Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium Chloride, Granular, U.S.P. - F.C.C., J.T. Baker™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 IUPAC Name: sodium chloride SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Sodium Citrate, Dihydrate, Granular, Multi-Compendial, U.S.P., J.T. Baker™
CAS: 4-3-6132 Molecular Formula: C6H9Na3O9 Molecular Weight (g/mol): 294.10 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 4-3-6132 |
| Molecular Weight (g/mol) | 294.10 |
| ChEBI | CHEBI:32142 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H9Na3O9 |
Avantor Macron Ammonium Chloride ACS AR,Crystal, Macron Fine Chemicals™
CAS: 12125-02-9 Molecular Formula: ClH4N Molecular Weight (g/mol): 53.49 MDL Number: MFCD00011420 InChI Key: NLXLAEXVIDQMFP-UHFFFAOYSA-N Synonym: ammonium chloride,salmiac,sal ammoniac,ammonium muriate,ammoniumchlorid,ammoneric,darammon,amchlor,ammonium chloride nh4 cl,ammoniumklorid PubChem CID: 25517 ChEBI: CHEBI:31206 IUPAC Name: amine hydrochloride SMILES: N.Cl
| PubChem CID | 25517 |
|---|---|
| CAS | 12125-02-9 |
| Molecular Weight (g/mol) | 53.49 |
| ChEBI | CHEBI:31206 |
| MDL Number | MFCD00011420 |
| SMILES | N.Cl |
| Synonym | ammonium chloride,salmiac,sal ammoniac,ammonium muriate,ammoniumchlorid,ammoneric,darammon,amchlor,ammonium chloride nh4 cl,ammoniumklorid |
| IUPAC Name | amine hydrochloride |
| InChI Key | NLXLAEXVIDQMFP-UHFFFAOYSA-N |
| Molecular Formula | ClH4N |
Potassium osmate(VI) dihydrate, 51.0-52.0% Os
CAS: 10022-66-9 Molecular Formula: K2O4Os·2H2O Molecular Weight (g/mol): 368.42 MDL Number: MFCD00149919 InChI Key: DGODWNOPHMXOTR-UHFFFAOYSA-N Synonym: potassium osmate vi dihydrate,potassium dioxidodioxoosmium dihydrate,potassium osmate dihydrate,unii-5m2bwq2tyj,5m2bwq2tyj,osmate oso42-, dipotassium, dihydrate, t-4,dipotassium tetrahydroxodioxoosmate,potassium osmate k2oso2 oh 4,potassium osmate k2oso4 , dihydrate PubChem CID: 53393272 IUPAC Name: dipotassium;dioxido(dioxo)osmium;dihydrate SMILES: O.O.[O-][Os](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 53393272 |
|---|---|
| CAS | 10022-66-9 |
| Molecular Weight (g/mol) | 368.42 |
| MDL Number | MFCD00149919 |
| SMILES | O.O.[O-][Os](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium osmate vi dihydrate,potassium dioxidodioxoosmium dihydrate,potassium osmate dihydrate,unii-5m2bwq2tyj,5m2bwq2tyj,osmate oso42-, dipotassium, dihydrate, t-4,dipotassium tetrahydroxodioxoosmate,potassium osmate k2oso2 oh 4,potassium osmate k2oso4 , dihydrate |
| IUPAC Name | dipotassium;dioxido(dioxo)osmium;dihydrate |
| InChI Key | DGODWNOPHMXOTR-UHFFFAOYSA-N |
| Molecular Formula | K2O4Os·2H2O |
Potassium Chloride, Crystal, Multi-Compendial, U.S.P., J.T. Baker™
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Potassium Iodide, Certified, 10.0% (w/v) ±0.4% (w/v), LabChem™
CAS: 7681-11-0 Molecular Formula: IK Molecular Weight (g/mol): 166.003 InChI Key: NLKNQRATVPKPDG-UHFFFAOYSA-M Synonym: potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide PubChem CID: 4875 ChEBI: CHEBI:8346 IUPAC Name: potassium;iodide SMILES: [K+].[I-]
| PubChem CID | 4875 |
|---|---|
| CAS | 7681-11-0 |
| Molecular Weight (g/mol) | 166.003 |
| ChEBI | CHEBI:8346 |
| SMILES | [K+].[I-] |
| Synonym | potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide |
| IUPAC Name | potassium;iodide |
| InChI Key | NLKNQRATVPKPDG-UHFFFAOYSA-M |
| Molecular Formula | IK |
Cupric Sulfate Pentahydrate, ACS Reagent Grade, Ricca Chemical
CAS: 7758-99-8 Molecular Formula: CuH10O9S Molecular Weight (g/mol): 249.68 MDL Number: MFCD00149681 InChI Key: JZCCFEFSEZPSOG-UHFFFAOYSA-L Synonym: copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas PubChem CID: 24463 ChEBI: CHEBI:31440 IUPAC Name: copper(2+) pentahydrate sulfate SMILES: O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O
| PubChem CID | 24463 |
|---|---|
| CAS | 7758-99-8 |
| Molecular Weight (g/mol) | 249.68 |
| ChEBI | CHEBI:31440 |
| MDL Number | MFCD00149681 |
| SMILES | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O |
| Synonym | copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas |
| IUPAC Name | copper(2+) pentahydrate sulfate |
| InChI Key | JZCCFEFSEZPSOG-UHFFFAOYSA-L |
| Molecular Formula | CuH10O9S |
Sodium Hypochlorite Solution, 2.5% (w/w) NaOCl, Ricca Chemical
CAS: 7732-18-5 Molecular Formula: ClNaO Molecular Weight (g/mol): 74.439 InChI Key: SUKJFIGYRHOWBL-UHFFFAOYSA-N Synonym: sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution PubChem CID: 23665760 ChEBI: CHEBI:32146 IUPAC Name: sodium;hypochlorite SMILES: [O-]Cl.[Na+]
| PubChem CID | 23665760 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 74.439 |
| ChEBI | CHEBI:32146 |
| SMILES | [O-]Cl.[Na+] |
| Synonym | sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution |
| IUPAC Name | sodium;hypochlorite |
| InChI Key | SUKJFIGYRHOWBL-UHFFFAOYSA-N |
| Molecular Formula | ClNaO |
Sodium Hypochlorite Solution, 5% available Chlorine, Ricca Chemical
CAS: 7732-18-5 Molecular Weight (g/mol): 74.44 g/mol Synonym: dihydrogen oxide,dihydrogen monoxide
| CAS | 7732-18-5 |
|---|---|
| Molecular Weight (g/mol) | 74.44 g/mol |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
Sodium Chloride, 2% (w/v), Ricca Chemical
CAS: 7732-18-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 IUPAC Name: sodium chloride SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Sodium L-Ascorbate 98.0+%, TCI America™
CAS: 134-03-2 Molecular Formula: C6H7NaO6 Molecular Weight (g/mol): 198.11 MDL Number: MFCD00082340 InChI Key: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC Name: sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
| PubChem CID | 131674100 |
|---|---|
| CAS | 134-03-2 |
| Molecular Weight (g/mol) | 198.11 |
| MDL Number | MFCD00082340 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| IUPAC Name | sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
| InChI Key | IFVCRSPJFHGFCG-HXPAKLQESA-N |
| Molecular Formula | C6H7NaO6 |
Hydrazine Monohydrate 98.0+%, TCI America™
CAS: 7803-57-8 Molecular Formula: H6N2O Molecular Weight (g/mol): 50.06 MDL Number: MFCD00149931 InChI Key: IKDUDTNKRLTJSI-UHFFFAOYSA-N Synonym: hydrazine hydrate,hydrazine monohydrate,hydrazinium hydroxide,hydrazine hydroxide,hydrazine, monohydrate,hydrazine, hydrate,idrazina idrata italian,hydrazinemonohydrate,unii-kyd297831p,ccris 7739 PubChem CID: 24654 ChEBI: CHEBI:35511 IUPAC Name: hydrazine hydrate SMILES: O.NN
| PubChem CID | 24654 |
|---|---|
| CAS | 7803-57-8 |
| Molecular Weight (g/mol) | 50.06 |
| ChEBI | CHEBI:35511 |
| MDL Number | MFCD00149931 |
| SMILES | O.NN |
| Synonym | hydrazine hydrate,hydrazine monohydrate,hydrazinium hydroxide,hydrazine hydroxide,hydrazine, monohydrate,hydrazine, hydrate,idrazina idrata italian,hydrazinemonohydrate,unii-kyd297831p,ccris 7739 |
| IUPAC Name | hydrazine hydrate |
| InChI Key | IKDUDTNKRLTJSI-UHFFFAOYSA-N |
| Molecular Formula | H6N2O |
Ricca Chemical Company Sodium Chloride Standard, 0.90% (w/w), Ricca Chemical
CAS: 7732-18-5 Molecular Formula: H2O Molecular Weight (g/mol): 58.44 g/mol InChI Key: XLYOFNOQVPJJNP-UHFFFAOYSA-N IUPAC Name: water SMILES: O
| CAS | 7732-18-5 |
|---|---|
| Molecular Weight (g/mol) | 58.44 g/mol |
| SMILES | O |
| IUPAC Name | water |
| InChI Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Molecular Formula | H2O |
Sodium Chloride, Non-Sterile, Certified, 0.900% (w/v) ±0.006%, LabChem™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 IUPAC Name: sodium chloride SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
| Linear Formula | AgNO3 |
|---|---|
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Density | 1.0150g/mL |
| PubChem CID | 24470 |
| Name Note | 0.1 N Standard Solution |
| Fieser | 01,1008; 02,366; 03,252; 04,429; 05,582; 07,321; 09,411; 10,350; 11,268; 12,257; 14,350; 15,39 |
| Formula Weight | 169.87 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Silver nitrate |
| Grade | Pure |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Merck Index | 15, 8657 |
| Concentration or Composition (by Analyte or Components) | 0.0998 to 0.1002N (20°C) |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. If skin irritation occurs: Get medical advice/attention. IF IN EYES: Rinse cautiously with wa |
| MDL Number | MFCD00003414 |
| Health Hazard 2 | GHS H Statement May be corrosive to metals. Causes skin irritation. Causes serious eye irritation. Very toxic to aquatic life with long lasting effects. |
| Packaging | HDPE Bottle |
| Solubility Information | Solubility in water: miscible. |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| Molecular Formula | AgNO3 |
| EINECS Number | 231-853-9 |
| Specific Gravity | 1.015 |