Chemicals
Filtered Search Results
Ricca Chemical Company Perchloric Acid, 8% (w/v) Aqueous, Ricca Chemical
CAS: 7732-18-5 Molecular Formula: ClHO4 Molecular Weight (g/mol): 100.45 MDL Number: MFCD00011325 InChI Key: VLTRZXGMWDSKGL-UHFFFAOYSA-N Synonym: unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 PubChem CID: 24247 ChEBI: CHEBI:29221 IUPAC Name: perchloric acid SMILES: O[Cl](=O)(=O)=O
| PubChem CID | 24247 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 100.45 |
| ChEBI | CHEBI:29221 |
| MDL Number | MFCD00011325 |
| SMILES | O[Cl](=O)(=O)=O |
| Synonym | unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 |
| IUPAC Name | perchloric acid |
| InChI Key | VLTRZXGMWDSKGL-UHFFFAOYSA-N |
| Molecular Formula | ClHO4 |
Sodium deoxycholate monohydrate, 97%, Thermo Scientific Chemicals
CAS: 145224-92-6 Molecular Formula: C24H41NaO5 Molecular Weight (g/mol): 432.58 MDL Number: MFCD00150750 MFCD00064139 InChI Key: NDVHNZISGVSFMP-WTCAICSISA-M Synonym: 7-Deoxycholic acid sodium salt PubChem CID: 91810855 IUPAC Name: sodium (4R)-4-[(1R,3aS,3bR,5aR,7R,9aS,9bS,11S,11aR)-7,11-dihydroxy-9a,11a-dimethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-1-yl]pentanoate hydrate SMILES: O.[Na+].[H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCC([O-])=O
| PubChem CID | 91810855 |
|---|---|
| CAS | 145224-92-6 |
| Molecular Weight (g/mol) | 432.58 |
| MDL Number | MFCD00150750 MFCD00064139 |
| SMILES | O.[Na+].[H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCC([O-])=O |
| Synonym | 7-Deoxycholic acid sodium salt |
| IUPAC Name | sodium (4R)-4-[(1R,3aS,3bR,5aR,7R,9aS,9bS,11S,11aR)-7,11-dihydroxy-9a,11a-dimethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-1-yl]pentanoate hydrate |
| InChI Key | NDVHNZISGVSFMP-WTCAICSISA-M |
| Molecular Formula | C24H41NaO5 |
LabChem, Inc. EDTA, Certified, 0.0500M ±0.0005M (0.1N), LabChem™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Reagent Alcohol, ACS Grade, 94.0% to 96.0% (v/v), LabChem™
CAS: 64-17-5 Molecular Formula: C2H6O Molecular Weight (g/mol): 46.069 InChI Key: LFQSCWFLJHTTHZ-UHFFFAOYSA-N Synonym: ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol PubChem CID: 702 ChEBI: CHEBI:16236 IUPAC Name: ethanol SMILES: CCO
| PubChem CID | 702 |
|---|---|
| CAS | 64-17-5 |
| Molecular Weight (g/mol) | 46.069 |
| ChEBI | CHEBI:16236 |
| SMILES | CCO |
| Synonym | ethyl alcohol,alcohol,methylcarbinol,grain alcohol,ethyl hydroxide,ethyl hydrate,algrain,alcohol,anhydrol,tecsol |
| IUPAC Name | ethanol |
| InChI Key | LFQSCWFLJHTTHZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6O |
Acetone, For HPLC, MilliporeSigma™
CAS: 67-64-1 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00008765 InChI Key: CSCPPACGZOOCGX-UHFFFAOYSA-N Synonym: acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone PubChem CID: 180 ChEBI: CHEBI:15347 IUPAC Name: propan-2-one SMILES: CC(C)=O
| PubChem CID | 180 |
|---|---|
| CAS | 67-64-1 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:15347 |
| MDL Number | MFCD00008765 |
| SMILES | CC(C)=O |
| Synonym | acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone |
| IUPAC Name | propan-2-one |
| InChI Key | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O |
4-Methylpiperidine, 98+%
CAS: 626-58-4 Molecular Formula: C6H13N Molecular Weight (g/mol): 99.18 MDL Number: MFCD00006005 InChI Key: UZOFELREXGAFOI-UHFFFAOYSA-N Synonym: 4-pipecoline,piperidine, 4-methyl,gamma-pipecoline,4-methylpiperidin,.gamma.-pipecoline,4-methyl-piperidine,4-methylpiperdine,4-methylpyperidine,4-methyl piperidine,hexahydro-g-picoline PubChem CID: 69381 IUPAC Name: 4-methylpiperidine SMILES: CC1CCNCC1
| PubChem CID | 69381 |
|---|---|
| CAS | 626-58-4 |
| Molecular Weight (g/mol) | 99.18 |
| MDL Number | MFCD00006005 |
| SMILES | CC1CCNCC1 |
| Synonym | 4-pipecoline,piperidine, 4-methyl,gamma-pipecoline,4-methylpiperidin,.gamma.-pipecoline,4-methyl-piperidine,4-methylpiperdine,4-methylpyperidine,4-methyl piperidine,hexahydro-g-picoline |
| IUPAC Name | 4-methylpiperidine |
| InChI Key | UZOFELREXGAFOI-UHFFFAOYSA-N |
| Molecular Formula | C6H13N |
Sodium Hydroxide, 0.500 N (N/2), Ricca Chemical
Molecular Formula: HNaO Molecular Weight (g/mol): 40 g/mol InChI Key: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC Name: sodium;hydroxide SMILES: [OH-].[Na+]
| PubChem CID | 14798 |
|---|---|
| Molecular Weight (g/mol) | 40 g/mol |
| ChEBI | CHEBI:32145 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Molecular Formula | HNaO |
Calcium sulfate, anhydrous, 99%
CAS: 7778-18-9 Molecular Formula: CaO4S Molecular Weight (g/mol): 136.13 MDL Number: MFCD00010912 InChI Key: OSGAYBCDTDRGGQ-UHFFFAOYSA-L Synonym: calcium sulfate,drierite,gypsum,sulfuric acid, calcium salt 1:1,karstenite,calcium sulphate,anhydrous gypsum,plaster of paris,anhydrous calcium sulfate,calcium sulfate, anhydrous PubChem CID: 24497 ChEBI: CHEBI:31346 IUPAC Name: calcium;sulfate SMILES: [Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24497 |
|---|---|
| CAS | 7778-18-9 |
| Molecular Weight (g/mol) | 136.13 |
| ChEBI | CHEBI:31346 |
| MDL Number | MFCD00010912 |
| SMILES | [Ca++].[O-]S([O-])(=O)=O |
| Synonym | calcium sulfate,drierite,gypsum,sulfuric acid, calcium salt 1:1,karstenite,calcium sulphate,anhydrous gypsum,plaster of paris,anhydrous calcium sulfate,calcium sulfate, anhydrous |
| IUPAC Name | calcium;sulfate |
| InChI Key | OSGAYBCDTDRGGQ-UHFFFAOYSA-L |
| Molecular Formula | CaO4S |
tert-Amyl Alcohol 98.0+%, TCI America™
CAS: 75-85-4 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00004478 InChI Key: MSXVEPNJUHWQHW-UHFFFAOYSA-N Synonym: 2-methyl-2-butanol,tert-amyl alcohol,amylene hydrate,tert-pentyl alcohol,tert-pentanol,t-amyl alcohol,2-butanol, 2-methyl,dimethylethylcarbinol,ethyldimethylcarbinol,tert-isoamyl alcohol PubChem CID: 6405 IUPAC Name: 2-methylbutan-2-ol SMILES: CCC(C)(C)O
| PubChem CID | 6405 |
|---|---|
| CAS | 75-85-4 |
| Molecular Weight (g/mol) | 88.15 |
| MDL Number | MFCD00004478 |
| SMILES | CCC(C)(C)O |
| Synonym | 2-methyl-2-butanol,tert-amyl alcohol,amylene hydrate,tert-pentyl alcohol,tert-pentanol,t-amyl alcohol,2-butanol, 2-methyl,dimethylethylcarbinol,ethyldimethylcarbinol,tert-isoamyl alcohol |
| IUPAC Name | 2-methylbutan-2-ol |
| InChI Key | MSXVEPNJUHWQHW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
1,1,1,3,3,3-Hexafluoro-2-propanol 99.0+%, TCI America™
CAS: 920-66-1 Molecular Formula: C3H2F6O Molecular Weight (g/mol): 168.038 MDL Number: MFCD00011651 InChI Key: BYEAHWXPCBROCE-UHFFFAOYSA-N Synonym: 1,1,1,3,3,3-hexafluoro-2-propanol,hexafluoroisopropanol,hfip,hexafluoro-2-propanol,hexafluoroisopropyl alcohol,bis trifluoromethyl methanol,1,1,1,3,3,3-hexafluoroisopropanol,2h-hexafluoroisopropanol,2-propanol, 1,1,1,3,3,3-hexafluoro,1,1,1,3,3,3-hexafluoroisopropyl alcohol PubChem CID: 13529 ChEBI: CHEBI:63104 IUPAC Name: 1,1,1,3,3,3-hexafluoropropan-2-ol SMILES: C(C(F)(F)F)(C(F)(F)F)O
| PubChem CID | 13529 |
|---|---|
| CAS | 920-66-1 |
| Molecular Weight (g/mol) | 168.038 |
| ChEBI | CHEBI:63104 |
| MDL Number | MFCD00011651 |
| SMILES | C(C(F)(F)F)(C(F)(F)F)O |
| Synonym | 1,1,1,3,3,3-hexafluoro-2-propanol,hexafluoroisopropanol,hfip,hexafluoro-2-propanol,hexafluoroisopropyl alcohol,bis trifluoromethyl methanol,1,1,1,3,3,3-hexafluoroisopropanol,2h-hexafluoroisopropanol,2-propanol, 1,1,1,3,3,3-hexafluoro,1,1,1,3,3,3-hexafluoroisopropyl alcohol |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChI Key | BYEAHWXPCBROCE-UHFFFAOYSA-N |
| Molecular Formula | C3H2F6O |
Ammonia, ca. 7N solution in methanol
Ammonia, H3N, CAS Number-7664-41-7, 67-56-1, am-fol, ammonia, ammonia anhydrous, ammonia, anhydrous, ammonia gas, ammoniak, ammoniakgas, anhydrous ammonia, nitro-sil, spirit of hartshorn, 2.5L, CHEBI:16134, Colorless to Yellow, 6.0 to 7.5N, 0.7700g/mL, 05,15, 14 deg.C, 17.03, GHS Signal Word: Danger | CAS: 7664-41-7 | H3N | 17.03 g/mol
| Linear Formula | NH3 |
|---|---|
| Molecular Weight (g/mol) | 17.03 |
| ChEBI | CHEBI:16134 |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Ammonia |
| SMILES | N |
| Merck Index | 15, 488 |
| Concentration | 6.0 to 7.5N |
| InChI Key | QGZKDVFQNNGYKY-UHFFFAOYSA-N |
| Density | 0.7700g/mL |
| PubChem CID | 222 |
| Name Note | ca. 7N Solution in Methanol |
| Fieser | 05,15 |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement: IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective clothing/eye protection/face protection. Call a POISON CENTER or doctor/physician if you feel unwell. IF ON SKIN: Gently wash with plenty of soap and water. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. IF exposed: Call a POISON CENTER or doctor/physician. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Avoid release to the environment. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00011418 |
| Health Hazard 2 | GHS H Statement: Toxic if swallowed. Causes severe skin burns and eye damage. Toxic in contact with skin. Causes damage to organs. Fatal if inhaled. Highly flammable liquid and vapor. |
| Flash Point | 14°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | ammonia,ammonia gas,spirit of hartshorn,nitro-sil,ammoniakgas,ammonia anhydrous,anhydrous ammonia,ammonia, anhydrous,ammoniak,am-fol |
| IUPAC Name | azane |
| Molecular Formula | H3N |
| Formula Weight | 17.03 |
| Specific Gravity | 0.77 |
Acetonitrile, DriSolv™, MilliporeSigma™
CAS: 75-05-8 Molecular Formula: C2H3N Molecular Weight (g/mol): 41.053 InChI Key: WEVYAHXRMPXWCK-UHFFFAOYSA-N Synonym: methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn PubChem CID: 6342 ChEBI: CHEBI:38472 IUPAC Name: acetonitrile SMILES: CC#N
| PubChem CID | 6342 |
|---|---|
| CAS | 75-05-8 |
| Molecular Weight (g/mol) | 41.053 |
| ChEBI | CHEBI:38472 |
| SMILES | CC#N |
| Synonym | methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn |
| IUPAC Name | acetonitrile |
| InChI Key | WEVYAHXRMPXWCK-UHFFFAOYSA-N |
| Molecular Formula | C2H3N |
LabChem, Inc. Sulfuric Acid, Certified, 50% (v/v) ±1%, LabChem™
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Cesium carbonate, 99% (metals basis)
CAS: 534-17-8 Molecular Formula: CCs2O3 Molecular Weight (g/mol): 325.82 MDL Number: MFCD00010957 InChI Key: FJDQFPXHSGXQBY-UHFFFAOYSA-L Synonym: cesium carbonate,dicesium carbonate,caesium carbonate,cesiumcarbonate,carbonic acid, dicesium salt,cs2co3,unii-qqi20a14p4,cesium carbonate cs2co3,carbonic acid, cesium salt 1:2,dicaesium 1+ ion carbonate PubChem CID: 10796 SMILES: [Cs+].[Cs+].[O-]C([O-])=O
| PubChem CID | 10796 |
|---|---|
| CAS | 534-17-8 |
| Molecular Weight (g/mol) | 325.82 |
| MDL Number | MFCD00010957 |
| SMILES | [Cs+].[Cs+].[O-]C([O-])=O |
| Synonym | cesium carbonate,dicesium carbonate,caesium carbonate,cesiumcarbonate,carbonic acid, dicesium salt,cs2co3,unii-qqi20a14p4,cesium carbonate cs2co3,carbonic acid, cesium salt 1:2,dicaesium 1+ ion carbonate |
| InChI Key | FJDQFPXHSGXQBY-UHFFFAOYSA-L |
| Molecular Formula | CCs2O3 |
3-Methyl-1-butanol 99.0+%, TCI America™
CAS: 123-51-3 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 MDL Number: MFCD00002934 InChI Key: PHTQWCKDNZKARW-UHFFFAOYSA-N Synonym: 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol PubChem CID: 31260 ChEBI: CHEBI:15837 IUPAC Name: 3-methylbutan-1-ol SMILES: CC(C)CCO
| PubChem CID | 31260 |
|---|---|
| CAS | 123-51-3 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:15837 |
| MDL Number | MFCD00002934 |
| SMILES | CC(C)CCO |
| Synonym | 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol |
| IUPAC Name | 3-methylbutan-1-ol |
| InChI Key | PHTQWCKDNZKARW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |