Chemicals
Filtered Search Results
Isobutyl isobutyrate, 98%
CAS: 97-85-8 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.21 MDL Number: MFCD00008916 InChI Key: RXGUIWHIADMCFC-UHFFFAOYSA-N Synonym: isobutyl isobutyrate,isobutyl 2-methylpropanoate,isobutyl isobutanoate,isobutyric acid, isobutyl ester,propanoic acid, 2-methyl-, 2-methylpropyl ester,2-methylpropyl 2-methylpropionate,2-methylpropyl isobutyrate,isobutylester kyseliny isomaselne,fema number 2189,2-methyl-1-propyl 2-methylpropanoate PubChem CID: 7351 IUPAC Name: 2-methylpropyl 2-methylpropanoate SMILES: CC(C)COC(=O)C(C)C
| PubChem CID | 7351 |
|---|---|
| CAS | 97-85-8 |
| Molecular Weight (g/mol) | 144.21 |
| MDL Number | MFCD00008916 |
| SMILES | CC(C)COC(=O)C(C)C |
| Synonym | isobutyl isobutyrate,isobutyl 2-methylpropanoate,isobutyl isobutanoate,isobutyric acid, isobutyl ester,propanoic acid, 2-methyl-, 2-methylpropyl ester,2-methylpropyl 2-methylpropionate,2-methylpropyl isobutyrate,isobutylester kyseliny isomaselne,fema number 2189,2-methyl-1-propyl 2-methylpropanoate |
| IUPAC Name | 2-methylpropyl 2-methylpropanoate |
| InChI Key | RXGUIWHIADMCFC-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
Phenetole, 98+%
CAS: 103-73-1 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.167 MDL Number: MFCD00009090 InChI Key: DLRJIFUOBPOJNS-UHFFFAOYSA-N Synonym: phenetole,benzene, ethoxy,ethyl phenyl ether,phenetol,phenyl ethyl ether,phenoxyethane,a phenoxyethane,ether, ethyl phenyl,unii-rb8lu2c57f PubChem CID: 7674 ChEBI: CHEBI:67129 IUPAC Name: ethoxybenzene SMILES: CCOC1=CC=CC=C1
| PubChem CID | 7674 |
|---|---|
| CAS | 103-73-1 |
| Molecular Weight (g/mol) | 122.167 |
| ChEBI | CHEBI:67129 |
| MDL Number | MFCD00009090 |
| SMILES | CCOC1=CC=CC=C1 |
| Synonym | phenetole,benzene, ethoxy,ethyl phenyl ether,phenetol,phenyl ethyl ether,phenoxyethane,a phenoxyethane,ether, ethyl phenyl,unii-rb8lu2c57f |
| IUPAC Name | ethoxybenzene |
| InChI Key | DLRJIFUOBPOJNS-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
Sodium, Ion chromatography standard solution, Specpure™ Na∣+ 1000μg/mL
CAS: 7440-23-5 Molecular Formula: Na Molecular Weight (g/mol): 22.99 MDL Number: MFCD00085307 InChI Key: KEAYESYHFKHZAL-UHFFFAOYSA-N Synonym: natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,monosodium PubChem CID: 5360545 ChEBI: CHEBI:26708 IUPAC Name: sodium SMILES: [Na]
| PubChem CID | 5360545 |
|---|---|
| CAS | 7440-23-5 |
| Molecular Weight (g/mol) | 22.99 |
| ChEBI | CHEBI:26708 |
| MDL Number | MFCD00085307 |
| SMILES | [Na] |
| Synonym | natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,monosodium |
| IUPAC Name | sodium |
| InChI Key | KEAYESYHFKHZAL-UHFFFAOYSA-N |
| Molecular Formula | Na |
Tungsten powder, -200+325 mesh, 99.95% (metals basis), Thermo Scientific Chemicals
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
Tungsten powder, -50+100 mesh, 99+% (metals basis)
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
3-Heptanone 98.0+%, TCI America™
CAS: 106-35-4 Molecular Formula: C7H14O Molecular Weight (g/mol): 114.19 MDL Number: MFCD00009483 InChI Key: NGAZZOYFWWSOGK-UHFFFAOYSA-N Synonym: 3-heptanone,butyl ethyl ketone,n-butyl ethyl ketone,aethylbutylketon,ethylbutylcetone,ethyl n-butyl ketone,ethylbutylketon,etilbutilchetone,eptan-3-one,ethyl butyl ketone PubChem CID: 7802 ChEBI: CHEBI:50139 IUPAC Name: heptan-3-one SMILES: CCCCC(=O)CC
| PubChem CID | 7802 |
|---|---|
| CAS | 106-35-4 |
| Molecular Weight (g/mol) | 114.19 |
| ChEBI | CHEBI:50139 |
| MDL Number | MFCD00009483 |
| SMILES | CCCCC(=O)CC |
| Synonym | 3-heptanone,butyl ethyl ketone,n-butyl ethyl ketone,aethylbutylketon,ethylbutylcetone,ethyl n-butyl ketone,ethylbutylketon,etilbutilchetone,eptan-3-one,ethyl butyl ketone |
| IUPAC Name | heptan-3-one |
| InChI Key | NGAZZOYFWWSOGK-UHFFFAOYSA-N |
| Molecular Formula | C7H14O |
Methoxypolyethylene glycol amine, M.W. 5,000
CAS: 80506-64-5 Molecular Formula: H2NCH2CH2(OCH2CH2)nOCH3 Molecular Weight (g/mol): 559.69 MDL Number: MFCD00131599 InChI Key: QWCGXANSAOXRFE-UHFFFAOYSA-N Synonym: 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontan-37-amine,mpeg12-nh2,mpeg12-amine,m-dpeg12-amine,m-peg12-amine,ambotzpeg1655,m-dpeg r 12-amine,aminopolyethylene glycol 5'000 monomethyl ether,3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaheptatriacontane-1-amine IUPAC Name: 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontan-37-amine SMILES: COCCOCCN
| CAS | 80506-64-5 |
|---|---|
| Molecular Weight (g/mol) | 559.69 |
| MDL Number | MFCD00131599 |
| SMILES | COCCOCCN |
| Synonym | 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontan-37-amine,mpeg12-nh2,mpeg12-amine,m-dpeg12-amine,m-peg12-amine,ambotzpeg1655,m-dpeg r 12-amine,aminopolyethylene glycol 5'000 monomethyl ether,3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxaheptatriacontane-1-amine |
| IUPAC Name | 2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxaheptatriacontan-37-amine |
| InChI Key | QWCGXANSAOXRFE-UHFFFAOYSA-N |
| Molecular Formula | H2NCH2CH2(OCH2CH2)nOCH3 |
2-Amino-5-cyanopyridine, 98%
CAS: 4214-73-7 Molecular Formula: C6H6N3 Molecular Weight (g/mol): 120.13 MDL Number: MFCD00128902 InChI Key: KDVBYUUGYXUXNL-UHFFFAOYSA-O Synonym: 2-amino-5-cyanopyridine,6-aminonicotinonitrile,6-amino-3-pyridinecarbonitrile,6-amino-nicotinonitrile,3-pyridinecarbonitrile, 6-amino,2-amino-5-cyano pyridine,6-aminonicotinonitril,zlchem 518,pubchem5752,acmc-209jnu PubChem CID: 818260 IUPAC Name: 6-aminopyridine-3-carbonitrile SMILES: NC1=CC=C(C=[NH+]1)C#N
| PubChem CID | 818260 |
|---|---|
| CAS | 4214-73-7 |
| Molecular Weight (g/mol) | 120.13 |
| MDL Number | MFCD00128902 |
| SMILES | NC1=CC=C(C=[NH+]1)C#N |
| Synonym | 2-amino-5-cyanopyridine,6-aminonicotinonitrile,6-amino-3-pyridinecarbonitrile,6-amino-nicotinonitrile,3-pyridinecarbonitrile, 6-amino,2-amino-5-cyano pyridine,6-aminonicotinonitril,zlchem 518,pubchem5752,acmc-209jnu |
| IUPAC Name | 6-aminopyridine-3-carbonitrile |
| InChI Key | KDVBYUUGYXUXNL-UHFFFAOYSA-O |
| Molecular Formula | C6H6N3 |
| CAS | 3368-04-5 |
|---|---|
| MDL Number | MFCD00016969 |
L-Phenylalanine methyl ester hydrochloride, 98%
CAS: 7524-50-7 Molecular Formula: C10H14ClNO2 Molecular Weight (g/mol): 215.68 MDL Number: MFCD00012489 InChI Key: SWVMLNPDTIFDDY-UHFFFAOYNA-N Synonym: l-phenylalanine methyl ester hydrochloride,h-phe-ome.hcl,methyl l-phenylalaninate hydrochloride,s-methyl 2-amino-3-phenylpropanoate hydrochloride,unii-47hk4y94ja,h-phe-ome hcl,h-phe-ome hydrochloride,l-phenylalanine, methyl ester, hydrochloride,l-phenylalanine methyl ester hcl PubChem CID: 75736 SMILES: [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1
| PubChem CID | 75736 |
|---|---|
| CAS | 7524-50-7 |
| Molecular Weight (g/mol) | 215.68 |
| MDL Number | MFCD00012489 |
| SMILES | [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 |
| Synonym | l-phenylalanine methyl ester hydrochloride,h-phe-ome.hcl,methyl l-phenylalaninate hydrochloride,s-methyl 2-amino-3-phenylpropanoate hydrochloride,unii-47hk4y94ja,h-phe-ome hcl,h-phe-ome hydrochloride,l-phenylalanine, methyl ester, hydrochloride,l-phenylalanine methyl ester hcl |
| InChI Key | SWVMLNPDTIFDDY-UHFFFAOYNA-N |
| Molecular Formula | C10H14ClNO2 |
1,10-Phenanthroline monohydrate, ACS reagent
CAS: 5144-89-8 Molecular Formula: C12H10N2O Molecular Weight (g/mol): 198.23 MDL Number: MFCD00149973 InChI Key: PPQJCISYYXZCAE-UHFFFAOYSA-N PubChem CID: 21226 SMILES: O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1
| PubChem CID | 21226 |
|---|---|
| CAS | 5144-89-8 |
| Molecular Weight (g/mol) | 198.23 |
| MDL Number | MFCD00149973 |
| SMILES | O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| InChI Key | PPQJCISYYXZCAE-UHFFFAOYSA-N |
| Molecular Formula | C12H10N2O |
Silver Nitrate, Certified, 0.0100N ±0.0002N (0.01M), LabChem™
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Indium foil, 0.5mm (0.02in) thick, Puratronic™, 99.9975% (metals basis)
CAS: 7440-74-6 Molecular Formula: In Molecular Weight (g/mol): 114.82 MDL Number: MFCD00134048 InChI Key: APFVFJFRJDLVQX-UHFFFAOYSA-N Synonym: indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic PubChem CID: 5359967 ChEBI: CHEBI:30430 IUPAC Name: indium SMILES: [In]
| PubChem CID | 5359967 |
|---|---|
| CAS | 7440-74-6 |
| Molecular Weight (g/mol) | 114.82 |
| ChEBI | CHEBI:30430 |
| MDL Number | MFCD00134048 |
| SMILES | [In] |
| Synonym | indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic |
| IUPAC Name | indium |
| InChI Key | APFVFJFRJDLVQX-UHFFFAOYSA-N |
| Molecular Formula | In |
[Bis(2-methoxyethyl)amino]sulfur trifluoride, 2.7M (50 wt.%) solution in toluene
CAS: 202289-38-1 | C6H14F3NO2S | 221.24 g/mol
| Linear Formula | (CH3OCHCH2)2NSF3 |
|---|---|
| Molecular Weight (g/mol) | 221.24 |
| Color | Orange-Yellow |
| Physical Form | Liquid |
| CAS Min % | 49.0 |
| Chemical Name or Material | [Bis(2-methoxyethyl)amino]sulfur trifluoride |
| SMILES | COCCN(CCOC)S(F)(F)F |
| Merck Index | 15,2899 |
| InChI Key | APOYTRAZFJURPB-UHFFFAOYSA-N |
| Density | 1.2000g/mL |
| PubChem CID | 2734690 |
| Percent Purity | ≥95% (NMR, neat substance) |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Use personal protective equipment as required. Avoid breathing dust/fume/gas/mist/vapors/spray. Do not breathe dust/fume/gas/mist/vapors/spray. IF SWALLOWED: Immediately call a POISON CENTRE or doctor/physician. Do NOT induce vomiting. Store in a dry place. Store in a closed container. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. |
| Health Hazard 2 | GHS H Statement Toxic if swallowed. May be fatal if swallowed and enters airways. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. Highly flammable liquid and vapor. Reacts violently with water. |
| Packaging | Plastic bottle |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | bis 2-methoxyethyl aminosulfur trifluoride,deoxo-fluor,2-methoxy-n-2-methoxyethyl-n-trifluorothio-ethanamine,deoxo-fluor r,bis 2-methoxyethyl aminosulphurtrifluoride,bast,bis 2-methoxyethyl amino sulfur trifluoride,bis 2-methoxyethyl aminosulphur trifluoride |
| IUPAC Name | 2-methoxy-N-(2-methoxyethyl)-N-(trifluoro-$l^{4}-sulfanyl)ethanamine |
| Molecular Formula | C6H14F3NO2S |
| Formula Weight | 221.24 |
| Specific Gravity | 1.2 |
| CAS Max % | 51.0 |
Tetramethylammonium hydroxide, 25% w/w in methanol
CAS: 75-59-2 Molecular Formula: C4H13NO Molecular Weight (g/mol): 91.154 MDL Number: MFCD00008280 InChI Key: WGTYBPLFGIVFAS-UHFFFAOYSA-M Synonym: tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide PubChem CID: 60966 IUPAC Name: tetramethylazanium;hydroxide SMILES: C[N+](C)(C)C.[OH-]
| PubChem CID | 60966 |
|---|---|
| CAS | 75-59-2 |
| Molecular Weight (g/mol) | 91.154 |
| MDL Number | MFCD00008280 |
| SMILES | C[N+](C)(C)C.[OH-] |
| Synonym | tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide |
| IUPAC Name | tetramethylazanium;hydroxide |
| InChI Key | WGTYBPLFGIVFAS-UHFFFAOYSA-M |
| Molecular Formula | C4H13NO |