Chemicals
Filtered Search Results
Perchloric acid, ACS reagent, ca. 70% solution in water
CAS: 7601-90-3 Molecular Formula: ClHO4 Molecular Weight (g/mol): 100.45 MDL Number: MFCD00011325 InChI Key: VLTRZXGMWDSKGL-UHFFFAOYSA-N Synonym: unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 PubChem CID: 24247 ChEBI: CHEBI:29221 IUPAC Name: perchloric acid SMILES: O[Cl](=O)(=O)=O
| PubChem CID | 24247 |
|---|---|
| CAS | 7601-90-3 |
| Molecular Weight (g/mol) | 100.45 |
| ChEBI | CHEBI:29221 |
| MDL Number | MFCD00011325 |
| SMILES | O[Cl](=O)(=O)=O |
| Synonym | unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 |
| IUPAC Name | perchloric acid |
| InChI Key | VLTRZXGMWDSKGL-UHFFFAOYSA-N |
| Molecular Formula | ClHO4 |
sec-Butanol, 99+%, for analysis
CAS: 78-92-2 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00004569 InChI Key: BTANRVKWQNVYAZ-UHFFFAOYNA-N Synonym: 2-butanol,sec-butanol,sec-butyl alcohol,2-hydroxybutane,2-butyl alcohol,s-butyl alcohol,butylene hydrate,s-butanol,1-methyl-1-propanol,1-methylpropyl alcohol PubChem CID: 6568 ChEBI: CHEBI:35687 IUPAC Name: butan-2-ol SMILES: CCC(C)O
| PubChem CID | 6568 |
|---|---|
| CAS | 78-92-2 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35687 |
| MDL Number | MFCD00004569 |
| SMILES | CCC(C)O |
| Synonym | 2-butanol,sec-butanol,sec-butyl alcohol,2-hydroxybutane,2-butyl alcohol,s-butyl alcohol,butylene hydrate,s-butanol,1-methyl-1-propanol,1-methylpropyl alcohol |
| IUPAC Name | butan-2-ol |
| InChI Key | BTANRVKWQNVYAZ-UHFFFAOYNA-N |
| Molecular Formula | C4H10O |
Isopropyl methanesulfonate, 99%
CAS: 926-06-7 Molecular Formula: C4H10O3S Molecular Weight (g/mol): 138.19 MDL Number: MFCD00047802 InChI Key: SWWHCQCMVCPLEQ-UHFFFAOYSA-N Synonym: isopropyl methanesulfonate,isopropyl mesylate,isopropylmethanesulfonate,methanesulfonic acid, 1-methylethyl ester,isopropyl methane sulphonate,2-propyl methanesulphonate,isopropyl methane sulfonate,methanesulfonic acid, isopropyl ester,isopropyl methanesulphonate,unii-t0k2txy26b PubChem CID: 13551 IUPAC Name: propan-2-yl methanesulfonate SMILES: CC(C)OS(=O)(=O)C
| PubChem CID | 13551 |
|---|---|
| CAS | 926-06-7 |
| Molecular Weight (g/mol) | 138.19 |
| MDL Number | MFCD00047802 |
| SMILES | CC(C)OS(=O)(=O)C |
| Synonym | isopropyl methanesulfonate,isopropyl mesylate,isopropylmethanesulfonate,methanesulfonic acid, 1-methylethyl ester,isopropyl methane sulphonate,2-propyl methanesulphonate,isopropyl methane sulfonate,methanesulfonic acid, isopropyl ester,isopropyl methanesulphonate,unii-t0k2txy26b |
| IUPAC Name | propan-2-yl methanesulfonate |
| InChI Key | SWWHCQCMVCPLEQ-UHFFFAOYSA-N |
| Molecular Formula | C4H10O3S |
| Boiling Point | 100.0°C to 140.0°C |
|---|---|
| Viscosity | 0.76 mm2/s (25°C) |
| Physical Form | Liquid |
| Chemical Name or Material | Petroleum ether |
| Grade | Extra Pure |
| Merck Index | 14, 5489 |
| Residue after Evaporation | 0.005% max. |
| Density | 0.7400g/mL |
| CAS | 73513-42-5 |
| Infrared Spectrum | Authentic |
| Health Hazard 3 | GHS P Statement: IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Avoid breathing dust/fume/gas/mist/vapors/spray. Avoid release to the environment. Wash face, hands and any exposed skin thoroughly after handling. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00081849 |
| Health Hazard 2 | GHS H Statement: May be fatal if swallowed and enters airways. Causes skin irritation. May cause drowsiness or dizziness. Very toxic to aquatic life with long lasting effects. Highly flammable liquid and vapor. |
| Solubility Information | Solubility in water: insoluble. |
| Flash Point | 2°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.4030 to 1.4080 |
| IUPAC Name | Petroleum ether |
| Specific Gravity | 0.74 |
| Melting Point | -30.0°C |
Phthalic acid, 99%
CAS: 88-99-3 Molecular Formula: C8H6O4 Molecular Weight (g/mol): 166.132 MDL Number: MFCD00002467 InChI Key: XNGIFLGASWRNHJ-UHFFFAOYSA-N Synonym: 1,2-benzenedicarboxylic acid,benzene-1,2-dicarboxylic acid,o-phthalic acid,o-dicarboxybenzene,o-benzenedicarboxylic acid,pathalic acid,acide phtalique,kyselina ftalova,ortho-phthalic acid,phthalicacid PubChem CID: 1017 ChEBI: CHEBI:29069 IUPAC Name: phthalic acid SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)O
| PubChem CID | 1017 |
|---|---|
| CAS | 88-99-3 |
| Molecular Weight (g/mol) | 166.132 |
| ChEBI | CHEBI:29069 |
| MDL Number | MFCD00002467 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)O |
| Synonym | 1,2-benzenedicarboxylic acid,benzene-1,2-dicarboxylic acid,o-phthalic acid,o-dicarboxybenzene,o-benzenedicarboxylic acid,pathalic acid,acide phtalique,kyselina ftalova,ortho-phthalic acid,phthalicacid |
| IUPAC Name | phthalic acid |
| InChI Key | XNGIFLGASWRNHJ-UHFFFAOYSA-N |
| Molecular Formula | C8H6O4 |
p-Naphtholbenzein, TCI America™
CAS: 145-50-6 Molecular Formula: C27H18O2 Molecular Weight (g/mol): 374.439 MDL Number: MFCD00078492 InChI Key: VDDWRTZCUJCDJM-PNHLSOANSA-N Synonym: p-naphtholbenzein,1-naphtholbenzein,alpha-naphtholbenzein,.alpha.-naphtholbenzein,4-4-hydroxynaphthyl phenylmethylene naphthalen-1-one,naphtholbenzein,1 4h-naphthalenone, 4-4-hydroxy-1-naphthalenyl phenylmethylene,1 4h-naphthalenone,4-4-hydroxy-1-naphthalenyl phenylmethylene,1 4h-naphthalenone, 4-.alpha.-4-hydroxy-1-naphthyl benzylidene PubChem CID: 5941340 IUPAC Name: (4Z)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-one SMILES: C1=CC=C(C=C1)C(=C2C=CC(=O)C3=CC=CC=C23)C4=CC=C(C5=CC=CC=C54)O
| PubChem CID | 5941340 |
|---|---|
| CAS | 145-50-6 |
| Molecular Weight (g/mol) | 374.439 |
| MDL Number | MFCD00078492 |
| SMILES | C1=CC=C(C=C1)C(=C2C=CC(=O)C3=CC=CC=C23)C4=CC=C(C5=CC=CC=C54)O |
| Synonym | p-naphtholbenzein,1-naphtholbenzein,alpha-naphtholbenzein,.alpha.-naphtholbenzein,4-4-hydroxynaphthyl phenylmethylene naphthalen-1-one,naphtholbenzein,1 4h-naphthalenone, 4-4-hydroxy-1-naphthalenyl phenylmethylene,1 4h-naphthalenone,4-4-hydroxy-1-naphthalenyl phenylmethylene,1 4h-naphthalenone, 4-.alpha.-4-hydroxy-1-naphthyl benzylidene |
| IUPAC Name | (4Z)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-one |
| InChI Key | VDDWRTZCUJCDJM-PNHLSOANSA-N |
| Molecular Formula | C27H18O2 |
2,5-Bis(5-tert-butyl-2-benzoxazolyl)thiophene, 99%
CAS: 7128-64-5 Molecular Formula: C26H26N2O2S Molecular Weight (g/mol): 430.566 MDL Number: MFCD00005774 InChI Key: AIXZBGVLNVRQSS-UHFFFAOYSA-N Synonym: bbot,2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene,uvitex ob,2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene,bbot 150,2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene,benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl,unii-w7ur9129gp,fluorescent brightener 184,2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole PubChem CID: 292429 IUPAC Name: 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole SMILES: CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C
| PubChem CID | 292429 |
|---|---|
| CAS | 7128-64-5 |
| Molecular Weight (g/mol) | 430.566 |
