O6 Molecular Weight (g/mol): 264.32 MDL Number: MFCD00005113 InChI Key: XEZNGIUYQVAUSS-UHFFFAOYSA-N Synonym: 18-crown-6,18-crown-6 ether,ethylene oxide cyclic hexamer,18-crown-6-ether,unii-63j177nc5b,ccris 3587,18-crown 6-ether,1,4,7,10,13,16-hexanoxacyclooctadecane,18-crown-6/1,4,7,10,13,16-hexaoxacyclooctadecane PubChem CID: 28557 ChEBI: CHEBI:32397 IUPAC Name: 1,4,7,10,13,16-hexaoxacyclooctadecane SMILES: C1COCCOCCOCCOCCOCCO1
| PubChem CID | 28557 |
|---|---|
| CAS | 17455-13-9 |
| Molecular Weight (g/mol) | 264.32 |
| ChEBI | CHEBI:32397 |
| MDL Number | MFCD00005113 |
| SMILES | C1COCCOCCOCCOCCOCCO1 |
| Synonym | 18-crown-6,18-crown-6 ether,ethylene oxide cyclic hexamer,18-crown-6-ether,unii-63j177nc5b,ccris 3587,18-crown 6-ether,1,4,7,10,13,16-hexanoxacyclooctadecane,18-crown-6/1,4,7,10,13,16-hexaoxacyclooctadecane |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadecane |
| InChI Key | XEZNGIUYQVAUSS-UHFFFAOYSA-N |
| Molecular Formula | C12H24O6 |