Chemicals
Filtered Search Results
Avantor Phosphoric acid, J.T. Baker™
CAS: 7664-38-2 Molecular Formula: H3O4P Molecular Weight (g/mol): 97.994 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid SMILES: OP(=O)(O)O
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| Molecular Weight (g/mol) | 97.994 |
| ChEBI | CHEBI:26078 |
| SMILES | OP(=O)(O)O |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
Edetate Disodium, U.S.P., J.T. Baker™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
6-chloro-1-hexyne, 97%
CAS: 10297-06-0 Molecular Formula: C6H9Cl Molecular Weight (g/mol): 116.59 MDL Number: MFCD00013697 InChI Key: ZUKOCGMVJUXIJA-UHFFFAOYSA-N PubChem CID: 272001 IUPAC Name: 6-chlorohex-1-yne SMILES: ClCCCCC#C
| PubChem CID | 272001 |
|---|---|
| CAS | 10297-06-0 |
| Molecular Weight (g/mol) | 116.59 |
| MDL Number | MFCD00013697 |
| SMILES | ClCCCCC#C |
| IUPAC Name | 6-chlorohex-1-yne |
| InChI Key | ZUKOCGMVJUXIJA-UHFFFAOYSA-N |
| Molecular Formula | C6H9Cl |
(Trimethylsilyl)methyllithium, 0.7M (10 wt%) solution in hexanes, AcroSeal™
CAS: 1822-00-0 | C4H11LiSi | 94.16 g/mol
| Boiling Point | 65.0°C to 70.0°C |
|---|---|
| Linear Formula | LiCH2Si(CH3)3 |
| Molecular Weight (g/mol) | 94.16 |
| Color | Brown-Yellow to Colorless |
| Physical Form | Solution |
| CAS Min % | 86.0 |
| Chemical Name or Material | (Trimethylsilyl)methyllithium |
| SMILES | [Li+].C[Si](C)(C)[CH2-] |
| InChI Key | KVWLUDFGXDFFON-UHFFFAOYSA-N |
| Density | 0.6500g/mL |
| PubChem CID | 3482579 |
| Name Note | 0.8M (12 wt%) solution in hexanes |
| Percent Purity | 7 to 14 wt% |
| CAS | 92112-69-1 |
| Health Hazard 3 | GHS P Statement Wear eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00010747 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. May be fatal if swallowed and enters airways. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Suspected of damaging fertility. May cause d |
| Flash Point | −40°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | trimethylsilyl methyllithium,trimethylsilyl methyl lithium,lich2sime3,pubchem18144,tms-ch2li,lithiomethyltrimethylsilane,acmc-1bvf0,trimethylsilylmethyl lithium |
| IUPAC Name | lithium;methanidyl(trimethyl)silane |
| Molecular Formula | C4H11LiSi |
| Formula Weight | 94.16 |
| Specific Gravity | 0.65 |
| CAS Max % | 93.0 |
4-Phenoxybenzoic acid, 98%
CAS: 2215-77-2 Molecular Formula: C13H10O3 Molecular Weight (g/mol): 214.22 MDL Number: MFCD00002539 InChI Key: RYAQFHLUEMJOMF-UHFFFAOYSA-N Synonym: p-phenoxybenzoic acid,benzoic acid, 4-phenoxy,diphenyl ether 4-carboxylic acid,4-phenoxy-benzoic acid,4-carboxybiphenyl ether,4-carboxydiphenyl ether,benzoic acid, p-phenoxy,p-carboxydiphenyl ether,4-phenoxy benzoic acid,4-phoc6h4cooh PubChem CID: 75182 ChEBI: CHEBI:72632 IUPAC Name: 4-phenoxybenzoic acid SMILES: OC(=O)C1=CC=C(OC2=CC=CC=C2)C=C1
| PubChem CID | 75182 |
|---|---|
| CAS | 2215-77-2 |
| Molecular Weight (g/mol) | 214.22 |
| ChEBI | CHEBI:72632 |
| MDL Number | MFCD00002539 |
| SMILES | OC(=O)C1=CC=C(OC2=CC=CC=C2)C=C1 |
| Synonym | p-phenoxybenzoic acid,benzoic acid, 4-phenoxy,diphenyl ether 4-carboxylic acid,4-phenoxy-benzoic acid,4-carboxybiphenyl ether,4-carboxydiphenyl ether,benzoic acid, p-phenoxy,p-carboxydiphenyl ether,4-phenoxy benzoic acid,4-phoc6h4cooh |
| IUPAC Name | 4-phenoxybenzoic acid |
| InChI Key | RYAQFHLUEMJOMF-UHFFFAOYSA-N |
| Molecular Formula | C13H10O3 |
5-Indolylboronic acid, 97%
CAS: 144104-59-6 Molecular Formula: C8H8BNO2 Molecular Weight (g/mol): 160.97 MDL Number: MFCD01319013 InChI Key: VHADYSUJZAPXOW-UHFFFAOYSA-N Synonym: 5-indolylboronic acid,indole-5-boronic acid,1h-indol-5-yl boronic acid,1h-indole-5-boronic acid,5-indolboronic acid,5-indolyl boronic acid,5-indole-boronic acid,1h-indol-5-ylboranediol,5-indole boric acid,5-indoleboronic acid PubChem CID: 2734361 IUPAC Name: 1H-indol-5-ylboronic acid SMILES: OB(O)C1=CC=C2NC=CC2=C1
| PubChem CID | 2734361 |
|---|---|
| CAS | 144104-59-6 |
| Molecular Weight (g/mol) | 160.97 |
| MDL Number | MFCD01319013 |
| SMILES | OB(O)C1=CC=C2NC=CC2=C1 |
| Synonym | 5-indolylboronic acid,indole-5-boronic acid,1h-indol-5-yl boronic acid,1h-indole-5-boronic acid,5-indolboronic acid,5-indolyl boronic acid,5-indole-boronic acid,1h-indol-5-ylboranediol,5-indole boric acid,5-indoleboronic acid |
| IUPAC Name | 1H-indol-5-ylboronic acid |
| InChI Key | VHADYSUJZAPXOW-UHFFFAOYSA-N |
| Molecular Formula | C8H8BNO2 |
2,2,5,5-Tetramethyl-3-pyrrolin-1-oxyl-3-carboxylic acid, 99%
CAS: 2154-67-8 Molecular Formula: C9H14NO3 Molecular Weight (g/mol): 184.22 MDL Number: MFCD00041847 Synonym: 3-Carboxy-2,2,5,5-tetramethyl-3-pyrrolin-1-yloxy
| CAS | 2154-67-8 |
|---|---|
| Molecular Weight (g/mol) | 184.22 |
| MDL Number | MFCD00041847 |
| Synonym | 3-Carboxy-2,2,5,5-tetramethyl-3-pyrrolin-1-yloxy |
| Molecular Formula | C9H14NO3 |
1-Naphthalenemethanol, 98%
CAS: 4780-79-4 Molecular Formula: C11H10O Molecular Weight (g/mol): 158.20 MDL Number: MFCD00004044 InChI Key: PBLNHHSDYFYZNC-UHFFFAOYSA-N Synonym: 1-naphthalenemethanol,1-naphthylmethanol,1-hydroxymethylnaphthalene,naphthalene-1-methanol,1-naphthalene methanol,1-menaphthyl alcohol,1-naphthylmethyl alcohol,naphthalen-1-yl-methanol,naphthalen-1-yl methanol,1-naphthylenemethanol PubChem CID: 20908 ChEBI: CHEBI:38137 IUPAC Name: naphthalen-1-ylmethanol SMILES: OCC1=C2C=CC=CC2=CC=C1
| PubChem CID | 20908 |
|---|---|
| CAS | 4780-79-4 |
| Molecular Weight (g/mol) | 158.20 |
| ChEBI | CHEBI:38137 |
| MDL Number | MFCD00004044 |
| SMILES | OCC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthalenemethanol,1-naphthylmethanol,1-hydroxymethylnaphthalene,naphthalene-1-methanol,1-naphthalene methanol,1-menaphthyl alcohol,1-naphthylmethyl alcohol,naphthalen-1-yl-methanol,naphthalen-1-yl methanol,1-naphthylenemethanol |
| IUPAC Name | naphthalen-1-ylmethanol |
| InChI Key | PBLNHHSDYFYZNC-UHFFFAOYSA-N |
| Molecular Formula | C11H10O |
1,2-Dichloroethane, 99.8+%, extra pure
CAS: 107-06-2 Molecular Formula: C2H4Cl2 Molecular Weight (g/mol): 98.95 MDL Number: MFCD00000963 InChI Key: WSLDOOZREJYCGB-UHFFFAOYSA-N Synonym: ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion PubChem CID: 11 ChEBI: CHEBI:27789 IUPAC Name: 1,2-dichloroethane SMILES: ClCCCl
| PubChem CID | 11 |
|---|---|
| CAS | 107-06-2 |
| Molecular Weight (g/mol) | 98.95 |
| ChEBI | CHEBI:27789 |
| MDL Number | MFCD00000963 |
| SMILES | ClCCCl |
| Synonym | ethylene dichloride,ethylene chloride,ethane, 1,2-dichloro,dutch liquid,dutch oil,ethane dichloride,glycol dichloride,aethylenchlorid,dichloro-1,2-ethane,dichloremulsion |
| IUPAC Name | 1,2-dichloroethane |
| InChI Key | WSLDOOZREJYCGB-UHFFFAOYSA-N |
| Molecular Formula | C2H4Cl2 |
D-(-)-Fructose 99.0+%, TCI America™
CAS: 57-48-7 Molecular Formula: C6H12O6 Molecular Weight (g/mol): 180.156 MDL Number: MFCD00148910 InChI Key: BJHIKXHVCXFQLS-UYFOZJQFSA-N Synonym: d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 PubChem CID: 5984 ChEBI: CHEBI:48095 IUPAC Name: (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one SMILES: C(C(C(C(C(=O)CO)O)O)O)O
| PubChem CID | 5984 |
|---|---|
| CAS | 57-48-7 |
| Molecular Weight (g/mol) | 180.156 |
| ChEBI | CHEBI:48095 |
| MDL Number | MFCD00148910 |
| SMILES | C(C(C(C(C(=O)CO)O)O)O)O |
| Synonym | d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 |
| IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| InChI Key | BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| Molecular Formula | C6H12O6 |
| CAS | 67-64-1 |
|---|
Trifluoromethanesulfonic Anhydride 98.0+%, TCI America™
CAS: 358-23-6 Molecular Formula: C2F6O5S2 Molecular Weight (g/mol): 282.127 MDL Number: MFCD00000408 InChI Key: WJKHJLXJJJATHN-UHFFFAOYSA-N Synonym: trifluoromethanesulfonic anhydride,triflic anhydride,trifluoromethanesulphonic anhydride,trifluoromethanesulfonic acid anhydride,methanesulfonic acid, trifluoro-, anhydride,trifluoromethanesulphonic acid anhydride,unii-8w034lhg1u,tf2o,trifluoromethane sulfonyl trifluoromethanesulfonate,trifluoromethane sulfonic anhydride PubChem CID: 67749 ChEBI: CHEBI:48509 IUPAC Name: trifluoromethylsulfonyl trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F
| PubChem CID | 67749 |
|---|---|
| CAS | 358-23-6 |
| Molecular Weight (g/mol) | 282.127 |
| ChEBI | CHEBI:48509 |
| MDL Number | MFCD00000408 |
| SMILES | C(F)(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F |
| Synonym | trifluoromethanesulfonic anhydride,triflic anhydride,trifluoromethanesulphonic anhydride,trifluoromethanesulfonic acid anhydride,methanesulfonic acid, trifluoro-, anhydride,trifluoromethanesulphonic acid anhydride,unii-8w034lhg1u,tf2o,trifluoromethane sulfonyl trifluoromethanesulfonate,trifluoromethane sulfonic anhydride |
| IUPAC Name | trifluoromethylsulfonyl trifluoromethanesulfonate |
| InChI Key | WJKHJLXJJJATHN-UHFFFAOYSA-N |
| Molecular Formula | C2F6O5S2 |
LabChem, Inc. Sodium Carbonate, Anhydrous, ACS Grade, ≥ 99.5%, LabChem™
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 IUPAC Name: disodium carbonate SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| IUPAC Name | disodium carbonate |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
Trichloroacetic Acid, 80% (w/v), Ricca Chemical
CAS: 76-03-9 Molecular Formula: C2HCl3O2 Molecular Weight (g/mol): Mixture InChI Key: YNJBWRMUSHSURL-UHFFFAOYSA-N Synonym: trichloroacetic acid,trichloroethanoic acid,aceto-caustin,trichloroacetic acid,acetic acid, trichloro,trichloressigsaeure,konesta,acide trichloracetique,acido tricloroacetico,amchem grass killer PubChem CID: 6421 ChEBI: CHEBI:30956 IUPAC Name: trichloroacetic acid SMILES: OC(=O)C(Cl)(Cl)Cl
| PubChem CID | 6421 |
|---|---|
| CAS | 76-03-9 |
| Molecular Weight (g/mol) | Mixture |
| ChEBI | CHEBI:30956 |
| SMILES | OC(=O)C(Cl)(Cl)Cl |
| Synonym | trichloroacetic acid,trichloroethanoic acid,aceto-caustin,trichloroacetic acid,acetic acid, trichloro,trichloressigsaeure,konesta,acide trichloracetique,acido tricloroacetico,amchem grass killer |
| IUPAC Name | trichloroacetic acid |
| InChI Key | YNJBWRMUSHSURL-UHFFFAOYSA-N |
| Molecular Formula | C2HCl3O2 |
EDTA, Certified, 0.1000M ±0.0005M (0.2N), LabChem™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |