Chemicals
Filtered Search Results
Ammonium sulfate, 99%, pure
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N Synonym: ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate PubChem CID: 6097028 ChEBI: CHEBI:62946 SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| Synonym | ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
| Water | 50ppm max. |
|---|---|
| Linear Formula | CH3OCH2CH2OCH3 |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Dry |
| Identification | Pass Test |
| Merck Index | 15, 3245 |
| Density | 0.8670g/mL |
| Vapor Pressure | Vapor Pressure: 64hPa at 20°C |
| Assay Percent Range | 99% |
| Percent Purity | ≥99% |
| Fieser | 01,267; 02,143; 16,229 |
| CAS | 128-37-0 |
| Health Hazard 3 | GHS P Statement: Obtain special instructions before use. IF exposed or concerned: Get medical advice/attention. Keep container tightly closed. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Health Hazard 2 | GHS H Statement: Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. May form explosive peroxides. |
| Packaging | AcroSeal™ Glass Bottle |
| Health Hazard 1 | Danger |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| TSCA | TSCA |
| RTECS Number | KI1451000 |
| Beilstein | 01, 467 |
| EINECS Number | 203-794-9 |
| Formula Weight | 90.12 |
Potassium perchlorate, 99%
CAS: 7778-74-7 Molecular Formula: ClKO4 Molecular Weight (g/mol): 138.54 MDL Number: MFCD00011362 InChI Key: YLMGFJXSLBMXHK-UHFFFAOYSA-M Synonym: potassium perchlorate,perchloracap,astrumal,peroidin,perchloric acid, potassium salt,irenat,potassium hyperchloride,perchloric acid, potassium salt 1:1,potassium perchlorate kclo4,potassium perchlorate usp PubChem CID: 516900 SMILES: [K+].[O-][Cl](=O)(=O)=O
| PubChem CID | 516900 |
|---|---|
| CAS | 7778-74-7 |
| Molecular Weight (g/mol) | 138.54 |
| MDL Number | MFCD00011362 |
| SMILES | [K+].[O-][Cl](=O)(=O)=O |
| Synonym | potassium perchlorate,perchloracap,astrumal,peroidin,perchloric acid, potassium salt,irenat,potassium hyperchloride,perchloric acid, potassium salt 1:1,potassium perchlorate kclo4,potassium perchlorate usp |
| InChI Key | YLMGFJXSLBMXHK-UHFFFAOYSA-M |
| Molecular Formula | ClKO4 |
p-Toluenesulfonyl chloride, 98%
CAS: 98-59-9 Molecular Formula: C7H7ClO2S Molecular Weight (g/mol): 190.64 MDL Number: MFCD00007450 InChI Key: YYROPELSRYBVMQ-UHFFFAOYSA-N Synonym: tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride PubChem CID: 7397 IUPAC Name: 4-methylbenzenesulfonyl chloride SMILES: CC1=CC=C(C=C1)S(Cl)(=O)=O
| PubChem CID | 7397 |
|---|---|
| CAS | 98-59-9 |
| Molecular Weight (g/mol) | 190.64 |
| MDL Number | MFCD00007450 |
| SMILES | CC1=CC=C(C=C1)S(Cl)(=O)=O |
| Synonym | tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride |
| IUPAC Name | 4-methylbenzenesulfonyl chloride |
| InChI Key | YYROPELSRYBVMQ-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClO2S |
Sodium bis(trimethylsilyl)amide, 98%
CAS: 1070-89-9 Molecular Formula: C6H18NNaSi2 Molecular Weight (g/mol): 183.377 MDL Number: MFCD00009835 InChI Key: WRIKHQLVHPKCJU-UHFFFAOYSA-N Synonym: sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt PubChem CID: 2724254 IUPAC Name: sodium;bis(trimethylsilyl)azanide SMILES: C[Si](C)(C)[N-][Si](C)(C)C.[Na+]
| PubChem CID | 2724254 |
|---|---|
| CAS | 1070-89-9 |
| Molecular Weight (g/mol) | 183.377 |
| MDL Number | MFCD00009835 |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.[Na+] |
| Synonym | sodium bis trimethylsilyl amide,n-sodiohexamethyldisilazane,sodium hexamethyldisilazide,nahmds,sodiobis trimethylsilyl amine,sodium bis trimethylsilyl azanide,n-sodium hexamethyldisilazane,sodium-bis trimethylsilyl amide,hexamethyldisilazane sodium salt |
| IUPAC Name | sodium;bis(trimethylsilyl)azanide |
| InChI Key | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| Molecular Formula | C6H18NNaSi2 |
Tin(II) chloride dihydrate, Reagent Grade
CAS: 10025-69-1 Molecular Formula: SnCl2·2H2O MDL Number: MFCD00149863
| CAS | 10025-69-1 |
|---|---|
| MDL Number | MFCD00149863 |
| Molecular Formula | SnCl2·2H2O |
Tetraethylammonium hydroxide, 35% w/w aq. soln.
CAS: 77-98-5 Molecular Formula: C8H21NO Molecular Weight (g/mol): 147.26 MDL Number: MFCD00009024 InChI Key: LRGJRHZIDJQFCL-UHFFFAOYSA-M Synonym: tetraethylammonium hydroxide,tetraethyl ammonium hydroxide,unii-ra8vu41b1f,ammonium, tetraethyl-, hydroxide,tetraethylazanium hydroxide,ethanaminium, n,n,n-triethyl-, hydroxide,ra8vu41b1f,ethanaminium, n,n,n-triethyl-, hydroxide 1:1,tetraethylammonium hydroxide solution in water,n,n,n-triethylethanaminium PubChem CID: 6509 IUPAC Name: tetraethylazanium;hydroxide SMILES: [OH-].CC[N+](CC)(CC)CC
| PubChem CID | 6509 |
|---|---|
| CAS | 77-98-5 |
| Molecular Weight (g/mol) | 147.26 |
| MDL Number | MFCD00009024 |
| SMILES | [OH-].CC[N+](CC)(CC)CC |
| Synonym | tetraethylammonium hydroxide,tetraethyl ammonium hydroxide,unii-ra8vu41b1f,ammonium, tetraethyl-, hydroxide,tetraethylazanium hydroxide,ethanaminium, n,n,n-triethyl-, hydroxide,ra8vu41b1f,ethanaminium, n,n,n-triethyl-, hydroxide 1:1,tetraethylammonium hydroxide solution in water,n,n,n-triethylethanaminium |
| IUPAC Name | tetraethylazanium;hydroxide |
| InChI Key | LRGJRHZIDJQFCL-UHFFFAOYSA-M |
| Molecular Formula | C8H21NO |
Benzil, 99+%
CAS: 134-81-6 Molecular Formula: C14H10O2 Molecular Weight (g/mol): 210.23 MDL Number: MFCD00003080 InChI Key: WURBFLDFSFBTLW-UHFFFAOYSA-N Synonym: benzil,diphenylethanedione,dibenzoyl,diphenylglyoxal,bibenzoyl,ethanedione, diphenyl,1,2-diphenylethanedione,diphenylethane-1,2-dione,glyoxal, diphenyl,diphenyldiketon PubChem CID: 8651 ChEBI: CHEBI:51507 IUPAC Name: 1,2-diphenylethane-1,2-dione SMILES: O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 8651 |
|---|---|
| CAS | 134-81-6 |
| Molecular Weight (g/mol) | 210.23 |
| ChEBI | CHEBI:51507 |
| MDL Number | MFCD00003080 |
| SMILES | O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | benzil,diphenylethanedione,dibenzoyl,diphenylglyoxal,bibenzoyl,ethanedione, diphenyl,1,2-diphenylethanedione,diphenylethane-1,2-dione,glyoxal, diphenyl,diphenyldiketon |
| IUPAC Name | 1,2-diphenylethane-1,2-dione |
| InChI Key | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| Molecular Formula | C14H10O2 |
Choline hydroxide, 46% w/w aq. soln.
CAS: 123-41-1 Molecular Formula: C5H15NO2 Molecular Weight (g/mol): 121.18 MDL Number: MFCD00002831 InChI Key: KIZQNNOULOCVDM-UHFFFAOYSA-M Synonym: choline hydroxide,gossypine,sincaline,bursine,luridine,sinkalin,sinkaline,fagine,vidine,2-hydroxy-n,n,n-trimethylethanaminium hydroxide PubChem CID: 31255 SMILES: [OH-].C[N+](C)(C)CCO
| PubChem CID | 31255 |
|---|---|
| CAS | 123-41-1 |
| Molecular Weight (g/mol) | 121.18 |
| MDL Number | MFCD00002831 |
| SMILES | [OH-].C[N+](C)(C)CCO |
| Synonym | choline hydroxide,gossypine,sincaline,bursine,luridine,sinkalin,sinkaline,fagine,vidine,2-hydroxy-n,n,n-trimethylethanaminium hydroxide |
| InChI Key | KIZQNNOULOCVDM-UHFFFAOYSA-M |
| Molecular Formula | C5H15NO2 |
| Physical Form | Liquid |
|---|---|
| Packaging | Plastic bottle |
| Chemical Name or Material | Tyrode's Solution |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
n-Hexane, anhydrous
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
2,2,2-Tribromoethanol, 99%
CAS: 75-80-9 Molecular Formula: C2H3Br3O Molecular Weight (g/mol): 282.757 MDL Number: MFCD00004671 InChI Key: YFDSDPIBEUFTMI-UHFFFAOYSA-N Synonym: tribromoethanol,avertin,bromethol,ethobrome,tribromethanol,ethobrom,basibrol,narcolan,narcotyl,narkolan PubChem CID: 6400 IUPAC Name: 2,2,2-tribromoethanol SMILES: C(C(Br)(Br)Br)O
| PubChem CID | 6400 |
|---|---|
| CAS | 75-80-9 |
| Molecular Weight (g/mol) | 282.757 |
| MDL Number | MFCD00004671 |
| SMILES | C(C(Br)(Br)Br)O |
| Synonym | tribromoethanol,avertin,bromethol,ethobrome,tribromethanol,ethobrom,basibrol,narcolan,narcotyl,narkolan |
| IUPAC Name | 2,2,2-tribromoethanol |
| InChI Key | YFDSDPIBEUFTMI-UHFFFAOYSA-N |
| Molecular Formula | C2H3Br3O |
1,3,5-Benzenetricarbonyl chloride, 98+%
CAS: 4422-95-1 Molecular Formula: C9H3Cl3O3 Molecular Weight (g/mol): 265.47 MDL Number: MFCD00000679 InChI Key: UWCPYKQBIPYOLX-UHFFFAOYSA-N Synonym: trimesoyl chloride,1,3,5-benzenetricarbonyl trichloride,1,3,5-benzenetricarboxylic acid chloride,1,3,5-benzenetricarbonyl chloride,trimesic acid trichloride,1,3,5-benzenetricarboxylic chloride,benzene-1,3,5-tricarbonyl trichloride,unii-5866peo79w,1,5-benzenetricarbonyl trichloride,1,3,5-benzenetricarboxylicacidchloride PubChem CID: 78138 SMILES: ClC(=O)C1=CC(=CC(=C1)C(Cl)=O)C(Cl)=O
| PubChem CID | 78138 |
|---|---|
| CAS | 4422-95-1 |
| Molecular Weight (g/mol) | 265.47 |
| MDL Number | MFCD00000679 |
| SMILES | ClC(=O)C1=CC(=CC(=C1)C(Cl)=O)C(Cl)=O |
| Synonym | trimesoyl chloride,1,3,5-benzenetricarbonyl trichloride,1,3,5-benzenetricarboxylic acid chloride,1,3,5-benzenetricarbonyl chloride,trimesic acid trichloride,1,3,5-benzenetricarboxylic chloride,benzene-1,3,5-tricarbonyl trichloride,unii-5866peo79w,1,5-benzenetricarbonyl trichloride,1,3,5-benzenetricarboxylicacidchloride |
| InChI Key | UWCPYKQBIPYOLX-UHFFFAOYSA-N |
| Molecular Formula | C9H3Cl3O3 |
Boron powder, amorphous, -325 mesh, 90%, Mg nominal 5%, Thermo Scientific Chemicals
CAS: 7440-42-8 Molecular Formula: B Molecular Weight (g/mol): 10.81 MDL Number: MFCD00134034 MFCD00151272 InChI Key: ZOXJGFHDIHLPTG-UHFFFAOYSA-N Synonym: boron, metallic,unii-n9e3x5056q,boron, amorphous,powder, crystalline,boro,boron-elemental,boron, elemental,and compounds,boracium,boranylidyne PubChem CID: 5462311 ChEBI: CHEBI:27560 IUPAC Name: boron SMILES: [B]
| PubChem CID | 5462311 |
|---|---|
| CAS | 7440-42-8 |
| Molecular Weight (g/mol) | 10.81 |
| ChEBI | CHEBI:27560 |
| MDL Number | MFCD00134034 MFCD00151272 |
| SMILES | [B] |
| Synonym | boron, metallic,unii-n9e3x5056q,boron, amorphous,powder, crystalline,boro,boron-elemental,boron, elemental,and compounds,boracium,boranylidyne |
| IUPAC Name | boron |
| InChI Key | ZOXJGFHDIHLPTG-UHFFFAOYSA-N |
| Molecular Formula | B |
Chlorobenzene, ACS, 99.5%
CAS: 108-90-7 Molecular Formula: C6H5Cl Molecular Weight (g/mol): 112.556 MDL Number: MFCD00000530 InChI Key: MVPPADPHJFYWMZ-UHFFFAOYSA-N Synonym: monochlorobenzene,benzene chloride,phenyl chloride,benzene, chloro,chlorbenzene,chlorobenzol,monochlorbenzol,chlorbenzol,chlorobenzen,clorobenzene PubChem CID: 7964 ChEBI: CHEBI:28097 IUPAC Name: chlorobenzene SMILES: C1=CC=C(C=C1)Cl
| PubChem CID | 7964 |
|---|---|
| CAS | 108-90-7 |
| Molecular Weight (g/mol) | 112.556 |
| ChEBI | CHEBI:28097 |
| MDL Number | MFCD00000530 |
| SMILES | C1=CC=C(C=C1)Cl |
| Synonym | monochlorobenzene,benzene chloride,phenyl chloride,benzene, chloro,chlorbenzene,chlorobenzol,monochlorbenzol,chlorbenzol,chlorobenzen,clorobenzene |
| IUPAC Name | chlorobenzene |
| InChI Key | MVPPADPHJFYWMZ-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl |