Chemicals
Filtered Search Results
Zinc chloride, anhydrous, 98+%
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Silicone oil, for oil baths, usable range from -40 to +200°C
CAS: 63148-62-9 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): NaN MDL Number: MFCD00132673 IUPAC Name: Polydimethylsiloxane SMILES: C[Si](C)(-*)O-*
| CAS | 63148-62-9 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00132673 |
| SMILES | C[Si](C)(-*)O-* |
| IUPAC Name | Polydimethylsiloxane |
| Molecular Formula | (C2H6OSi)n |
Magnesium Chloride Hexahydrate, 99+%, ACS reagent
CAS: 7791-18-6 Molecular Formula: Cl2H12MgO6 Molecular Weight (g/mol): 203.30 MDL Number: MFCD00149781 InChI Key: DHRRIBDTHFBPNG-UHFFFAOYSA-L IUPAC Name: magnesium(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Mg++].[Cl-].[Cl-]
| CAS | 7791-18-6 |
|---|---|
| Molecular Weight (g/mol) | 203.30 |
| MDL Number | MFCD00149781 |
| SMILES | O.O.O.O.O.O.[Mg++].[Cl-].[Cl-] |
| IUPAC Name | magnesium(2+) hexahydrate dichloride |
| InChI Key | DHRRIBDTHFBPNG-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12MgO6 |
Dichloromethane, for HPLC
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
L-(+)-Ascorbic acid, 99+%
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |
| Linear Formula | HCl |
|---|---|
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Hydrochloric acid |
| SMILES | Cl |
| Merck Index | 15, 4818 |
| Concentration | 0.998 to 1.002N (20°C) |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Density | 1.0200g/mL |
| PubChem CID | 313 |
| Name Note | 1N standard solution |
| Fieser | 04,450; 05,533; 06,283 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement: Keep only in original container. Absorb spillage to prevent material damage. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00011324 MFCD00792839 |
| Health Hazard 2 | GHS H Statement: May be corrosive to metals. |
| Health Hazard 1 | Warning |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| Molecular Formula | ClH |
Magnesium sulfate, anhydrous, 99.5% min
CAS: 7487-88-9 Molecular Formula: MgO4S Molecular Weight (g/mol): 120.36 MDL Number: MFCD00011110 InChI Key: CSNNHWWHGAXBCP-UHFFFAOYSA-L Synonym: magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot PubChem CID: 24083 ChEBI: CHEBI:32599 SMILES: [Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24083 |
|---|---|
| CAS | 7487-88-9 |
| Molecular Weight (g/mol) | 120.36 |
| ChEBI | CHEBI:32599 |
| MDL Number | MFCD00011110 |
| SMILES | [Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot |
| InChI Key | CSNNHWWHGAXBCP-UHFFFAOYSA-L |
| Molecular Formula | MgO4S |
N,N-Dimethylformamide, anhydrous, amine free, 99.9%
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
Acetonitrile, LC-MS Grade, 99.8%
CAS: 75-05-8 Molecular Formula: C2H3N Molecular Weight (g/mol): 41.053 MDL Number: MFCD00001878 InChI Key: WEVYAHXRMPXWCK-UHFFFAOYSA-N Synonym: methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn PubChem CID: 6342 ChEBI: CHEBI:38472 IUPAC Name: acetonitrile SMILES: CC#N
| PubChem CID | 6342 |
|---|---|
| CAS | 75-05-8 |
| Molecular Weight (g/mol) | 41.053 |
| ChEBI | CHEBI:38472 |
| MDL Number | MFCD00001878 |
| SMILES | CC#N |
| Synonym | methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn |
| IUPAC Name | acetonitrile |
| InChI Key | WEVYAHXRMPXWCK-UHFFFAOYSA-N |
| Molecular Formula | C2H3N |
Thermo Scientific™ Water, nuclease-free
Optimize molecular biology applications with this deionized and 0.22μm membrane-filtered nuclease-free water.
| Treatment(s) | Not DEPC-Treated |
|---|---|
| pH | 7.6 |
| Grade | Molecular Biology |
Pyridine, 99+%
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
Potassium sulfite, 90%, pure
CAS: 10117-38-1 Molecular Formula: K2O3S Molecular Weight (g/mol): 158.26 InChI Key: BHZRJJOHZFYXTO-UHFFFAOYSA-L Synonym: potassium sulfite,dipotassium sulfite,potassium sulphite,sulfurous acid, dipotassium salt,unii-015kzc652e,sulfurous acid, potassium salt 1:2,potassium sulfite k2so3,kaliumsulfit,potassiumsulfite,dipotassium ion sulfite PubChem CID: 24958 IUPAC Name: dipotassium;sulfite SMILES: [O-]S(=O)[O-].[K+].[K+]
| PubChem CID | 24958 |
|---|---|
| CAS | 10117-38-1 |
| Molecular Weight (g/mol) | 158.26 |
| SMILES | [O-]S(=O)[O-].[K+].[K+] |
| Synonym | potassium sulfite,dipotassium sulfite,potassium sulphite,sulfurous acid, dipotassium salt,unii-015kzc652e,sulfurous acid, potassium salt 1:2,potassium sulfite k2so3,kaliumsulfit,potassiumsulfite,dipotassium ion sulfite |
| IUPAC Name | dipotassium;sulfite |
| InChI Key | BHZRJJOHZFYXTO-UHFFFAOYSA-L |
| Molecular Formula | K2O3S |
Sodium Sulfate Anhydrous, Certified ACS, Suitable for Pesticide Residue Analysis (Granular, 10-60 mesh), Fisher Chemical™
CAS: 7757-82-6 Molecular Formula: Na2O4S Molecular Weight (g/mol): 142.04 MDL Number: MFCD00003504 InChI Key: PMZURENOXWZQFD-UHFFFAOYSA-L Synonym: sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 PubChem CID: 24436 ChEBI: CHEBI:32149 IUPAC Name: disodium sulfate SMILES: [Na+].[Na+].[O-]S([O-])(=O)=O
| PubChem CID | 24436 |
|---|---|
| CAS | 7757-82-6 |
| Molecular Weight (g/mol) | 142.04 |
| ChEBI | CHEBI:32149 |
| MDL Number | MFCD00003504 |
| SMILES | [Na+].[Na+].[O-]S([O-])(=O)=O |
| Synonym | sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 |
| IUPAC Name | disodium sulfate |
| InChI Key | PMZURENOXWZQFD-UHFFFAOYSA-L |
| Molecular Formula | Na2O4S |