Chemicals
Filtered Search Results
N,N'-Dicyclohexylcarbodiimide, 99%
CAS: 538-75-0 Molecular Formula: C13H22N2 Molecular Weight (g/mol): 206.333 MDL Number: MFCD00011659 InChI Key: QOSSAOTZNIDXMA-UHFFFAOYSA-N Synonym: dicyclohexylcarbodiimide,n,n'-dicyclohexylcarbodiimide,dccd,1,3-dicyclohexylcarbodiimide,dcci,carbodicyclohexylimide,bis cyclohexyl carbodiimide,dcc,n,n-dicyclohexylcarbodiimide,carbodiimide, dicyclohexyl PubChem CID: 10868 ChEBI: CHEBI:53090 IUPAC Name: N,N'-dicyclohexylmethanediimine SMILES: C1CCC(CC1)N=C=NC2CCCCC2
| PubChem CID | 10868 |
|---|---|
| CAS | 538-75-0 |
| Molecular Weight (g/mol) | 206.333 |
| ChEBI | CHEBI:53090 |
| MDL Number | MFCD00011659 |
| SMILES | C1CCC(CC1)N=C=NC2CCCCC2 |
| Synonym | dicyclohexylcarbodiimide,n,n'-dicyclohexylcarbodiimide,dccd,1,3-dicyclohexylcarbodiimide,dcci,carbodicyclohexylimide,bis cyclohexyl carbodiimide,dcc,n,n-dicyclohexylcarbodiimide,carbodiimide, dicyclohexyl |
| IUPAC Name | N,N'-dicyclohexylmethanediimine |
| InChI Key | QOSSAOTZNIDXMA-UHFFFAOYSA-N |
| Molecular Formula | C13H22N2 |
Hydrochloric Acid, Certified ACS Plus, 36.5 to 38.0%, Fisher Chemical™
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N IUPAC Name: hydrogen chloride SMILES: Cl
| CAS | 7647-01-0 |
|---|---|
| Molecular Weight (g/mol) | 36.46 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Sodium acetate, 3M aq. soln., pH 5.2, RNAse free
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 IUPAC Name: sodium acetate SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| IUPAC Name | sodium acetate |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |
Silica Gel Desiccant (100-200 Mesh/923, Chromatographic Grade), Fisher Chemical™
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: silanedione SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
4-Methoxyphenol, 99%
CAS: 150-76-5 Molecular Formula: C7H8O2 Molecular Weight (g/mol): 124.14 MDL Number: MFCD00002332 InChI Key: NWVVVBRKAWDGAB-UHFFFAOYSA-N Synonym: mequinol,4-hydroxyanisole,p-hydroxyanisole,p-methoxyphenol,hydroquinone monomethyl ether,phenol, 4-methoxy,leucobasal,mehq,leucodine b,mechinolum PubChem CID: 9015 ChEBI: CHEBI:69441 IUPAC Name: 4-methoxyphenol SMILES: COC1=CC=C(O)C=C1
| PubChem CID | 9015 |
|---|---|
| CAS | 150-76-5 |
| Molecular Weight (g/mol) | 124.14 |
| ChEBI | CHEBI:69441 |
| MDL Number | MFCD00002332 |
| SMILES | COC1=CC=C(O)C=C1 |
| Synonym | mequinol,4-hydroxyanisole,p-hydroxyanisole,p-methoxyphenol,hydroquinone monomethyl ether,phenol, 4-methoxy,leucobasal,mehq,leucodine b,mechinolum |
| IUPAC Name | 4-methoxyphenol |
| InChI Key | NWVVVBRKAWDGAB-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2 |
Acetonitrile, anhydrous, 99.8+%
CAS: 75-05-8 Molecular Formula: C2H3N Molecular Weight (g/mol): 41.053 MDL Number: MFCD00001878 InChI Key: WEVYAHXRMPXWCK-UHFFFAOYSA-N Synonym: methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn PubChem CID: 6342 ChEBI: CHEBI:38472 IUPAC Name: acetonitrile SMILES: CC#N
| PubChem CID | 6342 |
|---|---|
| CAS | 75-05-8 |
| Molecular Weight (g/mol) | 41.053 |
| ChEBI | CHEBI:38472 |
| MDL Number | MFCD00001878 |
| SMILES | CC#N |
| Synonym | methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn |
| IUPAC Name | acetonitrile |
| InChI Key | WEVYAHXRMPXWCK-UHFFFAOYSA-N |
| Molecular Formula | C2H3N |
n-Butyllithium, 2.5M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00009414 InChI Key: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| PubChem CID | 61028 |
|---|---|
| CAS | 109-72-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00009414 |
| SMILES | [Li]CCCC |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| InChI Key | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |
| Boiling Point | 100.0°C |
|---|---|
| Linear Formula | KOH |
| Molecular Weight (g/mol) | 56.11 |
| ChEBI | CHEBI:32035 |
| Color | Colorless |
| UN Number | 1814 |
| Chemical Name or Material | Potassium hydroxide |
| SMILES | [OH-].[K+] |
| Concentration | 1N, exact strength on the certificate of analysis |
| InChI Key | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
| Density | 1.0500g/mL |
| PubChem CID | 14797 |
| Name Note | 1N solution in water |
| Fieser | 01,935; 02,346; 03,238; 04,409; 05,557; 06,486; 07,303; 08,415; 09,387; 11,439; 12,411; 13,258 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement: IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00003553 |
| Health Hazard 2 | GHS H Statement: Causes severe skin burns and eye damage. |
| Solubility Information | Solubility in water: soluble. |
| Health Hazard 1 | Danger |
| Synonym | potassium hydroxide,caustic potash,potash lye,potassium hydrate,hydroxyde de potassium,potassa,potasse caustique,potassium hydroxide k oh,potassium hydroxide solution,caswell no. 693 |
| Molecular Formula | HKO |
| Formula Weight | 56.11 |
| Specific Gravity | 1.05 |
Acetone, 99+%
CAS: 67-64-1 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00008765 InChI Key: CSCPPACGZOOCGX-UHFFFAOYSA-N Synonym: acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone PubChem CID: 180 ChEBI: CHEBI:15347 IUPAC Name: propan-2-one SMILES: CC(C)=O
| PubChem CID | 180 |
|---|---|
| CAS | 67-64-1 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:15347 |
| MDL Number | MFCD00008765 |
| SMILES | CC(C)=O |
| Synonym | acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone |
| IUPAC Name | propan-2-one |
| InChI Key | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O |
Quercetin dihydrate, 97%
CAS: 6151-25-3 Molecular Formula: C15H14O9 Molecular Weight (g/mol): 338.27 MDL Number: MFCD00149487 InChI Key: GMGIWEZSKCNYSW-UHFFFAOYSA-N Synonym: quercetin dihydrate,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one dihydrate,quercetine dihydrate,quercetin, dihydrate,ccris 3304,3,3',4',5,7-pentahydroxyflavone dihydrate,quercetin dihydrate sophoretin,flavone, 3,3',4',5,7-pentahydroxy-, dihydrate,dsstox_cid_1219,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-1-benzopyran-4-one dihydrate PubChem CID: 5284452 IUPAC Name: 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dihydrate SMILES: O.O.OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC=C(O)C(O)=C2)=C1
| PubChem CID | 5284452 |
|---|---|
| CAS | 6151-25-3 |
| Molecular Weight (g/mol) | 338.27 |
| MDL Number | MFCD00149487 |
| SMILES | O.O.OC1=CC(O)=C2C(OC(=C(O)C2=O)C2=CC=C(O)C(O)=C2)=C1 |
| Synonym | quercetin dihydrate,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-chromen-4-one dihydrate,quercetine dihydrate,quercetin, dihydrate,ccris 3304,3,3',4',5,7-pentahydroxyflavone dihydrate,quercetin dihydrate sophoretin,flavone, 3,3',4',5,7-pentahydroxy-, dihydrate,dsstox_cid_1219,2-3,4-dihydroxyphenyl-3,5,7-trihydroxy-4h-1-benzopyran-4-one dihydrate |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dihydrate |
| InChI Key | GMGIWEZSKCNYSW-UHFFFAOYSA-N |
| Molecular Formula | C15H14O9 |
Propylene carbonate, 99.5%
CAS: 108-32-7 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 102.09 MDL Number: MFCD00005385,MFCD00798264,MFCD00798265 InChI Key: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC Name: 4-methyl-1,3-dioxolan-2-one SMILES: CC1COC(=O)O1
| PubChem CID | 7924 |
|---|---|
| CAS | 108-32-7 |
| Molecular Weight (g/mol) | 102.09 |
| MDL Number | MFCD00005385,MFCD00798264,MFCD00798265 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| IUPAC Name | 4-methyl-1,3-dioxolan-2-one |
| InChI Key | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
| Molecular Formula | C4H6O3 |
Titanium(III) chloride, 20% w/v solution in 2N Hydrochloric acid
CAS: 7705-07-9 | Cl3Ti | 154.22 g/mol
| Linear Formula | TiCl3 |
|---|---|
| Molecular Weight (g/mol) | 154.22 |
| Color | Purple |
| Physical Form | Liquid |
| Chemical Name or Material | Titanium(III) chloride |
| SMILES | [Cl-].[Cl-].[Cl-].[Ti+3] |
| Merck Index | 15,9637 |
| InChI Key | YONPGGFAJWQGJC-UHFFFAOYSA-K |
| Density | 1.2000g/mL |
| Percent Purity | ∼20% (TiCl3) (exact strength stated on certificate of analysis) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00011266 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May be corrosive to metals. |
| Packaging | Plastic bottle |
| Solubility Information | Solubility in water: soluble. Other solubilities: soluble in alcohol, practically insoluble in ether |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Titanous chloride |
| IUPAC Name | titanium(3+) trichloride |
| Molecular Formula | Cl3Ti |
| EINECS Number | 231-728-9 |
| Formula Weight | 154.26 |
Ammonium sulfate, ACS, 99.0% min
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N Synonym: ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate PubChem CID: 6097028 ChEBI: CHEBI:62946 SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| Synonym | ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Calcium chloride dihydrate, ACS, 99.0-105.0%
CAS: 10035-04-8 Molecular Formula: CaCl2·2H2O MDL Number: MFCD00149613
| CAS | 10035-04-8 |
|---|---|
| MDL Number | MFCD00149613 |
| Molecular Formula | CaCl2·2H2O |
Gallic acid, 98%
CAS: 149-91-7 Molecular Formula: C7H6O5 Molecular Weight (g/mol): 170.12 MDL Number: MFCD00002510 InChI Key: LNTHITQWFMADLM-UHFFFAOYSA-N Synonym: gallic acid,gallate,benzoic acid, 3,4,5-trihydroxy,gallic acid, tech.,galop,pyrogallol-5-carboxylic acid,kyselina gallova,3,4,5-trihydroxybenzoate,ccris 5523,kyselina gallova czech PubChem CID: 370 ChEBI: CHEBI:30778 IUPAC Name: 3,4,5-trihydroxybenzoic acid SMILES: OC(=O)C1=CC(O)=C(O)C(O)=C1
| PubChem CID | 370 |
|---|---|
| CAS | 149-91-7 |
| Molecular Weight (g/mol) | 170.12 |
| ChEBI | CHEBI:30778 |
| MDL Number | MFCD00002510 |
| SMILES | OC(=O)C1=CC(O)=C(O)C(O)=C1 |
| Synonym | gallic acid,gallate,benzoic acid, 3,4,5-trihydroxy,gallic acid, tech.,galop,pyrogallol-5-carboxylic acid,kyselina gallova,3,4,5-trihydroxybenzoate,ccris 5523,kyselina gallova czech |
| IUPAC Name | 3,4,5-trihydroxybenzoic acid |
| InChI Key | LNTHITQWFMADLM-UHFFFAOYSA-N |
| Molecular Formula | C7H6O5 |