Chemicals
Filtered Search Results
Dithiothreitol, >99.5%, Molecular Biology Grade, Ultrapure
CAS: 12-3-3483 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 MDL Number: MFCD00004877 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2 S,3 S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:42170 |
| MDL Number | MFCD00004877 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2 S,3 S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Molecular Formula | C4H10O2S2 |
n-Hexane, 99%
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
Iron(III) chloride, 98%, pure, anhydrous
CAS: 7705-08-0 Molecular Formula: Cl3Fe Molecular Weight (g/mol): 162.20 MDL Number: MFCD00011005 InChI Key: RBTARNINKXHZNM-UHFFFAOYSA-K Synonym: Ferric chloride IUPAC Name: iron(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 7705-08-0 |
|---|---|
| Molecular Weight (g/mol) | 162.20 |
| MDL Number | MFCD00011005 |
| SMILES | [Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | Ferric chloride |
| IUPAC Name | iron(3+) trichloride |
| InChI Key | RBTARNINKXHZNM-UHFFFAOYSA-K |
| Molecular Formula | Cl3Fe |
Sodium phosphate, dibasic, 99+%, ACS reagent, suitable for buffer solutions
CAS: 7558-79-4 Molecular Formula: HNa2O4P Molecular Weight (g/mol): 141.96 MDL Number: MFCD00003496 InChI Key: BNIILDVGGAEEIG-UHFFFAOYSA-L Synonym: disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt PubChem CID: 24203 ChEBI: CHEBI:34683 SMILES: [Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 24203 |
|---|---|
| CAS | 7558-79-4 |
| Molecular Weight (g/mol) | 141.96 |
| ChEBI | CHEBI:34683 |
| MDL Number | MFCD00003496 |
| SMILES | [Na+].[Na+].OP([O-])([O-])=O |
| Synonym | disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt |
| InChI Key | BNIILDVGGAEEIG-UHFFFAOYSA-L |
| Molecular Formula | HNa2O4P |
Methyl sulfoxide, 99.7%, pure, Thermo Scientific Chemicals
CAS: 67-68-5 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00002089 InChI Key: IAZDPXIOMUYVGZ-UHFFFAOYSA-N Synonym: dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide PubChem CID: 679 ChEBI: CHEBI:28262 IUPAC Name: methylsulfinylmethane SMILES: CS(C)=O
| PubChem CID | 679 |
|---|---|
| CAS | 67-68-5 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:28262 |
| MDL Number | MFCD00002089 |
| SMILES | CS(C)=O |
| Synonym | dimethyl sulfoxide,dmso,methyl sulfoxide,dimethylsulfoxide,dimethyl sulphoxide,methane, sulfinylbis,demsodrox,demasorb,demavet,dimexide |
| IUPAC Name | methylsulfinylmethane |
| InChI Key | IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |
Polyethylene glycol 200
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
2,2,2-Trichloroethanol, 99%
CAS: 115-20-8 Molecular Formula: C2H3Cl3O Molecular Weight (g/mol): 149.4 MDL Number: MFCD00004677 InChI Key: KPWDGTGXUYRARH-UHFFFAOYSA-N Synonym: trichloroethanol,trichlorethanol,trichloroethyl alcohol,ethanol, 2,2,2-trichloro,2,2,2-trichloro-1-ethanol,hydroxymethyl trichloromethane,2,2,2-trichloroethyl alcohol,2,2,2-trichloroethan-1-ol,unii-aw835aj62n,beta-trichloroethanol PubChem CID: 8259 ChEBI: CHEBI:28094 IUPAC Name: 2,2,2-trichloroethanol SMILES: C(C(Cl)(Cl)Cl)O
| PubChem CID | 8259 |
|---|---|
| CAS | 115-20-8 |
| Molecular Weight (g/mol) | 149.4 |
| ChEBI | CHEBI:28094 |
| MDL Number | MFCD00004677 |
| SMILES | C(C(Cl)(Cl)Cl)O |
| Synonym | trichloroethanol,trichlorethanol,trichloroethyl alcohol,ethanol, 2,2,2-trichloro,2,2,2-trichloro-1-ethanol,hydroxymethyl trichloromethane,2,2,2-trichloroethyl alcohol,2,2,2-trichloroethan-1-ol,unii-aw835aj62n,beta-trichloroethanol |
| IUPAC Name | 2,2,2-trichloroethanol |
| InChI Key | KPWDGTGXUYRARH-UHFFFAOYSA-N |
| Molecular Formula | C2H3Cl3O |
Sulfamic acid, 99%
CAS: 5329-14-6 Molecular Formula: H3NO3S Molecular Weight (g/mol): 97.09 InChI Key: IIACRCGMVDHOTQ-UHFFFAOYSA-N Synonym: amidosulfonic acid,amidosulfuric acid,aminosulfonic acid,imidosulfonic acid,sulfamidic acid,sulfaminic acid,sulphamic acid,jumbo,aminosulfuric acid,sulphamidic acid ChEBI: CHEBI:9330 IUPAC Name: sulfamic acid SMILES: NS(=O)(=O)O
| CAS | 5329-14-6 |
|---|---|
| Molecular Weight (g/mol) | 97.09 |
| ChEBI | CHEBI:9330 |
| SMILES | NS(=O)(=O)O |
| Synonym | amidosulfonic acid,amidosulfuric acid,aminosulfonic acid,imidosulfonic acid,sulfamidic acid,sulfaminic acid,sulphamic acid,jumbo,aminosulfuric acid,sulphamidic acid |
| IUPAC Name | sulfamic acid |
| InChI Key | IIACRCGMVDHOTQ-UHFFFAOYSA-N |
| Molecular Formula | H3NO3S |
Zinc powder, -100 mesh, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Bromine liquid, 99.8%
CAS: 7726-95-6 Molecular Formula: Br Molecular Weight (g/mol): 79.91 MDL Number: MFCD00010896 InChI Key: CPELXLSAUQHCOX-UHFFFAOYSA-M Synonym: bromine,dibromine,brom,bromine solution,brome,bromo,broom,bromine water,bromo italian,bromo spanish PubChem CID: 24408 ChEBI: CHEBI:29224 SMILES: [Br-]
| PubChem CID | 24408 |
|---|---|
| CAS | 7726-95-6 |
| Molecular Weight (g/mol) | 79.91 |
| ChEBI | CHEBI:29224 |
| MDL Number | MFCD00010896 |
| SMILES | [Br-] |
| Synonym | bromine,dibromine,brom,bromine solution,brome,bromo,broom,bromine water,bromo italian,bromo spanish |
| InChI Key | CPELXLSAUQHCOX-UHFFFAOYSA-M |
| Molecular Formula | Br |
Sodium phosphate, dibasic heptahydrate, 98+%, ACS reagent
CAS: 7782-85-6 Molecular Formula: H15Na2O11P Molecular Weight (g/mol): 268.06 MDL Number: MFCD00149180 InChI Key: LVXHNCUCBXIIPE-UHFFFAOYSA-L Synonym: sodium phosphate dibasic heptahydrate,unii-70wt22sf4b,sodium phosphate, dibasic, heptahydrate,sodium hydrogen phosphate heptahydrate,disodium hydrogen phosphate heptahydrate,axea paragraph signthornaae,2na.hpo4.7h2o,sodium hydrogenphosphate heptahydrate,sodium phosphate dibasic, acs,disodium hydrogenphosphate heptahydrate PubChem CID: 6096963 IUPAC Name: disodium phosphoric acid heptahydrate SMILES: O.[Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 6096963 |
|---|---|
| CAS | 7782-85-6 |
| Molecular Weight (g/mol) | 268.06 |
| MDL Number | MFCD00149180 |
| SMILES | O.[Na+].[Na+].OP([O-])([O-])=O |
| Synonym | sodium phosphate dibasic heptahydrate,unii-70wt22sf4b,sodium phosphate, dibasic, heptahydrate,sodium hydrogen phosphate heptahydrate,disodium hydrogen phosphate heptahydrate,axea paragraph signthornaae,2na.hpo4.7h2o,sodium hydrogenphosphate heptahydrate,sodium phosphate dibasic, acs,disodium hydrogenphosphate heptahydrate |
| IUPAC Name | disodium phosphoric acid heptahydrate |
| InChI Key | LVXHNCUCBXIIPE-UHFFFAOYSA-L |
| Molecular Formula | H15Na2O11P |
Formic Acid, 99.0+%, Optima™ LC/MS Grade, Fisher Chemical™
CAS: 64-18-6 Molecular Formula: CH2O2 MDL Number: 3297 InChI Key: BDAGIHXWWSANSR-UHFFFAOYSA-N Synonym: methanoic acid,formylic acid,aminic acid,bilorin,hydrogen carboxylic acid,formisoton,myrmicyl,formira,acide formique,collo-bueglatt PubChem CID: 284 ChEBI: CHEBI:30751 IUPAC Name: formic acid
| PubChem CID | 284 |
|---|---|
| CAS | 64-18-6 |
| ChEBI | CHEBI:30751 |
| MDL Number | 3297 |
| Synonym | methanoic acid,formylic acid,aminic acid,bilorin,hydrogen carboxylic acid,formisoton,myrmicyl,formira,acide formique,collo-bueglatt |
| IUPAC Name | formic acid |
| InChI Key | BDAGIHXWWSANSR-UHFFFAOYSA-N |
| Molecular Formula | CH2O2 |
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Boiling Point | 65.0°C |
|---|---|
| Linear Formula | ((CH3)3Si)2NLi |
| Molecular Weight (g/mol) | 167.33 |
| Chemical Name or Material | Lithium bis(trimethylsilyl)amide |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Density | 0.9000g/mL |
| PubChem CID | 2733832 |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Solubility Information | Solubility in water: reacts. |
| Flash Point | −21°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| Molecular Formula | C6H18LiNSi2 |
| EINECS Number | 223-725-6 |
| Formula Weight | 167.33 |
| Specific Gravity | 0.9 |
Activated charcoal, NORIT™ SA 2
CAS: 7440-44-0 Molecular Formula: C Molecular Weight (g/mol): 12 MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7440-44-0 |
| Molecular Weight (g/mol) | 12 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
| Water | 0.1% max. (K.F.) |
|---|---|
| Viscosity | 1.1 mPa.s (20°C) |
| Linear Formula | CH3OCH2CH2OCH3 |
| Density | 0.8670g/mL |
| Name Note | Stabilized with BHT |
| Percent Purity | ≥99% |
| Fieser | 01,267; 02,143; 16,229 |
| Infrared Spectrum | Authentic |
| pH | 6 to 7.5 (1:9) |
| Formula Weight | 90.12 |
| Melting Point | -69.0°C |
| Boiling Point | 84.0°C to 86.0°C |
| Physical Form | Liquid |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Pure |
| Merck Index | 15, 3245 |
| Assay Percent Range | 99+% |
| CAS | 128-37-0 |
| Health Hazard 3 | GHS P Statement: Obtain special instructions before use. IF exposed or concerned: Get medical advice/attention. Keep container tightly closed. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Health Hazard 2 | GHS H Statement: Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. May form explosive peroxides. |
| Flash Point | −6°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3785 to 1.3805 |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| Beilstein | 01, 467 |
| Specific Gravity | 0.867 |