Chemicals
Filtered Search Results
Hydrofluoric acid, for analysis, 48 to 51% solution in water, Thermo Scientific Chemicals
CAS: 7664-39-3 Molecular Formula: FH Molecular Weight (g/mol): 20.01 MDL Number: MFCD00011346 InChI Key: KRHYYFGTRYWZRS-UHFFFAOYSA-N Synonym: hydrofluoric acid,hydrogen fluoride,fluorhydric acid,hydrofluoride,rubigine,fluorwasserstoff,hydrogen-fluoride,antisal 2b,fluorowodor polish,caswell no. 484 PubChem CID: 14917 ChEBI: CHEBI:29228 IUPAC Name: hydrogen fluoride SMILES: F
| PubChem CID | 14917 |
|---|---|
| CAS | 7664-39-3 |
| Molecular Weight (g/mol) | 20.01 |
| ChEBI | CHEBI:29228 |
| MDL Number | MFCD00011346 |
| SMILES | F |
| Synonym | hydrofluoric acid,hydrogen fluoride,fluorhydric acid,hydrofluoride,rubigine,fluorwasserstoff,hydrogen-fluoride,antisal 2b,fluorowodor polish,caswell no. 484 |
| IUPAC Name | hydrogen fluoride |
| InChI Key | KRHYYFGTRYWZRS-UHFFFAOYSA-N |
| Molecular Formula | FH |
Zinc, granular, 20 mesh
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
N,N-Dimethylformamide, 99.8%, Extra Dry, AcroSeal™
CAS: 68-12-2 Molecular Formula: C3H7NO Molecular Weight (g/mol): 73.10 MDL Number: MFCD00003284 InChI Key: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC Name: N,N-dimethylformamide SMILES: CN(C)C=O
| PubChem CID | 6228 |
|---|---|
| CAS | 68-12-2 |
| Molecular Weight (g/mol) | 73.10 |
| ChEBI | CHEBI:17741 |
| MDL Number | MFCD00003284 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| IUPAC Name | N,N-dimethylformamide |
| InChI Key | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO |
Iron(II) sulfate heptahydrate, ACS, 99+%
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Potassium phosphate, dibasic, 98+%, ACS reagent
CAS: 11-4-7758 Molecular Formula: HK2O4P Molecular Weight (g/mol): 174.18 MDL Number: MFCD00011383 InChI Key: ZPWVASYFFYYZEW-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate PubChem CID: 24450 ChEBI: CHEBI:32031 IUPAC Name: dipotassium;hydrogen phosphate SMILES: OP(=O)([O-])[O-].[K+].[K+]
| PubChem CID | 24450 |
|---|---|
| CAS | 11-4-7758 |
| Molecular Weight (g/mol) | 174.18 |
| ChEBI | CHEBI:32031 |
| MDL Number | MFCD00011383 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Molecular Formula | HK2O4P |
Ethyl Acetate (Certified ACS), Fisher Chemical™
CAS: 141-78-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 MDL Number: MFCD00009171 InChI Key: XEKOWRVHYACXOJ-UHFFFAOYSA-N Synonym: ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester PubChem CID: 8857 ChEBI: CHEBI:27750 IUPAC Name: ethyl acetate SMILES: CCOC(=O)C
| PubChem CID | 8857 |
|---|---|
| CAS | 141-78-6 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:27750 |
| MDL Number | MFCD00009171 |
| SMILES | CCOC(=O)C |
| Synonym | ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester |
| IUPAC Name | ethyl acetate |
| InChI Key | XEKOWRVHYACXOJ-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Copper(II) sulfate pentahydrate, 98+%, ACS reagent
CAS: 7758-99-8 Molecular Formula: CuH10O9S Molecular Weight (g/mol): 249.68 MDL Number: MFCD00149681 InChI Key: JZCCFEFSEZPSOG-UHFFFAOYSA-L Synonym: copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas PubChem CID: 24463 ChEBI: CHEBI:31440 SMILES: O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O
| PubChem CID | 24463 |
|---|---|
| CAS | 7758-99-8 |
| Molecular Weight (g/mol) | 249.68 |
| ChEBI | CHEBI:31440 |
| MDL Number | MFCD00149681 |
| SMILES | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O |
| Synonym | copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas |
| InChI Key | JZCCFEFSEZPSOG-UHFFFAOYSA-L |
| Molecular Formula | CuH10O9S |
Pyruvic acid, sodium salt, 99+%
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.04 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.04 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
LC-MS Acetonitrile, OmniSolv, MilliporeSigma™
CAS: 75-05-8 Molecular Formula: C2H3N Molecular Weight (g/mol): 41.053 InChI Key: WEVYAHXRMPXWCK-UHFFFAOYSA-N Synonym: methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn PubChem CID: 6342 ChEBI: CHEBI:38472 IUPAC Name: acetonitrile SMILES: CC#N
| PubChem CID | 6342 |
|---|---|
| CAS | 75-05-8 |
| Molecular Weight (g/mol) | 41.053 |
| ChEBI | CHEBI:38472 |
| SMILES | CC#N |
| Synonym | methyl cyanide,cyanomethane,ethanenitrile,methanecarbonitrile,ethyl nitrile,methane, cyano,acetonitrile,cyanure de methyl,methylkyanid,mecn |
| IUPAC Name | acetonitrile |
| InChI Key | WEVYAHXRMPXWCK-UHFFFAOYSA-N |
| Molecular Formula | C2H3N |
Ammonium iron(III) citrate, 16.5 to 18.5% Fe
CAS: 1185-57-5 Molecular Formula: C6H11FeNO7 Molecular Weight (g/mol): 265 MDL Number: MFCD00013099 InChI Key: FRHBOQMZUOWXQL-UHFFFAOYSA-N Synonym: ammonium ferric citrate,ferri seltz,ammonii ferri citras,ferric ammonium citrate,iron ammonium citrate,ammonium iron 3+ citrate,ammonium iron iii citrate,iron ammonium citrate, green,ferri-ammoniumcitrat, braunes,ferriseltz PubChem CID: 118984355 IUPAC Name: azane;2-hydroxypropane-1,2,3-tricarboxylic acid;iron(3+) SMILES: C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.[Fe+3]
| PubChem CID | 118984355 |
|---|---|
| CAS | 1185-57-5 |
| Molecular Weight (g/mol) | 265 |
| MDL Number | MFCD00013099 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.N.[Fe+3] |
| Synonym | ammonium ferric citrate,ferri seltz,ammonii ferri citras,ferric ammonium citrate,iron ammonium citrate,ammonium iron 3+ citrate,ammonium iron iii citrate,iron ammonium citrate, green,ferri-ammoniumcitrat, braunes,ferriseltz |
| IUPAC Name | azane;2-hydroxypropane-1,2,3-tricarboxylic acid;iron(3+) |
| InChI Key | FRHBOQMZUOWXQL-UHFFFAOYSA-N |
| Molecular Formula | C6H11FeNO7 |
| Linear Formula | (CH3)2NH |
|---|---|
| ChEBI | CHEBI:17170 |
| InChI Key | ROSDSFDQCJNGOL-UHFFFAOYSA-N |
| PubChem CID | 674 |
| Percent Purity | ≥40% |
| Fieser | 07,119 |
| RTECS Number | IP8750000 |
| Formula Weight | 45.07 |
| Melting Point | -37.0°C |
| Boiling Point | 54.0°C |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Dimethylamine |
| SMILES | CNC |
| Merck Index | 15, 3250 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove conta |
| MDL Number | MFCD00008288 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if inhaled. Harmful if swallowed. May cause respiratory irritation. Highly flammable liquid and vapor. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.37 |
| Synonym | dimethylamine,n,n-dimethylamine,methanamine, n-methyl,dimethylamin,dimethyl amine,dimethyl-amine,dimethylamine anhydrous,rcra waste number u092,dimethylamine solution |
| TSCA | TSCA |
| Beilstein | 04, 39 |
| EINECS Number | 204-697-4 |
| Specific Gravity | 0.89 |
Phosphoric acid, ACS reagent, 85+% solution in water
CAS: 7664-38-2 Molecular Formula: H3O4P Molecular Weight (g/mol): 97.994 MDL Number: MFCD00011340 InChI Key: NBIIXXVUZAFLBC-UHFFFAOYSA-N Synonym: orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico PubChem CID: 1004 ChEBI: CHEBI:26078 IUPAC Name: phosphoric acid SMILES: OP(=O)(O)O
| PubChem CID | 1004 |
|---|---|
| CAS | 7664-38-2 |
| Molecular Weight (g/mol) | 97.994 |
| ChEBI | CHEBI:26078 |
| MDL Number | MFCD00011340 |
| SMILES | OP(=O)(O)O |
| Synonym | orthophosphoric acid,sonac,o-phosphoric acid,phosphorsaeure,acidum phosphoricum,evits,wc-reiniger,acide phosphorique,white,acido fosforico |
| IUPAC Name | phosphoric acid |
| InChI Key | NBIIXXVUZAFLBC-UHFFFAOYSA-N |
| Molecular Formula | H3O4P |
2,2,4-Trimethylpentane, ACS, 99+%
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Drierite™, with indicator, 10-20 mesh
CAS: 7778-18-9 Molecular Formula: CaO4S Molecular Weight (g/mol): 136.13 MDL Number: MFCD00010912 InChI Key: OSGAYBCDTDRGGQ-UHFFFAOYSA-L PubChem CID: 24497 ChEBI: CHEBI:31346 SMILES: [Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24497 |
|---|---|
| CAS | 7778-18-9 |
| Molecular Weight (g/mol) | 136.13 |
| ChEBI | CHEBI:31346 |
| MDL Number | MFCD00010912 |
| SMILES | [Ca++].[O-]S([O-])(=O)=O |
| InChI Key | OSGAYBCDTDRGGQ-UHFFFAOYSA-L |
| Molecular Formula | CaO4S |
Methyl sulfoxide-d6, for NMR, 99+ atom % D
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 IUPAC Name: trideuterio(trideuteriomethylsulfinyl)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| IUPAC Name | trideuterio(trideuteriomethylsulfinyl)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |