Chemicals
Filtered Search Results
2-Bromoethylamine hydrobromide, 99%
CAS: 2576-47-8 Molecular Formula: C2H6BrN·HBr Molecular Weight (g/mol): 204.9 MDL Number: MFCD00012886 InChI Key: WJAXXWSZNSFVNG-UHFFFAOYSA-N Synonym: 2-bromoethylamine hydrobromide,2-bromoethanamine hydrobromide,2-aminoethyl bromide hydrobromide,2-bromoethylamine hbr,2-bromoethylammonium bromide,ethanamine, 2-bromo-, hydrobromide,2-bromoethan-1-amine hydrobromide,bromoethylamine hydrobromide,aminoethyl bromide hbr,ethylamine, hydrobromide PubChem CID: 2774217 IUPAC Name: 2-bromoethanamine;hydrobromide SMILES: C(CBr)N.Br
| PubChem CID | 2774217 |
|---|---|
| CAS | 2576-47-8 |
| Molecular Weight (g/mol) | 204.9 |
| MDL Number | MFCD00012886 |
| SMILES | C(CBr)N.Br |
| Synonym | 2-bromoethylamine hydrobromide,2-bromoethanamine hydrobromide,2-aminoethyl bromide hydrobromide,2-bromoethylamine hbr,2-bromoethylammonium bromide,ethanamine, 2-bromo-, hydrobromide,2-bromoethan-1-amine hydrobromide,bromoethylamine hydrobromide,aminoethyl bromide hbr,ethylamine, hydrobromide |
| IUPAC Name | 2-bromoethanamine;hydrobromide |
| InChI Key | WJAXXWSZNSFVNG-UHFFFAOYSA-N |
| Molecular Formula | C2H6BrN·HBr |
2-Butoxyethanol, 99%, extra pure
CAS: 111-76-2 Molecular Formula: C6H14O2 Molecular Weight (g/mol): 118.18 MDL Number: MFCD00002884 InChI Key: POAOYUHQDCAZBD-UHFFFAOYSA-N Synonym: butoxyethanol,butyl glycol,butyl cellosolve,ethylene glycol monobutyl ether,n-butoxyethanol,ethanol, 2-butoxy,ethylene glycol butyl ether,butyl oxitol,glycol butyl ether,glycol ether eb PubChem CID: 8133 ChEBI: CHEBI:63921 SMILES: CCCCOCCO
| PubChem CID | 8133 |
|---|---|
| CAS | 111-76-2 |
| Molecular Weight (g/mol) | 118.18 |
| ChEBI | CHEBI:63921 |
| MDL Number | MFCD00002884 |
| SMILES | CCCCOCCO |
| Synonym | butoxyethanol,butyl glycol,butyl cellosolve,ethylene glycol monobutyl ether,n-butoxyethanol,ethanol, 2-butoxy,ethylene glycol butyl ether,butyl oxitol,glycol butyl ether,glycol ether eb |
| InChI Key | POAOYUHQDCAZBD-UHFFFAOYSA-N |
| Molecular Formula | C6H14O2 |
Calcium sulfate dihydrate, 98+%, ACS reagent
CAS: 10101-41-4 Molecular Formula: CaH4O6S Molecular Weight (g/mol): 172.16 MDL Number: MFCD00149625 InChI Key: PASHVRUKOFIRIK-UHFFFAOYSA-L Synonym: calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone PubChem CID: 24928 ChEBI: CHEBI:32583 IUPAC Name: calcium;sulfate;dihydrate SMILES: O.O.[Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24928 |
|---|---|
| CAS | 10101-41-4 |
| Molecular Weight (g/mol) | 172.16 |
| ChEBI | CHEBI:32583 |
| MDL Number | MFCD00149625 |
| SMILES | O.O.[Ca++].[O-]S([O-])(=O)=O |
| Synonym | calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone |
| IUPAC Name | calcium;sulfate;dihydrate |
| InChI Key | PASHVRUKOFIRIK-UHFFFAOYSA-L |
| Molecular Formula | CaH4O6S |
1-Chlorobutane, 99+%
CAS: 109-69-3 Molecular Formula: C4H9Cl Molecular Weight (g/mol): 92.57 MDL Number: MFCD00001009 InChI Key: VFWCMGCRMGJXDK-UHFFFAOYSA-N Synonym: butyl chloride,n-butyl chloride,butane, 1-chloro,chlorure de butyle,nbc wormer,n-propylcarbinyl chloride,sure shot,butane, chloro,chlorobutane,n-chlorobutane PubChem CID: 8005 IUPAC Name: 1-chlorobutane SMILES: CCCCCl
| PubChem CID | 8005 |
|---|---|
| CAS | 109-69-3 |
| Molecular Weight (g/mol) | 92.57 |
| MDL Number | MFCD00001009 |
| SMILES | CCCCCl |
| Synonym | butyl chloride,n-butyl chloride,butane, 1-chloro,chlorure de butyle,nbc wormer,n-propylcarbinyl chloride,sure shot,butane, chloro,chlorobutane,n-chlorobutane |
| IUPAC Name | 1-chlorobutane |
| InChI Key | VFWCMGCRMGJXDK-UHFFFAOYSA-N |
| Molecular Formula | C4H9Cl |
2-Naphthol, 99+%
CAS: 135-19-3 Molecular Formula: C10H8O Molecular Weight (g/mol): 144.17 MDL Number: MFCD00004067 InChI Key: JWAZRIHNYRIHIV-UHFFFAOYSA-N Synonym: 2-naphthol,2-naphthalenol,beta-naphthol,2-hydroxynaphthalene,betanaphthol,isonaphthol,developer bn,naphthol b,azogen developer a,beta-napthol PubChem CID: 8663 ChEBI: CHEBI:10432 IUPAC Name: naphthalen-2-ol SMILES: C1=CC=C2C=C(C=CC2=C1)O
| PubChem CID | 8663 |
|---|---|
| CAS | 135-19-3 |
| Molecular Weight (g/mol) | 144.17 |
| ChEBI | CHEBI:10432 |
| MDL Number | MFCD00004067 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)O |
| Synonym | 2-naphthol,2-naphthalenol,beta-naphthol,2-hydroxynaphthalene,betanaphthol,isonaphthol,developer bn,naphthol b,azogen developer a,beta-napthol |
| IUPAC Name | naphthalen-2-ol |
| InChI Key | JWAZRIHNYRIHIV-UHFFFAOYSA-N |
| Molecular Formula | C10H8O |
3-Methyl-1-butanol, 99%, for biochemistry, AcroSeal™
CAS: 123-51-3 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 InChI Key: PHTQWCKDNZKARW-UHFFFAOYSA-N Synonym: 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol PubChem CID: 31260 ChEBI: CHEBI:15837 IUPAC Name: 3-methylbutan-1-ol SMILES: CC(C)CCO
| PubChem CID | 31260 |
|---|---|
| CAS | 123-51-3 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:15837 |
| SMILES | CC(C)CCO |
| Synonym | 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol |
| IUPAC Name | 3-methylbutan-1-ol |
| InChI Key | PHTQWCKDNZKARW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
Dichlorodimethylsilane, 99+%, AcroSeal™
CAS: 75-78-5 Molecular Formula: C2H6Cl2Si Molecular Weight (g/mol): 129.06 MDL Number: MFCD00000491 InChI Key: LIKFHECYJZWXFJ-UHFFFAOYSA-N Synonym: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC Name: dichloro(dimethyl)silane SMILES: C[Si](C)(Cl)Cl
| PubChem CID | 6398 |
|---|---|
| CAS | 75-78-5 |
| Molecular Weight (g/mol) | 129.06 |
| MDL Number | MFCD00000491 |
| SMILES | C[Si](C)(Cl)Cl |
| Synonym | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
| IUPAC Name | dichloro(dimethyl)silane |
| InChI Key | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
| Molecular Formula | C2H6Cl2Si |
Triethylamine trihydrofluoride, ca 37% HF, Thermo Scientific Chemicals
CAS: 73602-61-6 Molecular Formula: C6H18F3N Molecular Weight (g/mol): 161.212 MDL Number: MFCD00043294 InChI Key: IKGLACJFEHSFNN-UHFFFAOYSA-N Synonym: triethylamine trihydrofluoride,n,n-diethylethanamine trihydrofluoride,triethylammonium fluoride,ethanamine, n,n-diethyl-, trihydrofluoride,triethylamine trishydrofluoride,hydrogen fluoride in triethylamine,hf in triethylamine,triethylaminetrihydrofluoride,hydrogen fluoride triethylamine,ethanamine, n,n-diethyl-, hydrofluoride 1:3 PubChem CID: 175505 IUPAC Name: N,N-diethylethanamine;trihydrofluoride SMILES: CCN(CC)CC.F.F.F
| PubChem CID | 175505 |
|---|---|
| CAS | 73602-61-6 |
| Molecular Weight (g/mol) | 161.212 |
| MDL Number | MFCD00043294 |
| SMILES | CCN(CC)CC.F.F.F |
| Synonym | triethylamine trihydrofluoride,n,n-diethylethanamine trihydrofluoride,triethylammonium fluoride,ethanamine, n,n-diethyl-, trihydrofluoride,triethylamine trishydrofluoride,hydrogen fluoride in triethylamine,hf in triethylamine,triethylaminetrihydrofluoride,hydrogen fluoride triethylamine,ethanamine, n,n-diethyl-, hydrofluoride 1:3 |
| IUPAC Name | N,N-diethylethanamine;trihydrofluoride |
| InChI Key | IKGLACJFEHSFNN-UHFFFAOYSA-N |
| Molecular Formula | C6H18F3N |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Boiling Point | 110.0°C |
|---|---|
| Linear Formula | [(CH3)2CHCH2]2AIH |
| Molecular Weight (g/mol) | 142.22 |
| Physical Form | Solution |
| Chemical Name or Material | Diisobutylaluminium hydride |
| Merck Index | 15, 3212 |
| Density | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00008928 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Solubility Information | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Molecular Formula | C8H19Al |
| EINECS Number | 214-729-9 |
| Formula Weight | 142.22 |
| Specific Gravity | 0.848 |
Thermo Scientific Chemicals Tamoxifen citrate, 98%
CAS: 54965-24-1 Molecular Formula: C32H37NO8 Molecular Weight (g/mol): 563.65 MDL Number: MFCD00058321 InChI Key: FQZYTYWMLGAPFJ-OQKDUQJOSA-N Synonym: tamoxifen citrate,istubal,zitazonium,unii-7frv7310n6,i.c.i. 46474 citrate,tamoxifen citrate salt,farmifeno,ginarsan,jenoxifen PubChem CID: 2733525 ChEBI: CHEBI:9397 IUPAC Name: 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1
| PubChem CID | 2733525 |
|---|---|
| CAS | 54965-24-1 |
| Molecular Weight (g/mol) | 563.65 |
| ChEBI | CHEBI:9397 |
| MDL Number | MFCD00058321 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1 |
| Synonym | tamoxifen citrate,istubal,zitazonium,unii-7frv7310n6,i.c.i. 46474 citrate,tamoxifen citrate salt,farmifeno,ginarsan,jenoxifen |
| IUPAC Name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | FQZYTYWMLGAPFJ-OQKDUQJOSA-N |
| Molecular Formula | C32H37NO8 |
Manganese(II) chloride, 99+%, anhydrous, -80 mesh
CAS: 7773-01-5 Molecular Formula: Cl2Mn Molecular Weight (g/mol): 125.84 MDL Number: MFCD00011114 InChI Key: GLFNIEUTAYBVOC-UHFFFAOYSA-L Synonym: manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline PubChem CID: 10313134 ChEBI: CHEBI:63041 IUPAC Name: manganese(2+) dichloride SMILES: [Cl-].[Cl-].[Mn++]
| PubChem CID | 10313134 |
|---|---|
| CAS | 7773-01-5 |
| Molecular Weight (g/mol) | 125.84 |
| ChEBI | CHEBI:63041 |
| MDL Number | MFCD00011114 |
| SMILES | [Cl-].[Cl-].[Mn++] |
| Synonym | manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline |
| IUPAC Name | manganese(2+) dichloride |
| InChI Key | GLFNIEUTAYBVOC-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mn |
Copper(II) nitrate, hemipentahydrate, 98+%, ACS reagent
CAS: 19004-19-4 Molecular Formula: 2·5 H2O Molecular Weight (g/mol): 232.6 MDL Number: MFCD02253001 Synonym: dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate
| CAS | 19004-19-4 |
|---|---|
| Molecular Weight (g/mol) | 232.6 |
| MDL Number | MFCD02253001 |
| Synonym | dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate |
| Molecular Formula | 2·5 H2O |
Hydrochloric acid, 36% w/w aq. soln.
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Dimethyl carbonate, 99+%, Extra Dry, AcroSeal™
CAS: 616-38-6 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.08 MDL Number: MFCD00008420 InChI Key: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC Name: dimethyl carbonate SMILES: COC(=O)OC
| PubChem CID | 12021 |
|---|---|
| CAS | 616-38-6 |
| Molecular Weight (g/mol) | 90.08 |
| ChEBI | CHEBI:36596 |
| MDL Number | MFCD00008420 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| IUPAC Name | dimethyl carbonate |
| InChI Key | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
Dipropylene glycol, mixture of isomers, 99%
CAS: 25265-71-8 Molecular Weight (g/mol): 134.18 InChI Key: AZUXKVXMJOIAOF-UHFFFAOYNA-N PubChem CID: 8087 IUPAC Name: 1-(2-hydroxypropoxy)propan-2-ol SMILES: CC(O)COCC(C)O
| PubChem CID | 8087 |
|---|---|
| CAS | 25265-71-8 |
| Molecular Weight (g/mol) | 134.18 |
| SMILES | CC(O)COCC(C)O |
| IUPAC Name | 1-(2-hydroxypropoxy)propan-2-ol |
| InChI Key | AZUXKVXMJOIAOF-UHFFFAOYNA-N |