Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Filtered Search Results
Sulfuric acid, ACS reagent, 95% solution in water
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Boric acid, 99.99% (metals basis)
CAS: 10043-35-3 Molecular Formula: BH3O3 Molecular Weight (g/mol): 61.83 MDL Number: MFCD00011337 InChI Key: KGBXLFKZBHKPEV-UHFFFAOYSA-N Synonym: orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe PubChem CID: 7628 ChEBI: CHEBI:33118 IUPAC Name: boric acid SMILES: OB(O)O
| PubChem CID | 7628 |
|---|---|
| CAS | 10043-35-3 |
| Molecular Weight (g/mol) | 61.83 |
| ChEBI | CHEBI:33118 |
| MDL Number | MFCD00011337 |
| SMILES | OB(O)O |
| Synonym | orthoboric acid,boracic acid,borofax,boron hydroxide,boron trihydroxide,three elephant,basilit b,trihydroxyborone,h3bo3,flea prufe |
| IUPAC Name | boric acid |
| InChI Key | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| Molecular Formula | BH3O3 |
Sulfuric acid, ACS, 95.0-98.0%
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
| Linear Formula | HCl |
|---|---|
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| UN Number | 2924 |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Density | 1.1000g/mL |
| PubChem CID | 313 |
| Name Note | 4N Solution in 1, 4-dioxane/water |
| Fieser | 04,450; 05,533; 06,283 |
| Formula Weight | 36.45 |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Hydrochloric acid |
| SMILES | Cl |
| Merck Index | 15, 4818 |
| Concentration | 3.95 to 4.40N |
| CAS | 123-91-1 |
| Health Hazard 3 | GHS P Statement: Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Immediately call a POISON CENTER or doctor/physician. Use personal protective equipment as required. Avoid breathing dust/fume/gas/mist/vapors/spray. Keep container tightly closed. IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00011324 MFCD00792839 |
| Health Hazard 2 | GHS H Statement: Suspected of causing cancer. May cause respiratory irritation. Causes serious eye irritation. Causes skin irritation. Highly flammable liquid and vapor. May form explosive peroxides. Repeated exposure may cause skin dryness or cracking. |
| Flash Point | 12°C |
| Packaging | Glass bottle |
| Health Hazard 1 | Danger |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| Molecular Formula | ClH |
| Specific Gravity | 1.1 |
Hydrochloric acid, 36% w/w aq. soln.
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Formic Acid, 98% (ACS), GR, MilliporeSigma™
CAS: 64-18-6 Molecular Formula: CH2O2 Molecular Weight (g/mol): 46.025 InChI Key: BDAGIHXWWSANSR-UHFFFAOYSA-N Synonym: methanoic acid,formylic acid,aminic acid,bilorin,hydrogen carboxylic acid,formisoton,myrmicyl,formira,acide formique,collo-bueglatt PubChem CID: 284 ChEBI: CHEBI:30751 IUPAC Name: formic acid SMILES: C(=O)O
| PubChem CID | 284 |
|---|---|
| CAS | 64-18-6 |
| Molecular Weight (g/mol) | 46.025 |
| ChEBI | CHEBI:30751 |
| SMILES | C(=O)O |
| Synonym | methanoic acid,formylic acid,aminic acid,bilorin,hydrogen carboxylic acid,formisoton,myrmicyl,formira,acide formique,collo-bueglatt |
| IUPAC Name | formic acid |
| InChI Key | BDAGIHXWWSANSR-UHFFFAOYSA-N |
| Molecular Formula | CH2O2 |
Oxalic acid, anhydrous, 98%
CAS: 144-62-7 Molecular Formula: C2H2O4 Molecular Weight (g/mol): 90.034 MDL Number: MFCD00002573 InChI Key: MUBZPKHOEPUJKR-UHFFFAOYSA-N Synonym: ethanedioic acid,aktisal,aquisal,oxiric acid,oxalate,oxalsaeure,oxaalzuur,kyselina stavelova,acide oxalique,acido ossalico PubChem CID: 971 ChEBI: CHEBI:16995 IUPAC Name: oxalic acid SMILES: C(=O)(C(=O)O)O
| PubChem CID | 971 |
|---|---|
| CAS | 144-62-7 |
| Molecular Weight (g/mol) | 90.034 |
| ChEBI | CHEBI:16995 |
| MDL Number | MFCD00002573 |
| SMILES | C(=O)(C(=O)O)O |
| Synonym | ethanedioic acid,aktisal,aquisal,oxiric acid,oxalate,oxalsaeure,oxaalzuur,kyselina stavelova,acide oxalique,acido ossalico |
| IUPAC Name | oxalic acid |
| InChI Key | MUBZPKHOEPUJKR-UHFFFAOYSA-N |
| Molecular Formula | C2H2O4 |
Hydrochloric Acid, 10 g/L HCl, Ricca Chemical
CAS: 7732-18-5 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid PubChem CID: 313 ChEBI: CHEBI:23116 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:23116 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Phosphomolybdic Acid hydrate, ACS Reagent
CAS: 51429-74-4 Molecular Formula: H3Mo12O40P Molecular Weight (g/mol): 1825.40 MDL Number: MFCD00149913 InChI Key: FEFSFHGZSNHJEL-UHFFFAOYSA-N IUPAC Name: phosphoric acid dodecamolybdenum hexatriacontaoxidandiide SMILES: [O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].OP(O)(O)=O
| CAS | 51429-74-4 |
|---|---|
| Molecular Weight (g/mol) | 1825.40 |
| MDL Number | MFCD00149913 |
| SMILES | [O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[O--].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].[Mo].OP(O)(O)=O |
| IUPAC Name | phosphoric acid dodecamolybdenum hexatriacontaoxidandiide |
| InChI Key | FEFSFHGZSNHJEL-UHFFFAOYSA-N |
| Molecular Formula | H3Mo12O40P |
trans-Cinnamic acid, 99+%
CAS: 140-10-3 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00004369 InChI Key: WBYWAXJHAXSJNI-VOTSOKGWSA-N Synonym: cinnamic acid,trans-cinnamic acid,e-cinnamic acid,3-phenylacrylic acid,trans-3-phenylacrylic acid,zimtsaeure,2e-3-phenylprop-2-enoic acid,3-phenylprop-2-enoic acid,3-phenylpropenoic acid PubChem CID: 444539 ChEBI: CHEBI:35697 IUPAC Name: (E)-3-phenylprop-2-enoic acid SMILES: C1=CC=C(C=C1)C=CC(=O)O
| PubChem CID | 444539 |
|---|---|
| CAS | 140-10-3 |
| Molecular Weight (g/mol) | 148.161 |
| ChEBI | CHEBI:35697 |
| MDL Number | MFCD00004369 |
| SMILES | C1=CC=C(C=C1)C=CC(=O)O |
| Synonym | cinnamic acid,trans-cinnamic acid,e-cinnamic acid,3-phenylacrylic acid,trans-3-phenylacrylic acid,zimtsaeure,2e-3-phenylprop-2-enoic acid,3-phenylprop-2-enoic acid,3-phenylpropenoic acid |
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
| InChI Key | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| Molecular Formula | C9H8O2 |
Perchloric acid, 70%, 99.9985% (metals basis)
CAS: 7601-90-3 Molecular Formula: ClHO4 Molecular Weight (g/mol): 100.45 MDL Number: MFCD00011325 InChI Key: VLTRZXGMWDSKGL-UHFFFAOYSA-N Synonym: unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 PubChem CID: 24247 ChEBI: CHEBI:29221 IUPAC Name: perchloric acid SMILES: O[Cl](=O)(=O)=O
| PubChem CID | 24247 |
|---|---|
| CAS | 7601-90-3 |
| Molecular Weight (g/mol) | 100.45 |
| ChEBI | CHEBI:29221 |
| MDL Number | MFCD00011325 |
| SMILES | O[Cl](=O)(=O)=O |
| Synonym | unii-v561v90bg2,perchloric acid,perchloric acid acid by mass forbidden,perchloric acid, acs reagent,perchlorsaeure,perchloric acid,ueberchlorsaeure,hyperchloric acid,hclo4 |
| IUPAC Name | perchloric acid |
| InChI Key | VLTRZXGMWDSKGL-UHFFFAOYSA-N |
| Molecular Formula | ClHO4 |
Sulfuric acid, 10% v/v aq. soln.
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Butyric Acid 99.0+%, TCI America™
CAS: 107-92-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.11 MDL Number: MFCD00002814 InChI Key: FERIUCNNQQJTOY-UHFFFAOYSA-N Synonym: butyric acid,n-butyric acid,n-butanoic acid,propylformic acid,ethylacetic acid,butanic acid,1-propanecarboxylic acid,butyrate,1-butyric acid,buttersaeure PubChem CID: 264 ChEBI: CHEBI:30772 IUPAC Name: butanoic acid SMILES: CCCC(O)=O
| PubChem CID | 264 |
|---|---|
| CAS | 107-92-6 |
| Molecular Weight (g/mol) | 88.11 |
| ChEBI | CHEBI:30772 |
| MDL Number | MFCD00002814 |
| SMILES | CCCC(O)=O |
| Synonym | butyric acid,n-butyric acid,n-butanoic acid,propylformic acid,ethylacetic acid,butanic acid,1-propanecarboxylic acid,butyrate,1-butyric acid,buttersaeure |
| IUPAC Name | butanoic acid |
| InChI Key | FERIUCNNQQJTOY-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Humic acid sodium salt, tech. 50-60% (as humic acid)
CAS: 68131-04-4 Molecular Formula: C9H8Na2O4 Molecular Weight (g/mol): 226.139 MDL Number: MFCD00135560 InChI Key: HMGUIQPKFUZDPV-UHFFFAOYSA-L Synonym: humic acid sodium salt,sodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate,sodium humate,disodium bicyclo 2.2.1 hept-5-en-2,3-dicarboxylate,disodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate,bicyclo 2.2.1 hepta-5-ene-2,3-dicarboxylic acid disodium salt PubChem CID: 21908873 IUPAC Name: disodium;bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate SMILES: C1C2C=CC1C(C2C(=O)[O-])C(=O)[O-].[Na+].[Na+]
| PubChem CID | 21908873 |
|---|---|
| CAS | 68131-04-4 |
| Molecular Weight (g/mol) | 226.139 |
| MDL Number | MFCD00135560 |
| SMILES | C1C2C=CC1C(C2C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Synonym | humic acid sodium salt,sodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate,sodium humate,disodium bicyclo 2.2.1 hept-5-en-2,3-dicarboxylate,disodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate,bicyclo 2.2.1 hepta-5-ene-2,3-dicarboxylic acid disodium salt |
| IUPAC Name | disodium;bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| InChI Key | HMGUIQPKFUZDPV-UHFFFAOYSA-L |
| Molecular Formula | C9H8Na2O4 |
Sulfuric acid, 20% v/v aq. soln.
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |