Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Niobium sputtering target, 76.2mm (3.0 in.) dia. x 6.35mm (0.250 in.) thick, 99.95% (metals basis excluding Ta), Thermo Scientific™
CAS: 3-1-7440 Molecular Formula: Nb Molecular Weight (g/mol): 92.91 MDL Number: MFCD00011126 InChI Key: GUCVJGMIXFAOAE-UHFFFAOYSA-N Synonym: columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio PubChem CID: 23936 ChEBI: CHEBI:33344 IUPAC Name: niobium SMILES: [Nb]
| PubChem CID | 23936 |
|---|---|
| CAS | 3-1-7440 |
| Molecular Weight (g/mol) | 92.91 |
| ChEBI | CHEBI:33344 |
| MDL Number | MFCD00011126 |
| SMILES | [Nb] |
| Synonym | columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio |
| IUPAC Name | niobium |
| InChI Key | GUCVJGMIXFAOAE-UHFFFAOYSA-N |
| Molecular Formula | Nb |
Tin foil, 2.0mm (0.08in) thick, Puratronic™, 99.9985% (metals basis)
CAS: 7440-31-5 Molecular Formula: Sn Molecular Weight (g/mol): 118.71 MDL Number: MFCD00133862 InChI Key: ATJFFYVFTNAWJD-UHFFFAOYSA-N Synonym: powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german PubChem CID: 5352426 ChEBI: CHEBI:32990 IUPAC Name: tin SMILES: [Sn]
| PubChem CID | 5352426 |
|---|---|
| CAS | 7440-31-5 |
| Molecular Weight (g/mol) | 118.71 |
| ChEBI | CHEBI:32990 |
| MDL Number | MFCD00133862 |
| SMILES | [Sn] |
| Synonym | powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german |
| IUPAC Name | tin |
| InChI Key | ATJFFYVFTNAWJD-UHFFFAOYSA-N |
| Molecular Formula | Sn |
Neodymium ingot, 99.1% (metals basis)
CAS: 7440-00-8 Molecular Formula: Nd Molecular Weight (g/mol): 144.24 MDL Number: MFCD00011130 InChI Key: QEFYFXOXNSNQGX-UHFFFAOYSA-N Synonym: neodimio,neodyme,neodym,trihydride,ingot reo,neodymium, ion nd5+,atom,ingot,iii,foil, 3n PubChem CID: 23934 ChEBI: CHEBI:33372 IUPAC Name: neodymium SMILES: [Nd]
| PubChem CID | 23934 |
|---|---|
| CAS | 7440-00-8 |
| Molecular Weight (g/mol) | 144.24 |
| ChEBI | CHEBI:33372 |
| MDL Number | MFCD00011130 |
| SMILES | [Nd] |
| Synonym | neodimio,neodyme,neodym,trihydride,ingot reo,neodymium, ion nd5+,atom,ingot,iii,foil, 3n |
| IUPAC Name | neodymium |
| InChI Key | QEFYFXOXNSNQGX-UHFFFAOYSA-N |
| Molecular Formula | Nd |
Niobium foil, 0.3mm (0.01in) thick, annealed, 99.8% (metals basis)
CAS: 3-1-7440 Molecular Formula: Nb Molecular Weight (g/mol): 92.91 MDL Number: MFCD00011126 InChI Key: GUCVJGMIXFAOAE-UHFFFAOYSA-N Synonym: columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio PubChem CID: 23936 ChEBI: CHEBI:33344 IUPAC Name: niobium SMILES: [Nb]
| PubChem CID | 23936 |
|---|---|
| CAS | 3-1-7440 |
| Molecular Weight (g/mol) | 92.91 |
| ChEBI | CHEBI:33344 |
| MDL Number | MFCD00011126 |
| SMILES | [Nb] |
| Synonym | columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio |
| IUPAC Name | niobium |
| InChI Key | GUCVJGMIXFAOAE-UHFFFAOYSA-N |
| Molecular Formula | Nb |
Propidium Iodide, 99%, For HPLC analysis, MP Biomedicals™
CAS: 25535-16-4 Molecular Formula: C27H34I2N4 Molecular Weight (g/mol): 668.406 InChI Key: XJMOSONTPMZWPB-UHFFFAOYSA-M Synonym: propidium iodide,propidium diiodide,3,8-diamino-5-3-diethyl methyl ammonio propyl-6-phenylphenanthridin-5-ium iodide,unii-tp416o228t,3,8-diamino-5-3-diethylmethylammonio propyl-6-phenylphenanthridinium diiodide,3,8-diamino-5-3-diethylaminopropyl-6-phenylphenanthridinium iodide methiodide,phenanthridinium, 3,8-diamino-5-3-diethylmethylammonio propyl-6-phenyl-, diiodide PubChem CID: 104981 ChEBI: CHEBI:51240 IUPAC Name: 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-diethyl-methylazanium;diiodide SMILES: CC[N+](C)(CC)CCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-].[I-]
| PubChem CID | 104981 |
|---|---|
| CAS | 25535-16-4 |
| Molecular Weight (g/mol) | 668.406 |
| ChEBI | CHEBI:51240 |
| SMILES | CC[N+](C)(CC)CCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-].[I-] |
| Synonym | propidium iodide,propidium diiodide,3,8-diamino-5-3-diethyl methyl ammonio propyl-6-phenylphenanthridin-5-ium iodide,unii-tp416o228t,3,8-diamino-5-3-diethylmethylammonio propyl-6-phenylphenanthridinium diiodide,3,8-diamino-5-3-diethylaminopropyl-6-phenylphenanthridinium iodide methiodide,phenanthridinium, 3,8-diamino-5-3-diethylmethylammonio propyl-6-phenyl-, diiodide |
| IUPAC Name | 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-diethyl-methylazanium;diiodide |
| InChI Key | XJMOSONTPMZWPB-UHFFFAOYSA-M |
| Molecular Formula | C27H34I2N4 |
Hydrogen tetrachloroaurate hydrate, 99.999%, (trace metal basis)
CAS: 27988-77-8 Molecular Formula: AuCl4H Molecular Weight (g/mol): 339.77 MDL Number: MFCD00149903 InChI Key: RFWCEGCWRSNAGT-UHFFFAOYSA-K Synonym: chloroauric acid hydrate,Gold trichloride acid hydrate IUPAC Name: hydrogen tetrachlorogoldtris(ylium) SMILES: [H+].Cl[Au+3](Cl)(Cl)Cl
| CAS | 27988-77-8 |
|---|---|
| Molecular Weight (g/mol) | 339.77 |
| MDL Number | MFCD00149903 |
| SMILES | [H+].Cl[Au+3](Cl)(Cl)Cl |
| Synonym | chloroauric acid hydrate,Gold trichloride acid hydrate |
| IUPAC Name | hydrogen tetrachlorogoldtris(ylium) |
| InChI Key | RFWCEGCWRSNAGT-UHFFFAOYSA-K |
| Molecular Formula | AuCl4H |
2-Naphthoyl chloride, 98%
CAS: 2243-83-6 Molecular Formula: C11H7ClO Molecular Weight (g/mol): 190.63 MDL Number: MFCD00004093 InChI Key: XNLBCXGRQWUJLU-UHFFFAOYSA-N Synonym: 2-naphthoyl chloride,2-naphthalenecarbonyl chloride,2-naphthoic chloride,2-naphthoylchloride,beta-naphthoyl chloride,2-napthoyl chloride,2-chlorocarbonyl naphthalene,.beta.-naphthoyl chloride,.beta.-naphthalenecarbonyl chloride,beta-naphthalenecarbonyl chloride PubChem CID: 75246 IUPAC Name: naphthalene-2-carbonyl chloride SMILES: C1=CC=C2C=C(C=CC2=C1)C(=O)Cl
| PubChem CID | 75246 |
|---|---|
| CAS | 2243-83-6 |
| Molecular Weight (g/mol) | 190.63 |
| MDL Number | MFCD00004093 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)Cl |
| Synonym | 2-naphthoyl chloride,2-naphthalenecarbonyl chloride,2-naphthoic chloride,2-naphthoylchloride,beta-naphthoyl chloride,2-napthoyl chloride,2-chlorocarbonyl naphthalene,.beta.-naphthoyl chloride,.beta.-naphthalenecarbonyl chloride,beta-naphthalenecarbonyl chloride |
| IUPAC Name | naphthalene-2-carbonyl chloride |
| InChI Key | XNLBCXGRQWUJLU-UHFFFAOYSA-N |
| Molecular Formula | C11H7ClO |
Thulium(III) bromide, ultra dry, 99.99% (REO)
CAS: 14456-51-0 Molecular Formula: Br3Tm Molecular Weight (g/mol): 408.646 MDL Number: MFCD00050138 InChI Key: HQSWGSFQSCMHFQ-UHFFFAOYSA-K Synonym: thulium bromide,thulium tribromide,thulium iii bromide,thulium 3+ tribromide,acmc-1bo43,thulium iii bromide, anhydrous, ampuled under argon trace metals basis 1g PubChem CID: 84454 IUPAC Name: thulium(3+);tribromide SMILES: [Br-].[Br-].[Br-].[Tm+3]
| PubChem CID | 84454 |
|---|---|
| CAS | 14456-51-0 |
| Molecular Weight (g/mol) | 408.646 |
| MDL Number | MFCD00050138 |
| SMILES | [Br-].[Br-].[Br-].[Tm+3] |
| Synonym | thulium bromide,thulium tribromide,thulium iii bromide,thulium 3+ tribromide,acmc-1bo43,thulium iii bromide, anhydrous, ampuled under argon trace metals basis 1g |
| IUPAC Name | thulium(3+);tribromide |
| InChI Key | HQSWGSFQSCMHFQ-UHFFFAOYSA-K |
| Molecular Formula | Br3Tm |
| Linear Formula | ICl |
|---|---|
| Molecular Weight (g/mol) | 162.35 |
| InChI Key | QZRGKCOWNLSUDK-UHFFFAOYSA-N |
| Density | 1.4200g/mL |
| PubChem CID | 24640 |
| Name Note | 1, 0M solution in dichloromethane |
| Fieser | 01,502; 08,261; 10,212; 11,268 |
| Formula Weight | 162.35 |
| Color | Brown to Orange |
| Physical Form | Solution |
| Chemical Name or Material | Iodine monochloride |
| SMILES | ClI |
| Merck Index | 15, 5060 |
| Concentration or Composition (by Analyte or Components) | 0.95 to 1.05M |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Rinse mouth. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. R |
| MDL Number | MFCD00011354 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer. Fatal if swallowed. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: insoluble |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french |
| IUPAC Name | iodochlorane |
| Molecular Formula | ClI |
| EINECS Number | 232-236-7 |
| Specific Gravity | 1.42 |
| Linear Formula | HCl |
|---|---|
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Density | 0.9090g/mL |
| PubChem CID | 313 |
| Fieser | 04,450; 05,533; 06,283 |
| Formula Weight | 36.45 |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Hydrochloric acid |
| Grade | Pure |
| SMILES | Cl |
| Merck Index | 15,4831 |
| Concentration or Composition (by Analyte or Components) | 5N min. |
| CAS | 67-63-0 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF IN EYES: Rinse cautiously with water for several minu |
| MDL Number | MFCD00011324 MFCD00792839 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Harmful if inhaled. Highly flammable liquid and vapor. |
| Solubility Information | Solubility in water: >1000g/L (20°C). Other solubilities: soluble in methanol, ethanol, 2-propanol: >50g/L |
| Flash Point | 11°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| Molecular Formula | ClH |
| EINECS Number | 231-595-7 |
| Specific Gravity | 0.909 |
Iodine, 0.0282N Volumetric Solution APHA), Standard, Macron Fine Chemicals™
CAS: 7553-56-2 Molecular Formula: I2 Molecular Weight (g/mol): 253.81 MDL Number: MFCD00011355 MFCD00164163 InChI Key: PNDPGZBMCMUPRI-UHFFFAOYSA-N Synonym: iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode PubChem CID: 807 ChEBI: CHEBI:17606 IUPAC Name: diiodine SMILES: II
| PubChem CID | 807 |
|---|---|
| CAS | 7553-56-2 |
| Molecular Weight (g/mol) | 253.81 |
| ChEBI | CHEBI:17606 |
| MDL Number | MFCD00011355 MFCD00164163 |
| SMILES | II |
| Synonym | iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode |
| IUPAC Name | diiodine |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molecular Formula | I2 |
Hafnium foil, 1.0mm (0.04in) thick, annealed, 99.5% (metals basis excluding Zr), Zr nominal 3%, Thermo Scientific Chemicals
CAS: 7440-58-6 Molecular Formula: Hf Molecular Weight (g/mol): 178.49 MDL Number: MFCD00011032 InChI Key: VBJZVLUMGGDVMO-UHFFFAOYSA-N Synonym: hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire PubChem CID: 23986 ChEBI: CHEBI:33343 IUPAC Name: hafnium SMILES: [Hf]
| PubChem CID | 23986 |
|---|---|
| CAS | 7440-58-6 |
| Molecular Weight (g/mol) | 178.49 |
| ChEBI | CHEBI:33343 |
| MDL Number | MFCD00011032 |
| SMILES | [Hf] |
| Synonym | hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire |
| IUPAC Name | hafnium |
| InChI Key | VBJZVLUMGGDVMO-UHFFFAOYSA-N |
| Molecular Formula | Hf |
Hafnium wire, 0.25mm (0.01 in.) dia., 99.97% (metals basis excluding Zr), Zr nominal 3%, Thermo Scientific Chemicals
CAS: 7440-58-6 Molecular Formula: Hf Molecular Weight (g/mol): 178.49 MDL Number: MFCD00011032 InChI Key: VBJZVLUMGGDVMO-UHFFFAOYSA-N Synonym: hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire PubChem CID: 23986 ChEBI: CHEBI:33343 IUPAC Name: hafnium SMILES: [Hf]
| PubChem CID | 23986 |
|---|---|
| CAS | 7440-58-6 |
| Molecular Weight (g/mol) | 178.49 |
| ChEBI | CHEBI:33343 |
| MDL Number | MFCD00011032 |
| SMILES | [Hf] |
| Synonym | hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire |
| IUPAC Name | hafnium |
| InChI Key | VBJZVLUMGGDVMO-UHFFFAOYSA-N |
| Molecular Formula | Hf |
Tin rod, 13mm (0.51in) dia, Puratronic™, 99.998+% (metals basis)
CAS: 7440-31-5 Molecular Formula: Sn Molecular Weight (g/mol): 118.71 MDL Number: MFCD00133862 InChI Key: ATJFFYVFTNAWJD-UHFFFAOYSA-N Synonym: powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german PubChem CID: 5352426 ChEBI: CHEBI:32990 IUPAC Name: tin SMILES: [Sn]
| PubChem CID | 5352426 |
|---|---|
| CAS | 7440-31-5 |
| Molecular Weight (g/mol) | 118.71 |
| ChEBI | CHEBI:32990 |
| MDL Number | MFCD00133862 |
| SMILES | [Sn] |
| Synonym | powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german |
| IUPAC Name | tin |
| InChI Key | ATJFFYVFTNAWJD-UHFFFAOYSA-N |
| Molecular Formula | Sn |
Hafnium wire, 1.57mm (0.0618in) dia, 99.7% (metals basis excluding Zr), Zr nominal 3%, Thermo Scientific Chemicals
CAS: 7440-58-6 Molecular Formula: Hf Molecular Weight (g/mol): 178.49 MDL Number: MFCD00011032 InChI Key: VBJZVLUMGGDVMO-UHFFFAOYSA-N Synonym: hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire PubChem CID: 23986 ChEBI: CHEBI:33343 IUPAC Name: hafnium SMILES: [Hf]
| PubChem CID | 23986 |
|---|---|
| CAS | 7440-58-6 |
| Molecular Weight (g/mol) | 178.49 |
| ChEBI | CHEBI:33343 |
| MDL Number | MFCD00011032 |
| SMILES | [Hf] |
| Synonym | hafnium, elemental,hafnio,celtium,unii-x71938l1do,and compounds,hsdb 552,powder,foil,atom,wire |
| IUPAC Name | hafnium |
| InChI Key | VBJZVLUMGGDVMO-UHFFFAOYSA-N |
| Molecular Formula | Hf |