Chemicals
Filtered Search Results
Selenium, 99.5+%, powder, -200 mesh
CAS: 7782-49-2 Molecular Formula: Se Molecular Weight (g/mol): 78.97 MDL Number: MFCD00134090 MFCD00011224 InChI Key: BUGBHKTXTAQXES-UHFFFAOYSA-N Synonym: selenium, elemental,selen,hydride,atom,elemental,selenio,vandex,alloy,and compounds,gray PubChem CID: 6326970 ChEBI: CHEBI:27568 IUPAC Name: selenium SMILES: [Se]
| PubChem CID | 6326970 |
|---|---|
| CAS | 7782-49-2 |
| Molecular Weight (g/mol) | 78.97 |
| ChEBI | CHEBI:27568 |
| MDL Number | MFCD00134090 MFCD00011224 |
| SMILES | [Se] |
| Synonym | selenium, elemental,selen,hydride,atom,elemental,selenio,vandex,alloy,and compounds,gray |
| IUPAC Name | selenium |
| InChI Key | BUGBHKTXTAQXES-UHFFFAOYSA-N |
| Molecular Formula | Se |
Potassium ferricyanide, 98%, pure
CAS: 13746-66-2 Molecular Formula: C6FeK3N6 Molecular Weight (g/mol): 329.25 MDL Number: MFCD00011392 InChI Key: QMTKJUMXUDIUAQ-UHFFFAOYSA-N Synonym: potassium ferricyanide,red prussiate,potassium ferricyanate,tripotassium hexacyanoferrate,potassium cyanoferrate,iron potassium cyanide,tripotassium ferricyanide,tripotassium iron hexacyanide,tripotassium ferric hexacyanide,ccris 5559 PubChem CID: 26250 SMILES: [K+].[K+].[K+].N#C[Fe+3](C#N)(C#N)(C#N)(C#N)C#N
| PubChem CID | 26250 |
|---|---|
| CAS | 13746-66-2 |
| Molecular Weight (g/mol) | 329.25 |
| MDL Number | MFCD00011392 |
| SMILES | [K+].[K+].[K+].N#C[Fe+3](C#N)(C#N)(C#N)(C#N)C#N |
| Synonym | potassium ferricyanide,red prussiate,potassium ferricyanate,tripotassium hexacyanoferrate,potassium cyanoferrate,iron potassium cyanide,tripotassium ferricyanide,tripotassium iron hexacyanide,tripotassium ferric hexacyanide,ccris 5559 |
| InChI Key | QMTKJUMXUDIUAQ-UHFFFAOYSA-N |
| Molecular Formula | C6FeK3N6 |
Phenyl isothiocyanate, 98%
CAS: 103-72-0 Molecular Formula: C7H5NS Molecular Weight (g/mol): 135.18 MDL Number: MFCD00004798 InChI Key: QKFJKGMPGYROCL-UHFFFAOYSA-N Synonym: phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate PubChem CID: 7673 ChEBI: CHEBI:85103 IUPAC Name: isothiocyanatobenzene SMILES: S=C=NC1=CC=CC=C1
| PubChem CID | 7673 |
|---|---|
| CAS | 103-72-0 |
| Molecular Weight (g/mol) | 135.18 |
| ChEBI | CHEBI:85103 |
| MDL Number | MFCD00004798 |
| SMILES | S=C=NC1=CC=CC=C1 |
| Synonym | phenyl isothiocyanate,phenylisothiocyanate,thiocarbanil,phenyl mustard oil,benzene, isothiocyanato,pitc,isothiocyanic acid phenyl ester,benzene-1-isothiocyanate,phenylsenfoel,phenyl thioisocyanate |
| IUPAC Name | isothiocyanatobenzene |
| InChI Key | QKFJKGMPGYROCL-UHFFFAOYSA-N |
| Molecular Formula | C7H5NS |
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
1-Methyl-2-pyrrolidinone, ACS grade, 99.0+%
CAS: 872-50-4 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.13 MDL Number: MFCD00003193 InChI Key: SECXISVLQFMRJM-UHFFFAOYSA-N IUPAC Name: 1-methylpyrrolidin-2-one SMILES: CN1CCCC1=O
| CAS | 872-50-4 |
|---|---|
| Molecular Weight (g/mol) | 99.13 |
| MDL Number | MFCD00003193 |
| SMILES | CN1CCCC1=O |
| IUPAC Name | 1-methylpyrrolidin-2-one |
| InChI Key | SECXISVLQFMRJM-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Dodecylamine, 98%
