Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Silicon carbide powder, coarse, 46 grit
CAS: 409-21-2 Molecular Formula: CSi Molecular Weight (g/mol): 40.10 MDL Number: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
| PubChem CID | 9863 |
|---|---|
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| MDL Number | MFCD00049531 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
| Molecular Formula | CSi |
Triethylsilane, 98+%
CAS: 617-86-7 Molecular Formula: C6H15Si Molecular Weight (g/mol): 115.271 MDL Number: MFCD00009018 InChI Key: QXTIBZLKQPJVII-UHFFFAOYSA-N Synonym: triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes PubChem CID: 6327258 IUPAC Name: triethylsilicon SMILES: CC[Si](CC)CC
| PubChem CID | 6327258 |
|---|---|
| CAS | 617-86-7 |
| Molecular Weight (g/mol) | 115.271 |
| MDL Number | MFCD00009018 |
| SMILES | CC[Si](CC)CC |
| Synonym | triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes |
| IUPAC Name | triethylsilicon |
| InChI Key | QXTIBZLKQPJVII-UHFFFAOYSA-N |
| Molecular Formula | C6H15Si |
Spectrum Chemical Manufacturing Corporation Antimony Trichloride TS, (U.S.P. Test Solution), Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 10025-91-9 Molecular Formula: Cl3Sb Molecular Weight (g/mol): 228.11 MDL Number: MFCD00011212 InChI Key: FAPDDOBMIUGHIN-UHFFFAOYSA-K IUPAC Name: antimony(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Sb+3]
| CAS | 10025-91-9 |
|---|---|
| Molecular Weight (g/mol) | 228.11 |
| MDL Number | MFCD00011212 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sb+3] |
| IUPAC Name | antimony(3+) trichloride |
| InChI Key | FAPDDOBMIUGHIN-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sb |
Boron tribromide, 99+%
CAS: 10294-33-4 Molecular Formula: BBr3 Molecular Weight (g/mol): 250.52 MDL Number: MFCD00011312 InChI Key: ILAHWRKJUDSMFH-UHFFFAOYSA-N Synonym: boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide PubChem CID: 25134 IUPAC Name: tribromoborane SMILES: BrB(Br)Br
| PubChem CID | 25134 |
|---|---|
| CAS | 10294-33-4 |
| Molecular Weight (g/mol) | 250.52 |
| MDL Number | MFCD00011312 |
| SMILES | BrB(Br)Br |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| IUPAC Name | tribromoborane |
| InChI Key | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Molecular Formula | BBr3 |
(3-Chloropropyl)trimethoxysilane, 97+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 2530-87-2 Molecular Formula: C6H15ClO3Si Molecular Weight (g/mol): 198.718 MDL Number: MFCD00000997 InChI Key: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonym: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan PubChem CID: 62449 IUPAC Name: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| PubChem CID | 62449 |
|---|---|
| CAS | 2530-87-2 |
| Molecular Weight (g/mol) | 198.718 |
| MDL Number | MFCD00000997 |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Synonym | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| IUPAC Name | 3-chloropropyl(trimethoxy)silane |
| InChI Key | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClO3Si |
tert-Butyldimethylchlorosilane, 97%
CAS: 18162-48-6 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.721 MDL Number: MFCD00000501 InChI Key: BCNZYOJHNLTNEZ-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride PubChem CID: 28928 ChEBI: CHEBI:85071 IUPAC Name: tert-butyl-chloro-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)Cl
| PubChem CID | 28928 |
|---|---|
| CAS | 18162-48-6 |
| Molecular Weight (g/mol) | 150.721 |
| ChEBI | CHEBI:85071 |
| MDL Number | MFCD00000501 |
| SMILES | CC(C)(C)[Si](C)(C)Cl |
| Synonym | tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride |
| IUPAC Name | tert-butyl-chloro-dimethylsilane |
| InChI Key | BCNZYOJHNLTNEZ-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
3-(Trimethylsilyl)propargyl alcohol, 98%
CAS: 5272-36-6 Molecular Formula: C6H12OSi Molecular Weight (g/mol): 128.25 MDL Number: MFCD00002913 InChI Key: ZVGCJDPEKKEYES-UHFFFAOYSA-N Synonym: 3-trimethylsilyl-2-propyn-1-ol,3-trimethylsilyl propargyl alcohol,2-propyn-1-ol, 3-trimethylsilyl,3-trimethylsilyl prop-2-yn-1-ol,1-trimethylsilylpropargyl alcohol,acmc-209l1b,3-trimethylsilylpropargyl alcohol,3-trimethylsilanyl-prop-2-yn-1-ol,3-trimethylsilyl-2-propyn-1-ol # PubChem CID: 78930 IUPAC Name: 3-trimethylsilylprop-2-yn-1-ol SMILES: C[Si](C)(C)C#CCO
| PubChem CID | 78930 |
|---|---|
| CAS | 5272-36-6 |
| Molecular Weight (g/mol) | 128.25 |
| MDL Number | MFCD00002913 |
| SMILES | C[Si](C)(C)C#CCO |
| Synonym | 3-trimethylsilyl-2-propyn-1-ol,3-trimethylsilyl propargyl alcohol,2-propyn-1-ol, 3-trimethylsilyl,3-trimethylsilyl prop-2-yn-1-ol,1-trimethylsilylpropargyl alcohol,acmc-209l1b,3-trimethylsilylpropargyl alcohol,3-trimethylsilanyl-prop-2-yn-1-ol,3-trimethylsilyl-2-propyn-1-ol # |
| IUPAC Name | 3-trimethylsilylprop-2-yn-1-ol |
| InChI Key | ZVGCJDPEKKEYES-UHFFFAOYSA-N |
| Molecular Formula | C6H12OSi |
1,4-Bis(methoxydimethylsilyl)benzene, 97%
CAS: 131182-68-8 Molecular Formula: C12H22O2Si2 Molecular Weight (g/mol): 254.476 MDL Number: MFCD09266162 InChI Key: VQECZZRUEDMVCU-UHFFFAOYSA-N Synonym: 1,4-bis methoxydimethylsilyl benzene,methoxy 4-methoxydimethylsilyl phenyl dimethylsilane,amtsi067,1,4-phenylenebis methoxydimethylsilane,p-bis dimethylmethoxysilyl benzene,1,4-phenylene bis methoxy dimethyl silane,methoxy-4-methoxy dimethyl silyl phenyl-dimethylsilane PubChem CID: 21900341 IUPAC Name: methoxy-[4-[methoxy(dimethyl)silyl]phenyl]-dimethylsilane SMILES: CO[Si](C)(C)C1=CC=C(C=C1)[Si](C)(C)OC
| PubChem CID | 21900341 |
|---|---|
| CAS | 131182-68-8 |
| Molecular Weight (g/mol) | 254.476 |
| MDL Number | MFCD09266162 |
| SMILES | CO[Si](C)(C)C1=CC=C(C=C1)[Si](C)(C)OC |
| Synonym | 1,4-bis methoxydimethylsilyl benzene,methoxy 4-methoxydimethylsilyl phenyl dimethylsilane,amtsi067,1,4-phenylenebis methoxydimethylsilane,p-bis dimethylmethoxysilyl benzene,1,4-phenylene bis methoxy dimethyl silane,methoxy-4-methoxy dimethyl silyl phenyl-dimethylsilane |
| IUPAC Name | methoxy-[4-[methoxy(dimethyl)silyl]phenyl]-dimethylsilane |
| InChI Key | VQECZZRUEDMVCU-UHFFFAOYSA-N |
| Molecular Formula | C12H22O2Si2 |
Silicon carbide, 99% (metals basis)
CAS: 409-21-2 Molecular Formula: CSi Molecular Weight (g/mol): 40.10 MDL Number: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 IUPAC Name: methanidylidynesilanylium SMILES: [C-]#[Si+]
| PubChem CID | 9863 |
|---|---|
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| MDL Number | MFCD00049531 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| IUPAC Name | methanidylidynesilanylium |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
| Molecular Formula | CSi |
Antimony(III) sulfide, 99.9% (metals basis)
CAS: 1345-04-6 Molecular Formula: S3Sb2 Molecular Weight (g/mol): 339.70 MDL Number: MFCD00011217 InChI Key: NVWBARWTDVQPJD-UHFFFAOYSA-N IUPAC Name: diantimony(3+) trisulfanediide SMILES: [S--].[S--].[S--].[Sb+3].[Sb+3]
| CAS | 1345-04-6 |
|---|---|
| Molecular Weight (g/mol) | 339.70 |
| MDL Number | MFCD00011217 |
| SMILES | [S--].[S--].[S--].[Sb+3].[Sb+3] |
| IUPAC Name | diantimony(3+) trisulfanediide |
| InChI Key | NVWBARWTDVQPJD-UHFFFAOYSA-N |
| Molecular Formula | S3Sb2 |
Tungsten wire, 0.075mm (0.003in) dia, 99.95% (metals basis)
CAS: 7440-33-7 Molecular Formula: W Molecular Weight (g/mol): 183.84 MDL Number: MFCD00011461 InChI Key: WFKWXMTUELFFGS-UHFFFAOYSA-N Synonym: wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder PubChem CID: 23964 ChEBI: CHEBI:27998 IUPAC Name: tungsten SMILES: [W]
| PubChem CID | 23964 |
|---|---|
| CAS | 7440-33-7 |
| Molecular Weight (g/mol) | 183.84 |
| ChEBI | CHEBI:27998 |
| MDL Number | MFCD00011461 |
| SMILES | [W] |
| Synonym | wolfram,ion,va,tungsten, elemental,wolframium,unii-v9306cxo6g,4+ ion,tungsten, soluble compounds,tungsten, insoluble compounds,powder |
| IUPAC Name | tungsten |
| InChI Key | WFKWXMTUELFFGS-UHFFFAOYSA-N |
| Molecular Formula | W |
Arsenic(III) sulfide, 99.9% (metals basis)
CAS: 1303-33-9 Molecular Formula: As2S3 Molecular Weight (g/mol): 246.02 MDL Number: MFCD00003435 InChI Key: CUGMJFZCCDSABL-UHFFFAOYSA-N IUPAC Name: diarsenic(3+) trisulfanediide SMILES: [S--].[S--].[S--].[As+3].[As+3]
| CAS | 1303-33-9 |
|---|---|
| Molecular Weight (g/mol) | 246.02 |
| MDL Number | MFCD00003435 |
| SMILES | [S--].[S--].[S--].[As+3].[As+3] |
| IUPAC Name | diarsenic(3+) trisulfanediide |
| InChI Key | CUGMJFZCCDSABL-UHFFFAOYSA-N |
| Molecular Formula | As2S3 |
(Triethylsilyl)acetylene, 97%
CAS: 1777-03-3 Molecular Formula: C8H16Si Molecular Weight (g/mol): 140.30 MDL Number: MFCD00075373 InChI Key: FWSPXZXVNVQHIF-UHFFFAOYSA-N Synonym: triethylsilyl acetylene,ethynyltriethylsilane,triethyl ethynyl silane,triethylsilylacetylene,silane, triethylethynyl,triethylsilyl acetylen,triethylsilyl-acetylene,triethyl-ethynyl-silane PubChem CID: 637947 IUPAC Name: triethyl(ethynyl)silane SMILES: CC[Si](CC)(CC)C#C
| PubChem CID | 637947 |
|---|---|
| CAS | 1777-03-3 |
| Molecular Weight (g/mol) | 140.30 |
| MDL Number | MFCD00075373 |
| SMILES | CC[Si](CC)(CC)C#C |
| Synonym | triethylsilyl acetylene,ethynyltriethylsilane,triethyl ethynyl silane,triethylsilylacetylene,silane, triethylethynyl,triethylsilyl acetylen,triethylsilyl-acetylene,triethyl-ethynyl-silane |
| IUPAC Name | triethyl(ethynyl)silane |
| InChI Key | FWSPXZXVNVQHIF-UHFFFAOYSA-N |
| Molecular Formula | C8H16Si |
Antimony(V) chloride, ultra dry, 99.999% (metals basis)
CAS: 7647-18-9 Molecular Formula: Cl5Sb Molecular Weight (g/mol): 299.02 MDL Number: MFCD00011213 InChI Key: VMPVEPPRYRXYNP-UHFFFAOYSA-I Synonym: antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german PubChem CID: 24294 IUPAC Name: antimony pentachloride SMILES: Cl[Sb](Cl)(Cl)(Cl)Cl
| PubChem CID | 24294 |
|---|---|
| CAS | 7647-18-9 |
| Molecular Weight (g/mol) | 299.02 |
| MDL Number | MFCD00011213 |
| SMILES | Cl[Sb](Cl)(Cl)(Cl)Cl |
| Synonym | antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german |
| IUPAC Name | antimony pentachloride |
| InChI Key | VMPVEPPRYRXYNP-UHFFFAOYSA-I |
| Molecular Formula | Cl5Sb |
Tellurium lump, typically 12mm (0.47 in.), 99.9999% (metals basis), Thermo Scientific Chemicals
CAS: 13494-80-9 Molecular Formula: Te Molecular Weight (g/mol): 127.60 MDL Number: MFCD00134062 InChI Key: PORWMNRCUJJQNO-UHFFFAOYSA-N Synonym: tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds PubChem CID: 6327182 ChEBI: CHEBI:30452 IUPAC Name: tellurium SMILES: [Te]
| PubChem CID | 6327182 |
|---|---|
| CAS | 13494-80-9 |
| Molecular Weight (g/mol) | 127.60 |
| ChEBI | CHEBI:30452 |
| MDL Number | MFCD00134062 |
| SMILES | [Te] |
| Synonym | tellurium, elemental,telloy,tellur,aurum paradoxum,element,tellur polish,metallum problematum,tellurium, metallic,unii-nqa0o090zj,and compounds |
| IUPAC Name | tellurium |
| InChI Key | PORWMNRCUJJQNO-UHFFFAOYSA-N |
| Molecular Formula | Te |