Chemicals
Filtered Search Results
Mercury(I) nitrate dihydrate, 97%
CAS: 7782-86-7 Molecular Formula: Hg2(NO3)2·2H2O MDL Number: MFCD00150812 Synonym: Mercurous nitrate
| CAS | 7782-86-7 |
|---|---|
| MDL Number | MFCD00150812 |
| Synonym | Mercurous nitrate |
| Molecular Formula | Hg2(NO3)2·2H2O |
Cesium nitrate, 99.999% (metals basis)
CAS: 7789-18-6 Molecular Formula: CsNO3 Molecular Weight (g/mol): 194.909 MDL Number: MFCD00010963 InChI Key: NLSCHDZTHVNDCP-UHFFFAOYSA-N Synonym: cesium nitrate,caesium nitrate,nitric acid, cesium salt,cesium i nitrate 1:1,caesium 1+ nitronate,acmc-1bhhg,caesium 1+ ion nitronate,ksc492a7j PubChem CID: 62674 IUPAC Name: cesium;nitrate SMILES: [N+](=O)([O-])[O-].[Cs+]
| PubChem CID | 62674 |
|---|---|
| CAS | 7789-18-6 |
| Molecular Weight (g/mol) | 194.909 |
| MDL Number | MFCD00010963 |
| SMILES | [N+](=O)([O-])[O-].[Cs+] |
| Synonym | cesium nitrate,caesium nitrate,nitric acid, cesium salt,cesium i nitrate 1:1,caesium 1+ nitronate,acmc-1bhhg,caesium 1+ ion nitronate,ksc492a7j |
| IUPAC Name | cesium;nitrate |
| InChI Key | NLSCHDZTHVNDCP-UHFFFAOYSA-N |
| Molecular Formula | CsNO3 |
Tin(IV) chloride pentahydrate, 98+%, extra pure
CAS: 10026-06-9 Molecular Formula: Cl4H10O5Sn Molecular Weight (g/mol): 350.59 MDL Number: MFCD00149864 InChI Key: KHMOASUYFVRATF-UHFFFAOYSA-J Synonym: tin iv chloride pentahydrate,tetrachlorostannane pentahydrate,tin chloride pentahydrate,stannic chloride pentahydrate,stannane, tetrachloro-, pentahydrate,ccris 6330,tin iv chloride, pentahydrate 1:4:5,cl4sn.5h2o,stannic chloride 5h2o PubChem CID: 61442 IUPAC Name: tin(4+) pentahydrate tetrachloride SMILES: O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cl-].[Sn+4]
| PubChem CID | 61442 |
|---|---|
| CAS | 10026-06-9 |
| Molecular Weight (g/mol) | 350.59 |
| MDL Number | MFCD00149864 |
| SMILES | O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Cl-].[Sn+4] |
| Synonym | tin iv chloride pentahydrate,tetrachlorostannane pentahydrate,tin chloride pentahydrate,stannic chloride pentahydrate,stannane, tetrachloro-, pentahydrate,ccris 6330,tin iv chloride, pentahydrate 1:4:5,cl4sn.5h2o,stannic chloride 5h2o |
| IUPAC Name | tin(4+) pentahydrate tetrachloride |
| InChI Key | KHMOASUYFVRATF-UHFFFAOYSA-J |
| Molecular Formula | Cl4H10O5Sn |
2,2,4-Trimethylpentane, 99+%, ACS reagent
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Salicylic acid, 99%
CAS: 69-72-7 Molecular Formula: C7H6O3 Molecular Weight (g/mol): 138.12 MDL Number: MFCD00002439 InChI Key: YGSDEFSMJLZEOE-UHFFFAOYSA-N Synonym: salicylic acid,o-hydroxybenzoic acid,2-carboxyphenol,o-carboxyphenol,rutranex,salonil,retarder w,keralyt,duoplant,freezone PubChem CID: 338 ChEBI: CHEBI:16914 IUPAC Name: 2-hydroxybenzoic acid SMILES: OC(=O)C1=CC=CC=C1O
| PubChem CID | 338 |
|---|---|
| CAS | 69-72-7 |
| Molecular Weight (g/mol) | 138.12 |
| ChEBI | CHEBI:16914 |
| MDL Number | MFCD00002439 |
| SMILES | OC(=O)C1=CC=CC=C1O |
| Synonym | salicylic acid,o-hydroxybenzoic acid,2-carboxyphenol,o-carboxyphenol,rutranex,salonil,retarder w,keralyt,duoplant,freezone |
| IUPAC Name | 2-hydroxybenzoic acid |
| InChI Key | YGSDEFSMJLZEOE-UHFFFAOYSA-N |
| Molecular Formula | C7H6O3 |
Tributyl phosphate, 99+%, Thermo Scientific Chemicals
CAS: 126-73-8 Molecular Formula: C12H27O4P Molecular Weight (g/mol): 266.32 MDL Number: MFCD00009436 InChI Key: STCOOQWBFONSKY-UHFFFAOYSA-N Synonym: tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de PubChem CID: 31357 ChEBI: CHEBI:35019 IUPAC Name: tributyl phosphate SMILES: CCCCOP(=O)(OCCCC)OCCCC
| PubChem CID | 31357 |
|---|---|
| CAS | 126-73-8 |
| Molecular Weight (g/mol) | 266.32 |
| ChEBI | CHEBI:35019 |
| MDL Number | MFCD00009436 |
