Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Bis(dibenzylideneacetone)palladium
CAS: 32005-36-0 Molecular Formula: C34H28O2Pd Molecular Weight (g/mol): 575.02 MDL Number: MFCD00051942 InChI Key: UKSZBOKPHAQOMP-SVLSSHOZSA-N Synonym: bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 PubChem CID: 6505921 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1
| PubChem CID | 6505921 |
|---|---|
| CAS | 32005-36-0 |
| Molecular Weight (g/mol) | 575.02 |
| MDL Number | MFCD00051942 |
| SMILES | [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 |
| Synonym | bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| Molecular Formula | C34H28O2Pd |
Palladium(II) trifluoroacetate, 97%
CAS: 42196-31-6 Molecular Formula: C4F6O4Pd Molecular Weight (g/mol): 332.45 MDL Number: MFCD00013204 InChI Key: PBDBXAQKXCXZCJ-UHFFFAOYSA-L Synonym: palladium ii trifluoroacetate,palladium ii 2,2,2-trifluoroacetate,palladium 2+ ion ditrifluoroacetate,palladium trifluoroacetate,palladium 2+ ditrifluoroacetate,trifluoroacetic acid palladium ii salt,bis 2,2,2-trifluoroacetoxy palladium,acmc-209jo7,ksc235m3d PubChem CID: 2733347 IUPAC Name: palladium(2+);2,2,2-trifluoroacetate SMILES: [Pd++].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F
| PubChem CID | 2733347 |
|---|---|
| CAS | 42196-31-6 |
| Molecular Weight (g/mol) | 332.45 |
| MDL Number | MFCD00013204 |
| SMILES | [Pd++].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F |
| Synonym | palladium ii trifluoroacetate,palladium ii 2,2,2-trifluoroacetate,palladium 2+ ion ditrifluoroacetate,palladium trifluoroacetate,palladium 2+ ditrifluoroacetate,trifluoroacetic acid palladium ii salt,bis 2,2,2-trifluoroacetoxy palladium,acmc-209jo7,ksc235m3d |
| IUPAC Name | palladium(2+);2,2,2-trifluoroacetate |
| InChI Key | PBDBXAQKXCXZCJ-UHFFFAOYSA-L |
| Molecular Formula | C4F6O4Pd |
Bis(dibenzylideneacetone)palladium(0)
CAS: 32005-36-0 Molecular Formula: C34H28O2Pd Molecular Weight (g/mol): 575.02 MDL Number: MFCD00051942 InChI Key: UKSZBOKPHAQOMP-SVLSSHOZSA-N Synonym: bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 PubChem CID: 6505921 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1
| PubChem CID | 6505921 |
|---|---|
| CAS | 32005-36-0 |
| Molecular Weight (g/mol) | 575.02 |
| MDL Number | MFCD00051942 |
| SMILES | [Pd].O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1.O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 |
| Synonym | bis dibenzylideneacetone palladium,bis dibenzylideneacetone palladium 0,pd dba 2,1e,4e-1,5-diphenylpenta-1,4-dien-3-one; palladium,bis dibenzyldeneacetone palladium 0,tris dibenzylideneacetone dipalladium o,palladium 0 bis dibenzylideneacetone,pubchem14428 |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| Molecular Formula | C34H28O2Pd |
Tetrakis(triphenylphosphine)palladium(0), 99%
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Dichlorobis(tricyclohexylphosphine)palladium(II), 98%
CAS: 29934-17-6 Molecular Formula: C36H66Cl2P2Pd Molecular Weight (g/mol): 738.19 MDL Number: MFCD00191830 InChI Key: VUYVXCJTTQJVKJ-UHFFFAOYSA-L Synonym: dichlorobis tricyclohexylphosphine palladium ii,bis tricyclohexylphosphine palladium ii dichloride,dichlorobis tricyclohexylphosphine palladium,bis tricyclohexylphosphine-palladium ii dichloride,bis tricyclohexylphosphine palladium ii-dichloride,bis tricyclo-hexylphosphine palladium ii dichloride,bis tricyclohexylphosphine palladium ii chloride PubChem CID: 11050900 SMILES: Cl[Pd]Cl.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| PubChem CID | 11050900 |
|---|---|
| CAS | 29934-17-6 |
| Molecular Weight (g/mol) | 738.19 |
| MDL Number | MFCD00191830 |
| SMILES | Cl[Pd]Cl.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| Synonym | dichlorobis tricyclohexylphosphine palladium ii,bis tricyclohexylphosphine palladium ii dichloride,dichlorobis tricyclohexylphosphine palladium,bis tricyclohexylphosphine-palladium ii dichloride,bis tricyclohexylphosphine palladium ii-dichloride,bis tricyclo-hexylphosphine palladium ii dichloride,bis tricyclohexylphosphine palladium ii chloride |
| InChI Key | VUYVXCJTTQJVKJ-UHFFFAOYSA-L |
| Molecular Formula | C36H66Cl2P2Pd |
Dichlorobis(tricyclohexylphosphine)palladium(II)
CAS: 29934-17-6 Molecular Formula: C36H66Cl2P2Pd Molecular Weight (g/mol): 738.19 MDL Number: MFCD00191830 InChI Key: VUYVXCJTTQJVKJ-UHFFFAOYSA-L Synonym: dichlorobis tricyclohexylphosphine palladium ii,bis tricyclohexylphosphine palladium ii dichloride,dichlorobis tricyclohexylphosphine palladium,bis tricyclohexylphosphine-palladium ii dichloride,bis tricyclohexylphosphine palladium ii-dichloride,bis tricyclo-hexylphosphine palladium ii dichloride,bis tricyclohexylphosphine palladium ii chloride PubChem CID: 11050900 IUPAC Name: dichloropalladium;tricyclohexylphosphane SMILES: Cl[Pd]Cl.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| PubChem CID | 11050900 |
|---|---|
| CAS | 29934-17-6 |
| Molecular Weight (g/mol) | 738.19 |
| MDL Number | MFCD00191830 |
| SMILES | Cl[Pd]Cl.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| Synonym | dichlorobis tricyclohexylphosphine palladium ii,bis tricyclohexylphosphine palladium ii dichloride,dichlorobis tricyclohexylphosphine palladium,bis tricyclohexylphosphine-palladium ii dichloride,bis tricyclohexylphosphine palladium ii-dichloride,bis tricyclo-hexylphosphine palladium ii dichloride,bis tricyclohexylphosphine palladium ii chloride |
| IUPAC Name | dichloropalladium;tricyclohexylphosphane |
| InChI Key | VUYVXCJTTQJVKJ-UHFFFAOYSA-L |
| Molecular Formula | C36H66Cl2P2Pd |
Bis(benzonitrile)palladium(II) chloride, 97+%
CAS: 14220-64-5 Molecular Formula: C14H10Cl2N2Pd Molecular Weight (g/mol): 383.57 MDL Number: MFCD00013123 InChI Key: QQPSWGUJSPTOSH-UHFFFAOYSA-L Synonym: bis benzonitrile palladium chloride,bis benzonitrile palladium ii chloride,trans-bis benzonitrile palladium ii chloride,bis benzonitrile palladium ii chloride, 500mg,palladium 2+ bis benzonitrile dichloride PubChem CID: 10271322 IUPAC Name: benzonitrile;palladium(2+);dichloride SMILES: Cl[Pd++](Cl)([N]#CC1=CC=CC=C1)[N]#CC1=CC=CC=C1
| PubChem CID | 10271322 |
|---|---|
| CAS | 14220-64-5 |
| Molecular Weight (g/mol) | 383.57 |
| MDL Number | MFCD00013123 |
| SMILES | Cl[Pd++](Cl)([N]#CC1=CC=CC=C1)[N]#CC1=CC=CC=C1 |
| Synonym | bis benzonitrile palladium chloride,bis benzonitrile palladium ii chloride,trans-bis benzonitrile palladium ii chloride,bis benzonitrile palladium ii chloride, 500mg,palladium 2+ bis benzonitrile dichloride |
| IUPAC Name | benzonitrile;palladium(2+);dichloride |
| InChI Key | QQPSWGUJSPTOSH-UHFFFAOYSA-L |
| Molecular Formula | C14H10Cl2N2Pd |
Bis(tricyclohexylphosphine)palladium(0), 97% min
CAS: 33309-88-5 Molecular Formula: C36H66P2Pd Molecular Weight (g/mol): 667.29 MDL Number: MFCD01073796 InChI Key: JGBZTJWQMWZVNX-UHFFFAOYSA-N Synonym: bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o PubChem CID: 2734559 IUPAC Name: palladium;tricyclohexylphosphane SMILES: [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| PubChem CID | 2734559 |
|---|---|
| CAS | 33309-88-5 |
| Molecular Weight (g/mol) | 667.29 |
| MDL Number | MFCD01073796 |
| SMILES | [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| Synonym | bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o |
| IUPAC Name | palladium;tricyclohexylphosphane |
| InChI Key | JGBZTJWQMWZVNX-UHFFFAOYSA-N |
| Molecular Formula | C36H66P2Pd |
Bis(triphenylphosphine)palladium(II) chloride, 98%
CAS: 13965-03-2 Molecular Formula: C36H30Cl2P2Pd Molecular Weight (g/mol): 701.90 MDL Number: MFCD00009593 InChI Key: YNHIGQDRGKUECZ-UHFFFAOYSA-L Synonym: bis triphenylphosphine palladium ii dichloride,bis triphenylphosphine palladium ii chloride,dichlorobis triphenylphosphine palladium,bis triphenylphosphine palladium chloride,bis triphenylphosphine palladiuml ii dichloride,palladium 2+ ; triphenylphosphane; dichloride,trans-dichlorobis triphenylphosphine palladium ii 1g PubChem CID: 131664180 IUPAC Name: ethane;methane;palladium(2+);triphenylphosphane;dichloride SMILES: [Cl-].[Cl-].[Pd++].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 131664180 |
|---|---|
| CAS | 13965-03-2 |
| Molecular Weight (g/mol) | 701.90 |
| MDL Number | MFCD00009593 |
| SMILES | [Cl-].[Cl-].[Pd++].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | bis triphenylphosphine palladium ii dichloride,bis triphenylphosphine palladium ii chloride,dichlorobis triphenylphosphine palladium,bis triphenylphosphine palladium chloride,bis triphenylphosphine palladiuml ii dichloride,palladium 2+ ; triphenylphosphane; dichloride,trans-dichlorobis triphenylphosphine palladium ii 1g |
| IUPAC Name | ethane;methane;palladium(2+);triphenylphosphane;dichloride |
| InChI Key | YNHIGQDRGKUECZ-UHFFFAOYSA-L |
| Molecular Formula | C36H30Cl2P2Pd |
Bis(tri-tert-butylphosphine)palladium(0)
CAS: 53199-31-8 Molecular Formula: C24H54P2Pd Molecular Weight (g/mol): 511.06 MDL Number: MFCD03094580 InChI Key: MXQOYLRVSVOCQT-UHFFFAOYSA-N Synonym: bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 PubChem CID: 2734558 IUPAC Name: palladium;tritert-butylphosphane SMILES: [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C
| PubChem CID | 2734558 |
|---|---|
| CAS | 53199-31-8 |
| Molecular Weight (g/mol) | 511.06 |
| MDL Number | MFCD03094580 |
| SMILES | [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| Synonym | bis tri-tert-butylphosphine palladium 0,bis tri-t-butylphosphine palladium 0,bis tri-tert-butylphosphine palladium,bis tri-tert-butylphosphane palladium,palladium; tritert-butylphosphane,palladium, bis tris 1,1-dimethylethyl phosphine,pd p tbu 3 2,pd t-bu3p 2,bis tri-t-butylphosphine palladium,di tri-tert-butylphosphine palladium 0 |
| IUPAC Name | palladium;tritert-butylphosphane |
| InChI Key | MXQOYLRVSVOCQT-UHFFFAOYSA-N |
| Molecular Formula | C24H54P2Pd |
Dichloro(ethylenediamine)palladium(II), Pd 44.8%
CAS: 15020-99-2 Molecular Formula: C2H8Cl2N2Pd Molecular Weight (g/mol): 237.42 MDL Number: MFCD00044991 InChI Key: CAYKJANQVKIYPJ-UHFFFAOYSA-L Synonym: dichloro 1,2-diaminoethane palladium,dichloro ethylenediamine palladium ii,dichloro 1,2-diaminoethane ;palladium,dichloro ethylenediamine palladate ii,ethylenediamine palladium ii chloride,ethylenediamine; palladium chloride,palladium ii chloride ethylenediamine complex,dichloro ethylenediamine palladium ii , pd PubChem CID: 11139157 SMILES: Cl[Pd]Cl.NCCN
| PubChem CID | 11139157 |
|---|---|
| CAS | 15020-99-2 |
| Molecular Weight (g/mol) | 237.42 |
| MDL Number | MFCD00044991 |
| SMILES | Cl[Pd]Cl.NCCN |
| Synonym | dichloro 1,2-diaminoethane palladium,dichloro ethylenediamine palladium ii,dichloro 1,2-diaminoethane ;palladium,dichloro ethylenediamine palladate ii,ethylenediamine palladium ii chloride,ethylenediamine; palladium chloride,palladium ii chloride ethylenediamine complex,dichloro ethylenediamine palladium ii , pd |
| InChI Key | CAYKJANQVKIYPJ-UHFFFAOYSA-L |
| Molecular Formula | C2H8Cl2N2Pd |
Bis(acetonitrile)palladium(II) chloride, 99%
CAS: 14592-56-4 Molecular Formula: C4H6Cl2N2Pd Molecular Weight (g/mol): 259.42 MDL Number: MFCD00013122 InChI Key: XGPJSRXOBCGBMN-UHFFFAOYSA-L IUPAC Name: palladium(2+) bis(acetonitrile) dichloride SMILES: CC#N.CC#N.Cl[Pd++]Cl
| CAS | 14592-56-4 |
|---|---|
| Molecular Weight (g/mol) | 259.42 |
| MDL Number | MFCD00013122 |
| SMILES | CC#N.CC#N.Cl[Pd++]Cl |
| IUPAC Name | palladium(2+) bis(acetonitrile) dichloride |
| InChI Key | XGPJSRXOBCGBMN-UHFFFAOYSA-L |
| Molecular Formula | C4H6Cl2N2Pd |
Bis(triphenylphosphine)palladium(II) diacetate, 99%
CAS: 14588-08-0 Molecular Formula: C40H36O4P2Pd Molecular Weight (g/mol): 749.09 MDL Number: MFCD00010013 InChI Key: YOUIUHDWQIUKAO-UHFFFAOYSA-L Synonym: bis triphenylphosphinepalladium acetate PubChem CID: 73357379 IUPAC Name: palladium(2+);triphenylphosphanium;diacetate SMILES: CC(=O)O[Pd++]OC(C)=O.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 73357379 |
|---|---|
| CAS | 14588-08-0 |
| Molecular Weight (g/mol) | 749.09 |
| MDL Number | MFCD00010013 |
| SMILES | CC(=O)O[Pd++]OC(C)=O.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | bis triphenylphosphinepalladium acetate |
| IUPAC Name | palladium(2+);triphenylphosphanium;diacetate |
| InChI Key | YOUIUHDWQIUKAO-UHFFFAOYSA-L |
| Molecular Formula | C40H36O4P2Pd |
Tetrakis(acetonitrile)palladium(II) tetrafluoroborate, Pd 23.5%
CAS: 21797-13-7 Molecular Formula: C8H12B2F8N4Pd Molecular Weight (g/mol): 444.24 MDL Number: MFCD00043297 InChI Key: YWMRPVUMBTVUEX-UHFFFAOYSA-N Synonym: tetrakis acetonitrile palladium ii tetrafluoroborate,acetonitrile; palladium 2+ ; ditetrafluoroborate,pd mecn 4 bf4 2,tetrakis acetonitrile palladium ii,palladium ii tetrafluoroborate tetraacetonitrile complex PubChem CID: 2734560 SMILES: [Pd++].CC#N.CC#N.CC#N.CC#N.F[B-](F)(F)F.F[B-](F)(F)F
| PubChem CID | 2734560 |
|---|---|
| CAS | 21797-13-7 |
| Molecular Weight (g/mol) | 444.24 |
| MDL Number | MFCD00043297 |
| SMILES | [Pd++].CC#N.CC#N.CC#N.CC#N.F[B-](F)(F)F.F[B-](F)(F)F |
| Synonym | tetrakis acetonitrile palladium ii tetrafluoroborate,acetonitrile; palladium 2+ ; ditetrafluoroborate,pd mecn 4 bf4 2,tetrakis acetonitrile palladium ii,palladium ii tetrafluoroborate tetraacetonitrile complex |
| InChI Key | YWMRPVUMBTVUEX-UHFFFAOYSA-N |
| Molecular Formula | C8H12B2F8N4Pd |
Bis(tricyclohexylphosphine)palladium(0), 98%
CAS: 33309-88-5 Molecular Formula: C36H66P2Pd Molecular Weight (g/mol): 667.29 MDL Number: MFCD01073796 InChI Key: JGBZTJWQMWZVNX-UHFFFAOYSA-N Synonym: bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o PubChem CID: 2734559 IUPAC Name: palladium;tricyclohexylphosphane SMILES: [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1
| PubChem CID | 2734559 |
|---|---|
| CAS | 33309-88-5 |
| Molecular Weight (g/mol) | 667.29 |
| MDL Number | MFCD01073796 |
| SMILES | [Pd].C1CCC(CC1)P(C1CCCCC1)C1CCCCC1.C1CCC(CC1)P(C1CCCCC1)C1CCCCC1 |
| Synonym | bis tricyclohexylphosphine palladium 0,bis tricyclohexylphosphine palladium o,bis tricyclohexylphosphine palladium,palladium, bis tricyclohexylphosphine,pd pcy3 2,palladium; tricyclohexylphosphane,palladium-tricyclohexylphosphine 1:2,bis tricyclohexylphosphine-palladium o |
| IUPAC Name | palladium;tricyclohexylphosphane |
| InChI Key | JGBZTJWQMWZVNX-UHFFFAOYSA-N |
| Molecular Formula | C36H66P2Pd |