Organometallic Compounds
Filtered Search Results
Bis(trimethylsilyl) malonate, 98%
CAS: 18457-04-0 Molecular Formula: C9H20O4Si2 Molecular Weight (g/mol): 248.43 MDL Number: MFCD00009631 InChI Key: ATCKJLDGNXGLAO-UHFFFAOYSA-N Synonym: bis trimethylsilyl malonate,malonic acid bis trimethylsilyl ester,propanedioic acid, bis trimethylsilyl ester,malonic acid, bis trimethylsilyl ester,malonic acid ditms,malonic acid 2tms,malonic acid, bis-tms,bis trimethylsilyl malonat,malonic acid bis-tms,acmc-1c3vy PubChem CID: 87656 IUPAC Name: bis(trimethylsilyl) propanedioate SMILES: C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C
| PubChem CID | 87656 |
|---|---|
| CAS | 18457-04-0 |
| Molecular Weight (g/mol) | 248.43 |
| MDL Number | MFCD00009631 |
| SMILES | C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C |
| Synonym | bis trimethylsilyl malonate,malonic acid bis trimethylsilyl ester,propanedioic acid, bis trimethylsilyl ester,malonic acid, bis trimethylsilyl ester,malonic acid ditms,malonic acid 2tms,malonic acid, bis-tms,bis trimethylsilyl malonat,malonic acid bis-tms,acmc-1c3vy |
| IUPAC Name | bis(trimethylsilyl) propanedioate |
| InChI Key | ATCKJLDGNXGLAO-UHFFFAOYSA-N |
| Molecular Formula | C9H20O4Si2 |
Triphenyltin chloride, 95%
CAS: 639-58-7 Molecular Formula: C18H17ClSn Molecular Weight (g/mol): 387.49 MDL Number: MFCD00000519 InChI Key: ZDYYCRIXXMWWQC-UHFFFAOYSA-N Synonym: triphenyltin chloride,fentin chloride,chlorotriphenyltin,triphenylchlorotin,stannane, chlorotriphenyl,brestanol,tptc,triphenylchlorostannane,aquatin,tinmate PubChem CID: 12540 ChEBI: CHEBI:35036 IUPAC Name: chloro(triphenyl)stannane SMILES: Cl.C1=CC=C(C=C1)[SnH](C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 12540 |
|---|---|
| CAS | 639-58-7 |
| Molecular Weight (g/mol) | 387.49 |
| ChEBI | CHEBI:35036 |
| MDL Number | MFCD00000519 |
| SMILES | Cl.C1=CC=C(C=C1)[SnH](C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenyltin chloride,fentin chloride,chlorotriphenyltin,triphenylchlorotin,stannane, chlorotriphenyl,brestanol,tptc,triphenylchlorostannane,aquatin,tinmate |
| IUPAC Name | chloro(triphenyl)stannane |
| InChI Key | ZDYYCRIXXMWWQC-UHFFFAOYSA-N |
| Molecular Formula | C18H17ClSn |
Chlorotriethylsilane 97.0+%, TCI America™
CAS: 994-30-9 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.72 MDL Number: MFCD00000507 InChI Key: DCFKHNIGBAHNSS-UHFFFAOYSA-N Synonym: triethylchlorosilane,silane, chlorotriethyl,triethylsilyl chloride,chloro triethyl silane,unii-q1a687m1py,triethyl silyl chloride,triethychlorosilane,chlorotrietylsilane,clsiet3,et3sicl PubChem CID: 13819 IUPAC Name: chlorotriethylsilane SMILES: CC[Si](Cl)(CC)CC
| PubChem CID | 13819 |
|---|---|
| CAS | 994-30-9 |
| Molecular Weight (g/mol) | 150.72 |
| MDL Number | MFCD00000507 |
| SMILES | CC[Si](Cl)(CC)CC |
| Synonym | triethylchlorosilane,silane, chlorotriethyl,triethylsilyl chloride,chloro triethyl silane,unii-q1a687m1py,triethyl silyl chloride,triethychlorosilane,chlorotrietylsilane,clsiet3,et3sicl |
| IUPAC Name | chlorotriethylsilane |
| InChI Key | DCFKHNIGBAHNSS-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
[3-(Diethylamino)propyl]trimethoxysilane 97.0+%, TCI America™
