Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
1,3-Divinyltetramethyldisiloxane, 96%, cont. up to 4% 1-vinyl-3-ethyltetramethyldisiloxane
CAS: 2627-95-4 Molecular Formula: C8H18OSi2 Molecular Weight (g/mol): 186.40 MDL Number: MFCD00014933 InChI Key: BITPLIXHRASDQB-UHFFFAOYSA-N Synonym: 1,3-divinyltetramethyldisiloxane,1,1,3,3-tetramethyl-1,3-divinyldisiloxane,disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl,1,1'-divinyltetramethyldisiloxane,unii-sj4d71zqf4,bisvinyltetramethyldisiloxane,1,3-divinyl-1,1,3,3-tetramethyl disiloxane,sym-tetramethyldivinyldisiloxane,tetramethyl-1,3-divinyldisiloxane,1,3-diethenyl-1,1,3,3-tetramethyldisiloxane PubChem CID: 75819 IUPAC Name: ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane SMILES: C[Si](C)(O[Si](C)(C)C=C)C=C
| PubChem CID | 75819 |
|---|---|
| CAS | 2627-95-4 |
| Molecular Weight (g/mol) | 186.40 |
| MDL Number | MFCD00014933 |
| SMILES | C[Si](C)(O[Si](C)(C)C=C)C=C |
| Synonym | 1,3-divinyltetramethyldisiloxane,1,1,3,3-tetramethyl-1,3-divinyldisiloxane,disiloxane, 1,3-diethenyl-1,1,3,3-tetramethyl,1,1'-divinyltetramethyldisiloxane,unii-sj4d71zqf4,bisvinyltetramethyldisiloxane,1,3-divinyl-1,1,3,3-tetramethyl disiloxane,sym-tetramethyldivinyldisiloxane,tetramethyl-1,3-divinyldisiloxane,1,3-diethenyl-1,1,3,3-tetramethyldisiloxane |
| IUPAC Name | ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane |
| InChI Key | BITPLIXHRASDQB-UHFFFAOYSA-N |
| Molecular Formula | C8H18OSi2 |
| Name Note | 1.6mm (0.062 in.) thick |
|---|---|
| Form | Foil |
| Health Hazard 3 | P201-P202-P261-P272-P280g-P281-P302+P352-P308+P313-P333+P313-P363-P501c |
| MDL Number | MFCD00801098 |
| Health Hazard 2 | GHS H Statement H351-H317 Suspected of causing cancer. May cause an allergic skin reaction. |
| Health Hazard 1 | H317-H351 |
| Chemical Name or Material | Nickel Copper foil, Alloy 400 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Avg. Mol. Wt. or Mol. Wt. Range | Ni:Cu; 67:33 wt% |
Germanium pieces, 2cm (0.8in) and down, Puratronic™, 99.999% (metals basis)
CAS: 7440-56-4 Molecular Formula: Ge Molecular Weight (g/mol): 72.63 MDL Number: MFCD00085310 InChI Key: GNPVGFCGXDBREM-UHFFFAOYSA-N Synonym: element,germanio,germanium, metal powder,unii-00072j7xws,powder,germanium, chips trace metals basis,atom,copper metal,germanium, disks, 15mm, thickness 1.0mm, polycrystalline,germanium, powder PubChem CID: 6326954 ChEBI: CHEBI:30441 IUPAC Name: germanium SMILES: [Ge]
| PubChem CID | 6326954 |
|---|---|
| CAS | 7440-56-4 |
| Molecular Weight (g/mol) | 72.63 |
| ChEBI | CHEBI:30441 |
| MDL Number | MFCD00085310 |
| SMILES | [Ge] |
| Synonym | element,germanio,germanium, metal powder,unii-00072j7xws,powder,germanium, chips trace metals basis,atom,copper metal,germanium, disks, 15mm, thickness 1.0mm, polycrystalline,germanium, powder |
| IUPAC Name | germanium |
| InChI Key | GNPVGFCGXDBREM-UHFFFAOYSA-N |
| Molecular Formula | Ge |
| Boiling Point | 130.0°C to 135.0°C |
|---|---|
| Linear Formula | NaBH4 |
| Molecular Weight (g/mol) | 37.83 |
| Chemical Name or Material | Sodium borohydride |
| SMILES | [BH4-].[Na+] |
| Merck Index | 15,8727 |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Density | 1.4000g/mL |
| Name Note | VenPure™ solution, 12% aq. solution |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF SWALLOWED: Rinse mouth. Do NOT induce |
| MDL Number | MFCD00003518 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. May damage fertility. May damage the unborn child. May be corrosive to metals. |
| Solubility Information | Solubility in water: completely soluble |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | SBH,Sodium tetrahydroborate |
| IUPAC Name | sodium boranuide |
| Molecular Formula | BH4Na |
| EINECS Number | 241-004-4 |
| Formula Weight | 37.82 |
| Specific Gravity | 1.4 |
Neodymium(III) oxide, REacton™, 99.9% (REO)
CAS: 1313-97-9 Molecular Formula: Nd2O3 Molecular Weight (g/mol): 336.48 MDL Number: MFCD00011134 InChI Key: PLDDOISOJJCEMH-UHFFFAOYSA-N IUPAC Name: dineodymium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Nd+3].[Nd+3]
| CAS | 1313-97-9 |
|---|---|
| Molecular Weight (g/mol) | 336.48 |
| MDL Number | MFCD00011134 |
| SMILES | [O--].[O--].[O--].[Nd+3].[Nd+3] |
| IUPAC Name | dineodymium(3+) trioxidandiide |
| InChI Key | PLDDOISOJJCEMH-UHFFFAOYSA-N |
| Molecular Formula | Nd2O3 |
Niobium rod, 19mm (0.75in) dia, hard, 99.8% (metals basis)
CAS: 3-1-7440 Molecular Formula: Nb Molecular Weight (g/mol): 92.91 MDL Number: MFCD00011126 InChI Key: GUCVJGMIXFAOAE-UHFFFAOYSA-N Synonym: columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio PubChem CID: 23936 ChEBI: CHEBI:33344 IUPAC Name: niobium SMILES: [Nb]
| PubChem CID | 23936 |
|---|---|
| CAS | 3-1-7440 |
| Molecular Weight (g/mol) | 92.91 |
| ChEBI | CHEBI:33344 |
| MDL Number | MFCD00011126 |
| SMILES | [Nb] |
| Synonym | columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio |
| IUPAC Name | niobium |
| InChI Key | GUCVJGMIXFAOAE-UHFFFAOYSA-N |
| Molecular Formula | Nb |
Erbium(III) oxide, nanopowder, 99.5% (REO)
CAS: 12061-16-4 Molecular Formula: Er2O3 Molecular Weight (g/mol): 382.52 MDL Number: MFCD00010991 InChI Key: ZXGIFJXRQHZCGJ-UHFFFAOYSA-N Synonym: Erbia IUPAC Name: dierbium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Er+3].[Er+3]
| CAS | 12061-16-4 |
|---|---|
| Molecular Weight (g/mol) | 382.52 |
| MDL Number | MFCD00010991 |
| SMILES | [O--].[O--].[O--].[Er+3].[Er+3] |
| Synonym | Erbia |
| IUPAC Name | dierbium(3+) trioxidandiide |
| InChI Key | ZXGIFJXRQHZCGJ-UHFFFAOYSA-N |
| Molecular Formula | Er2O3 |
Lithium metagallate, 99%, Thermo Scientific™
CAS: 944251-30-3 Molecular Formula: GaH3LiO2 Molecular Weight (g/mol): 111.685 MDL Number: MFCD00210623 InChI Key: UDTVNJWXCWSWEL-UHFFFAOYSA-M Synonym: Lithium gallate(III); Gallium(III) lithium oxide PubChem CID: 131675736 IUPAC Name: lithium;gallium;hydroxide;hydrate SMILES: [Li+].O.[OH-].[Ga]
| PubChem CID | 131675736 |
|---|---|
| CAS | 944251-30-3 |
| Molecular Weight (g/mol) | 111.685 |
| MDL Number | MFCD00210623 |
| SMILES | [Li+].O.[OH-].[Ga] |
| Synonym | Lithium gallate(III); Gallium(III) lithium oxide |
| IUPAC Name | lithium;gallium;hydroxide;hydrate |
| InChI Key | UDTVNJWXCWSWEL-UHFFFAOYSA-M |
| Molecular Formula | GaH3LiO2 |
Zinc chromate
CAS: 13530-65-9 Molecular Formula: CrO4Zn Molecular Weight (g/mol): 181.37 MDL Number: MFCD00036281 InChI Key: NDKWCCLKSWNDBG-UHFFFAOYSA-N Synonym: zinc chromate,zinc chrome,zinc chromate c,zinc chromate o,zinc chromate t,zinc chromate z,zinc chromate am,zincro zto,basic zinc chromate,zinc chrome yellow PubChem CID: 26089 IUPAC Name: zinc;dioxido(dioxo)chromium SMILES: [Zn++].[O-][Cr]([O-])(=O)=O
| PubChem CID | 26089 |
|---|---|
| CAS | 13530-65-9 |
| Molecular Weight (g/mol) | 181.37 |
| MDL Number | MFCD00036281 |
| SMILES | [Zn++].[O-][Cr]([O-])(=O)=O |
| Synonym | zinc chromate,zinc chrome,zinc chromate c,zinc chromate o,zinc chromate t,zinc chromate z,zinc chromate am,zincro zto,basic zinc chromate,zinc chrome yellow |
| IUPAC Name | zinc;dioxido(dioxo)chromium |
| InChI Key | NDKWCCLKSWNDBG-UHFFFAOYSA-N |
| Molecular Formula | CrO4Zn |
Barium fluoride, Puratronic™, 99.99% (metals basis)
CAS: 7787-32-8 Molecular Formula: BaF2 Molecular Weight (g/mol): 175.32 MDL Number: MFCD00003450 InChI Key: OYLGJCQECKOTOL-UHFFFAOYSA-L Synonym: barium fluoride,baryum fluorure french,baryum fluorure,difluorobarium,barium fluoride, ultra dry,barium ii fluoride,barium fluoride, powder,nickelous sulfate; nickel ii sulfate,barium fluoride trace metals basis PubChem CID: 62670 SMILES: [F-].[F-].[Ba++]
| PubChem CID | 62670 |
|---|---|
| CAS | 7787-32-8 |
| Molecular Weight (g/mol) | 175.32 |
| MDL Number | MFCD00003450 |
| SMILES | [F-].[F-].[Ba++] |
| Synonym | barium fluoride,baryum fluorure french,baryum fluorure,difluorobarium,barium fluoride, ultra dry,barium ii fluoride,barium fluoride, powder,nickelous sulfate; nickel ii sulfate,barium fluoride trace metals basis |
| InChI Key | OYLGJCQECKOTOL-UHFFFAOYSA-L |
| Molecular Formula | BaF2 |
Lithium fluoride, Optical Grade, 99.5+%
CAS: 7789-24-4 Molecular Formula: FLi Molecular Weight (g/mol): 25.94 MDL Number: MFCD00011090 InChI Key: PQXKHYXIUOZZFA-UHFFFAOYSA-M Synonym: lithium fluoride,fluorolithium,lithium monofluoride,trilithium trifluoride,lithium fluoride li3f3,lithium fluorure,ntl 50,lithium fluoride 6lif,lithium fluoride 7lif PubChem CID: 224478 SMILES: [Li+].[F-]
| PubChem CID | 224478 |
|---|---|
| CAS | 7789-24-4 |
| Molecular Weight (g/mol) | 25.94 |
| MDL Number | MFCD00011090 |
| SMILES | [Li+].[F-] |
| Synonym | lithium fluoride,fluorolithium,lithium monofluoride,trilithium trifluoride,lithium fluoride li3f3,lithium fluorure,ntl 50,lithium fluoride 6lif,lithium fluoride 7lif |
| InChI Key | PQXKHYXIUOZZFA-UHFFFAOYSA-M |
| Molecular Formula | FLi |
Copper(II)-ethylenediamine complex, technical, 1M sol. in water, not for viscosity determination
CAS: 14552-35-3 Molecular Formula: C4H18CuN4O2 Molecular Weight (g/mol): 217.76
| CAS | 14552-35-3 |
|---|---|
| Molecular Weight (g/mol) | 217.76 |
| Molecular Formula | C4H18CuN4O2 |
Praseodymium(III) trifluoromethanesulfonate, 98%, Thermo Scientific Chemicals
CAS: 52093-27-3 Molecular Formula: C3F9O9PrS3 Molecular Weight (g/mol): 588.097 MDL Number: MFCD00192417 InChI Key: ROUBZIWQWFQCHU-UHFFFAOYSA-K Synonym: praseodymium iii trifluoromethanesulfonate,praseodymium iii triflate,praseodymium trifluoromethanesulfonate,praseodymium 3+ tritriflate,praseodymium iii trifluoromethane-sulfonate,praseodymium iii tris trifluoromethanesulfonate,praseodymium 3+ ion tritrifluoromethanesulfonate PubChem CID: 9894708 IUPAC Name: praseodymium(3+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Pr+3]
| PubChem CID | 9894708 |
|---|---|
| CAS | 52093-27-3 |
| Molecular Weight (g/mol) | 588.097 |
| MDL Number | MFCD00192417 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Pr+3] |
| Synonym | praseodymium iii trifluoromethanesulfonate,praseodymium iii triflate,praseodymium trifluoromethanesulfonate,praseodymium 3+ tritriflate,praseodymium iii trifluoromethane-sulfonate,praseodymium iii tris trifluoromethanesulfonate,praseodymium 3+ ion tritrifluoromethanesulfonate |
| IUPAC Name | praseodymium(3+);trifluoromethanesulfonate |
| InChI Key | ROUBZIWQWFQCHU-UHFFFAOYSA-K |
| Molecular Formula | C3F9O9PrS3 |
Lanthanum(III) trifluoromethanesulfonate, 99%
CAS: 52093-26-2 Molecular Formula: C3F9LaO9S3 Molecular Weight (g/mol): 586.1 MDL Number: MFCD00077560 InChI Key: WGJJZRVGLPOKQT-UHFFFAOYSA-K Synonym: lanthanum iii trifluoromethanesulfonate,lanthanum triflate,lanthanum trifluoromethanesulfonate,la otf 3,lanthanum iii triflate,lanthanum tris trifluoromethanesulfonate,lanthanum 3+ tritriflate,lanthanum 3+ ; trifluoromethanesulfonate,trifluoromethanesulfonic acid lanthanum salt,tris trifluoromethanesulfonato lanthanum PubChem CID: 2733938 IUPAC Name: lanthanum(3+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[La+3]
| PubChem CID | 2733938 |
|---|---|
| CAS | 52093-26-2 |
| Molecular Weight (g/mol) | 586.1 |
| MDL Number | MFCD00077560 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[La+3] |
| Synonym | lanthanum iii trifluoromethanesulfonate,lanthanum triflate,lanthanum trifluoromethanesulfonate,la otf 3,lanthanum iii triflate,lanthanum tris trifluoromethanesulfonate,lanthanum 3+ tritriflate,lanthanum 3+ ; trifluoromethanesulfonate,trifluoromethanesulfonic acid lanthanum salt,tris trifluoromethanesulfonato lanthanum |
| IUPAC Name | lanthanum(3+);trifluoromethanesulfonate |
| InChI Key | WGJJZRVGLPOKQT-UHFFFAOYSA-K |
| Molecular Formula | C3F9LaO9S3 |
Magnesium citrate, dibasic hydrate
CAS: 119851-23-9 Molecular Formula: C6H6MgO7 Molecular Weight (g/mol): 214.41 MDL Number: MFCD00151706 InChI Key: DIXGJWCZQHXZNR-UHFFFAOYNA-L Synonym: magnesium 2-carboxymethyl-2-hydroxysuccinate hydrate PubChem CID: 88316079 SMILES: [Mg++].OC(=O)CC(O)(CC([O-])=O)C([O-])=O
| PubChem CID | 88316079 |
|---|---|
| CAS | 119851-23-9 |
| Molecular Weight (g/mol) | 214.41 |
| MDL Number | MFCD00151706 |
| SMILES | [Mg++].OC(=O)CC(O)(CC([O-])=O)C([O-])=O |
| Synonym | magnesium 2-carboxymethyl-2-hydroxysuccinate hydrate |
| InChI Key | DIXGJWCZQHXZNR-UHFFFAOYNA-L |
| Molecular Formula | C6H6MgO7 |