| MDL Number | MFCD00005774 |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C |
| Synonym | bbot,2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene,uvitex ob,2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene,bbot 150,2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene,benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl,unii-w7ur9129gp,fluorescent brightener 184,2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole |
| IUPAC Name | 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole |
| InChI Key | AIXZBGVLNVRQSS-UHFFFAOYSA-N |
| Molecular Formula | C26H26N2O2S |
1-Butanol, 99+%, for spectroscopy
CAS: 71-36-3 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00002964 InChI Key: LRHPLDYGYMQRHN-UHFFFAOYSA-N Synonym: 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane PubChem CID: 263 ChEBI: CHEBI:28885 IUPAC Name: butan-1-ol SMILES: CCCCO
| PubChem CID | 263 |
|---|---|
| CAS | 71-36-3 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:28885 |
| MDL Number | MFCD00002964 |
| SMILES | CCCCO |
| Synonym | 1-butanol,butanol,n-butanol,butyl alcohol,n-butyl alcohol,1-hydroxybutane,propylcarbinol,butyl hydroxide,propylmethanol,methylolpropane |
| IUPAC Name | butan-1-ol |
| InChI Key | LRHPLDYGYMQRHN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Quercetin dihydrate, 97%
CAS: 6151-25-3 Molecular Formula: C15H14O9 Molecular Weight (g/mol): 338.27 MDL Number: MFCD00149487 InChI Key: GMGIWEZSKCNYSW-UHFFFAOYSA-N Synonym: quercetin dihydrate,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one dihydrate,quercetine dihydrate,quercetin, dihydrate,ccris 3304,3,3',4',5,7-pentahydroxyflavone dihydrate,quercetin dihydrate sophoretin,flavone, 3,3',4',5,7-pentahydroxy-, dihydrate,dsstox_cid_1219,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-1-benzopyran-4-one dihydrate PubChem CID: 5284452 IUPAC Name: 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dihydrate SMILES: O.O.OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC=C(O)C(O)=C2)=C1
| PubChem CID | 5284452 |
|---|---|
| CAS | 6151-25-3 |
| Molecular Weight (g/mol) | 338.27 |
| MDL Number | MFCD00149487 |
| SMILES | O.O.OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC=C(O)C(O)=C2)=C1 |
| Synonym | quercetin dihydrate,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one dihydrate,quercetine dihydrate,quercetin, dihydrate,ccris 3304,3,3',4',5,7-pentahydroxyflavone dihydrate,quercetin dihydrate sophoretin,flavone, 3,3',4',5,7-pentahydroxy-, dihydrate,dsstox_cid_1219,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-1-benzopyran-4-one dihydrate |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dihydrate |
| InChI Key | GMGIWEZSKCNYSW-UHFFFAOYSA-N |
| Molecular Formula | C15H14O9 |
Naphthalene, 99%
CAS: 91-20-3 Molecular Formula: C10H8 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00001742 InChI Key: UFWIBTONFRDIAS-UHFFFAOYSA-N Synonym: naphthalin,naphthene,camphor tar,tar camphor,white tar,albocarbon,naphthaline,moth flakes,moth balls,naphtalene PubChem CID: 931 ChEBI: CHEBI:16482 IUPAC Name: naphthalene SMILES: C1=CC2=CC=CC=C2C=C1
| PubChem CID | 931 |
|---|---|
| CAS | 91-20-3 |
| Molecular Weight (g/mol) | 128.17 |
| ChEBI | CHEBI:16482 |
| MDL Number | MFCD00001742 |
| SMILES | C1=CC2=CC=CC=C2C=C1 |
| Synonym | naphthalin,naphthene,camphor tar,tar camphor,white tar,albocarbon,naphthaline,moth flakes,moth balls,naphtalene |
| IUPAC Name | naphthalene |
| InChI Key | UFWIBTONFRDIAS-UHFFFAOYSA-N |
| Molecular Formula | C10H8 |