| SMILES | CCCCOP(=O)(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphate,tributylphosphate,butyl phosphate,phosphoric acid tributyl ester,tributylphosphat,celluphos 4,disflamoll tb,tributilfosfato,tributylfosfaat,tributyle phosphate de |
| IUPAC Name | tributyl phosphate |
| InChI Key | STCOOQWBFONSKY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O4P |
Toluene, HPLC Grade, 99.7% min
CAS: 108-88-3 Molecular Formula: C7H8 Molecular Weight (g/mol): 92.14 MDL Number: MFCD00008512 InChI Key: YXFVVABEGXRONW-UHFFFAOYSA-N Synonym: methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene PubChem CID: 1140 ChEBI: CHEBI:17578 IUPAC Name: toluene SMILES: CC1=CC=CC=C1
| PubChem CID | 1140 |
|---|---|
| CAS | 108-88-3 |
| Molecular Weight (g/mol) | 92.14 |
| ChEBI | CHEBI:17578 |
| MDL Number | MFCD00008512 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene |
| IUPAC Name | toluene |
| InChI Key | YXFVVABEGXRONW-UHFFFAOYSA-N |
| Molecular Formula | C7H8 |
Sodium tripolyphosphate
CAS: 7758-29-4 Molecular Formula: Na5O10P3 Molecular Weight (g/mol): 367.86 MDL Number: MFCD00003514 InChI Key: HWGNBUXHKFFFIH-UHFFFAOYSA-I Synonym: sodium tripolyphosphate,sodium triphosphate,pentasodium triphosphate,stpp,thermphos,armofos,polygon,tripoly,rhodiaphos lv,thermphos n PubChem CID: 24455 IUPAC Name: pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate SMILES: [O-]P(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-].[Na+].[Na+].[Na+].[Na+].[Na+]
| PubChem CID | 24455 |
|---|---|
| CAS | 7758-29-4 |
| Molecular Weight (g/mol) | 367.86 |
| MDL Number | MFCD00003514 |
| SMILES | [O-]P(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-].[Na+].[Na+].[Na+].[Na+].[Na+] |
| Synonym | sodium tripolyphosphate,sodium triphosphate,pentasodium triphosphate,stpp,thermphos,armofos,polygon,tripoly,rhodiaphos lv,thermphos n |
| IUPAC Name | pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate |
| InChI Key | HWGNBUXHKFFFIH-UHFFFAOYSA-I |
| Molecular Formula | Na5O10P3 |
N,N-Dimethylacetamide, 99%
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
trans-Cinnamic Acid, 98+%
CAS: 140-10-3 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00004369 InChI Key: WBYWAXJHAXSJNI-VOTSOKGWSA-N Synonym: cinnamic acid,trans-cinnamic acid,e-cinnamic acid,3-phenylacrylic acid,trans-3-phenylacrylic acid,zimtsaeure,2e-3-phenylprop-2-enoic acid,3-phenylprop-2-enoic acid,3-phenylpropenoic acid PubChem CID: 444539 ChEBI: CHEBI:35697 IUPAC Name: (E)-3-phenylprop-2-enoic acid SMILES: C1=CC=C(C=C1)C=CC(=O)O
| PubChem CID | 444539 |
|---|---|
| CAS | 140-10-3 |
| Molecular Weight (g/mol) | 148.161 |
| ChEBI | CHEBI:35697 |
| MDL Number | MFCD00004369 |
| SMILES | C1=CC=C(C=C1)C=CC(=O)O |
| Synonym | cinnamic acid,trans-cinnamic acid,e-cinnamic acid,3-phenylacrylic acid,trans-3-phenylacrylic acid,zimtsaeure,2e-3-phenylprop-2-enoic acid,3-phenylprop-2-enoic acid,3-phenylpropenoic acid |
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
| InChI Key | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| Molecular Formula | C9H8O2 |
Ethyl pyruvate, 98%
CAS: 617-35-6 Molecular Formula: C5H8O3 Molecular Weight (g/mol): 116.116 MDL Number: MFCD00009123 InChI Key: XXRCUYVCPSWGCC-UHFFFAOYSA-N Synonym: ethyl pyruvate,ethyl 2-oxopropionate,pyruvic acid, ethyl ester,propanoic acid, 2-oxo-, ethyl ester,pyruvic acid ethyl ester,ethyl pyroracemate,ethyl acetylformate,2-oxo-propionic acid ethyl ester,ethyl pyruvate natural,ethyl alpha-ketopropionate PubChem CID: 12041 IUPAC Name: ethyl 2-oxopropanoate SMILES: CCOC(=O)C(=O)C
| PubChem CID | 12041 |
|---|---|
| CAS | 617-35-6 |
| Molecular Weight (g/mol) | 116.116 |
| MDL Number | MFCD00009123 |
| SMILES | CCOC(=O)C(=O)C |
| Synonym | ethyl pyruvate,ethyl 2-oxopropionate,pyruvic acid, ethyl ester,propanoic acid, 2-oxo-, ethyl ester,pyruvic acid ethyl ester,ethyl pyroracemate,ethyl acetylformate,2-oxo-propionic acid ethyl ester,ethyl pyruvate natural,ethyl alpha-ketopropionate |
| IUPAC Name | ethyl 2-oxopropanoate |
| InChI Key | XXRCUYVCPSWGCC-UHFFFAOYSA-N |
| Molecular Formula | C5H8O3 |
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9100g/mL |
| PubChem CID | 2723671 |
| Name Note | 40 wt.% solution in methanol |
| Percent Purity | ≥40% |
| Fieser | 05,645; 11,500 |
| Formula Weight | 259.46 |
| Melting Point | -98.0°C |
| Boiling Point | 65.0°C |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Tetrabutylammonium hydroxide |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove conta |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Toxic in contact with skin. Toxic if swallowed. Causes severe skin burns and eye damage. Toxic if inhaled. Causes damage to organs. Highly flammable liquid and vapor. |
| Solubility Information | Solubility in water: soluble |
| Packaging | Glass bottle |
| Flash Point | 12°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.91 |
L(-)-Glutathione, oxidized hydrate, 95%
CAS: 27025-41-8 Molecular Formula: C20H32N6O12S2 Molecular Weight (g/mol): 612.63 MDL Number: MFCD00150701 InChI Key: YPZRWBKMTBYPTK-IOKZUGQQNA-N Synonym: oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized PubChem CID: 65359 ChEBI: CHEBI:17858 IUPAC Name: (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid SMILES: N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O
| PubChem CID | 65359 |
|---|---|
| CAS | 27025-41-8 |
| Molecular Weight (g/mol) | 612.63 |
| ChEBI | CHEBI:17858 |
| MDL Number | MFCD00150701 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O |
| Synonym | oxiglutatione,glutathione disulfide,gssg,oxidized glutathione,glutathione disulphide,glutathione-ssg,l-glutathione oxidized,oxigluthione,glutathone disulfide,glutathione oxidized |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulfanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| InChI Key | YPZRWBKMTBYPTK-IOKZUGQQNA-N |
| Molecular Formula | C20H32N6O12S2 |
Tripotassium citrate monohydrate, 99+%
CAS: 6100-05-6 Molecular Formula: C6H7K3O8 Molecular Weight (g/mol): 324.41 MDL Number: MFCD00150442 InChI Key: PJAHUDTUZRZBKM-UHFFFAOYSA-K Synonym: potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate PubChem CID: 2735208 ChEBI: CHEBI:64746 IUPAC Name: tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+]
| PubChem CID | 2735208 |
|---|---|
| CAS | 6100-05-6 |
| Molecular Weight (g/mol) | 324.41 |
| ChEBI | CHEBI:64746 |
| MDL Number | MFCD00150442 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+] |
| Synonym | potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate |
| IUPAC Name | tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
| InChI Key | PJAHUDTUZRZBKM-UHFFFAOYSA-K |
| Molecular Formula | C6H7K3O8 |
Mercury(II) iodide, 99+%
CAS: 7774-29-0 Molecular Formula: HgI2 Molecular Weight (g/mol): 454.401 MDL Number: MFCD00011044 InChI Key: YFDLHELOZYVNJE-UHFFFAOYSA-L Synonym: mercury diiodide,mercuric iodide,mercury ii iodide,red mercuric iodide,mercuric iodide, red,mercury biniodide,mercury iodide,mercurius bijodatus,hydrargyrum diodatum,hydrargyrum bijodatum PubChem CID: 24485 ChEBI: CHEBI:49659 IUPAC Name: diiodomercury SMILES: I[Hg]I
| PubChem CID | 24485 |
|---|---|
| CAS | 7774-29-0 |
| Molecular Weight (g/mol) | 454.401 |
| ChEBI | CHEBI:49659 |
| MDL Number | MFCD00011044 |
| SMILES | I[Hg]I |
| Synonym | mercury diiodide,mercuric iodide,mercury ii iodide,red mercuric iodide,mercuric iodide, red,mercury biniodide,mercury iodide,mercurius bijodatus,hydrargyrum diodatum,hydrargyrum bijodatum |
| IUPAC Name | diiodomercury |
| InChI Key | YFDLHELOZYVNJE-UHFFFAOYSA-L |
| Molecular Formula | HgI2 |