Organometallic Compounds
eMolecules 252881-74-6 | NH2-PEG3-C2-Boc | Ambeed | MFCD06201017 | 277.361 | C13H27NO5 | 97.000 | CC(C)(C)OC(=O)CCOCCOCCOCCN | 25g | 562293042
NH2-PEG3-C2-Boc | Ambeed | 252881-74-6 | MFCD06201017 | 277.361 | C13H27NO5 | 97.000 | CC(C)(C)OC(=O)CCOCCOCCOCCN | 25g | 562293042
Sigma Aldrich Fine Chemicals Biosciences Chlorophyllin sodium copper salt commercial grade | 11006-34-1 | 25G
Chlorophyllin sodium copper salt commercial grade | Mol Wt: 724.15 | 11006-34-1 | 25G
![eMolecules 128008-30-0 | Indium(III) trifluoromethanesulfonate | Ambeed | MFCD00144478 | 562.010 | C3F9InO9S3 | 98.000 | [In+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F | 25g | 524999264](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000164524.jpg-250.jpg)
eMolecules 128008-30-0 | Indium(III) trifluoromethanesulfonate | Ambeed | MFCD00144478 | 562.010 | C3F9InO9S3 | 98.000 | [In+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F | 25g | 524999264
Indium(III) trifluoromethanesulfonate | Ambeed | 128008-30-0 | MFCD00144478 | 562.010 | C3F9InO9S3 | 98.000 | [In+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F | 25g | 524999264
![eMolecules 286-22-6 | 3,7-Dioxabicyclo[4.1.0]heptane | Combi-Blocks | MFCD11226853 | 100.117 | C5H8O2 | 97.000 | C1CC2OC2CO1 | 1g | 290699003](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000224708.jpg-250.jpg)
eMolecules 286-22-6 | 3,7-Dioxabicyclo[4.1.0]heptane | Combi-Blocks | MFCD11226853 | 100.117 | C5H8O2 | 97.000 | C1CC2OC2CO1 | 1g | 290699003
3,7-Dioxabicyclo[4.1.0]heptane | Combi-Blocks | 286-22-6 | MFCD11226853 | 100.117 | C5H8O2 | 97.000 | C1CC2OC2CO1 | 1g | 290699003
Apexbio Technology LLC OSI-930 728033-96-3 5mg
OSI-930 (CAS 728033-96-3) is a small molecule inhibitor targeting multiple receptor tyrosine kinases including Flt1 (IC 8 nM) KDR/VEGFR2 (IC 9 nM) CSF-1R (IC 15 nM) Lck c-Raf and Kit (IC 80 nM) In cellular studies OSI-930 inhibits proliferation and induces apoptosis in HMC-1 cells whose survival is dependent on Kit signaling while exhibiting minimal effects on COLO-205 cells under standard conditions Additionally OSI-930 inactivates cytochrome P450 3A4 in a time- and concentration-dependent manner and alters its spectral properties These characteristics make OSI-930 a valuable tool compound for investigating receptor tyrosine kinase signaling pathways and related cellular processes in cancer research
Medchemexpress LLC Trimethylamine-d9 hydrochloride | 18856-86-5 | 99.7% | 104.63 | C3HD9ClN | 10mg
Trimethylammonium chloride-d9 is the deuterium labeled Trimethylammonium chloride[1] Trimethylammonium chloride is an endogenous metabolite
eMolecules Thalidomide-O-PEG6-NHS ester | Broadpharm |707.686 | C32H41N3O15 | 98.000 | O=C(CCOCCOCCOCCOCCOCCOCCOc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12)ON1C(=O)CCC1=O | 100mg | 591908376
Thalidomide-O-PEG6-NHS ester | Broadpharm |707.686 | C32H41N3O15 | 98.000 | O=C(CCOCCOCCOCCOCCOCCOCCOc1cccc2C(=O)N(C3CCC(=O)NC3=O)C(=O)c12)ON1C(=O)CCC1=O | 100mg | 591908376
Selleck Chemical LLC CHC-A2844-1MG-25
CHC is a human monoclonal antibody against clathrin heavy chain (CHC) with potential anti-angiogenesis and anti-tumor activity MW 145 62 KD
![eMolecules 102229-10-7 | 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethanol | AA Blocks LLC | MFCD09261150 | 176.331 | C8H20O2Si | 0.000 | CC(C)(C)[Si](C)(C)OCCO | 10g | 585959289](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000472452.jpg-250.jpg)
eMolecules 102229-10-7 | 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethanol | AA Blocks LLC | MFCD09261150 | 176.331 | C8H20O2Si | 0.000 | CC(C)(C)[Si](C)(C)OCCO | 10g | 585959289
2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethanol | AA Blocks LLC | 102229-10-7 | MFCD09261150 | 176.331 | C8H20O2Si | 0.000 | CC(C)(C)[Si](C)(C)OCCO | 10g | 585959289
Medchemexpress LLC Trimethylamine hydrochloride | 593-81-7 | MFCD00012478 | 98.0% | 95.57 g/mol | C3H10ClN | 100g
Trimethylammonium chlorideIt is an endogenous metabolite that inhibits deacetylation Trimethylammonium chlorideIs a non-competitive inhibitor of acetylcholinesterase[1][2]