Chemicals
Filtered Search Results
1-Propylphosphonic acid cyclic anhydride, 50+% soln. in ethyl acetate, Thermo Scientific Chemicals
CAS: 68957-94-8 Molecular Formula: C9H21O6P3 MDL Number: MFCD00006583 InChI Key: PAQZWJGSJMLPMG-UHFFFAOYSA-N PubChem CID: 111923
| PubChem CID | 111923 |
|---|---|
| CAS | 68957-94-8 |
| MDL Number | MFCD00006583 |
| InChI Key | PAQZWJGSJMLPMG-UHFFFAOYSA-N |
| Molecular Formula | C9H21O6P3 |
Heptanal, 97%
CAS: 111-71-7 Molecular Formula: C7H14O Molecular Weight (g/mol): 114.19 MDL Number: MFCD00007028 InChI Key: FXHGMKSSBGDXIY-UHFFFAOYSA-N Synonym: heptaldehyde,enanthaldehyde,n-heptaldehyde,enanthal,heptyl aldehyde,heptanaldehyde,n-heptanal,oenanthaldehyde,enanthole,oenanthal PubChem CID: 8130 ChEBI: CHEBI:34787 IUPAC Name: heptanal SMILES: CCCCCCC=O
| PubChem CID | 8130 |
|---|---|
| CAS | 111-71-7 |
| Molecular Weight (g/mol) | 114.19 |
| ChEBI | CHEBI:34787 |
| MDL Number | MFCD00007028 |
| SMILES | CCCCCCC=O |
| Synonym | heptaldehyde,enanthaldehyde,n-heptaldehyde,enanthal,heptyl aldehyde,heptanaldehyde,n-heptanal,oenanthaldehyde,enanthole,oenanthal |
| IUPAC Name | heptanal |
| InChI Key | FXHGMKSSBGDXIY-UHFFFAOYSA-N |
| Molecular Formula | C7H14O |
Formic Acid, 88% (Certified ACS), Fisher Chemical™
CAS: 64-18-6 Molecular Formula: CH2O2 Molecular Weight (g/mol): 46.025 MDL Number: MFCD00003297 InChI Key: BDAGIHXWWSANSR-UHFFFAOYSA-N Synonym: methanoic acid,formylic acid,aminic acid,bilorin,hydrogen carboxylic acid,formisoton,myrmicyl,formira,acide formique,collo-bueglatt PubChem CID: 284 ChEBI: CHEBI:30751 IUPAC Name: formic acid SMILES: C(=O)O
| PubChem CID | 284 |
|---|---|
| CAS | 64-18-6 |
| Molecular Weight (g/mol) | 46.025 |
| ChEBI | CHEBI:30751 |
| MDL Number | MFCD00003297 |
| SMILES | C(=O)O |
| Synonym | methanoic acid,formylic acid,aminic acid,bilorin,hydrogen carboxylic acid,formisoton,myrmicyl,formira,acide formique,collo-bueglatt |
| IUPAC Name | formic acid |
| InChI Key | BDAGIHXWWSANSR-UHFFFAOYSA-N |
| Molecular Formula | CH2O2 |
1-Pentanol, 98+%
CAS: 71-41-0 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00002977,MFCD00081734,MFCD01075169 InChI Key: AMQJEAYHLZJPGS-UHFFFAOYSA-N Synonym: 1-pentanol,amyl alcohol,n-amyl alcohol,n-pentanol,pentanol,pentyl alcohol,butylcarbinol,1-pentyl alcohol,amylol,n-butylcarbinol PubChem CID: 6276 ChEBI: CHEBI:44884 IUPAC Name: pentan-1-ol SMILES: CCCCCO
| PubChem CID | 6276 |
|---|---|
| CAS | 71-41-0 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:44884 |
| MDL Number | MFCD00002977,MFCD00081734,MFCD01075169 |
| SMILES | CCCCCO |
| Synonym | 1-pentanol,amyl alcohol,n-amyl alcohol,n-pentanol,pentanol,pentyl alcohol,butylcarbinol,1-pentyl alcohol,amylol,n-butylcarbinol |
| IUPAC Name | pentan-1-ol |
| InChI Key | AMQJEAYHLZJPGS-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Magnesium nitrate hexahydrate, ACS, 98.0-102.0%
CAS: 13446-18-9 Molecular Formula: H12MgN2O12 Molecular Weight (g/mol): 256.40 MDL Number: MFCD00149779 InChI Key: MFUVDXOKPBAHMC-UHFFFAOYSA-N Synonym: magnesium nitrate hexahydrate,magnesium dinitrate hexahydrate,unii-v85k20ljmk,dusicnan horecnaty czech,v85k20ljmk,nitric acid, magnesium salt, hexahydrate,magnesium ii nitrate 1:2 , hexahydrate,magnesium 2+ ion hexahydrate dinitrate,magnesium, reference standard solution,dusicnan horecnaty PubChem CID: 202877 IUPAC Name: magnesium;dinitrate;hexahydrate SMILES: O.O.O.O.O.O.[Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 202877 |
