Chemicals
Filtered Search Results
| CAS | 97396-56-0 |
|---|---|
| MDL Number | MFCD00145830 |
| Boiling Point | 69.0°C |
|---|---|
| Viscosity | 0.31 mPa.s (20°C) |
| Linear Formula | CH3(CH2)4CH3 |
| Physical Form | Liquid |
| Chemical Name or Material | Hexanes |
| Grade | Technical |
| Merck Index | 14, 4694 |
| Residue after Evaporation | 0.002% max. |
| Density | 0.6590g/mL |
| Name Note | Mixture of isomers |
| CAS | 110-54-3 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF exposed or concerned: Get medical advice/attention. |
| MDL Number | MFCD00009520 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. May be fatal if swallowed and enters airways. Causes skin irritation. May cause drowsiness or dizziness. Suspected of damaging fertility. May cause damage to organs through prolonged or repeated exposure. Toxic to aquatic life with long lasting effects. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in alcohol, acetone, ether and chloroform |
| Flash Point | −22°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3748 to 1.3810 |
| Synonym | Hex |
| Beilstein | 01, 142 |
| Molecular Formula | C6H14 |
| Formula Weight | 86.18 |
| Specific Gravity | 0.659 |
| Melting Point | -95.0°C |
Thermo Scientific™ Calcium, Ion chromatography standard solution, Specpure™, Ca+++2 1000μg/ml
Molecular Formula: Ca(NO{3}){2} in H{2}O MDL Number: MFCD00069184
| MDL Number | MFCD00069184 |
|---|---|
| Molecular Formula | Ca(NO{3}){2} in H{2}O |
cis-Stilbene, 97%
CAS: 645-49-8 Molecular Formula: C14H12 Molecular Weight (g/mol): 180.25 MDL Number: MFCD00004788 InChI Key: PJANXHGTPQOBST-QXMHVHEDSA-N Synonym: cis-stilbene,z-stilbene,z-1,2-diphenylethene,cis-1,2-diphenylethylene,isostilbene,cis-diphenylethene,stilbene, z,z-2-phenylethenyl benzene,benzene, 1,1'-1,2-ethenediyl bis-, z,z-1,2-diphenylethylene PubChem CID: 5356785 ChEBI: CHEBI:36008 IUPAC Name: (Z)-stilbene SMILES: C1=CC=C(C=C1)C=CC2=CC=CC=C2
| PubChem CID | 5356785 |
|---|---|
| CAS | 645-49-8 |
| Molecular Weight (g/mol) | 180.25 |
| ChEBI | CHEBI:36008 |
| MDL Number | MFCD00004788 |
| SMILES | C1=CC=C(C=C1)C=CC2=CC=CC=C2 |
| Synonym | cis-stilbene,z-stilbene,z-1,2-diphenylethene,cis-1,2-diphenylethylene,isostilbene,cis-diphenylethene,stilbene, z,z-2-phenylethenyl benzene,benzene, 1,1'-1,2-ethenediyl bis-, z,z-1,2-diphenylethylene |
| IUPAC Name | (Z)-stilbene |
| InChI Key | PJANXHGTPQOBST-QXMHVHEDSA-N |
| Molecular Formula | C14H12 |
Formamide, 99+%, for spectroscopy
CAS: 75-12-7 Molecular Formula: CH3NO Molecular Weight (g/mol): 45.04 MDL Number: MFCD00007941 InChI Key: ZHNUHDYFZUAESO-UHFFFAOYSA-N Synonym: methanamide,carbamaldehyde,formimidic acid,formic acid, amide,formamid,methanoic acid, amide,amid kyseliny mravenci,amid kyseliny mravenci czech,formic amide,hsdb 88 PubChem CID: 713 ChEBI: CHEBI:48431 IUPAC Name: formamide SMILES: NC=O
| PubChem CID | 713 |
|---|---|
| CAS | 75-12-7 |
| Molecular Weight (g/mol) | 45.04 |
| ChEBI | CHEBI:48431 |
| MDL Number | MFCD00007941 |
| SMILES | NC=O |
| Synonym | methanamide,carbamaldehyde,formimidic acid,formic acid, amide,formamid,methanoic acid, amide,amid kyseliny mravenci,amid kyseliny mravenci czech,formic amide,hsdb 88 |
| IUPAC Name | formamide |
| InChI Key | ZHNUHDYFZUAESO-UHFFFAOYSA-N |
| Molecular Formula | CH3NO |
1-Octadecanol, 97%
CAS: 112-92-5 Molecular Formula: C18H38O Molecular Weight (g/mol): 270.501 MDL Number: MFCD00002823 InChI Key: GLDOVTGHNKAZLK-UHFFFAOYSA-N Synonym: stearyl alcohol,1-octadecanol,octadecanol,octadecyl alcohol,n-octadecanol,1-hydroxyoctadecane,n-1-octadecanol,stearol,n-octadecyl alcohol,stearic alcohol PubChem CID: 8221 ChEBI: CHEBI:32154 IUPAC Name: octadecan-1-ol SMILES: CCCCCCCCCCCCCCCCCCO
| PubChem CID | 8221 |
|---|---|
| CAS | 112-92-5 |
| Molecular Weight (g/mol) | 270.501 |
| ChEBI | CHEBI:32154 |
| MDL Number | MFCD00002823 |
| SMILES | CCCCCCCCCCCCCCCCCCO |
| Synonym | stearyl alcohol,1-octadecanol,octadecanol,octadecyl alcohol,n-octadecanol,1-hydroxyoctadecane,n-1-octadecanol,stearol,n-octadecyl alcohol,stearic alcohol |
| IUPAC Name | octadecan-1-ol |
| InChI Key | GLDOVTGHNKAZLK-UHFFFAOYSA-N |
| Molecular Formula | C18H38O |
2-(Diphenylphosphino)benzoic acid, 97%
CAS: 17261-28-8 Molecular Formula: C19H15O2P Molecular Weight (g/mol): 306.30 MDL Number: MFCD00674024 InChI Key: UYRPRYSDOVYCOU-UHFFFAOYSA-N Synonym: 2-diphenylphosphino benzoic acid,2-diphenylphosphinobenzoic acid,benzoic acid, 2-diphenylphosphino,o-diphenylphosphinobenozic acid,2-carboxyphenyl diphenylphosphine,2-diphenylphosphanyl benzoic acid,benzoic acid, diphenylphosphino,o-diphenylphosphino benzoic acid,dppbac,acmc-1bt7u PubChem CID: 87021 IUPAC Name: 2-diphenylphosphanylbenzoic acid SMILES: OC(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 87021 |
|---|---|
| CAS | 17261-28-8 |
| Molecular Weight (g/mol) | 306.30 |
| MDL Number | MFCD00674024 |
| SMILES | OC(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-diphenylphosphino benzoic acid,2-diphenylphosphinobenzoic acid,benzoic acid, 2-diphenylphosphino,o-diphenylphosphinobenozic acid,2-carboxyphenyl diphenylphosphine,2-diphenylphosphanyl benzoic acid,benzoic acid, diphenylphosphino,o-diphenylphosphino benzoic acid,dppbac,acmc-1bt7u |
| IUPAC Name | 2-diphenylphosphanylbenzoic acid |
| InChI Key | UYRPRYSDOVYCOU-UHFFFAOYSA-N |
| Molecular Formula | C19H15O2P |
Propionic acid, 99+%, extra pure
CAS: 79-09-4 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00002756 InChI Key: XBDQKXXYIPTUBI-UHFFFAOYSA-N Synonym: propionic acid,ethylformic acid,methylacetic acid,carboxyethane,ethanecarboxylic acid,pseudoacetic acid,metacetonic acid,monoprop,luprosil,prozoin PubChem CID: 1032 ChEBI: CHEBI:30768 IUPAC Name: propanoic acid SMILES: CCC(=O)O
| PubChem CID | 1032 |
|---|---|
| CAS | 79-09-4 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:30768 |
| MDL Number | MFCD00002756 |
| SMILES | CCC(=O)O |
| Synonym | propionic acid,ethylformic acid,methylacetic acid,carboxyethane,ethanecarboxylic acid,pseudoacetic acid,metacetonic acid,monoprop,luprosil,prozoin |
| IUPAC Name | propanoic acid |
| InChI Key | XBDQKXXYIPTUBI-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Bis(2-ethylhexyl) Phthalate 98.0+%, TCI America™
CAS: 117-81-7 Molecular Formula: C24H38O4 Molecular Weight (g/mol): 390.564 MDL Number: MFCD00009493 InChI Key: BJQHLKABXJIVAM-UHFFFAOYSA-N Synonym: dehp,bis 2-ethylhexyl phthalate,di 2-ethylhexyl phthalate,diethylhexyl phthalate,di-sec-octyl phthalate,octyl phthalate,fleximel,octoil PubChem CID: 8343 ChEBI: CHEBI:17747 IUPAC Name: bis(2-ethylhexyl) benzene-1,2-dicarboxylate SMILES: CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC
| PubChem CID | 8343 |
|---|---|
| CAS | 117-81-7 |
| Molecular Weight (g/mol) | 390.564 |
| ChEBI | CHEBI:17747 |
| MDL Number | MFCD00009493 |
| SMILES | CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC |
| Synonym | dehp,bis 2-ethylhexyl phthalate,di 2-ethylhexyl phthalate,diethylhexyl phthalate,di-sec-octyl phthalate,octyl phthalate,fleximel,octoil |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,2-dicarboxylate |
| InChI Key | BJQHLKABXJIVAM-UHFFFAOYSA-N |
| Molecular Formula | C24H38O4 |
Sulfuric Acid, 96%, Suprapur™, MilliporeSigma™
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| CAS | 7664-93-9 |
|---|---|
| Molecular Weight (g/mol) | 98.07 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
4,5-Bis(diphenylphosphino)-9,9-dimethylxanthene 98.0+%, TCI America™
CAS: 161265-03-8 Molecular Formula: C39H32OP2 Molecular Weight (g/mol): 578.63 MDL Number: MFCD00233866 InChI Key: CXNIUSPIQKWYAI-UHFFFAOYSA-N Synonym: xantphos,4,5-bis diphenylphosphino-9,9-dimethylxanthene,9,9-dimethyl-4,5-bis diphenylphosphino xanthene,9,9-dimethyl-9h-xanthene-4,5-diyl bis diphenylphosphine,dimethylbisdiphenylphosphinoxanthene,unii-nmu72mog9b,nmu72mog9b,9,9-dimethyl-9h-xanthene-4,5-diyl bis diphenylphosphane,5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl-diphenylphosphane,4,5-bis-diphenylphosphanyl-9,9-dimethyl-9h-xanthene PubChem CID: 636044 IUPAC Name: [5-(diphenylphosphanyl)-9,9-dimethyl-9H-xanthen-4-yl]diphenylphosphane SMILES: CC1(C)C2=C(OC3=C1C=CC=C3P(C1=CC=CC=C1)C1=CC=CC=C1)C(=CC=C2)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 636044 |
|---|---|
| CAS | 161265-03-8 |
| Molecular Weight (g/mol) | 578.63 |
| MDL Number | MFCD00233866 |
| SMILES | CC1(C)C2=C(OC3=C1C=CC=C3P(C1=CC=CC=C1)C1=CC=CC=C1)C(=CC=C2)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | xantphos,4,5-bis diphenylphosphino-9,9-dimethylxanthene,9,9-dimethyl-4,5-bis diphenylphosphino xanthene,9,9-dimethyl-9h-xanthene-4,5-diyl bis diphenylphosphine,dimethylbisdiphenylphosphinoxanthene,unii-nmu72mog9b,nmu72mog9b,9,9-dimethyl-9h-xanthene-4,5-diyl bis diphenylphosphane,5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl-diphenylphosphane,4,5-bis-diphenylphosphanyl-9,9-dimethyl-9h-xanthene |
| IUPAC Name | [5-(diphenylphosphanyl)-9,9-dimethyl-9H-xanthen-4-yl]diphenylphosphane |
| InChI Key | CXNIUSPIQKWYAI-UHFFFAOYSA-N |
| Molecular Formula | C39H32OP2 |
3-Hydroxybenzylamine, 96%, Thermo Scientific Chemicals
CAS: 73604-31-6 Molecular Formula: C7H9NO Molecular Weight (g/mol): 123.16 MDL Number: MFCD00798977 InChI Key: JNZYADHPGVZMQK-UHFFFAOYSA-N Synonym: 3-aminomethyl phenol,3-hydroxybenzylamine,phenol, 3-aminomethyl,3-hydroxybenzylamine, 3-hydroxyphenyl methylamine,3-aminomethyl-phenol,3-hydroxy-benzylamine,3-hydroxyphenyl methylamine PubChem CID: 735894 IUPAC Name: 3-(aminomethyl)phenol SMILES: NCC1=CC(O)=CC=C1
| PubChem CID | 735894 |
|---|---|
| CAS | 73604-31-6 |
| Molecular Weight (g/mol) | 123.16 |
| MDL Number | MFCD00798977 |
| SMILES | NCC1=CC(O)=CC=C1 |
| Synonym | 3-aminomethyl phenol,3-hydroxybenzylamine,phenol, 3-aminomethyl,3-hydroxybenzylamine, 3-hydroxyphenyl methylamine,3-aminomethyl-phenol,3-hydroxy-benzylamine,3-hydroxyphenyl methylamine |
| IUPAC Name | 3-(aminomethyl)phenol |
| InChI Key | JNZYADHPGVZMQK-UHFFFAOYSA-N |
| Molecular Formula | C7H9NO |
Polyethylene glycol (PEG), 50% soln.
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Levamisole Hydrochloride 99.0+%, TCI America™
CAS: 16595-80-5 Molecular Formula: C11H13ClN2S Molecular Weight (g/mol): 240.749 MDL Number: MFCD00012675 InChI Key: LAZPBGZRMVRFKY-HNCPQSOCSA-N Synonym: levamisole hydrochloride,levamisole hcl,ergamisol,tramisol,tramisole,decaris,--tetramisole hydrochloride,niratic hydrochloride,ascaridil,dekaris PubChem CID: 27944 ChEBI: CHEBI:6433 IUPAC Name: (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride SMILES: C1CSC2=NC(CN21)C3=CC=CC=C3.Cl
| PubChem CID | 27944 |
|---|---|
| CAS | 16595-80-5 |
| Molecular Weight (g/mol) | 240.749 |
| ChEBI | CHEBI:6433 |
| MDL Number | MFCD00012675 |
| SMILES | C1CSC2=NC(CN21)C3=CC=CC=C3.Cl |
| Synonym | levamisole hydrochloride,levamisole hcl,ergamisol,tramisol,tramisole,decaris,--tetramisole hydrochloride,niratic hydrochloride,ascaridil,dekaris |
| IUPAC Name | (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;hydrochloride |
| InChI Key | LAZPBGZRMVRFKY-HNCPQSOCSA-N |
| Molecular Formula | C11H13ClN2S |
Indium foil, 0.1mm (0.004in) thick, Puratronic™, 99.9975% (metals basis)
CAS: 7440-74-6 Molecular Formula: In Molecular Weight (g/mol): 114.82 MDL Number: MFCD00134048 InChI Key: APFVFJFRJDLVQX-UHFFFAOYSA-N Synonym: indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic PubChem CID: 5359967 ChEBI: CHEBI:30430 IUPAC Name: indium SMILES: [In]
| PubChem CID | 5359967 |
|---|---|
| CAS | 7440-74-6 |
| Molecular Weight (g/mol) | 114.82 |
| ChEBI | CHEBI:30430 |
| MDL Number | MFCD00134048 |
| SMILES | [In] |
| Synonym | indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic |
| IUPAC Name | indium |
| InChI Key | APFVFJFRJDLVQX-UHFFFAOYSA-N |
| Molecular Formula | In |