Sodium Bicarbonate, 99+%, Extra Pure
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Thermo Scientific Chemicals DL-1,4-Dithiothreitol, 99%, for biochemistry
CAS: 12-3-3483 MDL Number: MFCD00004877 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| ChEBI | CHEBI:42170 |
| MDL Number | MFCD00004877 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
Magnesium acetate tetrahydrate, ACS, 98.0-102.0%
CAS: 16674-78-5 Molecular Formula: C4H14MgO8 Molecular Weight (g/mol): 214.45 MDL Number: MFCD00149214 InChI Key: XKPKPGCRSHFTKM-UHFFFAOYSA-L Synonym: magnesium acetate tetrahydrate,cromosa,acetic acid, magnesium salt, tetrahydrate,unii-i01g0ejc3b,i01g0ejc3b,magnesium diacetate tetrahydrate,magnesium diethanoate tetrahydrate,acmc-20aklu,magnesiumacetatetetrahydrate,ksc497c8p PubChem CID: 134717 IUPAC Name: magnesium(2+) diacetate tetrahydrate SMILES: O.O.O.O.[Mg++].CC([O-])=O.CC([O-])=O
| PubChem CID | 134717 |
|---|---|
| CAS | 16674-78-5 |
| Molecular Weight (g/mol) | 214.45 |
| MDL Number | MFCD00149214 |
| SMILES | O.O.O.O.[Mg++].CC([O-])=O.CC([O-])=O |
| Synonym | magnesium acetate tetrahydrate,cromosa,acetic acid, magnesium salt, tetrahydrate,unii-i01g0ejc3b,i01g0ejc3b,magnesium diacetate tetrahydrate,magnesium diethanoate tetrahydrate,acmc-20aklu,magnesiumacetatetetrahydrate,ksc497c8p |
| IUPAC Name | magnesium(2+) diacetate tetrahydrate |
| InChI Key | XKPKPGCRSHFTKM-UHFFFAOYSA-L |
| Molecular Formula | C4H14MgO8 |
Cobalt(II) sulfate heptahydrate, 98%
CAS: 10026-24-1 Molecular Formula: CoH14O11S Molecular Weight (g/mol): 281.09 MDL Number: MFCD00149658 InChI Key: MEYVLGVRTYSQHI-UHFFFAOYSA-L Synonym: cobalt sulfate heptahydrate,cobalt 2+ sulfate heptahydrate,cobaltous sulfate heptahydrate,cobalt ii sulfate heptahydrate,cobalt monosulfate heptahydrate,dsstox_cid_340,dsstox_rid_75523,dsstox_gsid_20340,bieberite,coo4s.7h2o PubChem CID: 61444 IUPAC Name: cobalt(2+);sulfate;heptahydrate SMILES: O.O.O.O.O.O.O.[Co++].[O-]S([O-])(=O)=O
| PubChem CID | 61444 |
|---|---|
| CAS | 10026-24-1 |
| Molecular Weight (g/mol) | 281.09 |
| MDL Number | MFCD00149658 |
| SMILES | O.O.O.O.O.O.O.[Co++].[O-]S([O-])(=O)=O |
| Synonym | cobalt sulfate heptahydrate,cobalt 2+ sulfate heptahydrate,cobaltous sulfate heptahydrate,cobalt ii sulfate heptahydrate,cobalt monosulfate heptahydrate,dsstox_cid_340,dsstox_rid_75523,dsstox_gsid_20340,bieberite,coo4s.7h2o |
| IUPAC Name | cobalt(2+);sulfate;heptahydrate |
| InChI Key | MEYVLGVRTYSQHI-UHFFFAOYSA-L |
| Molecular Formula | CoH14O11S |
1,1,1-Trifluoroacetone, 95%
CAS: 421-50-1 Molecular Formula: C3H3F3O Molecular Weight (g/mol): 112.051 MDL Number: MFCD00000423 InChI Key: FHUDAMLDXFJHJE-UHFFFAOYSA-N Synonym: 1,1,1-trifluoroacetone,trifluoroacetone,1,1,1-trifluoro-2-propanone,methyl trifluoromethyl ketone,2-propanone, 1,1,1-trifluoro,trifluoromethyl methyl ketone,3,3,3-trifluoroacetone,1,1,1,-trifluoroacetone,trifluoroketone,trifluoracetone PubChem CID: 9871 IUPAC Name: 1,1,1-trifluoropropan-2-one SMILES: CC(=O)C(F)(F)F
| PubChem CID | 9871 |
|---|---|
| CAS | 421-50-1 |
| Molecular Weight (g/mol) | 112.051 |
| MDL Number | MFCD00000423 |
| SMILES | CC(=O)C(F)(F)F |
| Synonym | 1,1,1-trifluoroacetone,trifluoroacetone,1,1,1-trifluoro-2-propanone,methyl trifluoromethyl ketone,2-propanone, 1,1,1-trifluoro,trifluoromethyl methyl ketone,3,3,3-trifluoroacetone,1,1,1,-trifluoroacetone,trifluoroketone,trifluoracetone |
| IUPAC Name | 1,1,1-trifluoropropan-2-one |
| InChI Key | FHUDAMLDXFJHJE-UHFFFAOYSA-N |
| Molecular Formula | C3H3F3O |