CAS: 124-22-1 Molecular Formula: C12H27N Molecular Weight (g/mol): 185.36 MDL Number: MFCD00008154 InChI Key: JRBPAEWTRLWTQC-UHFFFAOYSA-N Synonym: dodecylamine,1-dodecanamine,laurylamine,1-aminododecane,n-dodecylamine,dodecanamine,1-dodecylamine,lauramine,n-laurylamine,alamine 4 PubChem CID: 13583 IUPAC Name: dodecan-1-amine SMILES: CCCCCCCCCCCCN
| PubChem CID | 13583 |
|---|---|
| CAS | 124-22-1 |
| Molecular Weight (g/mol) | 185.36 |
| MDL Number | MFCD00008154 |
| SMILES | CCCCCCCCCCCCN |
| Synonym | dodecylamine,1-dodecanamine,laurylamine,1-aminododecane,n-dodecylamine,dodecanamine,1-dodecylamine,lauramine,n-laurylamine,alamine 4 |
| IUPAC Name | dodecan-1-amine |
| InChI Key | JRBPAEWTRLWTQC-UHFFFAOYSA-N |
| Molecular Formula | C12H27N |
Potassium cyanide, 97+%, Thermo Scientific Chemicals
CAS: 151-50-8 Molecular Formula: CKN Molecular Weight (g/mol): 65.116 MDL Number: MFCD00011397 InChI Key: NNFCIKHAZHQZJG-UHFFFAOYSA-N Synonym: potassium cyanide,potassium cyanide k cn,cyanide of potassium,caswell no. 688a,zyankali,kalium cyanid german,unii-mqd255m2zo,rcra waste number p098,cyanure de potassium french PubChem CID: 9032 IUPAC Name: potassium;cyanide SMILES: [C-]#N.[K+]
| PubChem CID | 9032 |
|---|---|
| CAS | 151-50-8 |
| Molecular Weight (g/mol) | 65.116 |
| MDL Number | MFCD00011397 |
| SMILES | [C-]#N.[K+] |
| Synonym | potassium cyanide,potassium cyanide k cn,cyanide of potassium,caswell no. 688a,zyankali,kalium cyanid german,unii-mqd255m2zo,rcra waste number p098,cyanure de potassium french |
| IUPAC Name | potassium;cyanide |
| InChI Key | NNFCIKHAZHQZJG-UHFFFAOYSA-N |
| Molecular Formula | CKN |
Thermo Scientific Chemicals L-Nicotine, 99+%
CAS: 54-11-5 Molecular Formula: C10H14N2 Molecular Weight (g/mol): 162.23 InChI Key: SNICXCGAKADSCV-JTQLQIEISA-N Synonym: nicotine,l-nicotine,--nicotine,s-nicotine,habitrol,s-3-1-methylpyrrolidin-2-yl pyridine,nicoderm,nicotrol,s---nicotine,nicoderm cq PubChem CID: 89594 ChEBI: CHEBI:17688 IUPAC Name: 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine SMILES: CN1CCCC1C2=CN=CC=C2
| PubChem CID | 89594 |
|---|---|
| CAS | 54-11-5 |
| Molecular Weight (g/mol) | 162.23 |
| ChEBI | CHEBI:17688 |
| SMILES | CN1CCCC1C2=CN=CC=C2 |
| Synonym | nicotine,l-nicotine,--nicotine,s-nicotine,habitrol,s-3-1-methylpyrrolidin-2-yl pyridine,nicoderm,nicotrol,s---nicotine,nicoderm cq |
| IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChI Key | SNICXCGAKADSCV-JTQLQIEISA-N |
| Molecular Formula | C10H14N2 |
Potassium Phosphate, Monobasic, 99.0% min., HPLC, MilliporeSigma™
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M Synonym: potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate PubChem CID: 516951 ChEBI: CHEBI:63036 IUPAC Name: potassium dihydrogen phosphate SMILES: [K+].OP(O)([O-])=O
| PubChem CID | 516951 |
|---|---|
| CAS | 7778-77-0 |
| Molecular Weight (g/mol) | 136.08 |
| ChEBI | CHEBI:63036 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| Synonym | potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate |
| IUPAC Name | potassium dihydrogen phosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |
Triethanolamine, 97%, Thermo Scientific Chemicals
CAS: 102-71-6 Molecular Formula: C6H15NO3 Molecular Weight (g/mol): 149.19 MDL Number: MFCD00002855 InChI Key: GSEJCLTVZPLZKY-UHFFFAOYSA-N Synonym: triethanolamine,trolamine,2,2',2-nitrilotriethanol,sterolamide,daltogen,tris 2-hydroxyethyl amine,triethylolamine,nitrilotriethanol,trihydroxytriethylamine,thiofaco t-35 PubChem CID: 7618 ChEBI: CHEBI:28621 IUPAC Name: 2-[bis(2-hydroxyethyl)amino]ethan-1-ol SMILES: OCCN(CCO)CCO
| PubChem CID | 7618 |
|---|---|
| CAS | 102-71-6 |
| Molecular Weight (g/mol) | 149.19 |
| ChEBI | CHEBI:28621 |
| MDL Number | MFCD00002855 |
| SMILES | OCCN(CCO)CCO |
| Synonym | triethanolamine,trolamine,2,2',2-nitrilotriethanol,sterolamide,daltogen,tris 2-hydroxyethyl amine,triethylolamine,nitrilotriethanol,trihydroxytriethylamine,thiofaco t-35 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethan-1-ol |
| InChI Key | GSEJCLTVZPLZKY-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO3 |
Cacodylic acid sodium salt trihydrate 98+%
CAS: 6131-99-3 Molecular Formula: C2H12AsNaO5 Molecular Weight (g/mol): 214.024 MDL Number: MFCD00149079 InChI Key: RLGWPHBPRCROJO-UHFFFAOYSA-M Synonym: sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate PubChem CID: 23679059 IUPAC Name: sodium;dimethylarsinate;trihydrate SMILES: C[As](=O)(C)[O-].O.O.O.[Na+]
| PubChem CID | 23679059 |
|---|---|
| CAS | 6131-99-3 |
| Molecular Weight (g/mol) | 214.024 |
| MDL Number | MFCD00149079 |
| SMILES | C[As](=O)(C)[O-].O.O.O.[Na+] |
| Synonym | sodium cacodylate trihydrate,unii-r7a6nc7ygy,cacodylic acid sodium salt trihydrate,r7a6nc7ygy,dimethylarsonic acid sodium salt,cacodylic acid, sodium salt trihydrate,sodium dimethylarsinic acid trihydrate,dimethylarsenic acid sodium salt trihydrate,dimethylarsinic acid sodium salt trihydrate,hydroxydimethylarsine oxide sodium salt trihydrate |
| IUPAC Name | sodium;dimethylarsinate;trihydrate |
| InChI Key | RLGWPHBPRCROJO-UHFFFAOYSA-M |
| Molecular Formula | C2H12AsNaO5 |
Ammonium peroxydisulfate, ACS, 98.0% min
CAS: 7727-54-0 Molecular Formula: H8N2O8S2 Molecular Weight (g/mol): 228.19 MDL Number: MFCD00003390 InChI Key: ROOXNKNUYICQNP-UHFFFAOYSA-N Synonym: ammonium persulfate,ammonium peroxydisulfate,diammonium peroxydisulfate,diammonium persulfate,ammoniumpersulfate,diammonium peroxodisulphate,diammonium peroxydisulphate,unii-22qf6l357f,ccris 1430,persulfate d'ammonium french PubChem CID: 62648 IUPAC Name: diazanium;sulfonatooxy sulfate SMILES: [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O
| PubChem CID | 62648 |
|---|---|
| CAS | 7727-54-0 |
| Molecular Weight (g/mol) | 228.19 |
| MDL Number | MFCD00003390 |
| SMILES | [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O |
| Synonym | ammonium persulfate,ammonium peroxydisulfate,diammonium peroxydisulfate,diammonium persulfate,ammoniumpersulfate,diammonium peroxodisulphate,diammonium peroxydisulphate,unii-22qf6l357f,ccris 1430,persulfate d'ammonium french |
| IUPAC Name | diazanium;sulfonatooxy sulfate |
| InChI Key | ROOXNKNUYICQNP-UHFFFAOYSA-N |
| Molecular Formula | H8N2O8S2 |
Copper(II) chloride dihydrate, ACS, 99+%
CAS: 10125-13-0 Molecular Formula: Cl2CuH4O2 Molecular Weight (g/mol): 170.48 MDL Number: MFCD00149674 InChI Key: MPTQRFCYZCXJFQ-UHFFFAOYSA-L Synonym: coppertrace,copper ii chloride dihydrate,copper chloride dihydrate,caswell no. 235a,copper 2+ chloride dihydrate,cupric chloride usp,copper chloride cucl2 , dihydrate,epa pesticide chemical code 023701 PubChem CID: 61482 ChEBI: CHEBI:86318 IUPAC Name: copper(2+) dihydrate dichloride SMILES: O.O.[Cl-].[Cl-].[Cu++]
| PubChem CID | 61482 |
|---|---|
| CAS | 10125-13-0 |
| Molecular Weight (g/mol) | 170.48 |
| ChEBI | CHEBI:86318 |
| MDL Number | MFCD00149674 |
| SMILES | O.O.[Cl-].[Cl-].[Cu++] |
| Synonym | coppertrace,copper ii chloride dihydrate,copper chloride dihydrate,caswell no. 235a,copper 2+ chloride dihydrate,cupric chloride usp,copper chloride cucl2 , dihydrate,epa pesticide chemical code 023701 |
| IUPAC Name | copper(2+) dihydrate dichloride |
| InChI Key | MPTQRFCYZCXJFQ-UHFFFAOYSA-L |
| Molecular Formula | Cl2CuH4O2 |
Barium hydroxide, anhydrous, 94-98%
CAS: 17194-00-2 Molecular Formula: BaH2O2 Molecular Weight (g/mol): 171.341 MDL Number: MFCD00003443 InChI Key: RQPZNWPYLFFXCP-UHFFFAOYSA-L Synonym: barium hydroxide,barium 2+ dihydroxide,bariumhydroxid,aetzbaryt,barium ii hydroxide,barium 2+ hydroxide,acmc-20alr7,barium hydroxide,anhydrous,barium hydroxide anhydrous PubChem CID: 6093286 ChEBI: CHEBI:32592 IUPAC Name: barium(2+);dihydroxide SMILES: [OH-].[OH-].[Ba+2]
| PubChem CID | 6093286 |
|---|---|
| CAS | 17194-00-2 |
| Molecular Weight (g/mol) | 171.341 |
| ChEBI | CHEBI:32592 |
| MDL Number | MFCD00003443 |
| SMILES | [OH-].[OH-].[Ba+2] |
| Synonym | barium hydroxide,barium 2+ dihydroxide,bariumhydroxid,aetzbaryt,barium ii hydroxide,barium 2+ hydroxide,acmc-20alr7,barium hydroxide,anhydrous,barium hydroxide anhydrous |
| IUPAC Name | barium(2+);dihydroxide |
| InChI Key | RQPZNWPYLFFXCP-UHFFFAOYSA-L |
| Molecular Formula | BaH2O2 |
Iron(III) nitrate nonahydrate, ACS, 98.0-101.0%
CAS: 7782-61-8 Molecular Formula: FeH18N3O18 Molecular Weight (g/mol): 403.99 MDL Number: MFCD00149708 InChI Key: SZQUEWJRBJDHSM-UHFFFAOYSA-N Synonym: ferric nitrate nonahydrate,iron iii nitrate nonahydrate,unii-vmx4uop3vn,ferric nitrate, nonahydrate,iron iii nitrate,vmx4uop3vn,iron, reference standard solution,ferricnitratenonahydrate,nitric acid, iron 3+ salt, nonahydrate,iron iii nitrate hydrate PubChem CID: 16211566 IUPAC Name: iron(3+) nonahydrate trinitrate SMILES: O.O.O.O.O.O.O.O.O.[Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 16211566 |
|---|---|
| CAS | 7782-61-8 |
| Molecular Weight (g/mol) | 403.99 |
| MDL Number | MFCD00149708 |
| SMILES | O.O.O.O.O.O.O.O.O.[Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | ferric nitrate nonahydrate,iron iii nitrate nonahydrate,unii-vmx4uop3vn,ferric nitrate, nonahydrate,iron iii nitrate,vmx4uop3vn,iron, reference standard solution,ferricnitratenonahydrate,nitric acid, iron 3+ salt, nonahydrate,iron iii nitrate hydrate |
| IUPAC Name | iron(3+) nonahydrate trinitrate |
| InChI Key | SZQUEWJRBJDHSM-UHFFFAOYSA-N |
| Molecular Formula | FeH18N3O18 |