|---|---|
| CAS | 13446-18-9 |
| Molecular Weight (g/mol) | 256.40 |
| MDL Number | MFCD00149779 |
| SMILES | O.O.O.O.O.O.[Mg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | magnesium nitrate hexahydrate,magnesium dinitrate hexahydrate,unii-v85k20ljmk,dusicnan horecnaty czech,v85k20ljmk,nitric acid, magnesium salt, hexahydrate,magnesium ii nitrate 1:2 , hexahydrate,magnesium 2+ ion hexahydrate dinitrate,magnesium, reference standard solution,dusicnan horecnaty |
| IUPAC Name | magnesium;dinitrate;hexahydrate |
| InChI Key | MFUVDXOKPBAHMC-UHFFFAOYSA-N |
| Molecular Formula | H12MgN2O12 |
Ammonium iron(III) sulfate dodecahydrate, 99%, ACS reagent
CAS: 7783-83-7 Molecular Formula: H4FeNO8S2·12H2O Molecular Weight (g/mol): 482.19 MDL Number: MFCD00150004 InChI Key: LCPUDZUWZDSKMX-UHFFFAOYSA-K Synonym: ammonium ferric sulfate,ferric ammonium sulfate dodecahydrate,iron ammonium sulfate dodecahydrate,sulfuric acid, ammonium iron 3+ salt 2:1:1 , dodecahydrate,ferric ammonium sulfate, acs,azanium iron 3+ disulfate dodecahydrate,ferric iron ammonium dodecahydrate disulfate,azanium iron +3 cation disulfate dodecahydrate,ammonium iron iii sulfate dodecahydrate, acs 100g PubChem CID: 197097 IUPAC Name: azanium;iron(3+);disulfate;dodecahydrate SMILES: [NH4+].O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3]
| PubChem CID | 197097 |
|---|---|
| CAS | 7783-83-7 |
| Molecular Weight (g/mol) | 482.19 |
| MDL Number | MFCD00150004 |
| SMILES | [NH4+].O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3] |
| Synonym | ammonium ferric sulfate,ferric ammonium sulfate dodecahydrate,iron ammonium sulfate dodecahydrate,sulfuric acid, ammonium iron 3+ salt 2:1:1 , dodecahydrate,ferric ammonium sulfate, acs,azanium iron 3+ disulfate dodecahydrate,ferric iron ammonium dodecahydrate disulfate,azanium iron +3 cation disulfate dodecahydrate,ammonium iron iii sulfate dodecahydrate, acs 100g |
| IUPAC Name | azanium;iron(3+);disulfate;dodecahydrate |
| InChI Key | LCPUDZUWZDSKMX-UHFFFAOYSA-K |
| Molecular Formula | H4FeNO8S2·12H2O |
Thermo Scientific Chemicals DL-1,4-Dithiothreitol, 99%, for biochemistry
CAS: 12-3-3483 MDL Number: MFCD00004877 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| ChEBI | CHEBI:42170 |
| MDL Number | MFCD00004877 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
Lead(II) nitrate, 99+%, ACS reagent
CAS: 10099-74-8 Molecular Formula: N2O6Pb Molecular Weight (g/mol): 331.20 MDL Number: MFCD00011153 InChI Key: RLJMLMKIBZAXJO-UHFFFAOYSA-N Synonym: lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt PubChem CID: 24924 ChEBI: CHEBI:37187 SMILES: [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24924 |
|---|---|
| CAS | 10099-74-8 |
| Molecular Weight (g/mol) | 331.20 |
| ChEBI | CHEBI:37187 |
| MDL Number | MFCD00011153 |
| SMILES | [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt |
| InChI Key | RLJMLMKIBZAXJO-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pb |
Copper(II) sulfate, anhydrous, 98%
CAS: 7758-98-7 Molecular Formula: CuO4S Molecular Weight (g/mol): 159.602 MDL Number: MFCD00010981 InChI Key: ARUVKPQLZAKDPS-UHFFFAOYSA-L Synonym: copper sulfate,copper ii sulfate,cupric sulfate anhydrous,copper sulphate,copper 2+ sulfate,blue stone,copper monosulfate,copper ii sulfate, anhydrous,hylinec,trinagle PubChem CID: 24462 ChEBI: CHEBI:23414 IUPAC Name: copper;sulfate SMILES: [O-]S(=O)(=O)[O-].[Cu+2]
| PubChem CID | 24462 |
|---|---|
| CAS | 7758-98-7 |
| Molecular Weight (g/mol) | 159.602 |
| ChEBI | CHEBI:23414 |
| MDL Number | MFCD00010981 |
| SMILES | [O-]S(=O)(=O)[O-].[Cu+2] |
| Synonym | copper sulfate,copper ii sulfate,cupric sulfate anhydrous,copper sulphate,copper 2+ sulfate,blue stone,copper monosulfate,copper ii sulfate, anhydrous,hylinec,trinagle |
| IUPAC Name | copper;sulfate |
| InChI Key | ARUVKPQLZAKDPS-UHFFFAOYSA-L |
| Molecular Formula | CuO4S |
Tetraethyl orthosilicate, 98%
CAS: 78-10-4 Molecular Formula: C8H20O4Si Molecular Weight (g/mol): 208.33 MDL Number: MFCD00009062 InChI Key: BOTDANWDWHJENH-UHFFFAOYSA-N Synonym: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC Name: tetraethyl silicate SMILES: CCO[Si](OCC)(OCC)OCC
| PubChem CID | 6517 |
|---|---|
| CAS | 78-10-4 |
| Molecular Weight (g/mol) | 208.33 |
| MDL Number | MFCD00009062 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| Synonym | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
| IUPAC Name | tetraethyl silicate |
| InChI Key | BOTDANWDWHJENH-UHFFFAOYSA-N |
| Molecular Formula | C8H20O4Si |
Thermo Scientific Chemicals FerroZine™ Iron Reagent, Hydrate, 95+%, Pure
CAS: 1266615-85-3 Molecular Formula: C20H13N4NaO6S2 Molecular Weight (g/mol): 492.46 MDL Number: MFCD00150794 InChI Key: ZGVNYCXXBQPDPQ-UHFFFAOYSA-M Synonym: ferrozine mono-sodium salt hydrate,ferrozine™ iron reagent,c20h13n4o6s2.na.h2o,pdt disulfonate monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate PubChem CID: 129893581 IUPAC Name: sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate SMILES: [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O
| PubChem CID | 129893581 |
|---|---|
| CAS | 1266615-85-3 |
| Molecular Weight (g/mol) | 492.46 |
| MDL Number | MFCD00150794 |
| SMILES | [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O |
| Synonym | ferrozine mono-sodium salt hydrate,ferrozine™ iron reagent,c20h13n4o6s2.na.h2o,pdt disulfonate monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate |
| IUPAC Name | sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate |
| InChI Key | ZGVNYCXXBQPDPQ-UHFFFAOYSA-M |
| Molecular Formula | C20H13N4NaO6S2 |
Acetone, 99+%, extra pure
CAS: 67-64-1 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00008765 InChI Key: CSCPPACGZOOCGX-UHFFFAOYSA-N Synonym: acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone PubChem CID: 180 ChEBI: CHEBI:15347 IUPAC Name: propan-2-one SMILES: CC(C)=O
| PubChem CID | 180 |
|---|---|
| CAS | 67-64-1 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:15347 |
| MDL Number | MFCD00008765 |
| SMILES | CC(C)=O |
| Synonym | acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone |
| IUPAC Name | propan-2-one |
| InChI Key | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O |
Sodium phosphate, tribasic, anhydrous, tech.
CAS: 7601-54-9 Molecular Formula: Na3O4P Molecular Weight (g/mol): 163.939 MDL Number: MFCD00003510 InChI Key: RYFMWSXOAZQYPI-UHFFFAOYSA-K Synonym: trisodium phosphate,sodium orthophosphate,tromete,tribasic sodium phosphate,phosphoric acid, trisodium salt,oakite,sodium phosphate, anhydrous,trisodium orthophosphate,phosphoric acid trisodium salt,trinatriumphosphat PubChem CID: 24243 ChEBI: CHEBI:37583 IUPAC Name: trisodium;phosphate SMILES: [O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+]
| PubChem CID | 24243 |
|---|---|
| CAS | 7601-54-9 |
| Molecular Weight (g/mol) | 163.939 |
| ChEBI | CHEBI:37583 |
| MDL Number | MFCD00003510 |
| SMILES | [O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| Synonym | trisodium phosphate,sodium orthophosphate,tromete,tribasic sodium phosphate,phosphoric acid, trisodium salt,oakite,sodium phosphate, anhydrous,trisodium orthophosphate,phosphoric acid trisodium salt,trinatriumphosphat |
| IUPAC Name | trisodium;phosphate |
| InChI Key | RYFMWSXOAZQYPI-UHFFFAOYSA-K |
| Molecular Formula | Na3O4P |
Acriflavine neutral, 13.3-15.8% chlorine
CAS: 8048-52-0 Molecular Formula: C27H25ClN6 Molecular Weight (g/mol): 468.99 MDL Number: MFCD00064307 InChI Key: PEJLNXHANOHNSU-UHFFFAOYSA-N Synonym: Acriflavine base,3, 6-Diamino-10-methylacridinium chloride,Euflavine IUPAC Name: 3,6-diamino-10-methylacridin-10-ium acridine-3,6-diamine chloride SMILES: [Cl-].NC1=CC2=NC3=CC(N)=CC=C3C=C2C=C1.C[N+]1=C2C=C(N)C=CC2=CC2=CC=C(N)C=C12
| CAS | 8048-52-0 |
|---|---|
| Molecular Weight (g/mol) | 468.99 |
| MDL Number | MFCD00064307 |
| SMILES | [Cl-].NC1=CC2=NC3=CC(N)=CC=C3C=C2C=C1.C[N+]1=C2C=C(N)C=CC2=CC2=CC=C(N)C=C12 |
| Synonym | Acriflavine base,3, 6-Diamino-10-methylacridinium chloride,Euflavine |
| IUPAC Name | 3,6-diamino-10-methylacridin-10-ium acridine-3,6-diamine chloride |
| InChI Key | PEJLNXHANOHNSU-UHFFFAOYSA-N |
| Molecular Formula | C27H25ClN6 |
| Linear Formula | KOH |
|---|---|
| Molecular Weight (g/mol) | 56.11 |
| ChEBI | CHEBI:32035 |
| InChI Key | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
| Density | 0.8600g/mL |
| PubChem CID | 14797 |
| Name Note | 1N solution in ethanol |
| Formula Weight | 56.11 |
| Melting Point | -117.0°C |
| Boiling Point | 78.0°C |
| Color | Brown-Orange to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Potassium hydroxide |
| SMILES | [OH-].[K+] |
| Merck Index | 15, 7761 |
| Concentration | 0.950 to 1.050N |
| CAS | 64-17-5 |
| Health Hazard 3 | GHS P Statement: IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00003553 |
| Health Hazard 2 | GHS H Statement: Causes severe skin burns and eye damage. Highly flammable liquid and vapor. |
| Packaging | Plastic bottle |
| Flash Point | 12°C |
| Solubility Information | Solubility in water: soluble. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 |
| Recommended Storage | May darken on storage |
| IUPAC Name | potassium hydroxide |
| Molecular Formula | HKO |
| Specific Gravity | 0.86 |