Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Yttrium rod, 12.7mm (0.5in) dia, 99.9% (metals basis excluding Ta)
CAS: 7440-65-5 Molecular Formula: Y Molecular Weight (g/mol): 88.91 MDL Number: MFCD00011468 InChI Key: VWQVUPCCIRVNHF-UHFFFAOYSA-N Synonym: yttrium, elemental,yttrium-89,ion,ytrio,hydride,unii-58784xqc3y,yttrium, metal and compounds,ingot,foil,element PubChem CID: 23993 ChEBI: CHEBI:33331 IUPAC Name: yttrium SMILES: [Y]
| PubChem CID | 23993 |
|---|---|
| CAS | 7440-65-5 |
| Molecular Weight (g/mol) | 88.91 |
| ChEBI | CHEBI:33331 |
| MDL Number | MFCD00011468 |
| SMILES | [Y] |
| Synonym | yttrium, elemental,yttrium-89,ion,ytrio,hydride,unii-58784xqc3y,yttrium, metal and compounds,ingot,foil,element |
| IUPAC Name | yttrium |
| InChI Key | VWQVUPCCIRVNHF-UHFFFAOYSA-N |
| Molecular Formula | Y |
Titanium rod, 6.4mm (0.25in) dia, 99.99% (metals basis)
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
| Name Note | Both ends open |
|---|---|
| Chemical Name or Material | Al-23 Tube |
| TSCA | U |
| Recommended Storage | Ambient temperatures |
Apatite, naturally occurring mineral, grains, approximately 0.06-0.19in
CAS: 1306-05-4 Molecular Formula: Ca5FO12P3 Molecular Weight (g/mol): 504.298 MDL Number: MFCD00285511 InChI Key: VSIIXMUUUJUKCM-UHFFFAOYSA-D Synonym: fluorapatite,apatite,phosphate rock,unii-m4cm1h238j,phospate rock,fluorapatite ca5f po4 3 PubChem CID: 10207414 IUPAC Name: pentacalcium;fluoride;triphosphate SMILES: [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2]
| PubChem CID | 10207414 |
|---|---|
| CAS | 1306-05-4 |
| Molecular Weight (g/mol) | 504.298 |
| MDL Number | MFCD00285511 |
| SMILES | [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2] |
| Synonym | fluorapatite,apatite,phosphate rock,unii-m4cm1h238j,phospate rock,fluorapatite ca5f po4 3 |
| IUPAC Name | pentacalcium;fluoride;triphosphate |
| InChI Key | VSIIXMUUUJUKCM-UHFFFAOYSA-D |
| Molecular Formula | Ca5FO12P3 |
Strontium nitrate, Puratronic™, 99.9965% (metals basis)
CAS: 10042-76-9 Molecular Formula: N2O6Sr Molecular Weight (g/mol): 211.63 MDL Number: MFCD00011248 InChI Key: DHEQXMRUPNDRPG-UHFFFAOYSA-N Synonym: strontium nitrate,strontium dinitrate,nitric acid, strontium salt,strontium ii nitrate 1:2,unii-bdg873aqzl,nitrate de strontium french,hsdb 787,strontium nitrate sr no3 2,bdg873aqzl,nitric acid, strontium salt 2:1 PubChem CID: 24848 SMILES: [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24848 |
|---|---|
| CAS | 10042-76-9 |
| Molecular Weight (g/mol) | 211.63 |
| MDL Number | MFCD00011248 |
| SMILES | [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | strontium nitrate,strontium dinitrate,nitric acid, strontium salt,strontium ii nitrate 1:2,unii-bdg873aqzl,nitrate de strontium french,hsdb 787,strontium nitrate sr no3 2,bdg873aqzl,nitric acid, strontium salt 2:1 |
| InChI Key | DHEQXMRUPNDRPG-UHFFFAOYSA-N |
| Molecular Formula | N2O6Sr |
Vanadium(III) oxide, 99.7% (metals basis)
CAS: 1314-34-7 Molecular Formula: O3V2 Molecular Weight (g/mol): 149.88 MDL Number: MFCD00011455 InChI Key: KFAFTZQGYMGWLU-UHFFFAOYSA-N Synonym: vanadium iii oxide,divanadium trioxide,vanadium oxide v2o3,vanadium 3 oxide,oxo oxovanadio oxy vanadium,vanadium trioxide, nonfused form,vanadium trioxide, v2o3,vanadium iii oxide trace metals basis PubChem CID: 518710 IUPAC Name: oxo(oxovanadiooxy)vanadium SMILES: O=[V]O[V]=O
| PubChem CID | 518710 |
|---|---|
| CAS | 1314-34-7 |
| Molecular Weight (g/mol) | 149.88 |
| MDL Number | MFCD00011455 |
| SMILES | O=[V]O[V]=O |
| Synonym | vanadium iii oxide,divanadium trioxide,vanadium oxide v2o3,vanadium 3 oxide,oxo oxovanadio oxy vanadium,vanadium trioxide, nonfused form,vanadium trioxide, v2o3,vanadium iii oxide trace metals basis |
| IUPAC Name | oxo(oxovanadiooxy)vanadium |
| InChI Key | KFAFTZQGYMGWLU-UHFFFAOYSA-N |
| Molecular Formula | O3V2 |
Titanium(IV) oxide, 20-36% in H{2}O colloidal dispersion
CAS: 13463-67-7 Molecular Formula: O2Ti Molecular Weight (g/mol): 79.87 MDL Number: MFCD00011269 MFCD00210650 InChI Key: GWEVSGVZZGPLCZ-UHFFFAOYSA-N Synonym: titanium dioxide,titania,titanium iv oxide,rutile,anatase,brookite,titanium white,flamenco,hombitan,titafrance PubChem CID: 26042 ChEBI: CHEBI:32234 IUPAC Name: dioxotitanium SMILES: O=[Ti]=O
| PubChem CID | 26042 |
|---|---|
| CAS | 13463-67-7 |
| Molecular Weight (g/mol) | 79.87 |
| ChEBI | CHEBI:32234 |
| MDL Number | MFCD00011269 MFCD00210650 |
| SMILES | O=[Ti]=O |
| Synonym | titanium dioxide,titania,titanium iv oxide,rutile,anatase,brookite,titanium white,flamenco,hombitan,titafrance |
| IUPAC Name | dioxotitanium |
| InChI Key | GWEVSGVZZGPLCZ-UHFFFAOYSA-N |
| Molecular Formula | O2Ti |
Lithium sulfate hydrate, Puratronic™, 99.996% (metals basis)
CAS: 10377-48-7 Molecular Formula: Li2O4S Molecular Weight (g/mol): 109.94 MDL Number: MFCD00011086 InChI Key: INHCSSUBVCNVSK-UHFFFAOYSA-L Synonym: lithium sulfate,lithium sulphate,dilithium sulfate,sulfuric acid, dilithium salt,lithiophor,li2so4,dilthium sulfate,sulfuric acid, lithium salt 1:2,unii-919xa137jk,lithium sulfate, anhydrous PubChem CID: 66320 ChEBI: CHEBI:53474 SMILES: [Li+].[Li+].[O-]S([O-])(=O)=O
| PubChem CID | 66320 |
|---|---|
| CAS | 10377-48-7 |
| Molecular Weight (g/mol) | 109.94 |
| ChEBI | CHEBI:53474 |
| MDL Number | MFCD00011086 |
| SMILES | [Li+].[Li+].[O-]S([O-])(=O)=O |
| Synonym | lithium sulfate,lithium sulphate,dilithium sulfate,sulfuric acid, dilithium salt,lithiophor,li2so4,dilthium sulfate,sulfuric acid, lithium salt 1:2,unii-919xa137jk,lithium sulfate, anhydrous |
| InChI Key | INHCSSUBVCNVSK-UHFFFAOYSA-L |
| Molecular Formula | Li2O4S |
Yttrium(III) sulfide, 99.9% (REO)
CAS: 12039-19-9 Molecular Formula: S3Y2 Molecular Weight (g/mol): 273.99 MDL Number: MFCD00058806 InChI Key: BPMRLDMEAPSVQN-UHFFFAOYSA-N Synonym: yttrium sulfide,diyttrium trisulphide,yttrium iii sulfide,yttrium sulfide y2s3,yttrium 3+ trisulfide,diyttrium 3+ ion trisulfanediide,yttrium iii sulfide trace rare earth metals basis 1g PubChem CID: 166021 SMILES: [S--].[S--].[S--].[Y+3].[Y+3]
| PubChem CID | 166021 |
|---|---|
| CAS | 12039-19-9 |
| Molecular Weight (g/mol) | 273.99 |
| MDL Number | MFCD00058806 |
| SMILES | [S--].[S--].[S--].[Y+3].[Y+3] |
| Synonym | yttrium sulfide,diyttrium trisulphide,yttrium iii sulfide,yttrium sulfide y2s3,yttrium 3+ trisulfide,diyttrium 3+ ion trisulfanediide,yttrium iii sulfide trace rare earth metals basis 1g |
| InChI Key | BPMRLDMEAPSVQN-UHFFFAOYSA-N |
| Molecular Formula | S3Y2 |
Zirconium foil, 0.20mm (0.008in) thick, annealed, 99.8% (metals basis), Thermo Scientific Chemicals
CAS: 7440-67-7 Molecular Formula: Zr Molecular Weight (g/mol): 91.22 MDL Number: MFCD00011303 MFCD00148878 InChI Key: QCWXUUIWCKQGHC-UHFFFAOYSA-N Synonym: zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil PubChem CID: 23995 ChEBI: CHEBI:33342 IUPAC Name: zirconium SMILES: [Zr]
| PubChem CID | 23995 |
|---|---|
| CAS | 7440-67-7 |
| Molecular Weight (g/mol) | 91.22 |
