Chemicals
Filtered Search Results
Lithium bromide, anhydrous, 99% min
CAS: 7550-35-8 Molecular Formula: BrLi Molecular Weight (g/mol): 86.844 MDL Number: MFCD00011077 InChI Key: AMXOYNBUYSYVKV-UHFFFAOYSA-M Synonym: lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide PubChem CID: 82050 ChEBI: CHEBI:63042 IUPAC Name: lithium;bromide SMILES: [Li+].[Br-]
| PubChem CID | 82050 |
|---|---|
| CAS | 7550-35-8 |
| Molecular Weight (g/mol) | 86.844 |
| ChEBI | CHEBI:63042 |
| MDL Number | MFCD00011077 |
| SMILES | [Li+].[Br-] |
| Synonym | lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide |
| IUPAC Name | lithium;bromide |
| InChI Key | AMXOYNBUYSYVKV-UHFFFAOYSA-M |
| Molecular Formula | BrLi |
| Linear Formula | NH3 |
|---|---|
| Molecular Weight (g/mol) | 17.03 |
| ChEBI | CHEBI:16134 |
| InChI Key | QGZKDVFQNNGYKY-UHFFFAOYSA-N |
| Density | 0.7870g/mL |
| PubChem CID | 222 |
| Fieser | 05,15 |
| Formula Weight | 17.03 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Ammonia |
| SMILES | N |
| Merck Index | 15, 488 |
| Concentration | 1.90 to 2.20M |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective clothing/eye protection/face protection. Do not breathe dust/fume/gas/mist/vapors/spray. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN: Wash with plenty of soap and water. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| MDL Number | MFCD00011418 |
| Health Hazard 2 | GHS P Statement Toxic in contact with skin. Causes damage to organs. Toxic if swallowed. Causes serious eye damage. Toxic if inhaled. Causes skin irritation. Highly flammable liquid and vapor. |
| Packaging | AcroSeal™ Glass Bottle |
| Flash Point | 6°C |
| Solubility Information | Solubility in water: soluble. Other solubilities: soluble in most organic solvents |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | ammonia,ammonia gas,spirit of hartshorn,nitro-sil,ammoniakgas,ammonia anhydrous,anhydrous ammonia,ammonia, anhydrous,ammoniak,am-fol |
| IUPAC Name | azane |
| Molecular Formula | H3N |
| Specific Gravity | 0.787 |
Sodium hydrogen arsenate heptahydrate, 98%
CAS: 10048-95-0 Molecular Formula: AsH15Na2O11 Molecular Weight (g/mol): 312.01 MDL Number: MFCD00149179 InChI Key: KOLXPEJIBITWIQ-UHFFFAOYSA-L Synonym: disodium arsenate heptahydrate,sodium acid arsenate, heptahydrate,sodium arsenate heptahydrate,sodium orthoarsenate heptahydrate,dibasic sodium arsenate heptahydrate,sodium arsenate, dibasic, heptahydrate,unii-90zq7g407w,disodium arsenate, heptahydrate,ccris 5553,arsenic acid h3aso4 , disodium salt, heptahydrate PubChem CID: 61460 IUPAC Name: disodium;hydrogen arsorate;heptahydrate SMILES: O.O.O.O.O.O.O.[Na+].[Na+].O[As]([O-])([O-])=O
| PubChem CID | 61460 |
|---|---|
| CAS | 10048-95-0 |
| Molecular Weight (g/mol) | 312.01 |
| MDL Number | MFCD00149179 |
| SMILES | O.O.O.O.O.O.O.[Na+].[Na+].O[As]([O-])([O-])=O |
| Synonym | disodium arsenate heptahydrate,sodium acid arsenate, heptahydrate,sodium arsenate heptahydrate,sodium orthoarsenate heptahydrate,dibasic sodium arsenate heptahydrate,sodium arsenate, dibasic, heptahydrate,unii-90zq7g407w,disodium arsenate, heptahydrate,ccris 5553,arsenic acid h3aso4 , disodium salt, heptahydrate |
| IUPAC Name | disodium;hydrogen arsorate;heptahydrate |
| InChI Key | KOLXPEJIBITWIQ-UHFFFAOYSA-L |
| Molecular Formula | AsH15Na2O11 |
Ammonium oxalate monohydrate, 98%
CAS: 6009-70-7 Molecular Formula: C2H10N2O5 Molecular Weight (g/mol): 142.111 MDL Number: MFCD00149694 InChI Key: MSMNVXKYCPHLLN-UHFFFAOYSA-N Synonym: ammonium oxalate monohydrate,ammonium oxalate monohydrate, acs,ethanedioic acid, diammonium salt, monohydrate,diazanium oxalate hydrate,acmc-1aw90,ksc493e5j,diammonium hydrate oxalate,oxalic acid ammonium salt monohydrate PubChem CID: 516808 IUPAC Name: diazanium;oxalate;hydrate SMILES: C(=O)(C(=O)[O-])[O-].[NH4+].[NH4+].O
| PubChem CID | 516808 |
|---|---|
| CAS | 6009-70-7 |
| Molecular Weight (g/mol) | 142.111 |
| MDL Number | MFCD00149694 |
| SMILES | C(=O)(C(=O)[O-])[O-].[NH4+].[NH4+].O |
| Synonym | ammonium oxalate monohydrate,ammonium oxalate monohydrate, acs,ethanedioic acid, diammonium salt, monohydrate,diazanium oxalate hydrate,acmc-1aw90,ksc493e5j,diammonium hydrate oxalate,oxalic acid ammonium salt monohydrate |
| IUPAC Name | diazanium;oxalate;hydrate |
| InChI Key | MSMNVXKYCPHLLN-UHFFFAOYSA-N |
| Molecular Formula | C2H10N2O5 |
Hexylamine 99.0+%, TCI America™
CAS: 111-26-2 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.19 MDL Number: MFCD00008240 InChI Key: BMVXCPBXGZKUPN-UHFFFAOYSA-N Synonym: hexylamine,1-aminohexane,n-hexylamine,1-hexanamine,1-hexylamine,mono-n-hexylamine,hexanamine,hexyl amine,unii-ci4e002zv8,hexyl-amine PubChem CID: 8102 ChEBI: CHEBI:5712 IUPAC Name: hexan-1-amine SMILES: CCCCCCN
| PubChem CID | 8102 |
|---|---|
| CAS | 111-26-2 |
| Molecular Weight (g/mol) | 101.19 |
| ChEBI | CHEBI:5712 |
| MDL Number | MFCD00008240 |
| SMILES | CCCCCCN |
| Synonym | hexylamine,1-aminohexane,n-hexylamine,1-hexanamine,1-hexylamine,mono-n-hexylamine,hexanamine,hexyl amine,unii-ci4e002zv8,hexyl-amine |
| IUPAC Name | hexan-1-amine |
| InChI Key | BMVXCPBXGZKUPN-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
1-Naphthaleneacetic Acid 98.0+%, TCI America™
CAS: 86-87-3 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004046 InChI Key: PRPINYUDVPFIRX-UHFFFAOYSA-N Synonym: 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop PubChem CID: 6862 ChEBI: CHEBI:32918 IUPAC Name: 2-(naphthalen-1-yl)acetic acid SMILES: OC(=O)CC1=C2C=CC=CC2=CC=C1
| PubChem CID | 6862 |
|---|---|
| CAS | 86-87-3 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:32918 |
| MDL Number | MFCD00004046 |
| SMILES | OC(=O)CC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop |
| IUPAC Name | 2-(naphthalen-1-yl)acetic acid |
| InChI Key | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
Gallium Indium eutectic, 99.99% (metals basis)
Gallium Indium eutectic, Ga:In; 75.5:24.5 wt%, 10 g, 99.99% (metals basis), 6.2, Hazard Class: 8; Packaging Group: III, 231-163-8, H290-H314-H335, P234-P260-P264b-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P390-P501c, 15.7 deg.C, MFCD00144387, Liquid | Ga:In; 75.5:24.5 wt%
| Form | Liquid |
|---|---|
| Chemical Name or Material | Gallium Indium eutectic |
| Density | 6.2 |
| Assay Percent Range | 99.99% (metals basis) |
| Health Hazard 3 | P234-P260-P264b-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P390-P501c |
| MDL Number | MFCD00144387 |
| Solubility Information | Insoluble in water or organic solvents. |
| Health Hazard 1 | H290-H314-H335 |
| DOT Information | Hazard Class: 8; Packaging Group: III |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | Ga:In; 75.5:24.5 wt% |
| EINECS Number | 231-163-8 |
| Melting Point | 15.7°C |
Sodium dihydrogen citrate, 99%
CAS: 18996-35-5 Molecular Formula: C6H10NaO7 Molecular Weight (g/mol): 217.129 MDL Number: MFCD00013067 InChI Key: SLWOXBQHKZPUNY-UHFFFAOYSA-N Synonym: bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? PubChem CID: 131675399 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;molecular hydrogen;sodium SMILES: [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na]
| PubChem CID | 131675399 |
|---|---|
| CAS | 18996-35-5 |
| Molecular Weight (g/mol) | 217.129 |
| MDL Number | MFCD00013067 |
| SMILES | [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na] |
| Synonym | bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;molecular hydrogen;sodium |
| InChI Key | SLWOXBQHKZPUNY-UHFFFAOYSA-N |
| Molecular Formula | C6H10NaO7 |
2-Amino-6-methylpyridine, 99%
CAS: 1824-81-3 Molecular Formula: C6H8N2 Molecular Weight (g/mol): 108.14 MDL Number: MFCD00006331 InChI Key: QUXLCYFNVNNRBE-UHFFFAOYSA-N Synonym: 2-amino-6-methylpyridine,2-amino-6-picoline,6-amino-2-picoline,2-pyridinamine, 6-methyl,6-methyl-2-pyridinamine,6-methyl-2-pyridylamine,6-methyl-2-aminopyridine,2-picoline, 6-amino,6-amino-2-methylpyridine,pyridine, 2-amino-6-methyl PubChem CID: 15765 IUPAC Name: 6-methylpyridin-2-amine SMILES: CC1=CC=CC(N)=N1
| PubChem CID | 15765 |
|---|---|
| CAS | 1824-81-3 |
| Molecular Weight (g/mol) | 108.14 |
| MDL Number | MFCD00006331 |
| SMILES | CC1=CC=CC(N)=N1 |
| Synonym | 2-amino-6-methylpyridine,2-amino-6-picoline,6-amino-2-picoline,2-pyridinamine, 6-methyl,6-methyl-2-pyridinamine,6-methyl-2-pyridylamine,6-methyl-2-aminopyridine,2-picoline, 6-amino,6-amino-2-methylpyridine,pyridine, 2-amino-6-methyl |
| IUPAC Name | 6-methylpyridin-2-amine |
| InChI Key | QUXLCYFNVNNRBE-UHFFFAOYSA-N |
| Molecular Formula | C6H8N2 |
Terbium(III) chloride hexahydrate, 99.9%, (trace metal basis)
CAS: 13798-24-8 Molecular Formula: Cl3H12O6Tb Molecular Weight (g/mol): 373.37 MDL Number: MFCD00149870 InChI Key: ULJUVCOAZNLCJZ-UHFFFAOYSA-K IUPAC Name: terbium(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Tb+3]
| CAS | 13798-24-8 |
|---|---|
| Molecular Weight (g/mol) | 373.37 |
| MDL Number | MFCD00149870 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Tb+3] |
| IUPAC Name | terbium(3+) hexahydrate trichloride |
| InChI Key | ULJUVCOAZNLCJZ-UHFFFAOYSA-K |
| Molecular Formula | Cl3H12O6Tb |
2,9-Dimethyl-1,10-phenanthroline, 98%
CAS: 484-11-7 Molecular Formula: C14H12N2 Molecular Weight (g/mol): 208.264 MDL Number: MFCD00004973 InChI Key: IYRGXJIJGHOCFS-UHFFFAOYSA-N Synonym: neocuproine,neocuproin,1,10-phenanthroline, 2,9-dimethyl,2,9-dimethylphenanthroline,2,9-dimethyl-o-phenanthroline,neo-cuproin,neocuproine hemihydrate,dmphen,unii-8e7d2sh3bv,8e7d2sh3bv PubChem CID: 65237 IUPAC Name: 2,9-dimethyl-1,10-phenanthroline SMILES: CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C
| PubChem CID | 65237 |
|---|---|
| CAS | 484-11-7 |
| Molecular Weight (g/mol) | 208.264 |
| MDL Number | MFCD00004973 |
| SMILES | CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C |
| Synonym | neocuproine,neocuproin,1,10-phenanthroline, 2,9-dimethyl,2,9-dimethylphenanthroline,2,9-dimethyl-o-phenanthroline,neo-cuproin,neocuproine hemihydrate,dmphen,unii-8e7d2sh3bv,8e7d2sh3bv |
| IUPAC Name | 2,9-dimethyl-1,10-phenanthroline |
| InChI Key | IYRGXJIJGHOCFS-UHFFFAOYSA-N |
| Molecular Formula | C14H12N2 |
3-Methylcyclohexanone, 97%
CAS: 591-24-2 Molecular Formula: C7H12O Molecular Weight (g/mol): 112.17 MDL Number: MFCD00001639 InChI Key: UJBOOUHRTQVGRU-UHFFFAOYNA-N Synonym: 3-methylcyclohexanone,cyclohexanone, 3-methyl,methyl-3 cyclohexanone-1,3-methyl cyclohexanone,methyl-3 cyclohexanone-1 french,m-methylcyclohexanone,r-3-methylcyclohexanone,+-3r-3-methylcyclohexanone,cyclohexanone, 3-methyl-, r,cyclohexanone, 3-methyl-, s PubChem CID: 11567 IUPAC Name: 3-methylcyclohexan-1-one SMILES: CC1CCCC(=O)C1
| PubChem CID | 11567 |
|---|---|
| CAS | 591-24-2 |
| Molecular Weight (g/mol) | 112.17 |
| MDL Number | MFCD00001639 |
| SMILES | CC1CCCC(=O)C1 |
| Synonym | 3-methylcyclohexanone,cyclohexanone, 3-methyl,methyl-3 cyclohexanone-1,3-methyl cyclohexanone,methyl-3 cyclohexanone-1 french,m-methylcyclohexanone,r-3-methylcyclohexanone,+-3r-3-methylcyclohexanone,cyclohexanone, 3-methyl-, r,cyclohexanone, 3-methyl-, s |
| IUPAC Name | 3-methylcyclohexan-1-one |
| InChI Key | UJBOOUHRTQVGRU-UHFFFAOYNA-N |
| Molecular Formula | C7H12O |
1-Bromo-3-phenylpropane, 98%
CAS: 637-59-2 Molecular Formula: C9H11Br Molecular Weight (g/mol): 199.09 MDL Number: MFCD00000257 InChI Key: XMZQWZJMTBCUFT-UHFFFAOYSA-N Synonym: 3-bromopropyl benzene,1-bromo-3-phenylpropane,3-phenylpropyl bromide,benzene, 3-bromopropyl,3-bromo-1-phenylpropane,3-bromoprop-1-yl benzene,unii-6vx623qn9v,.gamma.-bromopropyl benzene,4-bromopropylbenzene,benzene, bromopropyl PubChem CID: 12503 IUPAC Name: 3-bromopropylbenzene SMILES: BrCCCC1=CC=CC=C1
| PubChem CID | 12503 |
|---|---|
| CAS | 637-59-2 |
| Molecular Weight (g/mol) | 199.09 |
| MDL Number | MFCD00000257 |
| SMILES | BrCCCC1=CC=CC=C1 |
| Synonym | 3-bromopropyl benzene,1-bromo-3-phenylpropane,3-phenylpropyl bromide,benzene, 3-bromopropyl,3-bromo-1-phenylpropane,3-bromoprop-1-yl benzene,unii-6vx623qn9v,.gamma.-bromopropyl benzene,4-bromopropylbenzene,benzene, bromopropyl |
| IUPAC Name | 3-bromopropylbenzene |
| InChI Key | XMZQWZJMTBCUFT-UHFFFAOYSA-N |
| Molecular Formula | C9H11Br |
5-Bromo-1-pentene, 95%
CAS: 1119-51-3 Molecular Formula: C5H9Br Molecular Weight (g/mol): 149.03 MDL Number: MFCD00000264 InChI Key: LPNANKDXVBMDKE-UHFFFAOYSA-N Synonym: 5-bromo-1-pentene,1-pentene, 5-bromo,1-bromo-4-pentene,4-pentenyl bromide,5-bromopentene,5-bromo-pent-1-ene,5-bromo-pentene,5-bromopentene-1,5-bromo-1-amylene,pent-4-enyl bromide PubChem CID: 70704 IUPAC Name: 5-bromopent-1-ene SMILES: C=CCCCBr
| PubChem CID | 70704 |
|---|---|
| CAS | 1119-51-3 |
| Molecular Weight (g/mol) | 149.03 |
| MDL Number | MFCD00000264 |
| SMILES | C=CCCCBr |
| Synonym | 5-bromo-1-pentene,1-pentene, 5-bromo,1-bromo-4-pentene,4-pentenyl bromide,5-bromopentene,5-bromo-pent-1-ene,5-bromo-pentene,5-bromopentene-1,5-bromo-1-amylene,pent-4-enyl bromide |
| IUPAC Name | 5-bromopent-1-ene |
| InChI Key | LPNANKDXVBMDKE-UHFFFAOYSA-N |
| Molecular Formula | C5H9Br |
Polystyrene standard, M.W. 290,000, Mw/Mn 1.06
CAS: 9003-53-6 Molecular Formula: (C8H8)n Molecular Weight (g/mol): 104.15 MDL Number: MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: ethenylbenzene SMILES: *-CC(-*)C1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 9003-53-6 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00084450 |
| SMILES | *-CC(-*)C1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | ethenylbenzene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | (C8H8)n |