Chemicals
Filtered Search Results
Phosphoric acid, for analysis, 85 wt% solution in water
CAS: 7664-38-2 Molecular Formula: H3O4P Molecular Weight (g/mol): 97.994 MDL Number: MFCD00011340 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid SMILES: OP(=O)(O)O
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| Molecular Weight (g/mol) | 97.994 |
| ChEBI | CHEBI:26078 |
| MDL Number | MFCD00011340 |
| SMILES | OP(=O)(O)O |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
Diethanolamine, 99%
CAS: 111-42-2 Molecular Formula: C4H11NO2 Molecular Weight (g/mol): 105.14 MDL Number: MFCD00002843 InChI Key: ZBCBWPMODOFKDW-UHFFFAOYSA-N Synonym: diethanolamine,2,2'-iminodiethanol,diolamine,iminodiethanol,bis 2-hydroxyethyl amine,diethylolamine,n,n-diethanolamine,diethanolamin,2,2'-dihydroxydiethylamine,ethanol, 2,2'-iminobis PubChem CID: 8113 ChEBI: CHEBI:28123 IUPAC Name: 2-(2-hydroxyethylamino)ethanol SMILES: OCCNCCO
| PubChem CID | 8113 |
|---|---|
| CAS | 111-42-2 |
| Molecular Weight (g/mol) | 105.14 |
| ChEBI | CHEBI:28123 |
| MDL Number | MFCD00002843 |
| SMILES | OCCNCCO |
| Synonym | diethanolamine,2,2'-iminodiethanol,diolamine,iminodiethanol,bis 2-hydroxyethyl amine,diethylolamine,n,n-diethanolamine,diethanolamin,2,2'-dihydroxydiethylamine,ethanol, 2,2'-iminobis |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol |
| InChI Key | ZBCBWPMODOFKDW-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO2 |
Propyl gallate, 98%
CAS: 121-79-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.2 MDL Number: MFCD00002196 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N Synonym: propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,gallic acid propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate PubChem CID: 4947 ChEBI: CHEBI:10607 IUPAC Name: propyl 3,4,5-trihydroxybenzoate SMILES: CCCOC(=O)C1=CC(=C(C(=C1)O)O)O
| PubChem CID | 4947 |
|---|---|
| CAS | 121-79-9 |
| Molecular Weight (g/mol) | 212.2 |
| ChEBI | CHEBI:10607 |
| MDL Number | MFCD00002196 |
| SMILES | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Synonym | propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,gallic acid propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate |
| IUPAC Name | propyl 3,4,5-trihydroxybenzoate |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
Ethyl acetate, 99.9%, Extra Dry over Molecular Sieve, AcroSeal™
CAS: 141-78-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00009171 InChI Key: XEKOWRVHYACXOJ-UHFFFAOYSA-N Synonym: ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester PubChem CID: 8857 ChEBI: CHEBI:27750 IUPAC Name: ethyl acetate SMILES: CCOC(=O)C
| PubChem CID | 8857 |
|---|---|
| CAS | 141-78-6 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:27750 |
| MDL Number | MFCD00009171 |
| SMILES | CCOC(=O)C |
| Synonym | ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester |
| IUPAC Name | ethyl acetate |
| InChI Key | XEKOWRVHYACXOJ-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Tetra-n-butylammonium iodide, 98%
CAS: 311-28-4 Molecular Formula: C16H36IN Molecular Weight (g/mol): 369.38 MDL Number: MFCD00011636 InChI Key: DPKBAXPHAYBPRL-UHFFFAOYSA-M Synonym: tetrabutylammonium iodide,tetra-n-butylammonium iodide,tbai,tetrabutylazanium iodide,tetra-n-butylammoniumjodid,tetrabutyl ammonium iodide,1-butanaminium, n,n,n-tributyl-, iodide,n,n,n-tributyl-1-butanaminium iodide,tetra-n-butylammoniumjodid czech,tetrabutylammonium ion iodide PubChem CID: 67553 IUPAC Name: tetrabutylazanium;iodide SMILES: [I-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 67553 |
|---|---|
| CAS | 311-28-4 |
| Molecular Weight (g/mol) | 369.38 |
| MDL Number | MFCD00011636 |
| SMILES | [I-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium iodide,tetra-n-butylammonium iodide,tbai,tetrabutylazanium iodide,tetra-n-butylammoniumjodid,tetrabutyl ammonium iodide,1-butanaminium, n,n,n-tributyl-, iodide,n,n,n-tributyl-1-butanaminium iodide,tetra-n-butylammoniumjodid czech,tetrabutylammonium ion iodide |
| IUPAC Name | tetrabutylazanium;iodide |
| InChI Key | DPKBAXPHAYBPRL-UHFFFAOYSA-M |
| Molecular Formula | C16H36IN |
O-(1H-Benzotriazol-1-yl)-N,N,N',N'-tetramethyluronium hexafluorophosphate, 98%
CAS: 94790-37-1 Molecular Formula: C11H16F6N5OP Molecular Weight (g/mol): 379.247 MDL Number: MFCD00075445 InChI Key: UQYZFNUUOSSNKT-UHFFFAOYSA-N Synonym: hbtu,o-benzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,2-1h-benzotriazole-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,hbtu-reagent,o-benzotriazol-1-yl-tetramethyluronium hexafluorophosphate,hbtu o-benzotriazole-n,n,n',n'-tetramethyl-uronium-hexafluoro-phosphate,n,n,n',n'-tetramethyl-o-1h-benzotriazol-1-yl uronium hexafluorophosphate,o-1h-benzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,o-benzotriazole-n,n,n',n'-tetramethyluronium hexafluorophosphate PubChem CID: 2733084 IUPAC Name: [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate SMILES: CN(C)C(=[N+](C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F
| PubChem CID | 2733084 |
|---|---|
| CAS | 94790-37-1 |
| Molecular Weight (g/mol) | 379.247 |
| MDL Number | MFCD00075445 |
| SMILES | CN(C)C(=[N+](C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F |
| Synonym | hbtu,o-benzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,2-1h-benzotriazole-1-yl-1,1,3,3-tetramethyluronium hexafluorophosphate,hbtu-reagent,o-benzotriazol-1-yl-tetramethyluronium hexafluorophosphate,hbtu o-benzotriazole-n,n,n',n'-tetramethyl-uronium-hexafluoro-phosphate,n,n,n',n'-tetramethyl-o-1h-benzotriazol-1-yl uronium hexafluorophosphate,o-1h-benzotriazol-1-yl-n,n,n',n'-tetramethyluronium hexafluorophosphate,o-benzotriazole-n,n,n',n'-tetramethyluronium hexafluorophosphate |
| IUPAC Name | [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium;hexafluorophosphate |
| InChI Key | UQYZFNUUOSSNKT-UHFFFAOYSA-N |
| Molecular Formula | C11H16F6N5OP |
Diethyl ether, 99.5%, for analysis, stabilized with BHT, conforms to Eur.Ph.
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Hydrochloric acid, 36%, technical
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Manganese(IV) Oxide, 99%, -10 mesh
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Potassium Hydroxide, in Ethanol, Certified, 0.100N ±0.001N (0.1M), LabChem™
CAS: 1310-58-3 Molecular Formula: HKO Molecular Weight (g/mol): 56.11 MDL Number: MFCD00003553 InChI Key: KWYUFKZDYYNOTN-UHFFFAOYSA-M Synonym: potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 PubChem CID: 14797 ChEBI: CHEBI:32035 IUPAC Name: potassium hydroxide SMILES: [OH-].[K+]
| PubChem CID | 14797 |
|---|---|
| CAS | 1310-58-3 |
| Molecular Weight (g/mol) | 56.11 |
| ChEBI | CHEBI:32035 |
| MDL Number | MFCD00003553 |
| SMILES | [OH-].[K+] |
| Synonym | potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 |
| IUPAC Name | potassium hydroxide |
| InChI Key | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
| Molecular Formula | HKO |
Sodium peroxide, 95%
CAS: 1313-60-6 Molecular Formula: Na2O2 Molecular Weight (g/mol): 77.978 MDL Number: MFCD00003497 InChI Key: PFUVRDFDKPNGAV-UHFFFAOYSA-N Synonym: sodium peroxide,disodium peroxide,solozone,natriumsuperoxid,sodium dioxide,disodium dioxide,natrium peroxydatum,sodium oxide, per,flocool 180,sodium oxide PubChem CID: 14803 IUPAC Name: disodium;peroxide SMILES: [O-][O-].[Na+].[Na+]
| PubChem CID | 14803 |
|---|---|
| CAS | 1313-60-6 |
| Molecular Weight (g/mol) | 77.978 |
| MDL Number | MFCD00003497 |
| SMILES | [O-][O-].[Na+].[Na+] |
| Synonym | sodium peroxide,disodium peroxide,solozone,natriumsuperoxid,sodium dioxide,disodium dioxide,natrium peroxydatum,sodium oxide, per,flocool 180,sodium oxide |
| IUPAC Name | disodium;peroxide |
| InChI Key | PFUVRDFDKPNGAV-UHFFFAOYSA-N |
| Molecular Formula | Na2O2 |
Ethyl formate, 97%
CAS: 109-94-4 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00003294 InChI Key: WBJINCZRORDGAQ-UHFFFAOYSA-N Synonym: areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat PubChem CID: 8025 ChEBI: CHEBI:52342 IUPAC Name: ethyl formate SMILES: CCOC=O
| PubChem CID | 8025 |
|---|---|
| CAS | 109-94-4 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:52342 |
| MDL Number | MFCD00003294 |
| SMILES | CCOC=O |
| Synonym | areginal,formic acid, ethyl ester,ethyl methanoate,formic acid ethyl ester,aethylformiat,ethyl formic ester,ethylformate,ethylformiaat,formic ether,ethylformiat |
| IUPAC Name | ethyl formate |
| InChI Key | WBJINCZRORDGAQ-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Barium nitrate, ACS reagent
CAS: 10022-31-8 Molecular Formula: BaN2O6 Molecular Weight (g/mol): 261.34 MDL Number: MFCD00003442 InChI Key: IWOUKMZUPDVPGQ-UHFFFAOYSA-N Synonym: barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 PubChem CID: 24798 SMILES: [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24798 |
|---|---|
| CAS | 10022-31-8 |
| Molecular Weight (g/mol) | 261.34 |
| MDL Number | MFCD00003442 |
| SMILES | [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 |
| InChI Key | IWOUKMZUPDVPGQ-UHFFFAOYSA-N |
| Molecular Formula | BaN2O6 |
Sodium Chloride, Cell Culture Reagent Grade, MP Biomedicals™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Tetramethylammonium hydroxide pentahydrate, 98%
CAS: 10424-65-4 Molecular Formula: C4H23NO6 Molecular Weight (g/mol): 181.23 MDL Number: MFCD00149566 InChI Key: MYXKPFMQWULLOH-UHFFFAOYSA-M Synonym: tetramethylammonium hydroxide pentahydrate,b2hkt2lckq,unii-b2hkt2lckq,methanaminium, n,n,n-trimethyl-, hydroxide, pentahydrate,tmaoh,tetramethylammoniumhydroxid,tetrametanoamonio hydroxido,tetrametiloamonio hydroxido,methanaminium, n,n,n-trimethyl-, hydroxide, hydrate 1:1:5,acmc-2098bm PubChem CID: 82620 IUPAC Name: tetramethylazanium;hydroxide;pentahydrate SMILES: O.O.O.O.O.[OH-].C[N+](C)(C)C
| PubChem CID | 82620 |
|---|---|
| CAS | 10424-65-4 |
| Molecular Weight (g/mol) | 181.23 |
| MDL Number | MFCD00149566 |
| SMILES | O.O.O.O.O.[OH-].C[N+](C)(C)C |
| Synonym | tetramethylammonium hydroxide pentahydrate,b2hkt2lckq,unii-b2hkt2lckq,methanaminium, n,n,n-trimethyl-, hydroxide, pentahydrate,tmaoh,tetramethylammoniumhydroxid,tetrametanoamonio hydroxido,tetrametiloamonio hydroxido,methanaminium, n,n,n-trimethyl-, hydroxide, hydrate 1:1:5,acmc-2098bm |
| IUPAC Name | tetramethylazanium;hydroxide;pentahydrate |
| InChI Key | MYXKPFMQWULLOH-UHFFFAOYSA-M |
| Molecular Formula | C4H23NO6 |