Chemicals
Filtered Search Results
Dichloromethane For gas chromatography MS SupraSolv™, MilliporeSigma™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
Kaolin, pure
CAS: 1332-58-7 Molecular Formula: Al2H4O9Si2 Molecular Weight (g/mol): 258.16 MDL Number: MFCD00062311 InChI Key: NLYAJNPCOHFWQQ-UHFFFAOYSA-N Synonym: kaolin,china clay,argilla,glomax,porcelain clay,bolus alba,white bole,hydrated aluminum silicate,kaolin clay slurry,alphagloss PubChem CID: 56841936 IUPAC Name: oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate SMILES: O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O
| PubChem CID | 56841936 |
|---|---|
| CAS | 1332-58-7 |
| Molecular Weight (g/mol) | 258.16 |
| MDL Number | MFCD00062311 |
| SMILES | O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O |
| Synonym | kaolin,china clay,argilla,glomax,porcelain clay,bolus alba,white bole,hydrated aluminum silicate,kaolin clay slurry,alphagloss |
| IUPAC Name | oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate |
| InChI Key | NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
| Molecular Formula | Al2H4O9Si2 |
Sulfur, 99.5%, sublimed
CAS: 7704-34-9 Molecular Formula: S Molecular Weight (g/mol): 32.06 MDL Number: MFCD00085316 InChI Key: NINIDFKCEFEMDL-UHFFFAOYSA-N Synonym: polymeric,lac,ad usum externum,acmc-20a47y,rubbervulcanizationagentis ot PubChem CID: 5362487 ChEBI: CHEBI:26833 IUPAC Name: sulfur SMILES: [S]
| PubChem CID | 5362487 |
|---|---|
| CAS | 7704-34-9 |
| Molecular Weight (g/mol) | 32.06 |
| ChEBI | CHEBI:26833 |
| MDL Number | MFCD00085316 |
| SMILES | [S] |
| Synonym | polymeric,lac,ad usum externum,acmc-20a47y,rubbervulcanizationagentis ot |
| IUPAC Name | sulfur |
| InChI Key | NINIDFKCEFEMDL-UHFFFAOYSA-N |
| Molecular Formula | S |
2,2'-Dipyridyl, 99+%
CAS: 366-18-7 Molecular Formula: C10H8N2 Molecular Weight (g/mol): 156.19 MDL Number: MFCD00006212 InChI Key: ROFVEXUMMXZLPA-UHFFFAOYSA-N Synonym: 2,2'-bipyridine,2,2'-dipyridyl,2,2'-bipyridyl,bipyridine,2,2'-dipyridine,2-2-pyridyl pyridine,2,2'-bipyridin,alpha,alpha'-dipyridyl,alpha,alpha'-bipyridyl,2,2-bipyridyl PubChem CID: 1474 ChEBI: CHEBI:30351 IUPAC Name: 2-pyridin-2-ylpyridine SMILES: C1=CC=C(N=C1)C1=CC=CC=N1
| PubChem CID | 1474 |
|---|---|
| CAS | 366-18-7 |
| Molecular Weight (g/mol) | 156.19 |
| ChEBI | CHEBI:30351 |
| MDL Number | MFCD00006212 |
| SMILES | C1=CC=C(N=C1)C1=CC=CC=N1 |
| Synonym | 2,2'-bipyridine,2,2'-dipyridyl,2,2'-bipyridyl,bipyridine,2,2'-dipyridine,2-2-pyridyl pyridine,2,2'-bipyridin,alpha,alpha'-dipyridyl,alpha,alpha'-bipyridyl,2,2-bipyridyl |
| IUPAC Name | 2-pyridin-2-ylpyridine |
| InChI Key | ROFVEXUMMXZLPA-UHFFFAOYSA-N |
| Molecular Formula | C10H8N2 |
Di-tert-butyl azodicarboxylate, 97%
CAS: 870-50-8 Molecular Formula: C10H18N2O4 Molecular Weight (g/mol): 230.26 InChI Key: QKSQWQOAUQFORH-VAWYXSNFSA-N Synonym: di-tert-butyl azodicarboxylate,di-tert-butylazodicarboxylate,di-tert-butyl diazene-1,2-dicarboxylate,azodicarboxylic acid di-tert-butyl ester,di-tert-butyl azodicarboxylate dbad,pubchem17548,n-tert-butoxycarbonyl imino tert-butoxy formamide,tert-butyl tert-butyl oxycarbonyl diazenyl formate,n-tert-butoxy carbonyl imino tert-butoxy formamide,1,2-diazenedicarboxylic acid, 1,2-bis 1,1-dimethylethyl ester PubChem CID: 6034084 IUPAC Name: tert-butyl (NE)-N-[(2-methylpropan-2-yl)oxycarbonylimino]carbamate SMILES: CC(C)(C)OC(=O)N=NC(=O)OC(C)(C)C
| PubChem CID | 6034084 |
|---|---|
| CAS | 870-50-8 |
| Molecular Weight (g/mol) | 230.26 |
| SMILES | CC(C)(C)OC(=O)N=NC(=O)OC(C)(C)C |
| Synonym | di-tert-butyl azodicarboxylate,di-tert-butylazodicarboxylate,di-tert-butyl diazene-1,2-dicarboxylate,azodicarboxylic acid di-tert-butyl ester,di-tert-butyl azodicarboxylate dbad,pubchem17548,n-tert-butoxycarbonyl imino tert-butoxy formamide,tert-butyl tert-butyl oxycarbonyl diazenyl formate,n-tert-butoxy carbonyl imino tert-butoxy formamide,1,2-diazenedicarboxylic acid, 1,2-bis 1,1-dimethylethyl ester |
| IUPAC Name | tert-butyl (NE)-N-[(2-methylpropan-2-yl)oxycarbonylimino]carbamate |
| InChI Key | QKSQWQOAUQFORH-VAWYXSNFSA-N |
| Molecular Formula | C10H18N2O4 |
Calcium chloride, ACS reagent, desiccant
CAS: 10043-52-4 Molecular Formula: CaCl2 Molecular Weight (g/mol): 110.98 InChI Key: UXVMQQNJUSDDNG-UHFFFAOYSA-L Synonym: calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal PubChem CID: 5284359 ChEBI: CHEBI:3312 SMILES: [Cl-].[Cl-].[Ca++]
| PubChem CID | 5284359 |
|---|---|
| CAS | 10043-52-4 |
| Molecular Weight (g/mol) | 110.98 |
| ChEBI | CHEBI:3312 |
| SMILES | [Cl-].[Cl-].[Ca++] |
| Synonym | calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal |
| InChI Key | UXVMQQNJUSDDNG-UHFFFAOYSA-L |
| Molecular Formula | CaCl2 |
Tin(II) chloride, 98%, anhydrous
CAS: 7772-99-8 Molecular Formula: Cl2Sn Molecular Weight (g/mol): 189.61 MDL Number: MFCD00011241 InChI Key: AXZWODMDQAVCJE-UHFFFAOYSA-L Synonym: Stannous chloride PubChem CID: 24479 ChEBI: CHEBI:78067 SMILES: [Cl-].[Cl-].[Sn++]
| PubChem CID | 24479 |
|---|---|
| CAS | 7772-99-8 |
| Molecular Weight (g/mol) | 189.61 |
| ChEBI | CHEBI:78067 |
| MDL Number | MFCD00011241 |
| SMILES | [Cl-].[Cl-].[Sn++] |
| Synonym | Stannous chloride |
| InChI Key | AXZWODMDQAVCJE-UHFFFAOYSA-L |
| Molecular Formula | Cl2Sn |
Triethanolamine hydrochloride, 99+%, Thermo Scientific Chemicals
CAS: 637-39-8 Molecular Formula: C6H16ClNO3 Molecular Weight (g/mol): 185.648 MDL Number: MFCD00012596 InChI Key: HHLJUSLZGFYWKW-UHFFFAOYSA-N Synonym: triethanolamine hydrochloride,tea-hydrochloride,triethanolammonium chloride,2,2',2-nitrilotriethanol hydrochloride,ethanol, 2,2',2-nitrilotris-, hydrochloride,2,2',2-nitrilotrisethanol hydrochloride,unii-r297uj9qdy,tris 2-hydroxyethyl ammonium chloride,tris 2-hydroxyethyl amine hydrochloride,r297uj9qdy PubChem CID: 101814 IUPAC Name: 2-[bis(2-hydroxyethyl)amino]ethanol;hydrochloride SMILES: C(CO)N(CCO)CCO.Cl
| PubChem CID | 101814 |
|---|---|
| CAS | 637-39-8 |
| Molecular Weight (g/mol) | 185.648 |
| MDL Number | MFCD00012596 |
| SMILES | C(CO)N(CCO)CCO.Cl |
| Synonym | triethanolamine hydrochloride,tea-hydrochloride,triethanolammonium chloride,2,2',2-nitrilotriethanol hydrochloride,ethanol, 2,2',2-nitrilotris-, hydrochloride,2,2',2-nitrilotrisethanol hydrochloride,unii-r297uj9qdy,tris 2-hydroxyethyl ammonium chloride,tris 2-hydroxyethyl amine hydrochloride,r297uj9qdy |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;hydrochloride |
| InChI Key | HHLJUSLZGFYWKW-UHFFFAOYSA-N |
| Molecular Formula | C6H16ClNO3 |
Sodium Sulfate, Anhydrous, 99.0% min., ACS, MilliporeSigma™
CAS: 7757-82-6 Molecular Formula: Na2O4S Molecular Weight (g/mol): 142.04 MDL Number: MFCD00003504 InChI Key: PMZURENOXWZQFD-UHFFFAOYSA-L Synonym: sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 PubChem CID: 24436 ChEBI: CHEBI:32149 IUPAC Name: disodium sulfate SMILES: [Na+].[Na+].[O-]S([O-])(=O)=O
| PubChem CID | 24436 |
|---|---|
| CAS | 7757-82-6 |
| Molecular Weight (g/mol) | 142.04 |
| ChEBI | CHEBI:32149 |
| MDL Number | MFCD00003504 |
| SMILES | [Na+].[Na+].[O-]S([O-])(=O)=O |
| Synonym | sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 |
| IUPAC Name | disodium sulfate |
| InChI Key | PMZURENOXWZQFD-UHFFFAOYSA-L |
| Molecular Formula | Na2O4S |
3-Aminopyridine, 99%
CAS: 462-08-8 Molecular Formula: C5H6N2 Molecular Weight (g/mol): 94.12 MDL Number: MFCD00006400 InChI Key: CUYKNJBYIJFRCU-UHFFFAOYSA-N Synonym: 3-aminopyridine,3-pyridinamine,3-pyridylamine,pyridin-3-ylamine,m-aminopyridine,amino-3 pyridine,pyridine, 3-amino,3-amino pyridine,beta-aminopyridine,amino-3-pyridine PubChem CID: 10009 IUPAC Name: pyridin-3-amine SMILES: NC1=CC=CN=C1
| PubChem CID | 10009 |
|---|---|
| CAS | 462-08-8 |
| Molecular Weight (g/mol) | 94.12 |
| MDL Number | MFCD00006400 |
| SMILES | NC1=CC=CN=C1 |
| Synonym | 3-aminopyridine,3-pyridinamine,3-pyridylamine,pyridin-3-ylamine,m-aminopyridine,amino-3 pyridine,pyridine, 3-amino,3-amino pyridine,beta-aminopyridine,amino-3-pyridine |
| IUPAC Name | pyridin-3-amine |
| InChI Key | CUYKNJBYIJFRCU-UHFFFAOYSA-N |
| Molecular Formula | C5H6N2 |
Chloroform (stabilized with 2-Methyl-2-butene) 99.5+%, TCI America™
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 IUPAC Name: trichloromethane SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| IUPAC Name | trichloromethane |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
| Linear Formula | BBr3 |
|---|---|
| Molecular Weight (g/mol) | 250.52 |
| InChI Key | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Density | 1.4670g/mL |
| PubChem CID | 25134 |
| Name Note | 1M Solution in Methylene Chloride |
| Fieser | 01,66; 02,33; 03,30; 04,42; 05,49; 06,64; 09,61; 10,50; 11,71; 13,43 |
| Formula Weight | 250.52 |
| Color | Yellow to Brown |
| Physical Form | Solution |
| Chemical Name or Material | Boron tribromide |
| SMILES | BrB(Br)Br |
| Merck Index | 15, 1349 |
| Concentration or Composition (by Analyte or Components) | 0.9 to 1.1M |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective clothing/eye protection/face protection. |
| MDL Number | MFCD00011312 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Fatal if inhaled. Fatal if swallowed. Suspected of causing cancer. Reacts violently with water. May cause drowsiness or dizziness. |
| Packaging | Glass bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| Recommended Storage | Darkens on storage |
| IUPAC Name | tribromoborane |
| Molecular Formula | BBr3 |
| EINECS Number | 233-657-9 |
| Specific Gravity | 1.467 |
p-Toluenesulfonyl isocyanate, 96%
CAS: 4083-64-1 Molecular Formula: C8H7NO3S Molecular Weight (g/mol): 197.21 MDL Number: MFCD00002030 InChI Key: VLJQDHDVZJXNQL-UHFFFAOYSA-N Synonym: tosyl isocyanate,p-toluenesulfonyl isocyanate,4-methylbenzenesulfonyl isocyanate,p-toluenesulphonyl isocyanate,benzenesulfonyl isocyanate, 4-methyl,tosylisocyanate,p-tolylsulfonyl isocyanate,unii-h9004fjx6v,p-toluenesulfonic acid, anhydride with isocyanic acid,p-toluene sulfonyl isocyanate PubChem CID: 77703 IUPAC Name: 4-methyl-N-(oxomethylidene)benzenesulfonamide SMILES: CC1=CC=C(C=C1)S(=O)(=O)N=C=O
| PubChem CID | 77703 |
|---|---|
| CAS | 4083-64-1 |
| Molecular Weight (g/mol) | 197.21 |
| MDL Number | MFCD00002030 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N=C=O |
| Synonym | tosyl isocyanate,p-toluenesulfonyl isocyanate,4-methylbenzenesulfonyl isocyanate,p-toluenesulphonyl isocyanate,benzenesulfonyl isocyanate, 4-methyl,tosylisocyanate,p-tolylsulfonyl isocyanate,unii-h9004fjx6v,p-toluenesulfonic acid, anhydride with isocyanic acid,p-toluene sulfonyl isocyanate |
| IUPAC Name | 4-methyl-N-(oxomethylidene)benzenesulfonamide |
| InChI Key | VLJQDHDVZJXNQL-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO3S |
Thermo Scientific Chemicals Albumin bovine / fraction V, for biochemistry, pH 7.0
CAS: 9048-46-8 MDL Number: MFCD00145743
| CAS | 9048-46-8 |
|---|---|
| MDL Number | MFCD00145743 |
Hydrazine sulfate, 99+%
CAS: 10034-93-2 Molecular Formula: H6N2O4S Molecular Weight (g/mol): 130.118 MDL Number: MFCD00044873 InChI Key: ZGCHATBSUIJLRL-UHFFFAOYSA-N Synonym: hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate PubChem CID: 24842 IUPAC Name: hydrazine;sulfuric acid SMILES: NN.OS(=O)(=O)O
| PubChem CID | 24842 |
|---|---|
| CAS | 10034-93-2 |
| Molecular Weight (g/mol) | 130.118 |
| MDL Number | MFCD00044873 |
| SMILES | NN.OS(=O)(=O)O |
| Synonym | hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate |
| IUPAC Name | hydrazine;sulfuric acid |
| InChI Key | ZGCHATBSUIJLRL-UHFFFAOYSA-N |
| Molecular Formula | H6N2O4S |