Chemicals
Filtered Search Results
Lithium bis(trimethylsilyl)amide, 95%
CAS: 4039-32-1 Molecular Formula: C6H18LiNSi2 Molecular Weight (g/mol): 167.33 MDL Number: MFCD00008261 InChI Key: YNESATAKKCNGOF-UHFFFAOYSA-N Synonym: lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide PubChem CID: 2733832 IUPAC Name: lithium;bis(trimethylsilyl)azanide SMILES: [Li+].C[Si](C)(C)[N-][Si](C)(C)C
| PubChem CID | 2733832 |
|---|---|
| CAS | 4039-32-1 |
| Molecular Weight (g/mol) | 167.33 |
| MDL Number | MFCD00008261 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Molecular Formula | C6H18LiNSi2 |
2,2,4-Trimethylpentane, 99+%, ACS reagent
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Thermo Scientific Chemicals Sodium azide, 99+%, for biochemistry
CAS: 26628-22-8 Molecular Formula: N3Na Molecular Weight (g/mol): 65.01 InChI Key: PXIPVTKHYLBLMZ-UHFFFAOYSA-N Synonym: sodium azide,azide, sodium,natriumazid,nemazyd,smite,kazoe,azoture de sodium,sodium azide na n3,hydrazoic acid, sodium salt,natriumazid german PubChem CID: 33557 ChEBI: CHEBI:278547 IUPAC Name: sodium;azide SMILES: [N-]=[N+]=[N-].[Na+]
| PubChem CID | 33557 |
|---|---|
| CAS | 26628-22-8 |
| Molecular Weight (g/mol) | 65.01 |
| ChEBI | CHEBI:278547 |
| SMILES | [N-]=[N+]=[N-].[Na+] |
| Synonym | sodium azide,azide, sodium,natriumazid,nemazyd,smite,kazoe,azoture de sodium,sodium azide na n3,hydrazoic acid, sodium salt,natriumazid german |
| IUPAC Name | sodium;azide |
| InChI Key | PXIPVTKHYLBLMZ-UHFFFAOYSA-N |
| Molecular Formula | N3Na |
Silicone oil, high temperature, usable temperature range: 25 to 250°C (open system) and 25 to 315°C (closed system)
CAS: 68083-14-7 Molecular Formula: C16H22O2Si2 Molecular Weight (g/mol): 302.52 MDL Number: MFCD00132673 InChI Key: ARWRSWALIGRKQA-UHFFFAOYSA-N Synonym: diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. PubChem CID: 121233058 IUPAC Name: methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane SMILES: CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2
| PubChem CID | 121233058 |
|---|---|
| CAS | 68083-14-7 |
| Molecular Weight (g/mol) | 302.52 |
| MDL Number | MFCD00132673 |
| SMILES | CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| Synonym | diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. |
| IUPAC Name | methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane |
| InChI Key | ARWRSWALIGRKQA-UHFFFAOYSA-N |
| Molecular Formula | C16H22O2Si2 |
Diphenyl ether, 99%
CAS: 101-84-8 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.211 MDL Number: MFCD00003034 InChI Key: USIUVYZYUHIAEV-UHFFFAOYSA-N Synonym: diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl PubChem CID: 7583 ChEBI: CHEBI:39258 IUPAC Name: phenoxybenzene SMILES: C1=CC=C(C=C1)OC2=CC=CC=C2
| PubChem CID | 7583 |
|---|---|
| CAS | 101-84-8 |
| Molecular Weight (g/mol) | 170.211 |
| ChEBI | CHEBI:39258 |
| MDL Number | MFCD00003034 |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Synonym | diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl |
| IUPAC Name | phenoxybenzene |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |
4-Hydroxybenzoic Acid, 99+%
CAS: 99-96-7 Molecular Formula: C7H6O3 Molecular Weight (g/mol): 138.12 MDL Number: MFCD00002547 InChI Key: FJKROLUGYXJWQN-UHFFFAOYSA-N Synonym: p-hydroxybenzoic acid,4-carboxyphenol,benzoic acid, 4-hydroxy,p-salicylic acid,benzoic acid, p-hydroxy,para-hydroxybenzoic acid,4-hydroxybenzoesaeure,p-carboxyphenol,4-hydroxy benzoic acid,p-oxybenzoesaure german PubChem CID: 135 ChEBI: CHEBI:30763 IUPAC Name: 4-hydroxybenzoic acid SMILES: OC(=O)C1=CC=C(O)C=C1
| PubChem CID | 135 |
|---|---|
| CAS | 99-96-7 |
| Molecular Weight (g/mol) | 138.12 |
| ChEBI | CHEBI:30763 |
| MDL Number | MFCD00002547 |
| SMILES | OC(=O)C1=CC=C(O)C=C1 |
| Synonym | p-hydroxybenzoic acid,4-carboxyphenol,benzoic acid, 4-hydroxy,p-salicylic acid,benzoic acid, p-hydroxy,para-hydroxybenzoic acid,4-hydroxybenzoesaeure,p-carboxyphenol,4-hydroxy benzoic acid,p-oxybenzoesaure german |
| IUPAC Name | 4-hydroxybenzoic acid |
| InChI Key | FJKROLUGYXJWQN-UHFFFAOYSA-N |
| Molecular Formula | C7H6O3 |
Hexamethylenetetramine, 99%
CAS: 100-97-0 Molecular Formula: C6H12N4 Molecular Weight (g/mol): 140.19 InChI Key: VKYKSIONXSXAKP-UHFFFAOYSA-N Synonym: methenamine,hexamethylenetetramine,hexamine,urotropine,1,3,5,7-tetraazaadamantane,hexamethylenamine,aminoform,methenamin,urotropin,formamine PubChem CID: 4101 ChEBI: CHEBI:6824 SMILES: C1N2CN3CN1CN(C2)C3
| PubChem CID | 4101 |
|---|---|
| CAS | 100-97-0 |
| Molecular Weight (g/mol) | 140.19 |
| ChEBI | CHEBI:6824 |
| SMILES | C1N2CN3CN1CN(C2)C3 |
| Synonym | methenamine,hexamethylenetetramine,hexamine,urotropine,1,3,5,7-tetraazaadamantane,hexamethylenamine,aminoform,methenamin,urotropin,formamine |
| InChI Key | VKYKSIONXSXAKP-UHFFFAOYSA-N |
| Molecular Formula | C6H12N4 |
3-Nitroaniline, 98%
CAS: 99-09-2 Molecular Formula: C6H6N2O2 Molecular Weight (g/mol): 138.13 MDL Number: MFCD00007782 InChI Key: XJCVRTZCHMZPBD-UHFFFAOYSA-N Synonym: m-nitroaniline,benzenamine, 3-nitro,3-nitrophenylamine,nitranilin,3-aminonitrobenzene,fast orange base r,azobase mna,devol orange r,m-nitrophenylamine,3-nitrobenzenamine PubChem CID: 7423 IUPAC Name: 3-nitroaniline SMILES: NC1=CC=CC(=C1)[N+]([O-])=O
| PubChem CID | 7423 |
|---|---|
| CAS | 99-09-2 |
| Molecular Weight (g/mol) | 138.13 |
| MDL Number | MFCD00007782 |
| SMILES | NC1=CC=CC(=C1)[N+]([O-])=O |
| Synonym | m-nitroaniline,benzenamine, 3-nitro,3-nitrophenylamine,nitranilin,3-aminonitrobenzene,fast orange base r,azobase mna,devol orange r,m-nitrophenylamine,3-nitrobenzenamine |
| IUPAC Name | 3-nitroaniline |
| InChI Key | XJCVRTZCHMZPBD-UHFFFAOYSA-N |
| Molecular Formula | C6H6N2O2 |
Thiourea, 99+%, ACS reagent
CAS: 62-56-6 Molecular Formula: CH4N2S Molecular Weight (g/mol): 76.12 MDL Number: MFCD00008067 InChI Key: UMGDCJDMYOKAJW-UHFFFAOYSA-N Synonym: thiocarbamide,2-thiourea,pseudothiourea,isothiourea,sulourea,2-thiopseudourea,sulfourea,thiuronium,thiocarbonic acid diamide,urea, thio PubChem CID: 2723790 ChEBI: CHEBI:36946 IUPAC Name: thiourea SMILES: NC(N)=S
| PubChem CID | 2723790 |
|---|---|
| CAS | 62-56-6 |
| Molecular Weight (g/mol) | 76.12 |
| ChEBI | CHEBI:36946 |
| MDL Number | MFCD00008067 |
| SMILES | NC(N)=S |
| Synonym | thiocarbamide,2-thiourea,pseudothiourea,isothiourea,sulourea,2-thiopseudourea,sulfourea,thiuronium,thiocarbonic acid diamide,urea, thio |
| IUPAC Name | thiourea |
| InChI Key | UMGDCJDMYOKAJW-UHFFFAOYSA-N |
| Molecular Formula | CH4N2S |
L-Lactic Acid (Free Acid), MP Biomedicals™
CAS: 79-33-4 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.078 MDL Number: MFCD00064266 InChI Key: JVTAAEKCZFNVCJ-REOHCLBHSA-N Synonym: l-lactic acid,l-+-lactic acid,s-2-hydroxypropanoic acid,s-lactic acid,sarcolactic acid,s-2-hydroxypropionic acid,2s-2-hydroxypropanoic acid,+-lactic acid,espiritin,tisulac PubChem CID: 107689 ChEBI: CHEBI:422 IUPAC Name: (2S)-2-hydroxypropanoic acid SMILES: CC(C(=O)O)O
| PubChem CID | 107689 |
|---|---|
| CAS | 79-33-4 |
| Molecular Weight (g/mol) | 90.078 |
| ChEBI | CHEBI:422 |
| MDL Number | MFCD00064266 |
| SMILES | CC(C(=O)O)O |
| Synonym | l-lactic acid,l-+-lactic acid,s-2-hydroxypropanoic acid,s-lactic acid,sarcolactic acid,s-2-hydroxypropionic acid,2s-2-hydroxypropanoic acid,+-lactic acid,espiritin,tisulac |
| IUPAC Name | (2S)-2-hydroxypropanoic acid |
| InChI Key | JVTAAEKCZFNVCJ-REOHCLBHSA-N |
| Molecular Formula | C3H6O3 |
Tetramethylammonium hydroxide, 2.38% w/w aq. soln., Electronic Grade, 99.9999% (metals basis)
CAS: 75-59-2 Molecular Formula: C4H13NO Molecular Weight (g/mol): 91.154 MDL Number: MFCD00008280 InChI Key: WGTYBPLFGIVFAS-UHFFFAOYSA-M Synonym: tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide PubChem CID: 60966 IUPAC Name: tetramethylazanium;hydroxide SMILES: C[N+](C)(C)C.[OH-]
| PubChem CID | 60966 |
|---|---|
| CAS | 75-59-2 |
| Molecular Weight (g/mol) | 91.154 |
| MDL Number | MFCD00008280 |
| SMILES | C[N+](C)(C)C.[OH-] |
| Synonym | tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide |
| IUPAC Name | tetramethylazanium;hydroxide |
| InChI Key | WGTYBPLFGIVFAS-UHFFFAOYSA-M |
| Molecular Formula | C4H13NO |
Barium chloride dihydrate, 99+%, for analysis
CAS: 10326-27-9 Molecular Formula: BaCl2H4O2 Molecular Weight (g/mol): 244.26 MDL Number: MFCD00149154 InChI Key: PWHCIQQGOQTFAE-UHFFFAOYSA-L Synonym: barium chloride dihydrate,bacl2.2h2o,barium 2+ dihydrate dichloride,barium 2+ dichloride dihydrate,acmc-20alrc,dsstox_cid_131,barium chloride, acs,dsstox_rid_75389,dsstox_gsid_20131,ksc174q7d PubChem CID: 5284346 ChEBI: CHEBI:86153 IUPAC Name: barium(2+);dichloride;dihydrate SMILES: O.O.[Cl-].[Cl-].[Ba++]
| PubChem CID | 5284346 |
|---|---|
| CAS | 10326-27-9 |
| Molecular Weight (g/mol) | 244.26 |
| ChEBI | CHEBI:86153 |
| MDL Number | MFCD00149154 |
| SMILES | O.O.[Cl-].[Cl-].[Ba++] |
| Synonym | barium chloride dihydrate,bacl2.2h2o,barium 2+ dihydrate dichloride,barium 2+ dichloride dihydrate,acmc-20alrc,dsstox_cid_131,barium chloride, acs,dsstox_rid_75389,dsstox_gsid_20131,ksc174q7d |
| IUPAC Name | barium(2+);dichloride;dihydrate |
| InChI Key | PWHCIQQGOQTFAE-UHFFFAOYSA-L |
| Molecular Formula | BaCl2H4O2 |
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Iron(III) sulfate pentahydrate, 97%
CAS: 142906-29-4 Molecular Formula: Fe2O12S3·5H2O Molecular Weight (g/mol): 489.96 MDL Number: MFCD00149714 InChI Key: YHGPYBQVSJBGHH-UHFFFAOYSA-H Synonym: unii-3hws7hf5xd,3hws7hf5xd,iron iii sulfate pentahydrate,sulfuric acid, iron 3+ salt 3:2 , pentahydrate 9ci,acmc-20n1we,ferric sulfate pentahydrate,iron iii sulphate pentahydrate,2fe.3so4.5h2o,sulfuric acid, iron 3+ salt 3:2 , pentahydrate PubChem CID: 23443659 IUPAC Name: iron(3+);trisulfate;pentahydrate SMILES: O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3].[Fe+3]
| PubChem CID | 23443659 |
|---|---|
| CAS | 142906-29-4 |
| Molecular Weight (g/mol) | 489.96 |
| MDL Number | MFCD00149714 |
| SMILES | O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3].[Fe+3] |
| Synonym | unii-3hws7hf5xd,3hws7hf5xd,iron iii sulfate pentahydrate,sulfuric acid, iron 3+ salt 3:2 , pentahydrate 9ci,acmc-20n1we,ferric sulfate pentahydrate,iron iii sulphate pentahydrate,2fe.3so4.5h2o,sulfuric acid, iron 3+ salt 3:2 , pentahydrate |
| IUPAC Name | iron(3+);trisulfate;pentahydrate |
| InChI Key | YHGPYBQVSJBGHH-UHFFFAOYSA-H |
| Molecular Formula | Fe2O12S3·5H2O |
Pyridine-d5, for NMR, 99 atom % D
CAS: 7291-22-7 Molecular Formula: C5H5N Molecular Weight (g/mol): 84.13 MDL Number: MFCD00044639 InChI Key: JUJWROOIHBZHMG-RALIUCGRSA-N Synonym: pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c PubChem CID: 558519 IUPAC Name: 2,3,4,5,6-pentadeuteriopyridine SMILES: [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H]
| PubChem CID | 558519 |
|---|---|
| CAS | 7291-22-7 |
| Molecular Weight (g/mol) | 84.13 |
| MDL Number | MFCD00044639 |
| SMILES | [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] |
| Synonym | pyridine-d5,2h5 pyridine,c5d5n,2 h? pyridine,pyridine d5,pyridine,crude,light,pyridine, perdeutero,∼2∼h_5_ pyridine,de85c |
| IUPAC Name | 2,3,4,5,6-pentadeuteriopyridine |
| InChI Key | JUJWROOIHBZHMG-RALIUCGRSA-N |
| Molecular Formula | C5H5N |