| ChEBI | CHEBI:33342 |
| MDL Number | MFCD00011303 MFCD00148878 |
| SMILES | [Zr] |
| Synonym | zircat,powder,circonio,zirconium, elemental,zirconio,zirkonium,compounds,unii-c6v6s92n3c,and compounds,foil |
| IUPAC Name | zirconium |
| InChI Key | QCWXUUIWCKQGHC-UHFFFAOYSA-N |
| Molecular Formula | Zr |
Strontium Titanium Oxide Substrate, 5 x 5 x 1mm, Polished Two Sides, 110 Orientation, Thermo Scientific™
CAS: 12060-59-2 Molecular Formula: O3SrTi Molecular Weight (g/mol): 183.48 MDL Number: MFCD00049554 InChI Key: VEALVRVVWBQVSL-UHFFFAOYSA-N Synonym: strontium titanate,strontium titanium oxide,unii-olh4i98373,o3ti.sr,strontium titanium oxide srtio3,strontium titanium trioxide,titanate tio32-, strontium 1:1,strontium titanate 100g,strontium dioxido oxo titanium,strontium titanate, powder PubChem CID: 82899 IUPAC Name: strontium;dioxido(oxo)titanium SMILES: [Sr++].[O-][Ti]([O-])=O
| PubChem CID | 82899 |
|---|---|
| CAS | 12060-59-2 |
| Molecular Weight (g/mol) | 183.48 |
| MDL Number | MFCD00049554 |
| SMILES | [Sr++].[O-][Ti]([O-])=O |
| Synonym | strontium titanate,strontium titanium oxide,unii-olh4i98373,o3ti.sr,strontium titanium oxide srtio3,strontium titanium trioxide,titanate tio32-, strontium 1:1,strontium titanate 100g,strontium dioxido oxo titanium,strontium titanate, powder |
| IUPAC Name | strontium;dioxido(oxo)titanium |
| InChI Key | VEALVRVVWBQVSL-UHFFFAOYSA-N |
| Molecular Formula | O3SrTi |
Magnesium Sulfate, Reagent grade, Solstice
CAS: 7487-88-9 Molecular Formula: MgO4S Molecular Weight (g/mol): 120.36 MDL Number: MFCD00011110 InChI Key: CSNNHWWHGAXBCP-UHFFFAOYSA-L Synonym: magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot PubChem CID: 24083 ChEBI: CHEBI:32599 SMILES: [Mg++].[O-]S([O-])(=O)=O
| PubChem CID | 24083 |
|---|---|
| CAS | 7487-88-9 |
| Molecular Weight (g/mol) | 120.36 |
| ChEBI | CHEBI:32599 |
| MDL Number | MFCD00011110 |
| SMILES | [Mg++].[O-]S([O-])(=O)=O |
| Synonym | magnesium sulfate,magnesium sulphate,magnesium sulfate anhydrous,sulfuric acid magnesium salt 1:1,bitter salt,sal angalis,magnesium sulfate 1:1,mgso4,sal de sedlitz,tomix ot |
| InChI Key | CSNNHWWHGAXBCP-UHFFFAOYSA-L |
| Molecular Formula | MgO4S |
Cholic Acid Sodium Salt, ≥97% (dry basis), Ultrapure
CAS: 361-09-1 Molecular Formula: C24H39NaO5 Molecular Weight (g/mol): 430.561 MDL Number: MFCD00150749 InChI Key: NRHMKIHPTBHXPF-RLWQFIAZSA-M Synonym: sodium cholate,sodium 3,7,12-trihydroxycholan-24-oate,sodium cholate, reagent,ksc575s0b,3,7,12-trihydroxycholan-24-oic acid sodium salt PubChem CID: 57349315 IUPAC Name: sodium;(4 R)-4-[(8 R,9 S,10 S,13 R,14 S,17 R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1 H-cyclopenta[a]phenanthren-17-yl]pentanoate SMILES: CC(CCC(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.[Na+]
| PubChem CID | 57349315 |
|---|---|
| CAS | 361-09-1 |
| Molecular Weight (g/mol) | 430.561 |
| MDL Number | MFCD00150749 |
| SMILES | CC(CCC(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.[Na+] |
| Synonym | sodium cholate,sodium 3,7,12-trihydroxycholan-24-oate,sodium cholate, reagent,ksc575s0b,3,7,12-trihydroxycholan-24-oic acid sodium salt |
| IUPAC Name | sodium;(4 R)-4-[(8 R,9 S,10 S,13 R,14 S,17 R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1 H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| InChI Key | NRHMKIHPTBHXPF-RLWQFIAZSA-M |
| Molecular Formula | C24H39NaO5 |
| Form | Boat |
|---|---|
| Chemical Name or Material | Al-23 Boat |