Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Arsenic(III) selenide, 99.999% (metals basis)
CAS: 1303-36-2 Molecular Formula: As2Se3 Molecular Weight (g/mol): 386.76 MDL Number: MFCD00014166 InChI Key: WBFMCDAQUDITAS-UHFFFAOYSA-N Synonym: arsenic triselenide,diarsenic triselenide,arsenic selenide,arsenous selenide,arsenic sesquiselenide,unii-xws0w0gb8g,diarsenic triselenide asse3,arsenic iii selenide,xws0w0gb8g PubChem CID: 14772 IUPAC Name: [(selanylidenearsanyl)selanyl]arsaneselone SMILES: [Se]=[As][Se][As]=[Se]
| PubChem CID | 14772 |
|---|---|
| CAS | 1303-36-2 |
| Molecular Weight (g/mol) | 386.76 |
| MDL Number | MFCD00014166 |
| SMILES | [Se]=[As][Se][As]=[Se] |
| Synonym | arsenic triselenide,diarsenic triselenide,arsenic selenide,arsenous selenide,arsenic sesquiselenide,unii-xws0w0gb8g,diarsenic triselenide asse3,arsenic iii selenide,xws0w0gb8g |
| IUPAC Name | [(selanylidenearsanyl)selanyl]arsaneselone |
| InChI Key | WBFMCDAQUDITAS-UHFFFAOYSA-N |
| Molecular Formula | As2Se3 |
Phosphonitrilic chloride trimer, 98%
CAS: 940-71-6 Molecular Formula: Cl6N3P3 Molecular Weight (g/mol): 347.642 MDL Number: MFCD00006474 InChI Key: UBIJTWDKTYCPMQ-UHFFFAOYSA-N Synonym: phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer PubChem CID: 220225 IUPAC Name: 2,2,4,4,6,6-hexachloro-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene SMILES: N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl
| PubChem CID | 220225 |
|---|---|
| CAS | 940-71-6 |
| Molecular Weight (g/mol) | 347.642 |
| MDL Number | MFCD00006474 |
| SMILES | N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl |
| Synonym | phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer |
| IUPAC Name | 2,2,4,4,6,6-hexachloro-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene |
| InChI Key | UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
| Molecular Formula | Cl6N3P3 |
Potassium chloride solution, MilliporeSigma™
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| IUPAC Name | potassium chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Silver oxide, 99%+, MilliporeSigma™
CAS: 20667-12-3 Molecular Formula: Ag2O Molecular Weight (g/mol): 231.74 MDL Number: MFCD00003404 InChI Key: KHJDQHIZCZTCAE-UHFFFAOYSA-N IUPAC Name: (argentiooxy)silver SMILES: [Ag]O[Ag]
| CAS | 20667-12-3 |
|---|---|
| Molecular Weight (g/mol) | 231.74 |
| MDL Number | MFCD00003404 |
| SMILES | [Ag]O[Ag] |
| IUPAC Name | (argentiooxy)silver |
| InChI Key | KHJDQHIZCZTCAE-UHFFFAOYSA-N |
| Molecular Formula | Ag2O |
Nickel wire, 0.15mm (0.006in) dia, annealed, Nickel 200, approximately 99% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Silicon(II) oxide, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 10097-28-6 Molecular Formula: OSi Molecular Weight (g/mol): 44.084 MDL Number: MFCD00151536 InChI Key: LIVNPJMFVYWSIS-UHFFFAOYSA-N Synonym: silicon monoxide,silylene, oxo,silicon ii oxide,unii-1oqn9cbg7l,1oqn9cbg7l,silicon ii oxide, optical grade,sio,oxidosilicon,oxosilanylidene,oxosilylene PubChem CID: 66241 ChEBI: CHEBI:30588 IUPAC Name: oxoniumylidynesilanide SMILES: [O+]#[Si-]
| PubChem CID | 66241 |
|---|---|
| CAS | 10097-28-6 |
| Molecular Weight (g/mol) | 44.084 |
| ChEBI | CHEBI:30588 |
| MDL Number | MFCD00151536 |
| SMILES | [O+]#[Si-] |
| Synonym | silicon monoxide,silylene, oxo,silicon ii oxide,unii-1oqn9cbg7l,1oqn9cbg7l,silicon ii oxide, optical grade,sio,oxidosilicon,oxosilanylidene,oxosilylene |
| IUPAC Name | oxoniumylidynesilanide |
| InChI Key | LIVNPJMFVYWSIS-UHFFFAOYSA-N |
| Molecular Formula | OSi |
Silicon(II) oxide, 99.9% (metals basis)
CAS: 10097-28-6 Molecular Formula: OSi Molecular Weight (g/mol): 44.084 MDL Number: MFCD00151536 InChI Key: LIVNPJMFVYWSIS-UHFFFAOYSA-N Synonym: silicon monoxide,silylene, oxo,silicon ii oxide,unii-1oqn9cbg7l,1oqn9cbg7l,silicon ii oxide, optical grade,sio,oxidosilicon,oxosilanylidene,oxosilylene PubChem CID: 66241 ChEBI: CHEBI:30588 IUPAC Name: oxoniumylidynesilanide SMILES: [O+]#[Si-]
| PubChem CID | 66241 |
|---|---|
| CAS | 10097-28-6 |
| Molecular Weight (g/mol) | 44.084 |
| ChEBI | CHEBI:30588 |
| MDL Number | MFCD00151536 |
| SMILES | [O+]#[Si-] |
| Synonym | silicon monoxide,silylene, oxo,silicon ii oxide,unii-1oqn9cbg7l,1oqn9cbg7l,silicon ii oxide, optical grade,sio,oxidosilicon,oxosilanylidene,oxosilylene |
| IUPAC Name | oxoniumylidynesilanide |
| InChI Key | LIVNPJMFVYWSIS-UHFFFAOYSA-N |
| Molecular Formula | OSi |
Thermo Scientific™ Magnesium, Ion chromatography standard solution, Specpure™, Mg+++2 1000μg/ml
Molecular Formula: Mg(NO{3}){2} in H{2}O MDL Number: MFCD00066799
| MDL Number | MFCD00066799 |
|---|---|
| Molecular Formula | Mg(NO{3}){2} in H{2}O |
| Name Note | 0.81mm (0.032 in.) thick |
|---|---|
| Form | Foil |
| Health Hazard 3 | P201-P202-P260-P264b-P270-P272-P280g-P281-P302+P352-P308+P313-P333+P313-P363-P501c |
| MDL Number | MFCD00801098 |
| Health Hazard 2 | GHS H Statement H351-H317 Suspected of causing cancer. May cause an allergic skin reaction. |
| Health Hazard 1 | H317-H350-H372 |
| Chemical Name or Material | Nickel Copper foil, Alloy 400 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Avg. Mol. Wt. or Mol. Wt. Range | Ni:Cu; 67:33 wt% |
Silicon powder, crystalline, -100 mesh, 99.9% (metals basis)
CAS: 7440-21-3 Molecular Formula: Si Molecular Weight (g/mol): 28.09 MDL Number: MFCD00085311 InChI Key: XUIMIQQOPSSXEZ-UHFFFAOYSA-N Synonym: metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 PubChem CID: 5461123 ChEBI: CHEBI:27573 IUPAC Name: silicon SMILES: [Si]
| PubChem CID | 5461123 |
|---|---|
| CAS | 7440-21-3 |
| Molecular Weight (g/mol) | 28.09 |
| ChEBI | CHEBI:27573 |
| MDL Number | MFCD00085311 |
| SMILES | [Si] |
| Synonym | metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 |
| IUPAC Name | silicon |
| InChI Key | XUIMIQQOPSSXEZ-UHFFFAOYSA-N |
| Molecular Formula | Si |
Bismuth titanium oxide, 99.9% (metals basis)
CAS: 12233-34-0 Molecular Formula: Bi2O11Ti4 Molecular Weight (g/mol): 785.418 MDL Number: MFCD01310393 InChI Key: TZQKEPWGUIJJIY-UHFFFAOYSA-N Synonym: tetraoxo-2,4,6,8,10-pentaoxa-1,11-dibisma-3,5,7,9-tetratitanaundecane-1,11-dione PubChem CID: 56846076 IUPAC Name: oxo-oxobismuthanyloxy-[oxo-[oxo-(oxo(oxobismuthanyloxy)titanio)oxytitanio]oxytitanio]oxytitanium SMILES: O=[Ti](O[Ti](=O)O[Ti](=O)O[Bi]=O)O[Ti](=O)O[Bi]=O
| PubChem CID | 56846076 |
|---|---|
| CAS | 12233-34-0 |
| Molecular Weight (g/mol) | 785.418 |
| MDL Number | MFCD01310393 |
| SMILES | O=[Ti](O[Ti](=O)O[Ti](=O)O[Bi]=O)O[Ti](=O)O[Bi]=O |
| Synonym | tetraoxo-2,4,6,8,10-pentaoxa-1,11-dibisma-3,5,7,9-tetratitanaundecane-1,11-dione |
| IUPAC Name | oxo-oxobismuthanyloxy-[oxo-[oxo-(oxo(oxobismuthanyloxy)titanio)oxytitanio]oxytitanio]oxytitanium |
| InChI Key | TZQKEPWGUIJJIY-UHFFFAOYSA-N |
| Molecular Formula | Bi2O11Ti4 |
Potassium hexachlororuthenate(III), Premion™, 99.99% (metals basis), Ru 23% min
CAS: 25443-63-4 Molecular Formula: K3RuCl6 MDL Number: MFCD00011390 Synonym: ruthenium 6+ hexachloride,tripotassium hexachlororuthenate,ruthenium hexachloride,ruthenium chloride rucl6 , oc-6-11,ruthenate 3-, tripotassium, oc-6-11
| CAS | 25443-63-4 |
|---|---|
| MDL Number | MFCD00011390 |
| Synonym | ruthenium 6+ hexachloride,tripotassium hexachlororuthenate,ruthenium hexachloride,ruthenium chloride rucl6 , oc-6-11,ruthenate 3-, tripotassium, oc-6-11 |
| Molecular Formula | K3RuCl6 |
5-Trimethylsilyl-4-pentyn-1-ol, 97%
CAS: 13224-84-5 Molecular Formula: C8H16OSi Molecular Weight (g/mol): 156.3 MDL Number: MFCD00190229 InChI Key: LIHAMNSEAAPIRM-UHFFFAOYSA-N PubChem CID: 2760861 IUPAC Name: 5-trimethylsilylpent-4-yn-1-ol SMILES: C[Si](C)(C)C#CCCCO
| PubChem CID | 2760861 |
|---|---|
| CAS | 13224-84-5 |
| Molecular Weight (g/mol) | 156.3 |
| MDL Number | MFCD00190229 |
| SMILES | C[Si](C)(C)C#CCCCO |
| IUPAC Name | 5-trimethylsilylpent-4-yn-1-ol |
| InChI Key | LIHAMNSEAAPIRM-UHFFFAOYSA-N |
| Molecular Formula | C8H16OSi |
| Name Note | 0.81mm (0.032 in.) thick |
|---|---|
| Form | Foil |
| MDL Number | MFCD00171255 |
| Chemical Name or Material | Brass foil, Alloy 260 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Odor | Odorless |
Silver wire, 0.025mm (0.001in) dia, hard, 99.9% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |