Chemicals
Filtered Search Results
Boron trifluoride, 12% (1.5M) in methanol
Boron trifluoride, 12% (1.5M) in methanol, Quantity: 500g, Packaging: Glass bottle, Boiling Point: 65.0 deg.C, CAS: 373-57-9, 67-56-1, Amber to Colorless, Melting Point: -98.0 deg.C, Molecular Formula: BF3, Molecular Weight: 67.81, Percent Purity: 10 to 15% (w/v BF3) | CAS: 373-57-9 | BF3 | 67.81 g/mol
| Linear Formula | BF3 |
|---|---|
| Molecular Weight (g/mol) | 67.81 |
| InChI Key | WTEOIRVLGSZEPR-UHFFFAOYSA-N |
| Density | 0.8700g/mL |
| PubChem CID | 11062313 |
| Name Note | 1.5M solution in methanol |
| Percent Purity | 10 to 15% (w/v BF3) |
| RTECS Number | ED2275000 |
| Formula Weight | 67.81 |
| Melting Point | -98.0°C |
| Boiling Point | 65.0°C |
| Color | Amber to Colorless |
| Physical Form | Solution |
| Chemical Name or Material | Boron trifluoride |
| SMILES | FB(F)F |
| Merck Index | 14, 1349 |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| MDL Number | MFCD00011316 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. Fatal if inhaled. Toxic if swallowed. Reacts violently with water. Toxic in contact with skin. Causes damage to organs |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: may decompose |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | boron trifluoride-methanol solution,boron trifluoride-methanol complex,boron trifluoride methanol,boron trifluoride-methanol solution in methanol,bf3 methanol,.bf3 in methanol,boron fluoride methanol,bf3 meoh,borontrifluoride methanol,boron trifluoride solution |
| TSCA | TSCA |
| Molecular Formula | BF3 |
| EINECS Number | 206-766-4 |
| Specific Gravity | 0.87 |
N-(1-Naphthyl)ethylenediamine dihydrochloride, ACS
CAS: 1465-25-4 Molecular Formula: C12H16Cl2N2 Molecular Weight (g/mol): 259.174 MDL Number: MFCD00012556 InChI Key: MZNYWPRCVDMOJG-UHFFFAOYSA-N Synonym: n-1-naphthyl ethylenediamine dihydrochloride,n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride,marshall's reagent,n-1-naphthylethylenediamine dihydrochloride,ccris 425,unii-h734599kjl,1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride,2-1-naphthylamino ethylamine 2hcl,bratton-marshall reagent,n-1-naphthalenyl-1,2-ethanediamine dihydrochloride PubChem CID: 15106 ChEBI: CHEBI:53452 IUPAC Name: N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride SMILES: C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl
| PubChem CID | 15106 |
|---|---|
| CAS | 1465-25-4 |
| Molecular Weight (g/mol) | 259.174 |
| ChEBI | CHEBI:53452 |
| MDL Number | MFCD00012556 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl |
| Synonym | n-1-naphthyl ethylenediamine dihydrochloride,n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride,marshall's reagent,n-1-naphthylethylenediamine dihydrochloride,ccris 425,unii-h734599kjl,1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride,2-1-naphthylamino ethylamine 2hcl,bratton-marshall reagent,n-1-naphthalenyl-1,2-ethanediamine dihydrochloride |
| IUPAC Name | N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| InChI Key | MZNYWPRCVDMOJG-UHFFFAOYSA-N |
| Molecular Formula | C12H16Cl2N2 |
Methanol, 99.8%, Extra Dry, anhydrous, SC, AcroSeal™, Thermo Scientific Chemicals
CAS: 67-56-1 Molecular Formula: CH4O Molecular Weight (g/mol): 32.04 MDL Number: MFCD00004595 InChI Key: OKKJLVBELUTLKV-UHFFFAOYSA-N Synonym: methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit PubChem CID: 887 ChEBI: CHEBI:17790 IUPAC Name: methanol SMILES: CO
| PubChem CID | 887 |
|---|---|
| CAS | 67-56-1 |
| Molecular Weight (g/mol) | 32.04 |
| ChEBI | CHEBI:17790 |
| MDL Number | MFCD00004595 |
| SMILES | CO |
| Synonym | methyl alcohol,wood alcohol,carbinol,wood spirit,wood naphtha,methylol,methyl hydroxide,pyroxylic spirit,colonial spirit,columbian spirit |
| IUPAC Name | methanol |
| InChI Key | OKKJLVBELUTLKV-UHFFFAOYSA-N |
| Molecular Formula | CH4O |
Hydrochloric acid, 0.5N Standardized Solution
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: chlorane SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | chlorane |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Iron(II) sulfate heptahydrate, ACS, 99+%
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Chloroform, >=99.8%, ACS reagent, stab. with EtOH, meets the requir. of Reag.Ph.Eur.
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
Phosphoric acid, ACS reagent, 85+% solution in water
CAS: 7664-38-2 Molecular Formula: H3O4P Molecular Weight (g/mol): 97.994 MDL Number: MFCD00011340 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid SMILES: OP(=O)(O)O
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| Molecular Weight (g/mol) | 97.994 |
| ChEBI | CHEBI:26078 |
| MDL Number | MFCD00011340 |
| SMILES | OP(=O)(O)O |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
Ammonium hydroxide, for analysis, 28-30 wt% solution of NH3 in water
CAS: 1336-21-6 Molecular Formula: H5NO Molecular Weight (g/mol): 35.05 MDL Number: MFCD00066650 InChI Key: VHUUQVKOLVNVRT-UHFFFAOYSA-N Synonym: ammonium hydroxide,ammonia water,ammonia aqueous,aquammonia,aqua ammonia,ammonia, aqua,household ammonia,ammonium hydroxide solution,ammonia, monohydrate,ammonium hydroxide nh4 oh PubChem CID: 14923 ChEBI: CHEBI:18219 SMILES: N.O
| PubChem CID | 14923 |
|---|---|
| CAS | 1336-21-6 |
| Molecular Weight (g/mol) | 35.05 |
| ChEBI | CHEBI:18219 |
| MDL Number | MFCD00066650 |
| SMILES | N.O |
| Synonym | ammonium hydroxide,ammonia water,ammonia aqueous,aquammonia,aqua ammonia,ammonia, aqua,household ammonia,ammonium hydroxide solution,ammonia, monohydrate,ammonium hydroxide nh4 oh |
| InChI Key | VHUUQVKOLVNVRT-UHFFFAOYSA-N |
| Molecular Formula | H5NO |
Potassium phosphate, monobasic, 99+%, ACS reagent
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M Synonym: potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate PubChem CID: 516951 ChEBI: CHEBI:63036 SMILES: [K+].OP(O)([O-])=O
| PubChem CID | 516951 |
|---|---|
| CAS | 7778-77-0 |
| Molecular Weight (g/mol) | 136.08 |
| ChEBI | CHEBI:63036 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| Synonym | potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |
| Boiling Point | 100.0°C |
|---|---|
| Linear Formula | HCl |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| Color | Colorless |
| Physical Form | Liquid |
| SMILES | Cl |
| Merck Index | 15, 4818 |
| Concentration | 0.0998 to 0.1002N (20°C) |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Density | 1.0000g/mL |
| PubChem CID | 313 |
| Name Note | 0.1 N Standard Solution |
| Fieser | 04,450; 05,533; 06,283 |
| CAS | 7732-18-5 |
| Health Hazard 3 | Emergency Overview May cause skin, eye, and respiratory tract irritation. The toxicological properties have not been fully investigated. NFPA Health: 2 Flammability: 0 Instability: 0 |
| MDL Number | MFCD00011324 MFCD00792839 |
| Solubility Information | Solubility in water: miscible. Other solubilities: soluble in alcohol and benzene |
| Health Hazard 1 | SIGNAL WORD: CAUTION! |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| Molecular Formula | ClH |
| Formula Weight | 36.46 |
| Specific Gravity | 1 |
Potassium phosphate, dibasic, 98+%, ACS reagent
CAS: 11-4-7758 Molecular Formula: HK2O4P Molecular Weight (g/mol): 174.18 MDL Number: MFCD00011383 InChI Key: ZPWVASYFFYYZEW-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate PubChem CID: 24450 ChEBI: CHEBI:32031 IUPAC Name: dipotassium;hydrogen phosphate SMILES: OP(=O)([O-])[O-].[K+].[K+]
| PubChem CID | 24450 |
|---|---|
| CAS | 11-4-7758 |
| Molecular Weight (g/mol) | 174.18 |
| ChEBI | CHEBI:32031 |
| MDL Number | MFCD00011383 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Molecular Formula | HK2O4P |
n-Undecane, 99%
CAS: 1120-21-4 Molecular Formula: C11H24 Molecular Weight (g/mol): 156.31 MDL Number: MFCD00008959 InChI Key: RSJKGSCJYJTIGS-UHFFFAOYSA-N Synonym: n-undecane,hendecane,n-hendecane,decane, methyl,unii-jv0qt00nue,ccris 3796,jv0qt00nue,undecane,undecane, analytical standard,und PubChem CID: 14257 ChEBI: CHEBI:46342 IUPAC Name: undecane SMILES: CCCCCCCCCCC
| PubChem CID | 14257 |
|---|---|
| CAS | 1120-21-4 |
| Molecular Weight (g/mol) | 156.31 |
| ChEBI | CHEBI:46342 |
| MDL Number | MFCD00008959 |
| SMILES | CCCCCCCCCCC |
| Synonym | n-undecane,hendecane,n-hendecane,decane, methyl,unii-jv0qt00nue,ccris 3796,jv0qt00nue,undecane,undecane, analytical standard,und |
| IUPAC Name | undecane |
| InChI Key | RSJKGSCJYJTIGS-UHFFFAOYSA-N |
| Molecular Formula | C11H24 |
Potassium phosphate, dibasic, 99%, for HPLC, anhydrous
CAS: 11-4-7758 Molecular Formula: HK2O4P Molecular Weight (g/mol): 174.18 InChI Key: ZPWVASYFFYYZEW-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate PubChem CID: 24450 ChEBI: CHEBI:32031 IUPAC Name: dipotassium;hydrogen phosphate SMILES: OP(=O)([O-])[O-].[K+].[K+]
| PubChem CID | 24450 |
|---|---|
| CAS | 11-4-7758 |
| Molecular Weight (g/mol) | 174.18 |
| ChEBI | CHEBI:32031 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Molecular Formula | HK2O4P |
Ethanolamine, 99%
CAS: 141-43-5 Molecular Formula: C2H7NO Molecular Weight (g/mol): 61.08 MDL Number: MFCD00008183 InChI Key: HZAXFHJVJLSVMW-UHFFFAOYSA-N Synonym: ethanolamine,monoethanolamine,aminoethanol,2-hydroxyethylamine,colamine,glycinol,olamine,2-amino-1-ethanol,ethanol, 2-amino,ethylolamine PubChem CID: 700 ChEBI: CHEBI:16000 SMILES: NCCO
| PubChem CID | 700 |
|---|---|
| CAS | 141-43-5 |
| Molecular Weight (g/mol) | 61.08 |
| ChEBI | CHEBI:16000 |
| MDL Number | MFCD00008183 |
| SMILES | NCCO |
| Synonym | ethanolamine,monoethanolamine,aminoethanol,2-hydroxyethylamine,colamine,glycinol,olamine,2-amino-1-ethanol,ethanol, 2-amino,ethylolamine |
| InChI Key | HZAXFHJVJLSVMW-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO |
Hydroxylamine hydrochloride, ACS reagent
CAS: 5470-11-1 Molecular Formula: ClH4NO Molecular Weight (g/mol): 69.49 MDL Number: MFCD00051089 InChI Key: WTDHULULXKLSOZ-UHFFFAOYSA-N Synonym: hydroxylamine hydrochloride,hydroxylamine hcl,hydroxylammonium chloride,oxammonium hydrochloride,hydroxylamine, hydrochloride,hydroxyamine hydrochloride,hydroxylamine chloride 1:1,hydroxylamine, hydrochloride 1:1,hydroxyamine hcl,oxammonium hci PubChem CID: 443297 ChEBI: CHEBI:5807 IUPAC Name: hydroxylamine;hydrochloride SMILES: Cl.NO
| PubChem CID | 443297 |
|---|---|
| CAS | 5470-11-1 |
| Molecular Weight (g/mol) | 69.49 |
| ChEBI | CHEBI:5807 |
| MDL Number | MFCD00051089 |
| SMILES | Cl.NO |
| Synonym | hydroxylamine hydrochloride,hydroxylamine hcl,hydroxylammonium chloride,oxammonium hydrochloride,hydroxylamine, hydrochloride,hydroxyamine hydrochloride,hydroxylamine chloride 1:1,hydroxylamine, hydrochloride 1:1,hydroxyamine hcl,oxammonium hci |
| IUPAC Name | hydroxylamine;hydrochloride |
| InChI Key | WTDHULULXKLSOZ-UHFFFAOYSA-N |
| Molecular Formula | ClH4NO |