Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2-Iodo-2-methylpropionitrile 96.0+%, TCI America™
CAS: 19481-79-9 Molecular Formula: C4H6IN Molecular Weight (g/mol): 195.00 MDL Number: MFCD28384148 InChI Key: DBESYUOJKJZGLV-UHFFFAOYSA-N PubChem CID: 549274 IUPAC Name: 2-iodo-2-methylpropanenitrile SMILES: CC(C)(I)C#N
| PubChem CID | 549274 |
|---|---|
| CAS | 19481-79-9 |
| Molecular Weight (g/mol) | 195.00 |
| MDL Number | MFCD28384148 |
| SMILES | CC(C)(I)C#N |
| IUPAC Name | 2-iodo-2-methylpropanenitrile |
| InChI Key | DBESYUOJKJZGLV-UHFFFAOYSA-N |
| Molecular Formula | C4H6IN |
2-Nitropropane 95.0+%, TCI America™
CAS: 79-46-9 Molecular Formula: C3H7NO2 Molecular Weight (g/mol): 89.094 MDL Number: MFCD00007397 InChI Key: FGLBSLMDCBOPQK-UHFFFAOYSA-N Synonym: propane, 2-nitro,isonitropropane,dimethylnitromethane,nitroisopropane,sec-nitropropane,nipar s-20,beta-nitropropane,2-np,nipar s-20 solvent,nipar s-30 solvent PubChem CID: 398 ChEBI: CHEBI:16037 IUPAC Name: 2-nitropropane SMILES: CC(C)[N+](=O)[O-]
| PubChem CID | 398 |
|---|---|
| CAS | 79-46-9 |
| Molecular Weight (g/mol) | 89.094 |
| ChEBI | CHEBI:16037 |
| MDL Number | MFCD00007397 |
| SMILES | CC(C)[N+](=O)[O-] |
| Synonym | propane, 2-nitro,isonitropropane,dimethylnitromethane,nitroisopropane,sec-nitropropane,nipar s-20,beta-nitropropane,2-np,nipar s-20 solvent,nipar s-30 solvent |
| IUPAC Name | 2-nitropropane |
| InChI Key | FGLBSLMDCBOPQK-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO2 |
Cyclohexaneethanol 98.0+%, TCI America™
CAS: 4442-79-9 Molecular Formula: C8H16O Molecular Weight (g/mol): 128.215 MDL Number: MFCD00001525 InChI Key: QJQZRLXDLORINA-UHFFFAOYSA-N Synonym: cyclohexaneethanol,cyclohexylethanol,cyclohexylethyl alcohol,2-cyclohexylethan-1-ol,ethanol, 2-cyclohexyl,hexahydrophenylethyl alcohol,unii-653aok9puo,2-hydroxyethyl cyclohexane,.beta.-cyclohexylethyl alcohol,2-cyclohexyl-ethanol PubChem CID: 20508 IUPAC Name: 2-cyclohexylethanol SMILES: C1CCC(CC1)CCO
| PubChem CID | 20508 |
|---|---|
| CAS | 4442-79-9 |
| Molecular Weight (g/mol) | 128.215 |
| MDL Number | MFCD00001525 |
| SMILES | C1CCC(CC1)CCO |
| Synonym | cyclohexaneethanol,cyclohexylethanol,cyclohexylethyl alcohol,2-cyclohexylethan-1-ol,ethanol, 2-cyclohexyl,hexahydrophenylethyl alcohol,unii-653aok9puo,2-hydroxyethyl cyclohexane,.beta.-cyclohexylethyl alcohol,2-cyclohexyl-ethanol |
| IUPAC Name | 2-cyclohexylethanol |
| InChI Key | QJQZRLXDLORINA-UHFFFAOYSA-N |
| Molecular Formula | C8H16O |
Propyl Gallate 98.0+%, TCI America™
CAS: 121-79-9 Molecular Formula: C10H12O5 Molecular Weight (g/mol): 212.201 MDL Number: MFCD00002196 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N Synonym: propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,gallic acid propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate PubChem CID: 4947 ChEBI: CHEBI:10607 IUPAC Name: propyl 3,4,5-trihydroxybenzoate SMILES: CCCOC(=O)C1=CC(=C(C(=C1)O)O)O
| PubChem CID | 4947 |
|---|---|
| CAS | 121-79-9 |
| Molecular Weight (g/mol) | 212.201 |
| ChEBI | CHEBI:10607 |
| MDL Number | MFCD00002196 |
| SMILES | CCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Synonym | propyl gallate,n-propyl gallate,progallin p,tenox pg,nipagallin p,gallic acid, propyl ester,gallic acid propyl ester,nipa 49,benzoic acid, 3,4,5-trihydroxy-, propyl ester,3,4,5-trihydroxybenzene-1-propylcarboxylate |
| IUPAC Name | propyl 3,4,5-trihydroxybenzoate |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O5 |
2-Bromo-9,10-diphenylanthracene 95.0+%, TCI America™
CAS: 201731-79-5 Molecular Formula: C26H17Br Molecular Weight (g/mol): 409.326 InChI Key: OZNXPZBQVNNJCS-UHFFFAOYSA-N PubChem CID: 22247163 IUPAC Name: 2-bromo-9,10-diphenylanthracene SMILES: C1=CC=C(C=C1)C2=C3C=CC(=CC3=C(C4=CC=CC=C42)C5=CC=CC=C5)Br
| PubChem CID | 22247163 |
|---|---|
| CAS | 201731-79-5 |
| Molecular Weight (g/mol) | 409.326 |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=CC3=C(C4=CC=CC=C42)C5=CC=CC=C5)Br |
| IUPAC Name | 2-bromo-9,10-diphenylanthracene |
| InChI Key | OZNXPZBQVNNJCS-UHFFFAOYSA-N |
| Molecular Formula | C26H17Br |
2-Amino-4-methoxybenzothiazole 98.0+%, TCI America™
CAS: 5464-79-9 Molecular Formula: C8H8N2OS Molecular Weight (g/mol): 180.225 MDL Number: MFCD00005792 InChI Key: YEBCRAVYUWNFQT-UHFFFAOYSA-N Synonym: 2-amino-4-methoxybenzothiazole,4-methoxy-2-aminobenzothiazole,2-benzothiazolamine, 4-methoxy,4-methoxybenzo d thiazol-2-amine,2-amino-4-methoxy-benzothiazole,benzothiazole, 2-amino-4-methoxy,4-methoxy-benzothiazol-2-ylamine,4-methoxybenzothiazol-2-ylamine,4-methoxybenzothiazole-2-ylamine,2-benzothiazolamine, 4-methoxy-9ci PubChem CID: 21622 IUPAC Name: 4-methoxy-1,3-benzothiazol-2-amine SMILES: COC1=C2C(=CC=C1)SC(=N2)N
| PubChem CID | 21622 |
|---|---|
| CAS | 5464-79-9 |
| Molecular Weight (g/mol) | 180.225 |
| MDL Number | MFCD00005792 |
| SMILES | COC1=C2C(=CC=C1)SC(=N2)N |
| Synonym | 2-amino-4-methoxybenzothiazole,4-methoxy-2-aminobenzothiazole,2-benzothiazolamine, 4-methoxy,4-methoxybenzo d thiazol-2-amine,2-amino-4-methoxy-benzothiazole,benzothiazole, 2-amino-4-methoxy,4-methoxy-benzothiazol-2-ylamine,4-methoxybenzothiazol-2-ylamine,4-methoxybenzothiazole-2-ylamine,2-benzothiazolamine, 4-methoxy-9ci |
| IUPAC Name | 4-methoxy-1,3-benzothiazol-2-amine |
| InChI Key | YEBCRAVYUWNFQT-UHFFFAOYSA-N |
| Molecular Formula | C8H8N2OS |
2-Acetyl-5-methylfuran 98.0+%, TCI America™
CAS: 1193-79-9 Molecular Formula: C7H8O2 Molecular Weight (g/mol): 124.139 MDL Number: MFCD00003243 InChI Key: KEFJLCGVTHRGAH-UHFFFAOYSA-N Synonym: 2-acetyl-5-methylfuran,5-methyl-2-acetylfuran,1-5-methylfuran-2-yl ethanone,1-5-methyl-2-furyl ethanone,5-methyl-2-furylmethylketone,ethanone, 1-5-methyl-2-furanyl,1-5-methyl-2-furanyl ethanone,2-methyl-5-acetylfuran,1-5-methyl-2-furyl ethan-1-one,methyl 5-methyl-2-furyl ketone PubChem CID: 14514 ChEBI: CHEBI:562752 IUPAC Name: 1-(5-methylfuran-2-yl)ethanone SMILES: CC1=CC=C(O1)C(=O)C
| PubChem CID | 14514 |
|---|---|
| CAS | 1193-79-9 |
| Molecular Weight (g/mol) | 124.139 |
| ChEBI | CHEBI:562752 |
| MDL Number | MFCD00003243 |
| SMILES | CC1=CC=C(O1)C(=O)C |
| Synonym | 2-acetyl-5-methylfuran,5-methyl-2-acetylfuran,1-5-methylfuran-2-yl ethanone,1-5-methyl-2-furyl ethanone,5-methyl-2-furylmethylketone,ethanone, 1-5-methyl-2-furanyl,1-5-methyl-2-furanyl ethanone,2-methyl-5-acetylfuran,1-5-methyl-2-furyl ethan-1-one,methyl 5-methyl-2-furyl ketone |
| IUPAC Name | 1-(5-methylfuran-2-yl)ethanone |
| InChI Key | KEFJLCGVTHRGAH-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2 |
8-Hydroxyquinoline-7-carboxylic Acid 98.0+%, TCI America™