CAS: 41051-80-3 Molecular Formula: C10H25NO3Si Molecular Weight (g/mol): 235.40 MDL Number: MFCD00039882 InChI Key: ZLDHYRXZZNDOKU-UHFFFAOYSA-N Synonym: N,N-Diethyl-3-(trimethoxysilyl)propylamine PubChem CID: 170458 IUPAC Name: diethyl[3-(trimethoxysilyl)propyl]amine SMILES: CCN(CC)CCC[Si](OC)(OC)OC
| PubChem CID | 170458 |
|---|---|
| CAS | 41051-80-3 |
| Molecular Weight (g/mol) | 235.40 |
| MDL Number | MFCD00039882 |
| SMILES | CCN(CC)CCC[Si](OC)(OC)OC |
| Synonym | N,N-Diethyl-3-(trimethoxysilyl)propylamine |
| IUPAC Name | diethyl[3-(trimethoxysilyl)propyl]amine |
| InChI Key | ZLDHYRXZZNDOKU-UHFFFAOYSA-N |
| Molecular Formula | C10H25NO3Si |
Ethyltrimethoxysilane 97.0+%, TCI America™
CAS: 5314-55-6 Molecular Formula: C5H14O3Si Molecular Weight (g/mol): 150.249 MDL Number: MFCD00051541 InChI Key: SBRXLTRZCJVAPH-UHFFFAOYSA-N Synonym: silane, ethyltrimethoxy,ethyl trimethoxy silane,trimethoxyethylsilane,silane,ethyltrimethoxy,acmc-209l4b,ethyltrimethoxysilane,dow corning™ product 1-6321 PubChem CID: 79204 IUPAC Name: ethyl(trimethoxy)silane SMILES: CC[Si](OC)(OC)OC
| PubChem CID | 79204 |
|---|---|
| CAS | 5314-55-6 |
| Molecular Weight (g/mol) | 150.249 |
| MDL Number | MFCD00051541 |
| SMILES | CC[Si](OC)(OC)OC |
| Synonym | silane, ethyltrimethoxy,ethyl trimethoxy silane,trimethoxyethylsilane,silane,ethyltrimethoxy,acmc-209l4b,ethyltrimethoxysilane,dow corning™ product 1-6321 |
| IUPAC Name | ethyl(trimethoxy)silane |
| InChI Key | SBRXLTRZCJVAPH-UHFFFAOYSA-N |
| Molecular Formula | C5H14O3Si |
Trimethoxy(propyl)silane 98.0+%, TCI America™
CAS: 1067-25-0 Molecular Formula: C6H16O3Si Molecular Weight (g/mol): 164.28 MDL Number: MFCD00043026 InChI Key: HQYALQRYBUJWDH-UHFFFAOYSA-N Synonym: trimethoxy propyl silane,n-propyltrimethoxysilane,propyltrimethoxysilane,silane, trimethoxypropyl,unii-t72c7n9xo2,dynasylan ptmo,trimethoxysilylpropane,propyl-trimethoxysilane,silane,trimethoxypropyl,trimethoxy-n-propylsilane PubChem CID: 61254 IUPAC Name: trimethoxy(propyl)silane SMILES: CCC[Si](OC)(OC)OC
| PubChem CID | 61254 |
|---|---|
| CAS | 1067-25-0 |
| Molecular Weight (g/mol) | 164.28 |
| MDL Number | MFCD00043026 |
| SMILES | CCC[Si](OC)(OC)OC |
| Synonym | trimethoxy propyl silane,n-propyltrimethoxysilane,propyltrimethoxysilane,silane, trimethoxypropyl,unii-t72c7n9xo2,dynasylan ptmo,trimethoxysilylpropane,propyl-trimethoxysilane,silane,trimethoxypropyl,trimethoxy-n-propylsilane |
| IUPAC Name | trimethoxy(propyl)silane |
| InChI Key | HQYALQRYBUJWDH-UHFFFAOYSA-N |
| Molecular Formula | C6H16O3Si |
Trimethoxy-n-octylsilane 96.0+%, TCI America™
CAS: 3069-40-7 Molecular Formula: C11H26O3Si Molecular Weight (g/mol): 234.41 MDL Number: MFCD00043053 InChI Key: NMEPHPOFYLLFTK-UHFFFAOYSA-N Synonym: trimethoxy octyl silane,n-octyltrimethoxysilane,octyltrimethoxysilane,silane, trimethoxyoctyl,unii-fz07e4lw2m,octyl-trimethoxysilane,fz07e4lw2m,trimethoxycaprylylsilane,trimethoxy-octylsilane,trimethoxy-n-octylsilane PubChem CID: 76485 IUPAC Name: trimethoxy(octyl)silane SMILES: CCCCCCCC[Si](OC)(OC)OC
| PubChem CID | 76485 |
|---|---|
| CAS | 3069-40-7 |
| Molecular Weight (g/mol) | 234.41 |
| MDL Number | MFCD00043053 |
| SMILES | CCCCCCCC[Si](OC)(OC)OC |
| Synonym | trimethoxy octyl silane,n-octyltrimethoxysilane,octyltrimethoxysilane,silane, trimethoxyoctyl,unii-fz07e4lw2m,octyl-trimethoxysilane,fz07e4lw2m,trimethoxycaprylylsilane,trimethoxy-octylsilane,trimethoxy-n-octylsilane |
| IUPAC Name | trimethoxy(octyl)silane |
| InChI Key | NMEPHPOFYLLFTK-UHFFFAOYSA-N |
| Molecular Formula | C11H26O3Si |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Boiling Point | 110.0°C |
|---|---|
| Linear Formula | [(CH3)2CHCH2]2AIH |
| Molecular Weight (g/mol) | 142.22 |
| Physical Form | Solution |
| Chemical Name or Material | Diisobutylaluminium hydride |
| Merck Index | 15, 3212 |
| Density | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00008928 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Solubility Information | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Molecular Formula | C8H19Al |
| EINECS Number | 214-729-9 |
| Formula Weight | 142.22 |
| Specific Gravity | 0.848 |
Tetrabutylammonium difluorotriphenyl stannate, 95%, Thermo Scientific™
CAS: 139353-88-1 Molecular Formula: C34H51F2NSn Molecular Weight (g/mol): 630.48 MDL Number: MFCD00192465 InChI Key: ODMXVCNGZGLSRS-UHFFFAOYSA-L Synonym: tetrabutylammonium difluorotriphenylstannate,tetrabutylammonium difluorotriphenylstannate iv,tetrabutylammonium difluorotriphenyltin,tetrabutylammonium triphenyldifluorotin,tetrabutylammoniumdifluorotriphenylstannate,tetrabutylam-monium triphenyldifluorostannate,tetrabutylammonium difluorotriphenyl stannate,tetra-n-butylammonium difluorotriphenylstannate,difluorotriphenylstannanuide; tetrabutylammonium,difluoro triphenyl stannanuide; tetrabutylammonium PubChem CID: 2733194 IUPAC Name: difluoro(triphenyl)stannanuide;tetrabutylazanium SMILES: CCCC[N+](CCCC)(CCCC)CCCC.C1=CC=C(C=C1)[Sn-](C2=CC=CC=C2)(C3=CC=CC=C3)(F)F
| PubChem CID | 2733194 |
|---|---|
| CAS | 139353-88-1 |
| Molecular Weight (g/mol) | 630.48 |
| MDL Number | MFCD00192465 |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.C1=CC=C(C=C1)[Sn-](C2=CC=CC=C2)(C3=CC=CC=C3)(F)F |
| Synonym | tetrabutylammonium difluorotriphenylstannate,tetrabutylammonium difluorotriphenylstannate iv,tetrabutylammonium difluorotriphenyltin,tetrabutylammonium triphenyldifluorotin,tetrabutylammoniumdifluorotriphenylstannate,tetrabutylam-monium triphenyldifluorostannate,tetrabutylammonium difluorotriphenyl stannate,tetra-n-butylammonium difluorotriphenylstannate,difluorotriphenylstannanuide; tetrabutylammonium,difluoro triphenyl stannanuide; tetrabutylammonium |
| IUPAC Name | difluoro(triphenyl)stannanuide;tetrabutylazanium |
| InChI Key | ODMXVCNGZGLSRS-UHFFFAOYSA-L |
| Molecular Formula | C34H51F2NSn |
2-(Tri-n-butylstannyl)furan, 97%
CAS: 118486-94-5 Molecular Formula: C16H30OSn Molecular Weight (g/mol): 357.125 MDL Number: MFCD00192512 InChI Key: SANWDQJIWZEKOD-UHFFFAOYSA-N Synonym: 2-tributylstannyl furan,tributyl furan-2-yl stannane,2-tributylstannylfuran,tributyl 2-furyl tin,tributyl 2-furyl stannane,2-tri-n-butylstannyl furan,stannane,tributyl-2-furanyl,stannane, tributyl-2-furanyl,2-furyltributyltin,tributylstannylfuran PubChem CID: 4393688 IUPAC Name: tributyl(furan-2-yl)stannane SMILES: CCCC[Sn](CCCC)(CCCC)C1=CC=CO1
| PubChem CID | 4393688 |
|---|---|
| CAS | 118486-94-5 |
| Molecular Weight (g/mol) | 357.125 |
| MDL Number | MFCD00192512 |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC=CO1 |
| Synonym | 2-tributylstannyl furan,tributyl furan-2-yl stannane,2-tributylstannylfuran,tributyl 2-furyl tin,tributyl 2-furyl stannane,2-tri-n-butylstannyl furan,stannane,tributyl-2-furanyl,stannane, tributyl-2-furanyl,2-furyltributyltin,tributylstannylfuran |
| IUPAC Name | tributyl(furan-2-yl)stannane |
| InChI Key | SANWDQJIWZEKOD-UHFFFAOYSA-N |
| Molecular Formula | C16H30OSn |
Ethylaluminium dichloride, 0.9M solution in heptane, AcroSeal™
CAS: 563-43-9 Molecular Formula: C2H5AlCl2 Molecular Weight (g/mol): 126.94 MDL Number: MFCD00000457 InChI Key: UAIZDWNSWGTKFZ-UHFFFAOYSA-L Synonym: ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum IUPAC Name: dichloro(ethyl)alumane SMILES: CC[Al](Cl)Cl
| CAS | 563-43-9 |
|---|---|
| Molecular Weight (g/mol) | 126.94 |
| MDL Number | MFCD00000457 |
| SMILES | CC[Al](Cl)Cl |
| Synonym | ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum |
| IUPAC Name | dichloro(ethyl)alumane |
| InChI Key | UAIZDWNSWGTKFZ-UHFFFAOYSA-L |
| Molecular Formula | C2H5AlCl2 |
Tri-n-butyltin chloride, 96%
CAS: 1461-22-9 Molecular Formula: C12H27ClSn Molecular Weight (g/mol): 325.508 MDL Number: MFCD00000521 InChI Key: GCTFWCDSFPMHHS-UHFFFAOYSA-M Synonym: tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride PubChem CID: 15096 ChEBI: CHEBI:79734 IUPAC Name: tributyl(chloro)stannane SMILES: CCCC[Sn](CCCC)(CCCC)Cl
| PubChem CID | 15096 |
|---|---|
| CAS | 1461-22-9 |
| Molecular Weight (g/mol) | 325.508 |
| ChEBI | CHEBI:79734 |
| MDL Number | MFCD00000521 |
| SMILES | CCCC[Sn](CCCC)(CCCC)Cl |
| Synonym | tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride |
| IUPAC Name | tributyl(chloro)stannane |
| InChI Key | GCTFWCDSFPMHHS-UHFFFAOYSA-M |
| Molecular Formula | C12H27ClSn |
n-Butyltin trichloride, 96%
CAS: 1118-46-3 Molecular Formula: C4H9Cl3Sn Molecular Weight (g/mol): 282.176 MDL Number: MFCD00000515 InChI Key: YMLFYGFCXGNERH-UHFFFAOYSA-K Synonym: butyltin trichloride,stannane, butyltrichloro,monobutyltin trichloride,butyltrichlorotin,trichlorobutyltin,butyl trichloro stannane,n-butyltin trichloride,trichlorobutylstannane,stannane, trichlorobutyl,monotributyltin trichloride PubChem CID: 14236 IUPAC Name: butyl(trichloro)stannane SMILES: CCCC[Sn](Cl)(Cl)Cl
| PubChem CID | 14236 |
|---|---|
| CAS | 1118-46-3 |
| Molecular Weight (g/mol) | 282.176 |
| MDL Number | MFCD00000515 |
| SMILES | CCCC[Sn](Cl)(Cl)Cl |
| Synonym | butyltin trichloride,stannane, butyltrichloro,monobutyltin trichloride,butyltrichlorotin,trichlorobutyltin,butyl trichloro stannane,n-butyltin trichloride,trichlorobutylstannane,stannane, trichlorobutyl,monotributyltin trichloride |
| IUPAC Name | butyl(trichloro)stannane |
| InChI Key | YMLFYGFCXGNERH-UHFFFAOYSA-K |
| Molecular Formula | C4H9Cl3Sn |
2-(Ethoxycarbonyl)ethylzinc bromide, 0.5M in THF
CAS: 193065-68-8 Molecular Formula: C5H10BrO2Zn- Molecular Weight (g/mol): 247.417 MDL Number: MFCD00671976 InChI Key: APUPJTIEDQLKSC-UHFFFAOYSA-M Synonym: 2-ethoxycarbonyl ethylzinc bromide, 0.5m in thf PubChem CID: 131668631 IUPAC Name: ethyl propanoate;zinc;bromide SMILES: CCC(=O)OCC.[Zn].[Br-]
| PubChem CID | 131668631 |
|---|---|
| CAS | 193065-68-8 |
| Molecular Weight (g/mol) | 247.417 |
| MDL Number | MFCD00671976 |
| SMILES | CCC(=O)OCC.[Zn].[Br-] |
| Synonym | 2-ethoxycarbonyl ethylzinc bromide, 0.5m in thf |
| IUPAC Name | ethyl propanoate;zinc;bromide |
| InChI Key | APUPJTIEDQLKSC-UHFFFAOYSA-M |
| Molecular Formula | C5H10BrO2Zn- |