CAS: 19829-79-9 Molecular Formula: C10H7NO3 Molecular Weight (g/mol): 189.17 MDL Number: MFCD00671539 InChI Key: JYIAZVFJRYLCBH-UHFFFAOYSA-N PubChem CID: 231363 IUPAC Name: 8-hydroxyquinoline-7-carboxylic acid SMILES: C1=CC2=C(C(=C(C=C2)C(=O)O)O)N=C1
| PubChem CID | 231363 |
|---|---|
| CAS | 19829-79-9 |
| Molecular Weight (g/mol) | 189.17 |
| MDL Number | MFCD00671539 |
| SMILES | C1=CC2=C(C(=C(C=C2)C(=O)O)O)N=C1 |
| IUPAC Name | 8-hydroxyquinoline-7-carboxylic acid |
| InChI Key | JYIAZVFJRYLCBH-UHFFFAOYSA-N |
| Molecular Formula | C10H7NO3 |
2,5-Dihydroxybenzoic Acid 98.0+%, TCI America™
CAS: 490-79-9 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.121 MDL Number: MFCD00002460 InChI Key: WXTMDXOMEHJXQO-UHFFFAOYSA-N Synonym: gentisic acid,hydroquinonecarboxylic acid,benzoic acid, 2,5-dihydroxy,5-hydroxysalicylic acid,gensigen,gensigon,gentisate,2,5-dioxybenzoic acid,2,5-dhba,gentisinic acid PubChem CID: 3469 ChEBI: CHEBI:17189 IUPAC Name: 2,5-dihydroxybenzoic acid SMILES: C1=CC(=C(C=C1O)C(=O)O)O
| PubChem CID | 3469 |
|---|---|
| CAS | 490-79-9 |
| Molecular Weight (g/mol) | 154.121 |
| ChEBI | CHEBI:17189 |
| MDL Number | MFCD00002460 |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)O |
| Synonym | gentisic acid,hydroquinonecarboxylic acid,benzoic acid, 2,5-dihydroxy,5-hydroxysalicylic acid,gensigen,gensigon,gentisate,2,5-dioxybenzoic acid,2,5-dhba,gentisinic acid |
| IUPAC Name | 2,5-dihydroxybenzoic acid |
| InChI Key | WXTMDXOMEHJXQO-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
6-Carboxyfluorescein Hydrate 97.0+%, TCI America™
CAS: 3301-79-9 Molecular Formula: C21H12O7 Molecular Weight (g/mol): 376.32 MDL Number: MFCD00036873 InChI Key: BZTDTCNHAFUJOG-UHFFFAOYSA-N Synonym: 6-carboxyfluorescein,6-fam,carboxyfluorescein,spiro isobenzofuran-1 3h ,9'-9h xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo,3,6,9-trihydroxyxanthen-9-yl terephthalic acid,3',6'-dihydroxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-6-carboxylic acid,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid,5 6-carboxy fluorescein,bidd:gt0504 PubChem CID: 76806 ChEBI: CHEBI:39073 IUPAC Name: 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid SMILES: C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O
| PubChem CID | 76806 |
|---|---|
| CAS | 3301-79-9 |
| Molecular Weight (g/mol) | 376.32 |
| ChEBI | CHEBI:39073 |
| MDL Number | MFCD00036873 |
| SMILES | C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
| Synonym | 6-carboxyfluorescein,6-fam,carboxyfluorescein,spiro isobenzofuran-1 3h ,9'-9h xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo,3,6,9-trihydroxyxanthen-9-yl terephthalic acid,3',6'-dihydroxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-6-carboxylic acid,3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid,5 6-carboxy fluorescein,bidd:gt0504 |
| IUPAC Name | 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| InChI Key | BZTDTCNHAFUJOG-UHFFFAOYSA-N |
| Molecular Formula | C21H12O7 |
Scandium(III) Trifluoromethanesulfonate 98.0+%, TCI America™
CAS: 144026-79-9 Molecular Formula: C3F9O9S3Sc Molecular Weight (g/mol): 492.146 MDL Number: MFCD00192433 InChI Key: HZXJVDYQRYYYOR-UHFFFAOYSA-K Synonym: scandium iii trifluoromethanesulfonate,scandium trifluoromethanesulfonate,scandium iii triflate,scandium triflate,sc otf 3,scandium 3+ ; trifluoromethanesulfonate,trifluoromethanesulfonic acid scandium iii salt,scandium iii trifluoromethanesulphonate,scandium tris trifluoromethanesulfonate,scandiumtriflate PubChem CID: 2734571 IUPAC Name: scandium(3+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Sc+3]
| PubChem CID | 2734571 |
|---|---|
| CAS | 144026-79-9 |
| Molecular Weight (g/mol) | 492.146 |
| MDL Number | MFCD00192433 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Sc+3] |
| Synonym | scandium iii trifluoromethanesulfonate,scandium trifluoromethanesulfonate,scandium iii triflate,scandium triflate,sc otf 3,scandium 3+ ; trifluoromethanesulfonate,trifluoromethanesulfonic acid scandium iii salt,scandium iii trifluoromethanesulphonate,scandium tris trifluoromethanesulfonate,scandiumtriflate |
| IUPAC Name | scandium(3+);trifluoromethanesulfonate |
| InChI Key | HZXJVDYQRYYYOR-UHFFFAOYSA-K |
| Molecular Formula | C3F9O9S3Sc |
3-Bromo-4-methoxybenzonitrile 98.0+%, TCI America™
CAS: 117572-79-9 Molecular Formula: C8H6BrNO Molecular Weight (g/mol): 212.05 MDL Number: MFCD00143097 InChI Key: QHWZMDRKTYTPEE-UHFFFAOYSA-N Synonym: 2-bromo-4-cyanoanisole,3-bromo-4-methoxylbenzonitrile,3-bromo-4-methoxybenzenecarbonitrile,3-bromo-4-methoxy-benzonitrile,benzonitrile, 3-bromo-4-methoxy,pubchem3795,acmc-1cexj,maybridge4_001971,3-bromo4-methoxybenzonitrile,ksc494m8l PubChem CID: 736049 IUPAC Name: 3-bromo-4-methoxybenzonitrile SMILES: COC1=CC=C(C=C1Br)C#N
| PubChem CID | 736049 |
|---|---|
| CAS | 117572-79-9 |
| Molecular Weight (g/mol) | 212.05 |
| MDL Number | MFCD00143097 |
| SMILES | COC1=CC=C(C=C1Br)C#N |
| Synonym | 2-bromo-4-cyanoanisole,3-bromo-4-methoxylbenzonitrile,3-bromo-4-methoxybenzenecarbonitrile,3-bromo-4-methoxy-benzonitrile,benzonitrile, 3-bromo-4-methoxy,pubchem3795,acmc-1cexj,maybridge4_001971,3-bromo4-methoxybenzonitrile,ksc494m8l |
| IUPAC Name | 3-bromo-4-methoxybenzonitrile |
| InChI Key | QHWZMDRKTYTPEE-UHFFFAOYSA-N |
| Molecular Formula | C8H6BrNO |
Undecafluoropentyl Iodide (stabilized with Copper chip) 98.0+%, TCI America™
CAS: 638-79-9 Molecular Formula: C5F11I Molecular Weight (g/mol): 395.942 MDL Number: MFCD08461629 InChI Key: KCEJJSGJNCSQFI-UHFFFAOYSA-N Synonym: Perfluoropentyl Iodide PubChem CID: 69494 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-iodopentane SMILES: C(C(C(F)(F)F)(F)F)(C(C(F)(F)I)(F)F)(F)F
| PubChem CID | 69494 |
|---|---|
| CAS | 638-79-9 |
| Molecular Weight (g/mol) | 395.942 |
| MDL Number | MFCD08461629 |
| SMILES | C(C(C(F)(F)F)(F)F)(C(C(F)(F)I)(F)F)(F)F |
| Synonym | Perfluoropentyl Iodide |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-iodopentane |
| InChI Key | KCEJJSGJNCSQFI-UHFFFAOYSA-N |
| Molecular Formula | C5F11I |
Sodium 2-Naphthoate 98.0+%, TCI America™
CAS: 17273-79-9 Molecular Formula: C11H7NaO2 Molecular Weight (g/mol): 194.17 MDL Number: MFCD00671570 InChI Key: WUJXROKYJRAVIO-UHFFFAOYSA-M Synonym: 2-Naphthalenecarboxylic Acid Sodium Salt, 2-Naphthoic Acid Sodium Salt PubChem CID: 23685274 IUPAC Name: sodium naphthalene-2-carboxylate SMILES: [Na+].[O-]C(=O)C1=CC2=CC=CC=C2C=C1
| PubChem CID | 23685274 |
|---|---|
| CAS | 17273-79-9 |
| Molecular Weight (g/mol) | 194.17 |
| MDL Number | MFCD00671570 |
| SMILES | [Na+].[O-]C(=O)C1=CC2=CC=CC=C2C=C1 |
| Synonym | 2-Naphthalenecarboxylic Acid Sodium Salt, 2-Naphthoic Acid Sodium Salt |
| IUPAC Name | sodium naphthalene-2-carboxylate |
| InChI Key | WUJXROKYJRAVIO-UHFFFAOYSA-M |
| Molecular Formula | C11H7NaO2 |